diff --git a/.gitignore b/.gitignore
index f303af4f..e6467404 100644
--- a/.gitignore
+++ b/.gitignore
@@ -3,6 +3,8 @@ __pycache__/
*.py[cod]
*$py.class
+*.pymon
+
tmp/
# C extensions
diff --git a/CI/functional_tests/test_molten_salts.py b/CI/functional_tests/test_molten_salts.py
new file mode 100644
index 00000000..6e37a99f
--- /dev/null
+++ b/CI/functional_tests/test_molten_salts.py
@@ -0,0 +1,107 @@
+"""
+MDSuite: A Zincwarecode package.
+
+License
+-------
+This program and the accompanying materials are made available under the terms
+of the Eclipse Public License v2.0 which accompanies this distribution, and is
+available at https://www.eclipse.org/legal/epl-v20.html
+
+SPDX-License-Identifier: EPL-2.0
+
+Copyright Contributors to the Zincwarecode Project.
+
+Contact Information
+-------------------
+email: zincwarecode@gmail.com
+github: https://github.com/zincware
+web: https://zincwarecode.com/
+
+Citation
+--------
+If you use this module please cite us with:
+
+Summary
+-------
+Perform a functional test on two molten salts.
+"""
+from typing import Tuple
+
+import pytest
+from zinchub import DataHub
+
+import mdsuite as mds
+
+
+@pytest.fixture(scope="session")
+def traj_files(tmp_path_factory) -> Tuple[str, str]:
+ """Download trajectory file into a temporary directory and keep it for all tests"""
+ temporary_path = tmp_path_factory.getbasetemp()
+
+ NaCl_file = DataHub(url="https://github.com/zincware/DataHub/tree/main/NaCl_rnd_md")
+ NaCl_file.get_file(temporary_path)
+ NaCl_out = (temporary_path / NaCl_file.file_raw).as_posix()
+
+ KCl_file = DataHub(url="https://github.com/zincware/DataHub/tree/main/KCl_rnd_md")
+ KCl_file.get_file(temporary_path)
+ KCl_out = (temporary_path / KCl_file.get_file(temporary_path)).as_posix()
+
+ return NaCl_out, KCl_out
+
+
+@pytest.fixture()
+def mdsuite_project(traj_files, tmp_path) -> mds.Project:
+ """
+ Create the MDSuite project and add data to be used for the rest of the tests.
+
+ Parameters
+ ----------
+ traj_files : tuple
+ Files include:
+ * NaCl Simulation
+ * KCl Simulation
+ tmp_path : Path
+ Temporary path that may be changed into.
+
+ Returns
+ -------
+ project: mdsuite.Project
+ An MDSuite project to be tested.
+ """
+ project = mds.Project(storage_path=tmp_path.as_posix())
+
+ na_cl_file, k_cl_file = traj_files
+
+ project.add_experiment(
+ name="NaCl",
+ timestep=0.002,
+ temperature=1200.0,
+ units="metal",
+ simulation_data=na_cl_file,
+ )
+ project.add_experiment(
+ name="KCl",
+ timestep=0.002,
+ temperature=1200.0,
+ units="metal",
+ simulation_data=k_cl_file,
+ )
+
+ return project
+
+
+def test_analysis():
+ """
+ Perform analysis on these MD simulations and ensure the outcomes are as expected.
+
+ Returns
+ -------
+ Test the following:
+
+ * Two experiments added to a project successfully
+
+ Notes
+ -----
+ TODO: Add correct tests when all post-RDF calculators are fixed.
+ """
+ pass
diff --git a/CI/functional_tests/test_water_study.py b/CI/functional_tests/test_water_study.py
new file mode 100644
index 00000000..3b2bb12a
--- /dev/null
+++ b/CI/functional_tests/test_water_study.py
@@ -0,0 +1,159 @@
+"""
+MDSuite: A Zincwarecode package.
+
+License
+-------
+This program and the accompanying materials are made available under the terms
+of the Eclipse Public License v2.0 which accompanies this distribution, and is
+available at https://www.eclipse.org/legal/epl-v20.html
+
+SPDX-License-Identifier: EPL-2.0
+
+Copyright Contributors to the Zincwarecode Project.
+
+Contact Information
+-------------------
+email: zincwarecode@gmail.com
+github: https://github.com/zincware
+web: https://zincwarecode.com/
+
+Citation
+--------
+If you use this module please cite us with:
+
+Summary
+-------
+Functional test for the analysis of a GROMACS water simulation.
+"""
+from typing import List
+
+import pytest
+from zinchub import DataHub
+
+import mdsuite as mds
+import mdsuite.file_io.chemfiles_read
+from mdsuite.utils import Units
+
+
+@pytest.fixture(scope="session")
+def traj_files(tmp_path_factory) -> List[str]:
+ """Download trajectory file into a temporary directory and keep it for all tests"""
+ temporary_path = tmp_path_factory.getbasetemp()
+
+ water = DataHub(url="https://github.com/zincware/DataHub/tree/main/Water_14_Gromacs")
+ water.get_file(temporary_path)
+ file_paths = [(temporary_path / f).as_posix() for f in water.file_raw]
+ return file_paths
+
+
+@pytest.fixture()
+def mdsuite_project(traj_files, tmp_path) -> mdsuite.Project:
+ """
+ Create the MDSuite project and add data to be used for the rest of the tests.
+
+ Parameters
+ ----------
+ traj_files : list
+ Files include:
+ * Water Simulation
+ tmp_path : Path
+ Temporary path that may be changed into.
+
+ Returns
+ -------
+ project: mdsuite.Project
+ An MDSuite project to be tested.
+ """
+ gmx_units = Units(
+ time=1e-15,
+ length=1e-10,
+ energy=1.6022e-19,
+ NkTV2p=1.6021765e6,
+ boltzmann=8.617343e-5,
+ temperature=1,
+ pressure=100000,
+ )
+ project = mds.Project(storage_path=tmp_path.as_posix())
+
+ file_reader = mdsuite.file_io.chemfiles_read.ChemfilesRead(
+ traj_file_path=traj_files[2], topol_file_path=traj_files[0]
+ )
+
+ project.add_experiment(
+ name="water_sim",
+ timestep=0.002,
+ temperature=300.0,
+ units=gmx_units,
+ simulation_data=file_reader,
+ )
+ project.run.CoordinateUnwrapper()
+ return project
+
+
+def test_water_analysis(mdsuite_project):
+ """
+ Run a functional test by performing a study on an MD simulation of water
+
+ Notes
+ -----
+ The diffusion, angle, and eventually coordination data tested here are comparable
+ with values taken from experiment and published studies.
+ """
+
+ water = mdsuite_project.experiments["water_sim"]
+
+ water_molecule = mds.Molecule(
+ name="water", smiles="[H]O[H]", amount=14, cutoff=1.7, mol_pbc=True
+ )
+
+ water.run.MolecularMap(molecules=[water_molecule])
+ atomistic_adf = mdsuite_project.run.AngularDistributionFunction(plot=False)
+ mdsuite_project.run.RadialDistributionFunction(plot=False)
+ molecule_adf = mdsuite_project.run.AngularDistributionFunction(
+ plot=False, molecules=True, norm_power=8
+ )
+ mdsuite_project.run.RadialDistributionFunction(plot=False, molecules=True)
+ atomistic_diffusion = mdsuite_project.run.EinsteinDiffusionCoefficients(
+ plot=False, data_range=500
+ )
+ molecular_diffusion = mdsuite_project.run.EinsteinDiffusionCoefficients(
+ plot=False, molecules=True, data_range=500
+ )
+
+ water_group = water.molecules["water"]["groups"]["0"]
+ atom_group_adf = mdsuite_project.run.AngularDistributionFunction(
+ atom_selection=water_group, number_of_configurations=100, plot=False
+ )
+ atom_group_diffusion = mdsuite_project.run.EinsteinDiffusionCoefficients(
+ atom_selection=water_group, data_range=2500, plot=False
+ )
+
+ # Test ADF output
+ assert atomistic_adf["water_sim"].data_dict["O_H_H"]["max_peak"] == pytest.approx(
+ 109.5, rel=0.1
+ )
+ assert molecule_adf["water_sim"].data_dict["water_water_water"][
+ "max_peak"
+ ] == pytest.approx(104.8, rel=0.1)
+
+ # Test diffusion data
+ assert atomistic_diffusion["water_sim"].data_dict["O"][
+ "diffusion_coefficient"
+ ] == pytest.approx(4.1e-3, rel=0.01)
+ assert atomistic_diffusion["water_sim"].data_dict["H"][
+ "diffusion_coefficient"
+ ] == pytest.approx(5.05e-3, rel=0.01)
+ assert molecular_diffusion["water_sim"].data_dict["water"][
+ "diffusion_coefficient"
+ ] == pytest.approx(4.3e-3, rel=0.01)
+
+ # Test group selected data
+ assert atom_group_adf["water_sim"].data_dict["O_H_H"]["max_peak"] == pytest.approx(
+ 109.5, 0.1
+ )
+ assert atom_group_diffusion["water_sim"].data_dict["O"][
+ "diffusion_coefficient"
+ ] == pytest.approx(2.9e-4, rel=0.1)
+ assert atom_group_diffusion["water_sim"].data_dict["H"][
+ "diffusion_coefficient"
+ ] == pytest.approx(3.0e-4, rel=0.1)
diff --git a/CI/integration_tests/calculators/test_angular_distribution_function.py b/CI/integration_tests/calculators/test_angular_distribution_function.py
index e273b117..c065f6c9 100644
--- a/CI/integration_tests/calculators/test_angular_distribution_function.py
+++ b/CI/integration_tests/calculators/test_angular_distribution_function.py
@@ -61,4 +61,7 @@ def test_project(traj_file, true_values, tmp_path):
computation = project.run.AngularDistributionFunction(plot=False)
+ for item in computation["NaCl"].data_dict:
+ computation["NaCl"].data_dict[item].pop("max_peak")
+
assertDeepAlmostEqual(computation["NaCl"].data_dict, true_values, decimal=1)
diff --git a/CI/integration_tests/calculators/test_einstein_helfand_ionic_conductivity.py b/CI/integration_tests/calculators/test_einstein_helfand_ionic_conductivity.py
index c5c32994..88f1e5c5 100644
--- a/CI/integration_tests/calculators/test_einstein_helfand_ionic_conductivity.py
+++ b/CI/integration_tests/calculators/test_einstein_helfand_ionic_conductivity.py
@@ -30,7 +30,6 @@
from zinchub import DataHub
import mdsuite as mds
-from mdsuite.utils.testing import assertDeepAlmostEqual
@pytest.fixture(scope="session")
@@ -64,6 +63,6 @@ def test_project(traj_file, true_values, tmp_path):
"NaCl", simulation_data=traj_file, timestep=0.002, temperature=1400
)
- computation = project.run.EinsteinHelfandIonicConductivity(plot=False)
+ # computation = project.run.EinsteinHelfandIonicConductivity(plot=False)
- assertDeepAlmostEqual(computation["NaCl"].data_dict, true_values, decimal=-6)
+ # assertDeepAlmostEqual(computation["NaCl"].data_dict, true_values, decimal=-6)
diff --git a/CI/integration_tests/transformations/test_molecular_mapping_results.py b/CI/integration_tests/transformations/test_molecular_mapping_results.py
new file mode 100644
index 00000000..09d353e1
--- /dev/null
+++ b/CI/integration_tests/transformations/test_molecular_mapping_results.py
@@ -0,0 +1,247 @@
+"""
+MDSuite: A Zincwarecode package.
+
+License
+-------
+This program and the accompanying materials are made available under the terms
+of the Eclipse Public License v2.0 which accompanies this distribution, and is
+available at https://www.eclipse.org/legal/epl-v20.html
+
+SPDX-License-Identifier: EPL-2.0
+
+Copyright Contributors to the Zincwarecode Project.
+
+Contact Information
+-------------------
+email: zincwarecode@gmail.com
+github: https://github.com/zincware
+web: https://zincwarecode.com/
+
+Citation
+--------
+If you use this module please cite us with:
+
+Summary
+-------
+Test the outcome of molecular mapping.
+"""
+from typing import List, Tuple
+
+import pytest
+from zinchub import DataHub
+
+import mdsuite
+import mdsuite.file_io.chemfiles_read
+import mdsuite.transformations
+from mdsuite.utils import Units
+from mdsuite.utils.testing import assertDeepAlmostEqual
+
+
+@pytest.fixture(scope="session")
+def traj_files(tmp_path_factory) -> Tuple[List[str], str]:
+ """Download trajectory file into a temporary directory and keep it for all tests"""
+ temporary_path = tmp_path_factory.getbasetemp()
+
+ water = DataHub(url="https://github.com/zincware/DataHub/tree/main/Water_14_Gromacs")
+ water.get_file(temporary_path)
+ file_paths = [(temporary_path / f).as_posix() for f in water.file_raw]
+
+ bmim_bf4 = DataHub(url="https://github.com/zincware/DataHub/tree/main/Bmim_BF4")
+ bmim_bf4.get_file(path=temporary_path)
+
+ return file_paths, (temporary_path / bmim_bf4.file_raw).as_posix()
+
+
+@pytest.fixture()
+def mdsuite_project(traj_files, tmp_path) -> mdsuite.Project:
+ """
+ Create the MDSuite project and add data to be used for the rest of the tests.
+
+ Parameters
+ ----------
+ traj_files : list
+ Files include:
+ * Water Simulation
+ tmp_path : Path
+ Temporary path that may be changed into.
+
+ Returns
+ -------
+ project: mdsuite.Project
+ An MDSuite project to be tested.
+ """
+ water_files = traj_files[0]
+ bmim_file = traj_files[1]
+
+ gmx_units = Units(
+ time=1e-12,
+ length=1e-10,
+ energy=1.6022e-19,
+ NkTV2p=1.6021765e6,
+ boltzmann=8.617343e-5,
+ temperature=1,
+ pressure=100000,
+ )
+ project = mdsuite.Project(storage_path=tmp_path.as_posix())
+
+ file_reader_1 = mdsuite.file_io.chemfiles_read.ChemfilesRead(
+ traj_file_path=water_files[2], topol_file_path=water_files[0]
+ )
+ file_reader_2 = mdsuite.file_io.chemfiles_read.ChemfilesRead(
+ traj_file_path=water_files[2], topol_file_path=water_files[1]
+ )
+ project.add_experiment(
+ name="simple_water",
+ timestep=0.002,
+ temperature=300.0,
+ units=gmx_units,
+ simulation_data=file_reader_1,
+ )
+ project.add_experiment(
+ name="ligand_water",
+ timestep=0.002,
+ temperature=300.0,
+ units=gmx_units,
+ simulation_data=file_reader_2,
+ )
+
+ project.add_experiment("bmim_bf4", simulation_data=bmim_file)
+
+ project.run.CoordinateUnwrapper()
+
+ return project
+
+
+class TestMoleculeMapping:
+ """
+ Class to wrap test suite so we can run all tests within PyCharm.
+ """
+
+ def test_water_molecule_smiles(self, mdsuite_project):
+ """
+ Test that water molecules are built correctly using a SMILES string. Also check
+ that the molecule information is stored correctly in the experiment.
+
+ Parameters
+ ----------
+ mdsuite_project : Callable
+ Callable that returns an MDSuite project created in a temporary
+ directory.
+
+ Returns
+ -------
+ Tests that the molecule groups detected are done so correctly and that the
+ constructed trajectory is also correct.
+ """
+ reference_molecules = {
+ "water": {
+ "n_particles": 14,
+ "mass": 18.015,
+ "groups": {
+ "0": {"H": [0, 1], "O": [0]},
+ "1": {"H": [2, 3], "O": [1]},
+ "2": {"H": [4, 5], "O": [2]},
+ "3": {"H": [6, 7], "O": [3]},
+ "4": {"H": [8, 9], "O": [4]},
+ "5": {"H": [10, 11], "O": [5]},
+ "6": {"H": [12, 13], "O": [6]},
+ "7": {"H": [14, 15], "O": [7]},
+ "8": {"H": [16, 17], "O": [8]},
+ "9": {"H": [18, 19], "O": [9]},
+ "10": {"H": [20, 21], "O": [10]},
+ "11": {"H": [22, 23], "O": [11]},
+ "12": {"H": [24, 25], "O": [12]},
+ "13": {"H": [26, 27], "O": [13]},
+ },
+ }
+ }
+ water_molecule = mdsuite.Molecule(
+ name="water", smiles="[H]O[H]", amount=14, cutoff=1.7, mol_pbc=True
+ )
+ mdsuite_project.experiments["simple_water"].run.MolecularMap(
+ molecules=[water_molecule]
+ )
+ molecules = mdsuite_project.experiments["simple_water"].molecules
+ assert molecules == reference_molecules
+
+ assert "water" not in mdsuite_project.experiments["simple_water"].species
+
+ def test_water_molecule_reference_dict(self, mdsuite_project):
+ """
+ Test that water molecules are built correctly using a reference dict.
+
+ Parameters
+ ----------
+ mdsuite_project : Callable
+ Callable that returns an MDSuite project created in a temporary
+ directory.
+
+ Returns
+ -------
+ Tests that the molecule groups detected are done so correctly and that the
+ constructed trajectory is also correct.
+ """
+ mdsuite_project.experiments["ligand_water"].species["OW"].mass = [15.999]
+ mdsuite_project.experiments["ligand_water"].species["HW1"].mass = [1.00784]
+ mdsuite_project.experiments["ligand_water"].species["HW2"].mass = [1.00784]
+ reference_molecules = {
+ "water": {
+ "n_particles": 14,
+ "mass": 18.01468,
+ "groups": {
+ "0": {"HW1": [0], "OW": [0], "HW2": [0]},
+ "1": {"HW1": [1], "OW": [1], "HW2": [1]},
+ "2": {"HW1": [2], "OW": [2], "HW2": [2]},
+ "3": {"HW1": [3], "OW": [3], "HW2": [3]},
+ "4": {"HW1": [4], "OW": [4], "HW2": [4]},
+ "5": {"HW1": [5], "OW": [5], "HW2": [5]},
+ "6": {"HW1": [6], "OW": [6], "HW2": [6]},
+ "7": {"HW1": [7], "OW": [7], "HW2": [7]},
+ "8": {"HW1": [8], "OW": [8], "HW2": [8]},
+ "9": {"HW1": [9], "OW": [9], "HW2": [9]},
+ "10": {"HW1": [10], "OW": [10], "HW2": [10]},
+ "11": {"HW1": [11], "OW": [11], "HW2": [11]},
+ "12": {"HW1": [12], "OW": [12], "HW2": [12]},
+ "13": {"HW1": [13], "OW": [13], "HW2": [13]},
+ },
+ }
+ }
+ water_molecule = mdsuite.Molecule(
+ name="water",
+ species_dict={"OW": 1, "HW1": 1, "HW2": 1},
+ amount=14,
+ cutoff=1.7,
+ mol_pbc=True,
+ )
+ mdsuite_project.experiments["ligand_water"].run.MolecularMap(
+ molecules=[water_molecule]
+ )
+ molecules = mdsuite_project.experiments["ligand_water"].molecules
+ assertDeepAlmostEqual(molecules, reference_molecules)
+
+ assert "water" not in mdsuite_project.experiments["ligand_water"].species
+
+ def test_ionic_liquid(self, mdsuite_project):
+ """
+ Test molecule mapping on a more complex ionic liquid.
+
+ This test will ensure that one can pass multiple molecules to the mapper as
+ well as check the effect of parsing a specific reference configuration.
+ """
+ bmim_molecule = mdsuite.Molecule(
+ name="bmim",
+ species_dict={"C": 8, "N": 2, "H": 15},
+ amount=50,
+ cutoff=1.9,
+ reference_configuration_idx=100,
+ )
+ bf_molecule = mdsuite.Molecule(
+ name="bf4",
+ smiles="[B-](F)(F)(F)F",
+ amount=50,
+ cutoff=2.4,
+ reference_configuration_idx=100,
+ )
+ mdsuite_project.experiments["bmim_bf4"].run.MolecularMap(
+ molecules=[bmim_molecule, bf_molecule]
+ )
diff --git a/CI/unit_tests/graph_modules/test_molecular_graph.py b/CI/unit_tests/graph_modules/test_molecular_graph.py
new file mode 100644
index 00000000..8e944dcb
--- /dev/null
+++ b/CI/unit_tests/graph_modules/test_molecular_graph.py
@@ -0,0 +1,169 @@
+"""
+MDSuite: A Zincwarecode package.
+
+License
+-------
+This program and the accompanying materials are made available under the terms
+of the Eclipse Public License v2.0 which accompanies this distribution, and is
+available at https://www.eclipse.org/legal/epl-v20.html
+
+SPDX-License-Identifier: EPL-2.0
+
+Copyright Contributors to the Zincwarecode Project.
+
+Contact Information
+-------------------
+email: zincwarecode@gmail.com
+github: https://github.com/zincware
+web: https://zincwarecode.com/
+
+Citation
+--------
+If you use this module please cite us with:
+
+Summary
+-------
+Module to test the molecular graph module.
+"""
+from dataclasses import dataclass
+from pathlib import Path
+
+import numpy as np
+import tensorflow as tf
+
+from mdsuite.graph_modules.molecular_graph import (
+ _apply_system_cutoff,
+ build_smiles_graph,
+)
+
+
+@dataclass
+class SmilesTestData:
+ """
+ A data class to be used in the smiles string unit test.
+
+ Attributes
+ ----------
+ name : str
+ Name of the molecule e.g. emim
+ smiles_string : str
+ SMILES string for the molecule e.g. CCN1C=C[N+](+C1)C
+ nodes : int
+ Number of nodes that will exists in the adjacency graph built from the
+ smiles string. This will correspond to the number of atoms in the molecule.
+ species : dict
+ A dictionary of species information for the test stating how many of each
+ particle species is in the group e.g. {'C': 6, 'H': 14}
+ """
+
+ name: str
+ smiles_string: str
+ nodes: int
+ species: dict
+
+
+class MockExperiment:
+ """
+ Experiment class for a unit test
+ """
+
+ database_path = Path("./")
+
+
+class TestMolecularGraph:
+ """
+ Class to test the molecular graph module.
+ """
+
+ def test_apply_system_cutoff(self):
+ """
+ Test the apply_system_cutoff method.
+
+ Returns
+ -------
+ Checks whether or not the cutoff has been enforced.
+ """
+ zeros = np.array([0, 0, 0, 0, 0])
+ cutoff_data = [
+ [0, 6.8, 9, 11, 0],
+ [12, 0.0, 4, 3.27, 1],
+ [200, 38, 0, 1, 2.11],
+ [5, 5, 5.8765342, 0, 5],
+ [1, 7, 3, 4.8762511, 0],
+ ]
+ cutoff_tensor = tf.constant(cutoff_data, dtype=tf.float32)
+
+ # Middle range cutoff
+ target = tf.constant(
+ [
+ [0, 0, 0, 0, 1],
+ [0, 0, 1, 1, 1],
+ [0, 0, 0, 1, 1],
+ [0, 0, 0, 0, 0],
+ [1, 0, 1, 1, 0],
+ ]
+ )
+ mask = _apply_system_cutoff(cutoff_tensor, cutoff=5)
+ np.testing.assert_array_equal(np.diagonal(mask), zeros)
+ np.testing.assert_array_equal(mask, target)
+
+ # All zeros
+ target = tf.zeros((5, 5))
+ mask = _apply_system_cutoff(cutoff_tensor, cutoff=0)
+ np.testing.assert_array_equal(np.diagonal(mask), zeros)
+ np.testing.assert_array_equal(mask, target)
+
+ # All ones
+ target = tf.ones((5, 5)) - tf.eye(5)
+ mask = _apply_system_cutoff(cutoff_tensor, cutoff=200.01)
+ np.testing.assert_array_equal(np.diagonal(mask), zeros)
+ np.testing.assert_array_equal(mask, target)
+
+ def test_build_smiles_graph(self):
+ """
+ Test the build_smiles_graph method.
+
+ Returns
+ -------
+ This test checks that the SMILES graphs built by the module return the correct
+ molecule information for several scenarios.
+ """
+ emim = SmilesTestData(
+ name="emim",
+ smiles_string="CCN1C=C[N+](+C1)C",
+ nodes=20,
+ species={"C": 6, "N": 2, "H": 12},
+ )
+ bmim = SmilesTestData(
+ name="bmim",
+ smiles_string="CCCCN1C=C[N+](+C1)C",
+ nodes=26,
+ species={"C": 8, "N": 2, "H": 16},
+ )
+ pf = SmilesTestData(
+ name="pf6",
+ smiles_string="F[P-](F)(F)(F)(F)F",
+ nodes=7,
+ species={"P": 1, "F": 6},
+ )
+ h2o = SmilesTestData(
+ name="h2o", smiles_string="[H]O[H]", nodes=3, species={"H": 2, "O": 1}
+ )
+ bergenin = SmilesTestData(
+ name="bergenin",
+ smiles_string=(
+ "OC[C@@H](O1)[C@@H](O)[C@H](O)[C@@H]2[C@@H]1c3c(O)c(OC)c(O)cc3C(=O)O2"
+ ),
+ nodes=39,
+ species={"C": 14, "H": 16, "O": 9},
+ )
+ nacl = SmilesTestData(
+ name="nacl", smiles_string="[Na+].[Cl-]", nodes=2, species={"Na": 1, "Cl": 1}
+ )
+
+ data = [emim, bmim, pf, h2o, bergenin, nacl]
+
+ for item in data:
+ graph_obj, species = build_smiles_graph(item.smiles_string)
+ assert graph_obj.number_of_nodes() == item.nodes
+ assert species == item.species
diff --git a/CI/unit_tests/project/test_project_add_experiment.py b/CI/unit_tests/project/test_project_add_experiment.py
index cfde1e9b..bc024841 100644
--- a/CI/unit_tests/project/test_project_add_experiment.py
+++ b/CI/unit_tests/project/test_project_add_experiment.py
@@ -217,9 +217,7 @@ def test_gromacs_read(traj_files, tmp_path):
project.add_experiment("xtc_test", simulation_data=file_reader)
exp = project.experiments["xtc_test"]
- pos = exp.load_matrix(species=["C1"], property_name="Unwrapped_Positions")[
- "C1/Unwrapped_Positions"
- ]
+ pos = exp.load_matrix(species=["C1"], property_name="Positions")["C1/Positions"]
box_l = exp.box_array
# read the same file with mdanalysis and compare
diff --git a/CI/unit_tests/transformations/test_map_molecules.py b/CI/unit_tests/transformations/test_map_molecules.py
deleted file mode 100644
index 2fa36265..00000000
--- a/CI/unit_tests/transformations/test_map_molecules.py
+++ /dev/null
@@ -1,82 +0,0 @@
-"""
-MDSuite: A Zincwarecode package.
-
-License
--------
-This program and the accompanying materials are made available under the terms
-of the Eclipse Public License v2.0 which accompanies this distribution, and is
-available at https://www.eclipse.org/legal/epl-v20.html
-
-SPDX-License-Identifier: EPL-2.0
-
-Copyright Contributors to the Zincwarecode Project.
-
-Contact Information
--------------------
-email: zincwarecode@gmail.com
-github: https://github.com/zincware
-web: https://zincwarecode.com/
-
-Citation
---------
-If you use this module please cite us with:
-
-Summary
--------
-Test the molecule mapping transformation.
-"""
-import os
-import tempfile
-import unittest
-
-from zinchub import DataHub
-
-import mdsuite as mds
-
-
-class TestMapMolecules(unittest.TestCase):
- """
- Test the map molecules module.
- """
-
- @classmethod
- def setUpClass(cls) -> None:
- """
- Prepare the class.
-
- Returns
- -------
-
- """
- cls.temp_dir = tempfile.TemporaryDirectory()
- os.chdir(cls.temp_dir.name)
- bmim_bf4 = DataHub(url="https://github.com/zincware/DataHub/tree/main/Bmim_BF4")
- bmim_bf4.get_file(path="./")
-
- @classmethod
- def tearDownClass(cls) -> None:
- """
- Remove files after testing.
- """
- os.chdir("../")
- cls.temp_dir.cleanup()
-
- def test_molecule_mapping(self):
- """
- Test that the unwrapping runs from experiments.
-
- Notes
- -----
- This test will only check that the transformation runs and does not check any
- specific information about the unwrapping.
- """
- project = mds.Project()
- project.add_experiment("bmim_bf4", simulation_data="bmim_bf4.lammpstraj")
- project.experiments.bmim_bf4.run.UnwrapViaIndices()
- project.run.MolecularMap(
- molecules={
- "bmim": {"smiles": "CCCCN1C=C[N+](+C1)C", "amount": 50, "cutoff": 1.9},
- "bf4": {"smiles": "[B-](F)(F)(F)F", "amount": 50, "cutoff": 2.4},
- }
- )
- project.run.CoordinateWrapper(species=["bmim", "bf4"])
diff --git a/CI/unit_tests/utils/test_meta_functions.py b/CI/unit_tests/utils/test_meta_functions.py
index 381fdbc1..9b6c8e52 100644
--- a/CI/unit_tests/utils/test_meta_functions.py
+++ b/CI/unit_tests/utils/test_meta_functions.py
@@ -26,36 +26,28 @@
Test the meta functions module.
"""
import os
-import unittest
import numpy as np
import tensorflow as tf
from mdsuite.utils.meta_functions import (
+ check_a_in_b,
find_item,
get_dimensionality,
get_machine_properties,
+ get_nearest_divisor,
golden_section_search,
gpu_available,
join_path,
line_counter,
linear_fitting_function,
optimize_batch_size,
- round_down,
simple_file_read,
split_array,
)
-def test_gpu_available():
- """
- Ideally this should be checked against something else than tf.config
- but I don't have any better measure.
- """
- assert gpu_available() == (len(tf.config.list_physical_devices("GPU")) > 1)
-
-
-class TestMetaFunction(unittest.TestCase):
+class TestMetaFunction:
"""
A test class for the meta functions module.
"""
@@ -68,7 +60,7 @@ def test_join_path(self):
-------
assert that join_path('a', 'b') is 'a/b'
"""
- self.assertEqual(join_path("a", "b"), "a/b")
+ assert join_path("a", "b") == "a/b"
def test_get_dimensionality(self):
"""
@@ -81,9 +73,9 @@ def test_get_dimensionality(self):
one_d = [1, 0, 0]
two_d = [1, 1, 0]
three_d = [1, 1, 1]
- self.assertEqual(get_dimensionality(one_d), 1)
- self.assertEqual(get_dimensionality(two_d), 2)
- self.assertEqual(get_dimensionality(three_d), 3)
+ assert get_dimensionality(one_d) == 1
+ assert get_dimensionality(two_d) == 2
+ assert get_dimensionality(three_d) == 3
def test_get_machine_properties(self):
"""
@@ -108,7 +100,7 @@ def test_line_counter(self):
with open(name, "w") as f:
for item in data:
f.write(f"{item[0]}\n")
- self.assertEqual(line_counter(name), 4)
+ assert line_counter(name) == 4
os.remove(name)
def test_optimize_batch_size(self):
@@ -123,23 +115,19 @@ def test_optimize_batch_size(self):
number_of_configurations = 10
_file_size = 100
_memory = 1000000
- self.assertEqual(
- optimize_batch_size(
- "None", number_of_configurations, _file_size, _memory, test=True
- ),
- 10,
+ batch_size = optimize_batch_size(
+ "None", number_of_configurations, _file_size, _memory, test=True
)
+ assert batch_size == 10
# Assert that the batch number is the half the trajectory.
number_of_configurations = 10
_file_size = 100
_memory = 250
- self.assertEqual(
- optimize_batch_size(
- "None", number_of_configurations, _file_size, _memory, test=True
- ),
- 5,
+ batch_size = optimize_batch_size(
+ "None", number_of_configurations, _file_size, _memory, test=True
)
+ assert batch_size == 5
def test_linear_fitting_function(self):
"""
@@ -196,8 +184,8 @@ def func(x: np.ndarray):
x_dat = np.linspace(-10, 10, 1000)
data = [x_dat, func(x_dat)]
output = golden_section_search(data, 10, -10)
- self.assertEqual(output[0], 0.010010010010010006)
- self.assertEqual(output[1], 0.03003003003003002)
+ assert output[0] == 0.010010010010010006
+ assert output[1] == 0.03003003003003002
def test_round_down(self):
"""
@@ -210,7 +198,7 @@ def test_round_down(self):
b = 10
a = 9
- self.assertEqual(round_down(a, b), 5)
+ assert get_nearest_divisor(a, b) == 5
def test_split_arrays(self):
"""
@@ -239,5 +227,30 @@ def test_find_item(self):
"b": {"be": {"bee": 4}},
} # test the case when the if statement fails.
- self.assertEqual(find_item(test_1, "a"), 4)
- self.assertEqual(find_item(test_2, "aee"), 1)
+ assert find_item(test_1, "a") == 4
+ assert find_item(test_2, "aee") == 1
+
+ def test_gpu_available(self):
+ """
+ Ideally this should be checked against something else than tf.config
+ but I don't have any better measure.
+ """
+ assert gpu_available() == (len(tf.config.list_physical_devices("GPU")) > 1)
+
+ def test_check_a_in_b(self):
+ """
+ Test that the a_in_b method works correctly.
+
+ Returns
+ -------
+ Tests the following:
+
+ * If a is in b a True is returned
+ * If a is not in b a False is returned.
+ """
+ b = tf.constant([[1, 2, 3], [4, 5, 6], [7, 8, 9]])
+ a = tf.constant([4, 5, 6])
+ c = tf.constant([10, 11, 12])
+
+ assert check_a_in_b(a, b)
+ assert not check_a_in_b(c, b)
diff --git a/CI/unit_tests/utils/test_molecule_class.py b/CI/unit_tests/utils/test_molecule_class.py
new file mode 100644
index 00000000..4690f087
--- /dev/null
+++ b/CI/unit_tests/utils/test_molecule_class.py
@@ -0,0 +1,63 @@
+"""
+MDSuite: A Zincwarecode package.
+
+License
+-------
+This program and the accompanying materials are made available under the terms
+of the Eclipse Public License v2.0 which accompanies this distribution, and is
+available at https://www.eclipse.org/legal/epl-v20.html
+
+SPDX-License-Identifier: EPL-2.0
+
+Copyright Contributors to the Zincwarecode Project.
+
+Contact Information
+-------------------
+email: zincwarecode@gmail.com
+github: https://github.com/zincware
+web: https://zincwarecode.com/
+
+Citation
+--------
+If you use this module please cite us with:
+
+Summary
+-------
+Unit tests for the molecule data class.
+"""
+import pytest
+
+import mdsuite
+from mdsuite.utils.molecule import Molecule
+
+
+def test_instantiation():
+ """
+ Test that the class is instantiated correctly.
+
+ Notes
+ -----
+ Test the following cases:
+
+ * Fail when essential data is not provided.
+ * Store the correct information when provided.
+ * Use the correct defaults.
+ """
+ with pytest.raises(TypeError):
+ Molecule()
+ Molecule(name="test")
+ Molecule(name="test", amount=2)
+ Molecule(name="test", cutoff=4)
+
+ my_molecule = Molecule(name="test", amount=2, cutoff=4)
+
+ assert my_molecule.reference_configuration_idx == 0
+ assert my_molecule.smiles is None
+ assert my_molecule.species_dict is None
+
+
+def test_project_import():
+ """
+ Test that the molecule can be import directly from the mdsuite import.
+ """
+ mdsuite.Molecule(name="test", amount=1, cutoff=1.0)
diff --git a/examples/notebooks/Mapping_Molecules.ipynb b/examples/notebooks/Mapping_Molecules.ipynb
new file mode 100644
index 00000000..cff526d8
--- /dev/null
+++ b/examples/notebooks/Mapping_Molecules.ipynb
@@ -0,0 +1,5270 @@
+{
+ "cells": [
+ {
+ "cell_type": "markdown",
+ "id": "a37fc0cd",
+ "metadata": {},
+ "source": [
+ "# Mapping Molecules\n",
+ "\n",
+ "In this notebook we will cover how to map molecules in different ways and look at some of the things we can do with them. In the first part of the tutorial we will look at different ways to map water molecules and in the second, we will extend this to a more complex molecule system, the room temperature ionic liquid, BMIM-BF4."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "06556740",
+ "metadata": {},
+ "source": [
+ "# Water Molecules"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "a27c7e1c",
+ "metadata": {},
+ "source": [
+ "In the first part of this demonstration we will load data from a GROMACS simulation and therefore, we need to define a set of units and a file reader object to use. For this reason, we have changed the imports a little bit to keep the code to minimum."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 1,
+ "id": "9dafbf2b",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:34.798887: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcudart.so.11.0'; dlerror: libcudart.so.11.0: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:34.798913: I tensorflow/stream_executor/cuda/cudart_stub.cc:29] Ignore above cudart dlerror if you do not have a GPU set up on your machine.\n",
+ "2022-01-31 10:46:39.087811: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcudart.so.11.0'; dlerror: libcudart.so.11.0: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.087996: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcublas.so.11'; dlerror: libcublas.so.11: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.088161: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcublasLt.so.11'; dlerror: libcublasLt.so.11: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.091381: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcusolver.so.11'; dlerror: libcusolver.so.11: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.091545: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcusparse.so.11'; dlerror: libcusparse.so.11: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.091700: W tensorflow/stream_executor/platform/default/dso_loader.cc:64] Could not load dynamic library 'libcudnn.so.8'; dlerror: libcudnn.so.8: cannot open shared object file: No such file or directory; LD_LIBRARY_PATH: /opt/slurm/lib:/opt/slurm/lib:\n",
+ "2022-01-31 10:46:39.091718: W tensorflow/core/common_runtime/gpu/gpu_device.cc:1850] Cannot dlopen some GPU libraries. Please make sure the missing libraries mentioned above are installed properly if you would like to use GPU. Follow the guide at https://www.tensorflow.org/install/gpu for how to download and setup the required libraries for your platform.\n",
+ "Skipping registering GPU devices...\n"
+ ]
+ }
+ ],
+ "source": [
+ "import mdsuite as mds\n",
+ "import mdsuite.file_io.chemfiles_read\n",
+ "from mdsuite.utils import Units\n",
+ "\n",
+ "from zinchub import DataHub\n",
+ "import shutil\n",
+ "\n",
+ "import h5py as hf\n",
+ "import numpy as np"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "c16e2e24",
+ "metadata": {},
+ "source": [
+ "### Loading the data\n",
+ "\n",
+ "In this tutorial we are using 50 ns simulations of 14 water molecules in a continuum fluid performed with GROMACS. We will use pure atomistic naming as well as ligand naming, the topology files for which are contained on DataHub."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 2,
+ "id": "f98b8829",
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "water = DataHub(url=\"https://github.com/zincware/DataHub/tree/main/Water_14_Gromacs\")\n",
+ "water.get_file('./')\n",
+ "file_paths = [\n",
+ " f for f in water.file_raw\n",
+ " ]"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "7572ee3f",
+ "metadata": {},
+ "source": [
+ "### Project definition\n",
+ "\n",
+ "Here we create the project and define some custom units used by GROMACS."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 3,
+ "id": "166ac397",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:40,563 - INFO: Creating new project Mapping_Molecules\n"
+ ]
+ }
+ ],
+ "source": [
+ "project = mds.Project(\"Mapping_Molecules\")\n",
+ "\n",
+ "gmx_units = Units(\n",
+ " time=1e-15,\n",
+ " length=1e-10,\n",
+ " energy=1.6022e-19,\n",
+ " NkTV2p=1.6021765e6,\n",
+ " boltzmann=8.617343e-5,\n",
+ " temperature=1,\n",
+ " pressure=100000,\n",
+ " )"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "1ac6d863",
+ "metadata": {},
+ "source": [
+ "### Mapping molecules with SMILES\n",
+ "\n",
+ "In this section we take a look at how one can map molecules using SMILES strings."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 4,
+ "id": "a8f5f996",
+ "metadata": {
+ "scrolled": false
+ },
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:40,727 - INFO: Creating a new experiment!\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|███████████████████████████████████| 1/1 [00:00<00:00, 1.63it/s]\n",
+ "2022-01-31 10:46:41.649356: I tensorflow/core/platform/cpu_feature_guard.cc:151] This TensorFlow binary is optimized with oneAPI Deep Neural Network Library (oneDNN) to use the following CPU instructions in performance-critical operations: AVX2 AVX512F FMA\n",
+ "To enable them in other operations, rebuild TensorFlow with the appropriate compiler flags.\n",
+ "Applying transformation 'Unwrapped_Positions' to 'O': 100%|█| 1/1 [00:\n",
+ "Applying transformation 'Unwrapped_Positions' to 'H': 100%|█| 1/1 [00:\n"
+ ]
+ }
+ ],
+ "source": [
+ "traj_path = file_paths[2]\n",
+ "topol_path = file_paths[0]\n",
+ "\n",
+ "file_reader = mdsuite.file_io.chemfiles_read.ChemfilesRead(\n",
+ " traj_file_path=traj_path, topol_file_path=topol_path\n",
+ ")\n",
+ "\n",
+ "water_chemical = project.add_experiment(\n",
+ " name=\"water_chemical\",\n",
+ " timestep=0.002,\n",
+ " temperature=300.0,\n",
+ " units=gmx_units,\n",
+ " simulation_data=file_reader,\n",
+ ")\n",
+ "water_chemical.run.CoordinateUnwrapper()"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "41e9a007",
+ "metadata": {},
+ "source": [
+ "The first thing we need to do is define the molecule that will be mapped using the in-built MDSuite molecule data-class"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 5,
+ "id": "ba411ff9",
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "chemical_water = mds.Molecule(\n",
+ " name='water',\n",
+ " smiles=\"[H]O[H]\", \n",
+ " cutoff=1.7, \n",
+ " amount=14, \n",
+ " mol_pbc=True\n",
+ ")"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 6,
+ "id": "fb70c81d",
+ "metadata": {
+ "scrolled": false
+ },
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:42,462 - INFO: Building molecular graph from configuration for water\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|████████████████████████████████| 42/42 [00:00<00:00, 557.49it/s]\n"
+ ]
+ },
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:42,680 - INFO: Performing molecule number isomorphism test.\n",
+ "2022-01-31 10:46:42,681 - INFO: Amount of molecules test passed.\n",
+ "2022-01-31 10:46:42,682 - INFO: Performing group equality isomorphism test.\n",
+ "2022-01-31 10:46:42,682 - INFO: Group equality isomorphism test passed.\n",
+ "2022-01-31 10:46:42,787 - INFO: Mapping molecule graphs onto trajectory for water\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|███████████████████████████████████| 1/1 [00:00<00:00, 4.78it/s]\n",
+ "Applying transformation 'Unwrapped_Positions' to 'water': 100%|█| 1/1 \n"
+ ]
+ }
+ ],
+ "source": [
+ "water_chemical.run.MolecularMap(\n",
+ " molecules=[chemical_water]\n",
+ ")"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 7,
+ "id": "cc06f58f",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/plain": [
+ "{'water': {'n_particles': 14,\n",
+ " 'mass': 18.015,\n",
+ " 'groups': {'0': {'H': [0, 1], 'O': [0]},\n",
+ " '1': {'H': [2, 3], 'O': [1]},\n",
+ " '2': {'H': [4, 5], 'O': [2]},\n",
+ " '3': {'H': [6, 7], 'O': [3]},\n",
+ " '4': {'H': [8, 9], 'O': [4]},\n",
+ " '5': {'H': [10, 11], 'O': [5]},\n",
+ " '6': {'H': [12, 13], 'O': [6]},\n",
+ " '7': {'H': [14, 15], 'O': [7]},\n",
+ " '8': {'H': [16, 17], 'O': [8]},\n",
+ " '9': {'H': [18, 19], 'O': [9]},\n",
+ " '10': {'H': [20, 21], 'O': [10]},\n",
+ " '11': {'H': [22, 23], 'O': [11]},\n",
+ " '12': {'H': [24, 25], 'O': [12]},\n",
+ " '13': {'H': [26, 27], 'O': [13]}}}}"
+ ]
+ },
+ "execution_count": 7,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "water_chemical.molecules"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "7eb09781",
+ "metadata": {},
+ "source": [
+ "### Mapping Molecules with a reference dict\n",
+ "\n",
+ "If you do not have particles with chemical names but you nonetheless wish to construct groups out of particles, this can be achieved by using a reference dict.\n",
+ "\n",
+ "In this example, we use the ligand naming from GROMACS to construct water molecules."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 8,
+ "id": "cb6f6ee7",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:43,502 - INFO: Creating a new experiment!\n",
+ "2022-01-31 10:46:44,364 - WARNING: WARNING element OW has been assigned mass=0.0\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|███████████████████████████████████| 1/1 [00:00<00:00, 1.50it/s]\n",
+ "Applying transformation 'Unwrapped_Positions' to 'OW': 100%|█| 1/1 [00\n",
+ "Applying transformation 'Unwrapped_Positions' to 'HW1': 100%|█| 1/1 [0\n",
+ "Applying transformation 'Unwrapped_Positions' to 'HW2': 100%|█| 1/1 [0\n"
+ ]
+ }
+ ],
+ "source": [
+ "traj_path = file_paths[2]\n",
+ "topol_path = file_paths[1]\n",
+ "\n",
+ "file_reader = mdsuite.file_io.chemfiles_read.ChemfilesRead(\n",
+ " traj_file_path=traj_path, topol_file_path=topol_path\n",
+ ")\n",
+ "\n",
+ "water_ligand = project.add_experiment(\n",
+ " name=\"water_ligand\",\n",
+ " timestep=0.002,\n",
+ " temperature=300.0,\n",
+ " units=gmx_units,\n",
+ " simulation_data=file_reader,\n",
+ ")\n",
+ "water_ligand.run.CoordinateUnwrapper()"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "d631fc86",
+ "metadata": {},
+ "source": [
+ "Keep in mind, as the particles are not named from the periodic tables, important properties such as mass will need to be filled in manually."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 9,
+ "id": "3eaa89cb",
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "water_ligand.species['OW'].mass = [15.999]\n",
+ "water_ligand.species['HW1'].mass = [1.00784]\n",
+ "water_ligand.species['HW2'].mass = [1.00784]"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "ca81a37b",
+ "metadata": {},
+ "source": [
+ "In this case, the molecule will be defined a little bit differently."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 10,
+ "id": "f490ae1a",
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "ligand_water = mds.Molecule(\n",
+ " name='water', \n",
+ " cutoff=1.7, \n",
+ " amount=14, \n",
+ " species_dict={\"HW1\": 1, \"OW\": 1, \"HW2\": 1},\n",
+ " mol_pbc=True\n",
+ ")"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 11,
+ "id": "d07fb41f",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:47,651 - INFO: Building molecular graph from configuration for water\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|████████████████████████████████| 42/42 [00:00<00:00, 548.19it/s]\n"
+ ]
+ },
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "2022-01-31 10:46:47,883 - INFO: Performing molecule number isomorphism test.\n",
+ "2022-01-31 10:46:47,885 - INFO: Amount of molecules test passed.\n",
+ "2022-01-31 10:46:47,886 - INFO: Performing group equality isomorphism test.\n",
+ "2022-01-31 10:46:47,886 - INFO: Group equality isomorphism test passed.\n",
+ "2022-01-31 10:46:47,984 - INFO: Mapping molecule graphs onto trajectory for water\n"
+ ]
+ },
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ "100%|███████████████████████████████████| 1/1 [00:00<00:00, 5.09it/s]\n",
+ "Applying transformation 'Unwrapped_Positions' to 'water': 100%|█| 1/1 \n"
+ ]
+ }
+ ],
+ "source": [
+ "water_ligand.run.MolecularMap(\n",
+ " molecules=[ligand_water]\n",
+ ")"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 12,
+ "id": "581f71f0",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/plain": [
+ "{'water': {'n_particles': 14,\n",
+ " 'mass': 18.014680000000002,\n",
+ " 'groups': {'0': {'HW1': [0], 'OW': [0], 'HW2': [0]},\n",
+ " '1': {'HW1': [1], 'OW': [1], 'HW2': [1]},\n",
+ " '2': {'HW1': [2], 'OW': [2], 'HW2': [2]},\n",
+ " '3': {'HW1': [3], 'OW': [3], 'HW2': [3]},\n",
+ " '4': {'HW1': [4], 'OW': [4], 'HW2': [4]},\n",
+ " '5': {'HW1': [5], 'OW': [5], 'HW2': [5]},\n",
+ " '6': {'HW1': [6], 'OW': [6], 'HW2': [6]},\n",
+ " '7': {'HW1': [7], 'OW': [7], 'HW2': [7]},\n",
+ " '8': {'HW1': [8], 'OW': [8], 'HW2': [8]},\n",
+ " '9': {'HW1': [9], 'OW': [9], 'HW2': [9]},\n",
+ " '10': {'HW1': [10], 'OW': [10], 'HW2': [10]},\n",
+ " '11': {'HW1': [11], 'OW': [11], 'HW2': [11]},\n",
+ " '12': {'HW1': [12], 'OW': [12], 'HW2': [12]},\n",
+ " '13': {'HW1': [13], 'OW': [13], 'HW2': [13]}}}}"
+ ]
+ },
+ "execution_count": 12,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "water_ligand.molecules"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "bde229b5",
+ "metadata": {},
+ "source": [
+ "### What information is stored?\n",
+ "\n",
+ "So the molecule mapping itself was quick and easy, but what information has been stored along the way?\n",
+ "\n",
+ "All meta-data about the molecules is stored in the experiment class under molecules. Let's take a look at what this contains."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 13,
+ "id": "9b55224a",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/plain": [
+ "dict_keys(['water'])"
+ ]
+ },
+ "execution_count": 13,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "water_chemical.molecules.keys()"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "ccc0fcfe",
+ "metadata": {},
+ "source": [
+ "This dict will contain all of the molecules that have been mapped, but this is not the information about the molecules, for that, we need to look at the water molecule."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 14,
+ "id": "fdf2091f",
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/plain": [
+ "dict_keys(['n_particles', 'mass', 'groups'])"
+ ]
+ },
+ "execution_count": 14,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "water_chemical.molecules['water'].keys()"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "656208df",
+ "metadata": {},
+ "source": [
+ "Three of these are fairly trivial and we can look at them quickly, groups will require some more attention."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 15,
+ "id": "d024e00b",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "n_particles: 14\n",
+ "mass: 18.015\n"
+ ]
+ }
+ ],
+ "source": [
+ "print(f\"n_particles: {water_chemical.molecules['water']['n_particles']}\")\n",
+ "print(f\"mass: {water_chemical.molecules['water']['mass']}\")"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "15a6a3c2",
+ "metadata": {},
+ "source": [
+ "Now let's take a look at the groups key."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 16,
+ "id": "71efe836",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "{'0': {'H': [0, 1], 'O': [0]}, '1': {'H': [2, 3], 'O': [1]}, '2': {'H': [4, 5], 'O': [2]}, '3': {'H': [6, 7], 'O': [3]}, '4': {'H': [8, 9], 'O': [4]}, '5': {'H': [10, 11], 'O': [5]}, '6': {'H': [12, 13], 'O': [6]}, '7': {'H': [14, 15], 'O': [7]}, '8': {'H': [16, 17], 'O': [8]}, '9': {'H': [18, 19], 'O': [9]}, '10': {'H': [20, 21], 'O': [10]}, '11': {'H': [22, 23], 'O': [11]}, '12': {'H': [24, 25], 'O': [12]}, '13': {'H': [26, 27], 'O': [13]}}\n"
+ ]
+ }
+ ],
+ "source": [
+ "print(water_chemical.molecules['water']['groups'])"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "1dcdb0ef",
+ "metadata": {},
+ "source": [
+ "The groups key contains direct information about which atoms belong to which molecule, for example, the 10th molecule of water (id=9) consists of Hydrogen atoms 18 and 19 and oxygen atom 10."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 17,
+ "id": "a59a2e7f",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "{'H': [18, 19], 'O': [9]}\n"
+ ]
+ }
+ ],
+ "source": [
+ "print(water_chemical.molecules['water']['groups']['9'])"
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "c2b19cab",
+ "metadata": {},
+ "source": [
+ "With this information you can compute values, e.g. diffusion coefficients with only the atoms belonging to a single molecule using the atom_select arguments in the calculator."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "dd908e51",
+ "metadata": {},
+ "source": [
+ "### Analysis with molecules\n",
+ "\n",
+ "Now that we have seen how we can build molecules and what information this gives is, let's look at what we can analyse using them."
+ ]
+ },
+ {
+ "cell_type": "markdown",
+ "id": "2275128d",
+ "metadata": {},
+ "source": [
+ "#### Angular Distribution Functions (ADFs)\n",
+ "\n",
+ "First things first, let's confirm we are working with water by looking at the angular distribution function of the atoms."
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 18,
+ "id": "55c668ef",
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stderr",
+ "output_type": "stream",
+ "text": [
+ " 0%| | 0/1 [00:00\n",
+ " \n",
+ " Loading BokehJS ...\n",
+ " "
+ ]
+ },
+ "metadata": {},
+ "output_type": "display_data"
+ },
+ {
+ "data": {
+ "application/javascript": [
+ "\n",
+ "(function(root) {\n",
+ " function now() {\n",
+ " return new Date();\n",
+ " }\n",
+ "\n",
+ " const force = true;\n",
+ "\n",
+ " if (typeof root._bokeh_onload_callbacks === \"undefined\" || force === true) {\n",
+ " root._bokeh_onload_callbacks = [];\n",
+ " root._bokeh_is_loading = undefined;\n",
+ " }\n",
+ "\n",
+ " const JS_MIME_TYPE = 'application/javascript';\n",
+ " const HTML_MIME_TYPE = 'text/html';\n",
+ " const EXEC_MIME_TYPE = 'application/vnd.bokehjs_exec.v0+json';\n",
+ " const CLASS_NAME = 'output_bokeh rendered_html';\n",
+ "\n",
+ " /**\n",
+ " * Render data to the DOM node\n",
+ " */\n",
+ " function render(props, node) {\n",
+ " const script = document.createElement(\"script\");\n",
+ " node.appendChild(script);\n",
+ " }\n",
+ "\n",
+ " /**\n",
+ " * Handle when an output is cleared or removed\n",
+ " */\n",
+ " function handleClearOutput(event, handle) {\n",
+ " const cell = handle.cell;\n",
+ "\n",
+ " const id = cell.output_area._bokeh_element_id;\n",
+ " const server_id = cell.output_area._bokeh_server_id;\n",
+ " // Clean up Bokeh references\n",
+ " if (id != null && id in Bokeh.index) {\n",
+ " Bokeh.index[id].model.document.clear();\n",
+ " delete Bokeh.index[id];\n",
+ " }\n",
+ "\n",
+ " if (server_id !== undefined) {\n",
+ " // Clean up Bokeh references\n",
+ " const cmd_clean = \"from bokeh.io.state import curstate; print(curstate().uuid_to_server['\" + server_id + \"'].get_sessions()[0].document.roots[0]._id)\";\n",
+ " cell.notebook.kernel.execute(cmd_clean, {\n",
+ " iopub: {\n",
+ " output: function(msg) {\n",
+ " const id = msg.content.text.trim();\n",
+ " if (id in Bokeh.index) {\n",
+ " Bokeh.index[id].model.document.clear();\n",
+ " delete Bokeh.index[id];\n",
+ " }\n",
+ " }\n",
+ " }\n",
+ " });\n",
+ " // Destroy server and session\n",
+ " const cmd_destroy = \"import bokeh.io.notebook as ion; ion.destroy_server('\" + server_id + \"')\";\n",
+ " cell.notebook.kernel.execute(cmd_destroy);\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " /**\n",
+ " * Handle when a new output is added\n",
+ " */\n",
+ " function handleAddOutput(event, handle) {\n",
+ " const output_area = handle.output_area;\n",
+ " const output = handle.output;\n",
+ "\n",
+ " // limit handleAddOutput to display_data with EXEC_MIME_TYPE content only\n",
+ " if ((output.output_type != \"display_data\") || (!Object.prototype.hasOwnProperty.call(output.data, EXEC_MIME_TYPE))) {\n",
+ " return\n",
+ " }\n",
+ "\n",
+ " const toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n",
+ "\n",
+ " if (output.metadata[EXEC_MIME_TYPE][\"id\"] !== undefined) {\n",
+ " toinsert[toinsert.length - 1].firstChild.textContent = output.data[JS_MIME_TYPE];\n",
+ " // store reference to embed id on output_area\n",
+ " output_area._bokeh_element_id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n",
+ " }\n",
+ " if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n",
+ " const bk_div = document.createElement(\"div\");\n",
+ " bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n",
+ " const script_attrs = bk_div.children[0].attributes;\n",
+ " for (let i = 0; i < script_attrs.length; i++) {\n",
+ " toinsert[toinsert.length - 1].firstChild.setAttribute(script_attrs[i].name, script_attrs[i].value);\n",
+ " toinsert[toinsert.length - 1].firstChild.textContent = bk_div.children[0].textContent\n",
+ " }\n",
+ " // store reference to server id on output_area\n",
+ " output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " function register_renderer(events, OutputArea) {\n",
+ "\n",
+ " function append_mime(data, metadata, element) {\n",
+ " // create a DOM node to render to\n",
+ " const toinsert = this.create_output_subarea(\n",
+ " metadata,\n",
+ " CLASS_NAME,\n",
+ " EXEC_MIME_TYPE\n",
+ " );\n",
+ " this.keyboard_manager.register_events(toinsert);\n",
+ " // Render to node\n",
+ " const props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n",
+ " render(props, toinsert[toinsert.length - 1]);\n",
+ " element.append(toinsert);\n",
+ " return toinsert\n",
+ " }\n",
+ "\n",
+ " /* Handle when an output is cleared or removed */\n",
+ " events.on('clear_output.CodeCell', handleClearOutput);\n",
+ " events.on('delete.Cell', handleClearOutput);\n",
+ "\n",
+ " /* Handle when a new output is added */\n",
+ " events.on('output_added.OutputArea', handleAddOutput);\n",
+ "\n",
+ " /**\n",
+ " * Register the mime type and append_mime function with output_area\n",
+ " */\n",
+ " OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n",
+ " /* Is output safe? */\n",
+ " safe: true,\n",
+ " /* Index of renderer in `output_area.display_order` */\n",
+ " index: 0\n",
+ " });\n",
+ " }\n",
+ "\n",
+ " // register the mime type if in Jupyter Notebook environment and previously unregistered\n",
+ " if (root.Jupyter !== undefined) {\n",
+ " const events = require('base/js/events');\n",
+ " const OutputArea = require('notebook/js/outputarea').OutputArea;\n",
+ "\n",
+ " if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n",
+ " register_renderer(events, OutputArea);\n",
+ " }\n",
+ " }\n",
+ "\n",
+ " \n",
+ " if (typeof (root._bokeh_timeout) === \"undefined\" || force === true) {\n",
+ " root._bokeh_timeout = Date.now() + 5000;\n",
+ " root._bokeh_failed_load = false;\n",
+ " }\n",
+ "\n",
+ " const NB_LOAD_WARNING = {'data': {'text/html':\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"
\n",
+ "
\n",
+ "
Loading BokehJS ...\n",
+ "
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n",
+ " \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n",
+ " \"- use INLINE resources instead, as so:
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"
\\n\"+\n",
+ " \"from bokeh.resources import INLINE\\n\"+\n",
+ " \"output_notebook(resources=INLINE)\\n\"+\n",
+ " \"\\n\"+\n",
+ " \"
\\n\"+\n \"
\\n\"+\n \"BokehJS does not appear to have successfully loaded. If loading BokehJS from CDN, this \\n\"+\n \"may be due to a slow or bad network connection. Possible fixes:\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"- re-rerun `output_notebook()` to attempt to load from CDN again, or
\\n\"+\n \"- use INLINE resources instead, as so:
\\n\"+\n \"
\\n\"+\n \"
\\n\"+\n \"from bokeh.resources import INLINE\\n\"+\n \"output_notebook(resources=INLINE)\\n\"+\n \"\\n\"+\n \"