diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml
new file mode 100644
index 0000000..863258e
--- /dev/null
+++ b/.github/workflows/ci.yml
@@ -0,0 +1,31 @@
+name: Start pinspire CI
+
+on:
+  workflow_dispatch: {}
+  push: {}
+  pull_request:
+    types: [opened, edited, reopened]
+  
+jobs:
+  test:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Get repository code
+        uses: actions/checkout@v4
+      - name: Test application
+        continue-on-error: true
+        run: go test ./...
+  lint:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Get repository code
+        uses: actions/checkout@v4
+      - name: Lint application
+        run: make lint
+  build:  
+    runs-on: ubuntu-latest
+    steps:
+      - name: Get repository code
+        uses: actions/checkout@v4    
+      - name: Build application
+        run: make build_all
diff --git a/.github/workflows/deployment.yml b/.github/workflows/deployment.yml
new file mode 100644
index 0000000..b2fda69
--- /dev/null
+++ b/.github/workflows/deployment.yml
@@ -0,0 +1,58 @@
+name: Start Pinspire deployment
+
+on:
+  workflow_dispatch: {}
+  push:
+    branches:
+      - main
+      - dev4
+      
+jobs:
+  build_images:
+    runs-on: ubuntu-latest
+    steps:
+      - name: get repository code
+        uses: actions/checkout@v4
+      - name: Login to DockerHub Registry
+        run: echo ${{ secrets.DOCKERHUB_PASSWORD }} | docker login -u ${{ secrets.DOCKERHUB_USERNAME }} --password-stdin
+      - name: Build docker images of services
+        run: |
+          docker build -t pinspireapp/main:latest -f deployments/Dockerfile.main . &
+          docker build -t pinspireapp/auth:latest -f deployments/Dockerfile.auth . &
+          docker build -t pinspireapp/realtime:latest -f deployments/Dockerfile.realtime . &
+          docker build -t pinspireapp/messenger:latest -f deployments/Dockerfile.messenger . &
+          for p in $(jobs -p); do wait "$p" || { echo "job $p failed" >&2; exit; }; done
+      - name: Push docker images
+        run: |
+          docker push pinspireapp/main:latest &
+          docker push pinspireapp/auth:latest &
+          docker push pinspireapp/realtime:latest &
+          docker push pinspireapp/messenger:latest &
+          for p in $(jobs -p); do wait "$p" || { echo "job $p failed" >&2; exit; }; done
+  
+  deploy:
+    runs-on: ubuntu-latest
+    needs: build_images
+    steps:
+      - name: fetch changes
+        uses: appleboy/ssh-action@master
+        with:
+          host: pinspire.site
+          username: ${{ secrets.REMOTE_USERNAME }}
+          key: ${{ secrets.PRIVATE_KEY }}
+          script: |
+            cd ${{ secrets.PINSPIRE_BACKEND_PATH }}
+            sudo git switch dev4
+            sudo git pull
+      - name: deploy application
+        uses: appleboy/ssh-action@master
+        with:
+          host: pinspire.site
+          username: ${{ secrets.REMOTE_USERNAME }}
+          key: ${{ secrets.PRIVATE_KEY }}
+          script: |
+            cd ${{ secrets.PINSPIRE_BACKEND_PATH }}/deployments 
+            sudo docker compose down main_service auth_service realtime_service messenger_service
+            sudo docker rmi pinspireapp/main:latest pinspireapp/auth:latest pinspireapp/realtime:latest pinspireapp/messenger:latest
+            sudo docker compose -f docker-compose.yml -f compose.prod.yml up -d
+      
diff --git a/.gitignore b/.gitignore
index 1d94894..ad9c3ba 100644
--- a/.gitignore
+++ b/.gitignore
@@ -25,3 +25,6 @@ testdata/
 cert/
 .env
 redis.conf
+inventory
+keyVision.json
+script*
\ No newline at end of file
diff --git a/Makefile b/Makefile
index 75dc439..f054d18 100644
--- a/Makefile
+++ b/Makefile
@@ -1,14 +1,31 @@
 .PHONY: build run test test_with_coverage cleantest retest doc generate cover_all currcover
+.PHONY: build_auth  build_realtime build_messenger build_all
+.PHONY: .install-linter lint lint-fast
+
 ENTRYPOINT=cmd/app/main.go
 DOC_DIR=./docs
 COV_OUT=coverage.out
 COV_HTML=coverage.html
 CURRCOVER=github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1
 
+PROJECT_BIN = $(CURDIR)/bin
+$(shell [ -f bin ] || mkdir -p $(PROJECT_BIN))
+GOLANGCI_LINT = $(PROJECT_BIN)/golangci-lint
 
 build:
 	go build -o bin/app cmd/app/*.go
 
+build_auth:
+	go build -o bin/auth cmd/auth/*.go
+
+build_realtime:
+	go build -o bin/realtime cmd/realtime/*.go
+
+build_messenger:
+	go build -o bin/messenger cmd/messenger/*.go
+
+build_all: build build_auth build_realtime build_messenger
+
 run: build
 	./bin/app
 
@@ -40,3 +57,12 @@ cover_all:
 currcover:
 	go test -cover -v -coverprofile=cover.out ${CURRCOVER}
 	go tool cover -html=cover.out -o cover.html
+
+.install-linter:
+	[ -f $(PROJECT_BIN)/golangci-lint ] || curl -sSfL https://raw.githubusercontent.com/golangci/golangci-lint/master/install.sh | sh -s -- -b $(PROJECT_BIN) v1.55.2
+
+lint: .install-linter
+	$(GOLANGCI_LINT) run ./... --config=configs/.golangci.yml
+
+lint-fast: .install-linter
+	$(GOLANGCI_LINT) run ./... --fast --config=configs/.golangci.yml
diff --git a/api/proto/auth.proto b/api/proto/auth.proto
new file mode 100644
index 0000000..b819a5c
--- /dev/null
+++ b/api/proto/auth.proto
@@ -0,0 +1,41 @@
+syntax = "proto3";
+
+import "google/protobuf/empty.proto";
+import "google/protobuf/timestamp.proto";
+
+option go_package = "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/auth";
+
+package auth;
+
+service Auth {
+    rpc Register(RegisterData) returns (google.protobuf.Empty) {}
+    rpc Login(Credentials) returns (Session) {}
+    rpc Logout(Session) returns (google.protobuf.Empty) {}
+    rpc GetUserID(Session) returns (UserID) {}
+}
+
+message Credentials {
+    string password = 1;
+    string username = 2;
+}
+
+message RegisterData {
+    Credentials cred = 1;
+    string email = 2;
+}
+
+message User {
+    int64 id = 1;
+    string username = 2;
+    string avatar = 3;
+}
+
+message Session {
+    string key = 1;
+    int64 userID = 2;
+    google.protobuf.Timestamp expire = 3;
+}
+
+message UserID {
+    int64 id = 1;
+}
\ No newline at end of file
diff --git a/api/proto/messenger.proto b/api/proto/messenger.proto
new file mode 100644
index 0000000..07a0dec
--- /dev/null
+++ b/api/proto/messenger.proto
@@ -0,0 +1,64 @@
+syntax = "proto3";
+
+import "google/protobuf/empty.proto";
+
+option go_package = "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger";
+
+package messenger;
+
+service Messenger {
+    rpc UserChatsWithOtherUsers(FeedChatRequest) returns (FeedChat) {}
+    rpc SendMessage(Message) returns (MsgID) {}
+    rpc MessageFromChat(FeedMessageRequest) returns (FeedMessage) {}
+    rpc UpdateMessage(Message) returns (google.protobuf.Empty) {}
+    rpc DeleteMessage(MsgID) returns (google.protobuf.Empty) {}
+    rpc GetMessage(MsgID) returns (Message) {}
+}
+
+message MsgID {
+    int64 id = 1;
+}
+
+message Message {
+    MsgID id = 1;
+    int64 user_from = 2;
+    int64 user_to = 3;
+    string content = 4;
+}
+
+message Chat {
+    int64 userID1 = 1;
+    int64 userID2 = 2;
+}
+
+message FeedChatRequest {
+    int64 count = 1;
+    int64 lastID = 2;
+}
+
+message FeedMessageRequest {
+    Chat chat = 1;
+    int64 count = 2;
+    int64 lastID = 3;
+}
+
+message WichWhomChat {
+    int64 userID = 1;
+    string username = 2;
+    string avatar = 3;
+}
+
+message ChatWithUser {
+    int64 lastMessageID = 1;
+    WichWhomChat chat = 2;
+}
+
+message FeedMessage {
+    repeated Message messages = 1;
+    int64 lastID = 2;
+}
+
+message FeedChat {
+    repeated ChatWithUser chats = 1;
+    int64 lastID = 2;
+}
diff --git a/api/proto/realtime.proto b/api/proto/realtime.proto
new file mode 100644
index 0000000..3fca899
--- /dev/null
+++ b/api/proto/realtime.proto
@@ -0,0 +1,49 @@
+syntax = "proto3";
+
+import "google/protobuf/empty.proto";
+
+option go_package = "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime";
+
+package realtime;
+
+service RealTime {
+    rpc Publish(PublishMessage) returns (google.protobuf.Empty) {}
+    rpc Subscribe(Channels) returns (stream Message) {}
+}
+
+message Channels {
+    repeated Channel chans = 1;
+}
+
+message Channel {
+    string topic = 1;
+    string name = 2;
+}
+
+enum EventType {
+    EV_CREATE = 0;
+    EV_DELETE = 1;
+    EV_UPDATE = 2;
+}
+
+message EventObject {
+    int64 id = 1;
+    EventType type = 2;
+}
+
+message EventMap {
+    int64 type = 1;
+    map<string, string> m = 2;
+}
+
+message Message {
+    oneof body {
+        EventObject object = 1;
+        EventMap content = 2;
+    }
+}
+
+message PublishMessage {
+    Channel channel = 1;
+    Message message = 2;
+}
diff --git a/cmd/app/config.go b/cmd/app/config.go
deleted file mode 100644
index a59b192..0000000
--- a/cmd/app/config.go
+++ /dev/null
@@ -1,8 +0,0 @@
-package main
-
-import "github.com/go-park-mail-ru/2023_2_OND_team/internal/app"
-
-var configFiles = app.ConfigFiles{
-	ServerConfigFile: "configs/config.yml",
-	RedisConfigFile:  "redis.conf",
-}
diff --git a/cmd/app/main.go b/cmd/app/main.go
index 3d4dbb6..c571572 100644
--- a/cmd/app/main.go
+++ b/cmd/app/main.go
@@ -2,10 +2,18 @@ package main
 
 import (
 	"context"
+	"flag"
 	"fmt"
+	"os"
 
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/app"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/joho/godotenv"
+)
+
+var (
+	logOutput      = flag.String("log", "stdout", "file paths to write logging output to")
+	logErrorOutput = flag.String("logerror", "stderr", "path to write internal logger errors to.")
 )
 
 //	@title			Pinspire API
@@ -21,15 +29,25 @@ import (
 //	@license.url	http://www.apache.org/licenses/LICENSE-2.0.html
 
 func main() {
+	godotenv.Load()
+	flag.Parse()
 	ctxBase, cancel := context.WithCancel(context.Background())
 	defer cancel()
 
-	log, err := logger.New(logger.RFC3339FormatTime())
+	log, err := logger.New(
+		logger.RFC3339FormatTime(),
+		logger.SetOutputPaths(*logOutput),
+		logger.SetErrorOutputPaths(*logErrorOutput),
+	)
 	if err != nil {
 		fmt.Println(err)
 		return
 	}
 	defer log.Sync()
 
+	configFiles := app.ConfigFiles{
+		ServerConfigFile: "configs/config.yml",
+		AddrAuthServer:   os.Getenv("AUTH_SERVICE_HOST") + ":" + os.Getenv("AUTH_SERVICE_PORT"), // "localhost:8085",
+	}
 	app.Run(ctxBase, log, configFiles)
 }
diff --git a/cmd/auth/config.go b/cmd/auth/config.go
new file mode 100644
index 0000000..2ffd53a
--- /dev/null
+++ b/cmd/auth/config.go
@@ -0,0 +1,8 @@
+package main
+
+import "github.com/go-park-mail-ru/2023_2_OND_team/internal/app/auth"
+
+var configAuth = auth.Config{
+	Addr:            "0.0.0.0:8085",
+	RedisFileConfig: "redis.conf",
+}
diff --git a/cmd/auth/main.go b/cmd/auth/main.go
new file mode 100644
index 0000000..91b055b
--- /dev/null
+++ b/cmd/auth/main.go
@@ -0,0 +1,20 @@
+package main
+
+import (
+	"context"
+	"fmt"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/app/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+func main() {
+	log, err := logger.New(logger.RFC3339FormatTime())
+	if err != nil {
+		fmt.Println(err)
+		return
+	}
+	defer log.Sync()
+
+	auth.Run(context.Background(), log, configAuth)
+}
diff --git a/cmd/messenger/main.go b/cmd/messenger/main.go
new file mode 100644
index 0000000..a9dd91a
--- /dev/null
+++ b/cmd/messenger/main.go
@@ -0,0 +1,20 @@
+package main
+
+import (
+	"context"
+	"fmt"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/app/messenger"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+func main() {
+	log, err := logger.New()
+	if err != nil {
+		fmt.Println(err)
+		return
+	}
+	defer log.Sync()
+
+	messenger.Run(context.Background(), log)
+}
diff --git a/cmd/realtime/main.go b/cmd/realtime/main.go
new file mode 100644
index 0000000..a01f79f
--- /dev/null
+++ b/cmd/realtime/main.go
@@ -0,0 +1,56 @@
+package main
+
+import (
+	"fmt"
+	"net"
+
+	"google.golang.org/grpc"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/realtime"
+	grpcMetrics "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/metrics/grpc"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/grpc/interceptor"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/joho/godotenv"
+)
+
+const _address = "0.0.0.0:8090"
+
+func main() {
+	godotenv.Load()
+	log, err := logger.New()
+	if err != nil {
+		fmt.Println(err)
+		return
+	}
+	if err := RealTimeRun(log, _address); err != nil {
+		log.Error(err.Error())
+	}
+}
+
+func RealTimeRun(log *logger.Logger, addr string) error {
+	l, err := net.Listen("tcp", addr)
+	if err != nil {
+		return fmt.Errorf("listen tcp %s: %w", addr, err)
+	}
+
+	metrics := grpcMetrics.New("realtime")
+	if err := metrics.Registry(); err != nil {
+		log.Error(err.Error())
+		return err
+	}
+
+	node, err := realtime.NewNode()
+	if err != nil {
+		return fmt.Errorf("new server node: %w", err)
+	}
+
+	serv := grpc.NewServer(grpc.ChainUnaryInterceptor(
+		interceptor.Monitoring(metrics, "0.0.0.0:8091"),
+		interceptor.Logger(log),
+	))
+	rt.RegisterRealTimeServer(serv, realtime.NewServer(node))
+
+	log.Info("start realtime server", logger.F{"network", "tcp"}, logger.F{"addr", addr})
+	return serv.Serve(l)
+}
diff --git a/configs/.golangci.yml b/configs/.golangci.yml
new file mode 100644
index 0000000..52e544b
--- /dev/null
+++ b/configs/.golangci.yml
@@ -0,0 +1,206 @@
+# This code is licensed under the terms of the MIT license https://opensource.org/license/mit
+# Copyright (c) 2021 Marat Reymers
+
+## Golden config for golangci-lint v1.55.2
+#
+# This is the best config for golangci-lint based on my experience and opinion.
+# It is very strict, but not extremely strict.
+# Feel free to adapt and change it for your needs.
+
+run:
+  # Timeout for analysis, e.g. 30s, 5m.
+  # Default: 1m
+  timeout: 3m
+  skip-dirs:
+    ..
+
+
+
+# This file contains only configs which differ from defaults.
+# All possible options can be found here https://github.com/golangci/golangci-lint/blob/master/.golangci.reference.yml
+linters-settings:
+  cyclop:
+    # The maximal code complexity to report.
+    # Default: 10
+    max-complexity: 30
+    # The maximal average package complexity.
+    # If it's higher than 0.0 (float) the check is enabled
+    # Default: 0.0
+    package-average: 10.0
+
+  errcheck:
+    # Report about not checking of errors in type assertions: `a := b.(MyStruct)`.
+    # Such cases aren't reported by default.
+    # Default: false
+    check-type-assertions: true
+
+  exhaustive:
+    # Program elements to check for exhaustiveness.
+    # Default: [ switch ]
+    check:
+      - switch
+      - map
+
+  exhaustruct:
+    # List of regular expressions to exclude struct packages and names from check.
+    # Default: []
+    exclude:
+      # std libs
+      - "^net/http.Client$"
+      - "^net/http.Cookie$"
+      - "^net/http.Request$"
+      - "^net/http.Response$"
+      - "^net/http.Server$"
+      - "^net/http.Transport$"
+      - "^net/url.URL$"
+      - "^os/exec.Cmd$"
+      - "^reflect.StructField$"
+      # public libs
+      - "^github.com/Shopify/sarama.Config$"
+      - "^github.com/Shopify/sarama.ProducerMessage$"
+      - "^github.com/mitchellh/mapstructure.DecoderConfig$"
+      - "^github.com/prometheus/client_golang/.+Opts$"
+      - "^github.com/spf13/cobra.Command$"
+      - "^github.com/spf13/cobra.CompletionOptions$"
+      - "^github.com/stretchr/testify/mock.Mock$"
+      - "^github.com/testcontainers/testcontainers-go.+Request$"
+      - "^github.com/testcontainers/testcontainers-go.FromDockerfile$"
+      - "^golang.org/x/tools/go/analysis.Analyzer$"
+      - "^google.golang.org/protobuf/.+Options$"
+      - "^gopkg.in/yaml.v3.Node$"
+
+  funlen:
+    # Checks the number of lines in a function.
+    # If lower than 0, disable the check.
+    # Default: 60
+    lines: 100
+    # Checks the number of statements in a function.
+    # If lower than 0, disable the check.
+    # Default: 40
+    statements: 50
+    # Ignore comments when counting lines.
+    # Default false
+    ignore-comments: true
+
+  gocognit:
+    # Minimal code complexity to report.
+    # Default: 30 (but we recommend 10-20)
+    min-complexity: 20
+
+  gocritic:
+    # Settings passed to gocritic.
+    # The settings key is the name of a supported gocritic checker.
+    # The list of supported checkers can be find in https://go-critic.github.io/overview.
+    settings:
+      captLocal:
+        # Whether to restrict checker to params only.
+        # Default: true
+        paramsOnly: false
+      underef:
+        # Whether to skip (*x).method() calls where x is a pointer receiver.
+        # Default: true
+        skipRecvDeref: false
+
+  gomnd:
+    # List of function patterns to exclude from analysis.
+    # Values always ignored: `time.Date`,
+    # `strconv.FormatInt`, `strconv.FormatUint`, `strconv.FormatFloat`,
+    # `strconv.ParseInt`, `strconv.ParseUint`, `strconv.ParseFloat`.
+    # Default: []
+    ignored-functions:
+      - flag.Arg
+      - flag.Duration.*
+      - flag.Float.*
+      - flag.Int.*
+      - flag.Uint.*
+      - os.Chmod
+      - os.Mkdir.*
+      - os.OpenFile
+      - os.WriteFile
+      - prometheus.ExponentialBuckets.*
+      - prometheus.LinearBuckets
+
+  gomodguard:
+    blocked:
+      # List of blocked modules.
+      # Default: []
+      modules:
+        - github.com/golang/protobuf:
+            recommendations:
+              - google.golang.org/protobuf
+            reason: "see https://developers.google.com/protocol-buffers/docs/reference/go/faq#modules"
+        - github.com/satori/go.uuid:
+            recommendations:
+              - github.com/google/uuid
+            reason: "satori's package is not maintained"
+        - github.com/gofrs/uuid:
+            recommendations:
+              - github.com/google/uuid
+            reason: "gofrs' package is not go module"
+
+  govet:
+    # Enable all analyzers.
+    # Default: false
+    enable-all: true
+    # Disable analyzers by name.
+    # Run `go tool vet help` to see all analyzers.
+    # Default: []
+    disable:
+      - fieldalignment # too strict
+    # Settings per analyzer.
+    settings:
+      shadow:
+        # Whether to be strict about shadowing; can be noisy.
+        # Default: false
+        strict: true
+
+  nakedret:
+    # Make an issue if func has more lines of code than this setting, and it has naked returns.
+    # Default: 30
+    max-func-lines: 0
+
+  nolintlint:
+    # Exclude following linters from requiring an explanation.
+    # Default: []
+    allow-no-explanation: [ funlen, gocognit, lll ]
+    # Enable to require an explanation of nonzero length after each nolint directive.
+    # Default: false
+    require-explanation: true
+    # Enable to require nolint directives to mention the specific linter being suppressed.
+    # Default: false
+    require-specific: true
+
+  rowserrcheck:
+    # database/sql is always checked
+    # Default: []
+    packages:
+      - github.com/jmoiron/sqlx
+
+  tenv:
+    # The option `all` will run against whole test files (`_test.go`) regardless of method/function signatures.
+    # Otherwise, only methods that take `*testing.T`, `*testing.B`, and `testing.TB` as arguments are checked.
+    # Default: false
+    all: true
+
+  
+issues:
+  # Maximum count of issues with the same text.
+  # Set to 0 to disable.
+  # Default: 3
+  exclude-use-default: true
+  max-same-issues: 50
+
+  exclude-rules:
+    - source: "(noinspection|TODO)"
+      linters: [ godot ]
+    - source: "//noinspection"
+      linters: [ gocritic ]
+    - path: "_test\\.go"
+      linters:
+        - bodyclose
+        - dupl
+        - funlen
+        - goconst
+        - gosec
+        - noctx
+        - wrapcheck
\ No newline at end of file
diff --git a/configs/config.yml b/configs/config.yml
index 4d1fda6..87b2acd 100644
--- a/configs/config.yml
+++ b/configs/config.yml
@@ -2,6 +2,6 @@ app:
   server:
     host: 0.0.0.0
     port: 8080
-    https: false
+    https: true
     certFile: /home/ond_team/cert/fullchain.pem
     keyFile: /home/ond_team/cert/privkey.pem
diff --git a/configs/playbook.yml b/configs/playbook.yml
new file mode 100644
index 0000000..2e134dc
--- /dev/null
+++ b/configs/playbook.yml
@@ -0,0 +1,18 @@
+- name: "Provide configuration files"
+  become: yes
+  hosts: pinspire
+  tasks:
+    - name: "Provide .env file"
+      copy:
+        src: ../.env
+        dest: /home/ond_team/go/src/github.com/go-park-mail-ru/{{ item }}/.env
+      with_items:
+        - ci-cd
+        - 2023_2_OND_team
+    - name: "Provide redis config"
+      copy:
+        src: ../redis.conf
+        dest: /home/ond_team/go/src/github.com/go-park-mail-ru/{{ item }}/redis.conf
+      with_items:
+      - ci-cd
+      - 2023_2_OND_team
diff --git a/configs/prometheus.yml b/configs/prometheus.yml
new file mode 100644
index 0000000..a65d7b8
--- /dev/null
+++ b/configs/prometheus.yml
@@ -0,0 +1,29 @@
+global:
+  scrape_interval:     10s
+  evaluation_interval: 10s
+
+scrape_configs:
+  - job_name: 'api'
+    static_configs:
+      - targets: ['main_service:8079']
+
+  - job_name: 'auth'
+    static_configs:
+      - targets: ['auth_service:8086']
+
+  - job_name: 'messenger'
+    static_configs:
+      - targets: ['messenger_service:8096']
+
+  - job_name: 'realtime'
+    static_configs:
+      - targets: ['realtime_service:8091']
+  
+  - job_name: 'node_exporter'
+    static_configs:
+      - targets: ['node_exporter:9100']
+  
+  - job_name: 'pinspire'
+    scheme: https
+    static_configs:
+    - targets: ['pinspire.online:8080']
diff --git a/deployments/Dockerfile.auth b/deployments/Dockerfile.auth
new file mode 100644
index 0000000..74b9443
--- /dev/null
+++ b/deployments/Dockerfile.auth
@@ -0,0 +1,20 @@
+FROM golang:1.19.13-alpine AS build
+
+RUN apk --no-cache add make
+
+WORKDIR /pinspire
+
+COPY go.mod go.sum /pinspire/
+RUN go mod download
+
+COPY . .
+
+RUN make build_auth
+
+FROM alpine:latest
+
+WORKDIR /
+
+COPY --from=build /pinspire/bin/auth .
+
+ENTRYPOINT [ "./auth" ]
diff --git a/deployments/Dockerfile.main b/deployments/Dockerfile.main
new file mode 100644
index 0000000..4d500c8
--- /dev/null
+++ b/deployments/Dockerfile.main
@@ -0,0 +1,21 @@
+FROM golang:1.19.13-alpine AS build
+
+RUN apk --no-cache add make
+
+WORKDIR /pinspire
+
+COPY go.mod go.sum /pinspire/
+RUN go mod download
+
+COPY . .
+
+RUN make build
+
+FROM alpine:latest
+
+WORKDIR /
+
+COPY --from=build /pinspire/bin/app .
+COPY --from=build /pinspire/configs configs
+
+ENTRYPOINT [ "./app" ]
diff --git a/deployments/Dockerfile.messenger b/deployments/Dockerfile.messenger
new file mode 100644
index 0000000..cdaec41
--- /dev/null
+++ b/deployments/Dockerfile.messenger
@@ -0,0 +1,20 @@
+FROM golang:1.19.13-alpine AS build
+
+RUN apk --no-cache add make
+
+WORKDIR /pinspire
+
+COPY go.mod go.sum /pinspire/
+RUN go mod download
+
+COPY . .
+
+RUN make build_messenger
+
+FROM alpine:latest
+
+WORKDIR /
+
+COPY --from=build /pinspire/bin/messenger .
+
+ENTRYPOINT [ "./messenger" ]
diff --git a/deployments/Dockerfile.realtime b/deployments/Dockerfile.realtime
new file mode 100644
index 0000000..da5610f
--- /dev/null
+++ b/deployments/Dockerfile.realtime
@@ -0,0 +1,20 @@
+FROM golang:1.19.13-alpine AS build
+
+RUN apk --no-cache add make
+
+WORKDIR /pinspire
+
+COPY go.mod go.sum /pinspire/
+RUN go mod download
+
+COPY . .
+
+RUN make build_realtime
+
+FROM alpine:latest
+
+WORKDIR /
+
+COPY --from=build /pinspire/bin/realtime .
+
+ENTRYPOINT [ "./realtime" ]
diff --git a/deployments/compose.prod.yml b/deployments/compose.prod.yml
new file mode 100644
index 0000000..5156d5d
--- /dev/null
+++ b/deployments/compose.prod.yml
@@ -0,0 +1,14 @@
+version: '3.8'
+
+services:
+  main_service:
+    image: pinspireapp/main:latest
+
+  auth_service:
+    image: pinspireapp/auth:latest
+
+  messenger_service:
+    image: pinspireapp/messenger:latest
+    
+  realtime_service:
+    image: pinspireapp/realtime:latest
diff --git a/deployments/docker-compose.yml b/deployments/docker-compose.yml
index ba817e0..a06c4cc 100644
--- a/deployments/docker-compose.yml
+++ b/deployments/docker-compose.yml
@@ -8,14 +8,194 @@ services:
       - ../.env
     volumes:
       - ../db/migrations:/docker-entrypoint-initdb.d
+      - 'postgres_storage:/var/lib/postgresql/data'
     ports:
       - 5432:5432
-
+    healthcheck:
+      test: ["CMD", "pg_isready"]
+      interval: 5s
+      timeout: 5s
+      retries: 10
+      start_period: 15s
+      
   redis:
     image: redis:latest
     container_name: pinspireRedis
     volumes:
       - ../redis.conf:/usr/local/etc/redis/redis.conf
+      - 'redis_storage:/data'
     command: redis-server /usr/local/etc/redis/redis.conf
     ports:
         - 6379:6379
+    healthcheck:
+      test: ["CMD", "redis-cli", "ping"]
+      interval: 5s
+      timeout: 5s
+      retries: 10
+      start_period: 15s
+
+  main_service:
+    build: 
+      context: ./..
+      dockerfile: deployments/Dockerfile.main
+    container_name: pinspireMainService
+    env_file:
+     - ../.env
+    environment:
+      - POSTGRES_HOST=postgres
+      - AUTH_SERVICE_HOST=auth_service
+      - MESSENGER_SERVICE_HOST=messenger_service
+      - REALTIME_SERVICE_HOST=realtime_service
+    volumes:
+      - '/home/ond_team/cert/fullchain.pem:/home/ond_team/cert/fullchain.pem:ro'
+      - '/home/ond_team/cert/privkey.pem:/home/ond_team/cert/privkey.pem:ro'
+      - '/home/ond_team/go/src/github.com/go-park-mail-ru/ci-cd/upload:/upload'
+    depends_on:
+      postgres:
+        condition: 'service_healthy'
+      auth_service:
+        condition: 'service_started'
+      messenger_service:
+        condition: 'service_started'
+      realtime_service:
+        condition: 'service_started'
+    ports:
+    - 8079:8080
+    
+  auth_service:
+    build:
+      context: ./..
+      dockerfile: deployments/Dockerfile.auth
+    container_name: pinspireAuthService
+    env_file:
+     - ../.env
+    environment:
+      - POSTGRES_HOST=postgres
+      - REDIS_HOST=redis
+    depends_on:
+      postgres:
+        condition: 'service_healthy'
+      redis:
+        condition: 'service_healthy'
+    ports:
+    - 8186:8086
+    # - 8101:8085
+
+  messenger_service:
+    build:
+      context: ./..
+      dockerfile: deployments/Dockerfile.messenger
+    container_name: pinspireMessengerService
+    env_file:
+     - ../.env
+    environment:
+      - POSTGRES_HOST=postgres
+    depends_on:
+      postgres:
+        condition: 'service_healthy'
+    ports:
+      - 8196:8096
+    # - 8102:8095
+    
+  realtime_service:
+    build:
+      context: ./..
+      dockerfile: deployments/Dockerfile.realtime
+    container_name: pinspireRealtimeService
+    env_file:
+     - ../.env
+    environment:
+      - KAFKA_BROKER_ADDRESS=kafka
+      - KAFKA_BROKER_PORT=29092
+    depends_on:
+      kafka:
+        condition: 'service_healthy'
+    ports:
+    - 8191:8091
+    # - 8103:8090
+
+  zookeeper:
+    image: bitnami/zookeeper:latest
+    container_name: pinspireZookeeper
+    ports:
+      - "2181:2181"
+    volumes:
+      - "zookeeper_data:/bitnami"
+    environment:
+      - ALLOW_ANONYMOUS_LOGIN=yes
+    healthcheck:
+      test: |
+       curl localhost:2181 
+       [ $(echo $?) = '52' ] && exit 0 || exit -1
+      interval: 5s
+      timeout: 5s
+      retries: 10
+      start_period: 15s
+
+  kafka:
+    image: bitnami/kafka:latest
+    container_name: pinspireKafka
+    ports:
+      - "9092:9092"
+    volumes:
+      - "kafka_data:/bitnami"
+    environment:
+      - KAFKA_CFG_ZOOKEEPER_CONNECT=zookeeper:2181
+      - ALLOW_PLAINTEXT_LISTENER=yes
+      - KAFKA_CFG_LISTENER_SECURITY_PROTOCOL_MAP=CLIENT:PLAINTEXT,EXTERNAL:PLAINTEXT
+      - KAFKA_CFG_LISTENERS=CLIENT://:29092,EXTERNAL://:9092
+      - KAFKA_CFG_ADVERTISED_LISTENERS=CLIENT://kafka:29092,EXTERNAL://localhost:9092
+      - KAFKA_CFG_INTER_BROKER_LISTENER_NAME=CLIENT
+    healthcheck:
+      test: |
+       curl localhost:9092 
+       [ $(echo $?) = '52' ] && exit 0 || exit -1
+      interval: 5s
+      timeout: 5s
+      retries: 10
+      start_period: 15s
+    depends_on:
+      zookeeper:
+        condition: 'service_healthy'
+  
+  prometheus:
+    image: prom/prometheus:latest
+    container_name: pinspirePrometheus
+    ports:
+      - "9090:9090"
+    volumes:
+      - "../configs/prometheus.yml:/etc/prometheus/prometheus.yml"
+
+  grafana:
+    image: grafana/grafana:latest
+    container_name: pinspireGrafana
+    env_file:
+      - ../.env
+    ports:
+      - 3000:3000
+    volumes:
+     - 'grafana_storage:/var/lib/grafana'
+  
+  node_exporter:
+    image: quay.io/prometheus/node-exporter:latest
+    container_name: pinspireNodeExporter
+    user: root
+    privileged: true
+    command:
+      - '--path.procfs=/host/proc'
+      - '--path.sysfs=/host/sys'
+    volumes:
+      - /proc:/host/proc:ro
+      - /sys:/host/sys:ro
+      - /:/rootfs:ro
+    ports:
+     - "9100:9100"
+    
+volumes:
+  postgres_storage: {}
+  redis_storage: {}
+  zookeeper_data:
+    driver: local
+  kafka_data:
+    driver: local
+  grafana_storage: {}
diff --git a/go.mod b/go.mod
index 1919958..64ddf05 100644
--- a/go.mod
+++ b/go.mod
@@ -3,15 +3,21 @@ module github.com/go-park-mail-ru/2023_2_OND_team
 go 1.19
 
 require (
+	cloud.google.com/go/vision v1.2.0
+	cloud.google.com/go/vision/v2 v2.7.5
+	github.com/IBM/sarama v1.42.1
 	github.com/Masterminds/squirrel v1.5.4
 	github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2
 	github.com/go-chi/chi/v5 v5.0.10
 	github.com/golang/mock v1.6.0
-	github.com/google/uuid v1.3.1
+	github.com/golang/protobuf v1.5.3
+	github.com/google/uuid v1.4.0
 	github.com/jackc/pgx/v5 v5.4.3
 	github.com/joho/godotenv v1.5.1
+	github.com/mailru/easyjson v0.7.7
 	github.com/microcosm-cc/bluemonday v1.0.26
 	github.com/pashagolub/pgxmock/v2 v2.12.0
+	github.com/prometheus/client_golang v1.17.0
 	github.com/proullon/ramsql v0.0.1
 	github.com/redis/go-redis/v9 v9.2.1
 	github.com/rs/cors v1.10.1
@@ -23,18 +29,30 @@ require (
 	go.uber.org/zap v1.26.0
 	golang.org/x/crypto v0.14.0
 	golang.org/x/image v0.13.0
+	google.golang.org/grpc v1.60.0
+	google.golang.org/protobuf v1.31.0
+	nhooyr.io/websocket v1.8.10
 )
 
 require (
+	cloud.google.com/go v0.111.0 // indirect
+	cloud.google.com/go/compute v1.23.3 // indirect
+	cloud.google.com/go/compute/metadata v0.2.3 // indirect
+	cloud.google.com/go/longrunning v0.5.4 // indirect
 	github.com/ByteArena/poly2tri-go v0.0.0-20170716161910-d102ad91854f // indirect
 	github.com/KyleBanks/depth v1.2.1 // indirect
+	github.com/TwiN/go-away v1.6.12 // indirect
 	github.com/aymerick/douceur v0.2.0 // indirect
 	github.com/benoitkugler/textlayout v0.3.0 // indirect
 	github.com/benoitkugler/textprocessing v0.0.3 // indirect
+	github.com/beorn7/perks v1.0.1 // indirect
 	github.com/cespare/xxhash/v2 v2.2.0 // indirect
 	github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc // indirect
 	github.com/dgryski/go-rendezvous v0.0.0-20200823014737-9f7001d12a5f // indirect
 	github.com/dsnet/compress v0.0.1 // indirect
+	github.com/eapache/go-resiliency v1.4.0 // indirect
+	github.com/eapache/go-xerial-snappy v0.0.0-20230731223053-c322873962e3 // indirect
+	github.com/eapache/queue v1.1.0 // indirect
 	github.com/go-fonts/latin-modern v0.3.1 // indirect
 	github.com/go-openapi/jsonpointer v0.20.0 // indirect
 	github.com/go-openapi/jsonreference v0.20.2 // indirect
@@ -42,26 +60,52 @@ require (
 	github.com/go-openapi/swag v0.22.4 // indirect
 	github.com/go-text/typesetting v0.0.0-20231013144250-6cc35dbfae7d // indirect
 	github.com/golang/freetype v0.0.0-20170609003504-e2365dfdc4a0 // indirect
+	github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da // indirect
+	github.com/golang/snappy v0.0.4 // indirect
+	github.com/google/s2a-go v0.1.7 // indirect
+	github.com/googleapis/enterprise-certificate-proxy v0.3.2 // indirect
+	github.com/googleapis/gax-go/v2 v2.12.0 // indirect
 	github.com/gorilla/css v1.0.0 // indirect
+	github.com/hashicorp/errwrap v1.0.0 // indirect
+	github.com/hashicorp/go-multierror v1.1.1 // indirect
+	github.com/hashicorp/go-uuid v1.0.3 // indirect
 	github.com/jackc/pgpassfile v1.0.0 // indirect
 	github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a // indirect
 	github.com/jackc/puddle/v2 v2.2.1 // indirect
+	github.com/jcmturner/aescts/v2 v2.0.0 // indirect
+	github.com/jcmturner/dnsutils/v2 v2.0.0 // indirect
+	github.com/jcmturner/gofork v1.7.6 // indirect
+	github.com/jcmturner/gokrb5/v8 v8.4.4 // indirect
+	github.com/jcmturner/rpc/v2 v2.0.3 // indirect
 	github.com/josharian/intern v1.0.0 // indirect
+	github.com/klauspost/compress v1.16.7 // indirect
 	github.com/lann/builder v0.0.0-20180802200727-47ae307949d0 // indirect
 	github.com/lann/ps v0.0.0-20150810152359-62de8c46ede0 // indirect
-	github.com/mailru/easyjson v0.7.7 // indirect
+	github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 // indirect
+	github.com/pierrec/lz4/v4 v4.1.18 // indirect
 	github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 // indirect
+	github.com/prometheus/client_model v0.5.0 // indirect
+	github.com/prometheus/common v0.45.0 // indirect
+	github.com/prometheus/procfs v0.12.0 // indirect
+	github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475 // indirect
 	github.com/rogpeppe/go-internal v1.11.0 // indirect
 	github.com/swaggo/files v0.0.0-20220610200504-28940afbdbfe // indirect
 	github.com/tdewolff/minify/v2 v2.20.5 // indirect
 	github.com/tdewolff/parse/v2 v2.7.3 // indirect
+	go.opencensus.io v0.24.0 // indirect
 	go.uber.org/multierr v1.10.0 // indirect
-	golang.org/x/lint v0.0.0-20201208152925-83fdc39ff7b5 // indirect
+	golang.org/x/lint v0.0.0-20210508222113-6edffad5e616 // indirect
 	golang.org/x/net v0.17.0 // indirect
+	golang.org/x/oauth2 v0.13.0 // indirect
 	golang.org/x/sync v0.4.0 // indirect
 	golang.org/x/sys v0.13.0 // indirect
-	golang.org/x/text v0.13.0 // indirect
+	golang.org/x/text v0.14.0 // indirect
 	golang.org/x/tools v0.14.0 // indirect
+	google.golang.org/api v0.149.0 // indirect
+	google.golang.org/appengine v1.6.8 // indirect
+	google.golang.org/genproto v0.0.0-20231212172506-995d672761c0 // indirect
+	google.golang.org/genproto/googleapis/api v0.0.0-20231211222908-989df2bf70f3 // indirect
+	google.golang.org/genproto/googleapis/rpc v0.0.0-20231211222908-989df2bf70f3 // indirect
 	gopkg.in/yaml.v2 v2.4.0 // indirect
 	gopkg.in/yaml.v3 v3.0.1 // indirect
 	star-tex.org/x/tex v0.4.0 // indirect
diff --git a/go.sum b/go.sum
index 9f5314b..2c71421 100644
--- a/go.sum
+++ b/go.sum
@@ -1,12 +1,82 @@
+cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+cloud.google.com/go v0.38.0/go.mod h1:990N+gfupTy94rShfmMCWGDn0LpTmnzTp2qbd1dvSRU=
+cloud.google.com/go v0.44.1/go.mod h1:iSa0KzasP4Uvy3f1mN/7PiObzGgflwredwwASm/v6AU=
+cloud.google.com/go v0.44.2/go.mod h1:60680Gw3Yr4ikxnPRS/oxxkBccT6SA1yMk63TGekxKY=
+cloud.google.com/go v0.45.1/go.mod h1:RpBamKRgapWJb87xiFSdk4g1CME7QZg3uwTez+TSTjc=
+cloud.google.com/go v0.46.3/go.mod h1:a6bKKbmY7er1mI7TEI4lsAkts/mkhTSZK8w33B4RAg0=
+cloud.google.com/go v0.50.0/go.mod h1:r9sluTvynVuxRIOHXQEHMFffphuXHOMZMycpNR5e6To=
+cloud.google.com/go v0.52.0/go.mod h1:pXajvRH/6o3+F9jDHZWQ5PbGhn+o8w9qiu/CffaVdO4=
+cloud.google.com/go v0.53.0/go.mod h1:fp/UouUEsRkN6ryDKNW/Upv/JBKnv6WDthjR6+vze6M=
+cloud.google.com/go v0.54.0/go.mod h1:1rq2OEkV3YMf6n/9ZvGWI3GWw0VoqH/1x2nd8Is/bPc=
+cloud.google.com/go v0.56.0/go.mod h1:jr7tqZxxKOVYizybht9+26Z/gUq7tiRzu+ACVAMbKVk=
+cloud.google.com/go v0.57.0/go.mod h1:oXiQ6Rzq3RAkkY7N6t3TcE6jE+CIBBbA36lwQ1JyzZs=
+cloud.google.com/go v0.62.0/go.mod h1:jmCYTdRCQuc1PHIIJ/maLInMho30T/Y0M4hTdTShOYc=
+cloud.google.com/go v0.65.0/go.mod h1:O5N8zS7uWy9vkA9vayVHs65eM1ubvY4h553ofrNHObY=
+cloud.google.com/go v0.72.0/go.mod h1:M+5Vjvlc2wnp6tjzE102Dw08nGShTscUx2nZMufOKPI=
+cloud.google.com/go v0.74.0/go.mod h1:VV1xSbzvo+9QJOxLDaJfTjx5e+MePCpCWwvftOeQmWk=
+cloud.google.com/go v0.78.0/go.mod h1:QjdrLG0uq+YwhjoVOLsS1t7TW8fs36kLs4XO5R5ECHg=
+cloud.google.com/go v0.79.0/go.mod h1:3bzgcEeQlzbuEAYu4mrWhKqWjmpprinYgKJLgKHnbb8=
+cloud.google.com/go v0.81.0/go.mod h1:mk/AM35KwGk/Nm2YSeZbxXdrNK3KZOYHmLkOqC2V6E0=
+cloud.google.com/go v0.83.0/go.mod h1:Z7MJUsANfY0pYPdw0lbnivPx4/vhy/e2FEkSkF7vAVY=
+cloud.google.com/go v0.84.0/go.mod h1:RazrYuxIK6Kb7YrzzhPoLmCVzl7Sup4NrbKPg8KHSUM=
+cloud.google.com/go v0.87.0/go.mod h1:TpDYlFy7vuLzZMMZ+B6iRiELaY7z/gJPaqbMx6mlWcY=
+cloud.google.com/go v0.90.0/go.mod h1:kRX0mNRHe0e2rC6oNakvwQqzyDmg57xJ+SZU1eT2aDQ=
+cloud.google.com/go v0.93.3/go.mod h1:8utlLll2EF5XMAV15woO4lSbWQlk8rer9aLOfLh7+YI=
+cloud.google.com/go v0.94.1/go.mod h1:qAlAugsXlC+JWO+Bke5vCtc9ONxjQT3drlTTnAplMW4=
+cloud.google.com/go v0.97.0/go.mod h1:GF7l59pYBVlXQIBLx3a761cZ41F9bBH3JUlihCt2Udc=
+cloud.google.com/go v0.99.0/go.mod h1:w0Xx2nLzqWJPuozYQX+hFfCSI8WioryfRDzkoI/Y2ZA=
+cloud.google.com/go v0.100.2/go.mod h1:4Xra9TjzAeYHrl5+oeLlzbM2k3mjVhZh4UqTZ//w99A=
+cloud.google.com/go v0.111.0 h1:YHLKNupSD1KqjDbQ3+LVdQ81h/UJbJyZG203cEfnQgM=
+cloud.google.com/go v0.111.0/go.mod h1:0mibmpKP1TyOOFYQY5izo0LnT+ecvOQ0Sg3OdmMiNRU=
+cloud.google.com/go/bigquery v1.0.1/go.mod h1:i/xbL2UlR5RvWAURpBYZTtm/cXjCha9lbfbpx4poX+o=
+cloud.google.com/go/bigquery v1.3.0/go.mod h1:PjpwJnslEMmckchkHFfq+HTD2DmtT67aNFKH1/VBDHE=
+cloud.google.com/go/bigquery v1.4.0/go.mod h1:S8dzgnTigyfTmLBfrtrhyYhwRxG72rYxvftPBK2Dvzc=
+cloud.google.com/go/bigquery v1.5.0/go.mod h1:snEHRnqQbz117VIFhE8bmtwIDY80NLUZUMb4Nv6dBIg=
+cloud.google.com/go/bigquery v1.7.0/go.mod h1://okPTzCYNXSlb24MZs83e2Do+h+VXtc4gLoIoXIAPc=
+cloud.google.com/go/bigquery v1.8.0/go.mod h1:J5hqkt3O0uAFnINi6JXValWIb1v0goeZM77hZzJN/fQ=
+cloud.google.com/go/compute v0.1.0/go.mod h1:GAesmwr110a34z04OlxYkATPBEfVhkymfTBXtfbBFow=
+cloud.google.com/go/compute v1.3.0/go.mod h1:cCZiE1NHEtai4wiufUhW8I8S1JKkAnhnQJWM7YD99wM=
+cloud.google.com/go/compute v1.23.3 h1:6sVlXXBmbd7jNX0Ipq0trII3e4n1/MsADLK6a+aiVlk=
+cloud.google.com/go/compute v1.23.3/go.mod h1:VCgBUoMnIVIR0CscqQiPJLAG25E3ZRZMzcFZeQ+h8CI=
+cloud.google.com/go/compute/metadata v0.2.3 h1:mg4jlk7mCAj6xXp9UJ4fjI9VUI5rubuGBW5aJ7UnBMY=
+cloud.google.com/go/compute/metadata v0.2.3/go.mod h1:VAV5nSsACxMJvgaAuX6Pk2AawlZn8kiOGuCv6gTkwuA=
+cloud.google.com/go/datastore v1.0.0/go.mod h1:LXYbyblFSglQ5pkeyhO+Qmw7ukd3C+pD7TKLgZqpHYE=
+cloud.google.com/go/datastore v1.1.0/go.mod h1:umbIZjpQpHh4hmRpGhH4tLFup+FVzqBi1b3c64qFpCk=
+cloud.google.com/go/longrunning v0.5.4 h1:w8xEcbZodnA2BbW6sVirkkoC+1gP8wS57EUUgGS0GVg=
+cloud.google.com/go/longrunning v0.5.4/go.mod h1:zqNVncI0BOP8ST6XQD1+VcvuShMmq7+xFSzOL++V0dI=
+cloud.google.com/go/pubsub v1.0.1/go.mod h1:R0Gpsv3s54REJCy4fxDixWD93lHJMoZTyQ2kNxGRt3I=
+cloud.google.com/go/pubsub v1.1.0/go.mod h1:EwwdRX2sKPjnvnqCa270oGRyludottCI76h+R3AArQw=
+cloud.google.com/go/pubsub v1.2.0/go.mod h1:jhfEVHT8odbXTkndysNHCcx0awwzvfOlguIAii9o8iA=
+cloud.google.com/go/pubsub v1.3.1/go.mod h1:i+ucay31+CNRpDW4Lu78I4xXG+O1r/MAHgjpRVR+TSU=
+cloud.google.com/go/storage v1.0.0/go.mod h1:IhtSnM/ZTZV8YYJWCY8RULGVqBDmpoyjwiyrjsg+URw=
+cloud.google.com/go/storage v1.5.0/go.mod h1:tpKbwo567HUNpVclU5sGELwQWBDZ8gh0ZeosJ0Rtdos=
+cloud.google.com/go/storage v1.6.0/go.mod h1:N7U0C8pVQ/+NIKOBQyamJIeKQKkZ+mxpohlUTyfDhBk=
+cloud.google.com/go/storage v1.8.0/go.mod h1:Wv1Oy7z6Yz3DshWRJFhqM/UCfaWIRTdp0RXyy7KQOVs=
+cloud.google.com/go/storage v1.10.0/go.mod h1:FLPqc6j+Ki4BU591ie1oL6qBQGu2Bl/tZ9ullr3+Kg0=
+cloud.google.com/go/vision v1.2.0 h1:/CsSTkbmO9HC8iQpxbK8ATms3OQaX3YQUeTMGCxlaK4=
+cloud.google.com/go/vision v1.2.0/go.mod h1:SmNwgObm5DpFBme2xpyOyasvBc1aPdjvMk2bBk0tKD0=
+cloud.google.com/go/vision/v2 v2.7.5 h1:T/ujUghvEaTb+YnFY/jiYwVAkMbIC8EieK0CJo6B4vg=
+cloud.google.com/go/vision/v2 v2.7.5/go.mod h1:GcviprJLFfK9OLf0z8Gm6lQb6ZFUulvpZws+mm6yPLM=
+dmitri.shuralyov.com/gpu/mtl v0.0.0-20190408044501-666a987793e9/go.mod h1:H6x//7gZCb22OMCxBHrMx7a5I7Hp++hsVxbQ4BYO7hU=
 git.sr.ht/~sbinet/gg v0.5.0 h1:6V43j30HM623V329xA9Ntq+WJrMjDxRjuAB1LFWF5m8=
 github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
+github.com/BurntSushi/xgb v0.0.0-20160522181843-27f122750802/go.mod h1:IVnqGOEym/WlBOVXweHU+Q+/VP0lqqI8lqeDx9IjBqo=
 github.com/ByteArena/poly2tri-go v0.0.0-20170716161910-d102ad91854f h1:l7moT9o/v/9acCWA64Yz/HDLqjcRTvc0noQACi4MsJw=
 github.com/ByteArena/poly2tri-go v0.0.0-20170716161910-d102ad91854f/go.mod h1:vIOkSdX3NDCPwgu8FIuTat2zDF0FPXXQ0RYFRy+oQic=
+github.com/IBM/sarama v1.42.1 h1:wugyWa15TDEHh2kvq2gAy1IHLjEjuYOYgXz/ruC/OSQ=
+github.com/IBM/sarama v1.42.1/go.mod h1:Xxho9HkHd4K/MDUo/T/sOqwtX/17D33++E9Wib6hUdQ=
 github.com/KyleBanks/depth v1.2.1 h1:5h8fQADFrWtarTdtDudMmGsC7GPbOAu6RVB3ffsVFHc=
 github.com/KyleBanks/depth v1.2.1/go.mod h1:jzSb9d0L43HxTQfT+oSA1EEp2q+ne2uh6XgeJcm8brE=
 github.com/Masterminds/squirrel v1.5.4 h1:uUcX/aBc8O7Fg9kaISIUsHXdKuqehiXAMQTYX8afzqM=
 github.com/Masterminds/squirrel v1.5.4/go.mod h1:NNaOrjSoIDfDA40n7sr2tPNZRfjzjA400rg+riTZj10=
+github.com/OneOfOne/xxhash v1.2.2/go.mod h1:HSdplMjZKSmBqAxg5vPj2TmRDmfkzw+cTzAElWljhcU=
+github.com/PuerkitoBio/purell v1.1.1/go.mod h1:c11w/QuzBsJSee3cPx9rAFu61PvFxuPbtSwDGJws/X0=
+github.com/PuerkitoBio/urlesc v0.0.0-20170810143723-de5bf2ad4578/go.mod h1:uGdkoq3SwY9Y+13GIhn11/XLaGBb4BfwItxLd5jeuXE=
+github.com/TwiN/go-away v1.6.12 h1:80AjDyeTjfQaSFYbALzRcDKMAmxKW0a5PoxwXKZlW2A=
+github.com/TwiN/go-away v1.6.12/go.mod h1:MpvIC9Li3minq+CGgbgUDvQ9tDaeW35k5IXZrF9MVas=
 github.com/ajstarks/svgo v0.0.0-20211024235047-1546f124cd8b h1:slYM766cy2nI3BwyRiyQj/Ud48djTMtMebDqepE95rw=
+github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2 h1:DklsrG3dyBCFEj5IhUbnKptjxatkF07cF2ak3yi77so=
 github.com/asaskevich/govalidator v0.0.0-20230301143203-a9d515a09cc2/go.mod h1:WaHUgvxTVq04UNunO+XhnAqY/wQc+bxr74GqbsZ/Jqw=
 github.com/aymerick/douceur v0.2.0 h1:Mv+mAeH1Q+n9Fr+oyamOlAkUNPWPlA8PPGR0QAaYuPk=
@@ -17,11 +87,28 @@ github.com/benoitkugler/textlayout v0.3.0/go.mod h1:o+1hFV+JSHBC9qNLIuwVoLedERU7
 github.com/benoitkugler/textlayout-testdata v0.1.1/go.mod h1:i/qZl09BbUOtd7Bu/W1CAubRwTWrEXWq6JwMkw8wYxo=
 github.com/benoitkugler/textprocessing v0.0.3 h1:Q2X+Z6vxuW5Bxn1R9RaNt0qcprBfpc2hEUDeTlz90Ng=
 github.com/benoitkugler/textprocessing v0.0.3/go.mod h1:/4bLyCf1QYywunMK3Gf89Nhb50YI/9POewqrLxWhxd4=
+github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
+github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
 github.com/bsm/ginkgo/v2 v2.12.0 h1:Ny8MWAHyOepLGlLKYmXG4IEkioBysk6GpaRTLC8zwWs=
 github.com/bsm/gomega v1.27.10 h1:yeMWxP2pV2fG3FgAODIY8EiRE3dy0aeFYt4l7wh6yKA=
 github.com/campoy/embedmd v1.0.0 h1:V4kI2qTJJLf4J29RzI/MAt2c3Bl4dQSYPuflzwFH2hY=
+github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
+github.com/cespare/xxhash v1.1.0/go.mod h1:XrSqR1VqqWfGrhpAt58auRo0WTKS1nRRg3ghfAqPWnc=
+github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
 github.com/cespare/xxhash/v2 v2.2.0 h1:DC2CZ1Ep5Y4k3ZQ899DldepgrayRUGE6BBZ/cd9Cj44=
 github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
+github.com/chzyer/logex v1.1.10/go.mod h1:+Ywpsq7O8HXn0nuIou7OrIPyXbp3wmkHB+jjWRnGsAI=
+github.com/chzyer/readline v0.0.0-20180603132655-2972be24d48e/go.mod h1:nSuG5e5PlCu98SY8svDHJxuZscDgtXS6KTTbou5AhLI=
+github.com/chzyer/test v0.0.0-20180213035817-a1ea475d72b1/go.mod h1:Q3SI9o4m/ZMnBNeIyt5eFwwo7qiLfzFZmjNmxjkiQlU=
+github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
+github.com/cncf/udpa/go v0.0.0-20200629203442-efcf912fb354/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
+github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
+github.com/cncf/udpa/go v0.0.0-20210930031921-04548b0d99d4/go.mod h1:6pvJx4me5XPnfI9Z40ddWsdw2W/uZgQLFXToKeRcDiI=
+github.com/cncf/xds/go v0.0.0-20210312221358-fbca930ec8ed/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
+github.com/cncf/xds/go v0.0.0-20210805033703-aa0b78936158/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
+github.com/cncf/xds/go v0.0.0-20210922020428-25de7278fc84/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
+github.com/cncf/xds/go v0.0.0-20211011173535-cb28da3451f1/go.mod h1:eXthEFrGJvWHgFFCl3hGmgk+/aYT6PnTQLykKQRLhEs=
 github.com/creack/pty v1.1.9/go.mod h1:oKZEueFk5CKHvIhNR5MUki03XCEU+Q6VDXinZuGJ33E=
 github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
@@ -32,14 +119,37 @@ github.com/dgryski/go-rendezvous v0.0.0-20200823014737-9f7001d12a5f/go.mod h1:cu
 github.com/dsnet/compress v0.0.1 h1:PlZu0n3Tuv04TzpfPbrnI0HW/YwodEXDS+oPKahKF0Q=
 github.com/dsnet/compress v0.0.1/go.mod h1:Aw8dCMJ7RioblQeTqt88akK31OvO8Dhf5JflhBbQEHo=
 github.com/dsnet/golib v0.0.0-20171103203638-1ea166775780/go.mod h1:Lj+Z9rebOhdfkVLjJ8T6VcRQv3SXugXy999NBtR9aFY=
+github.com/eapache/go-resiliency v1.4.0 h1:3OK9bWpPk5q6pbFAaYSEwD9CLUSHG8bnZuqX2yMt3B0=
+github.com/eapache/go-resiliency v1.4.0/go.mod h1:5yPzW0MIvSe0JDsv0v+DvcjEv2FyD6iZYSs1ZI+iQho=
+github.com/eapache/go-xerial-snappy v0.0.0-20230731223053-c322873962e3 h1:Oy0F4ALJ04o5Qqpdz8XLIpNA3WM/iSIXqxtqo7UGVws=
+github.com/eapache/go-xerial-snappy v0.0.0-20230731223053-c322873962e3/go.mod h1:YvSRo5mw33fLEx1+DlK6L2VV43tJt5Eyel9n9XBcR+0=
+github.com/eapache/queue v1.1.0 h1:YOEu7KNc61ntiQlcEeUIoDTJ2o8mQznoNvUhiigpIqc=
+github.com/eapache/queue v1.1.0/go.mod h1:6eCeP0CKFpHLu8blIFXhExK/dRa7WDZfr6jVFPTqq+I=
+github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98=
+github.com/envoyproxy/go-control-plane v0.9.7/go.mod h1:cwu0lG7PUMfa9snN8LXBig5ynNVH9qI8YYLbd1fK2po=
+github.com/envoyproxy/go-control-plane v0.9.9-0.20201210154907-fd9021fe5dad/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk=
+github.com/envoyproxy/go-control-plane v0.9.9-0.20210217033140-668b12f5399d/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk=
+github.com/envoyproxy/go-control-plane v0.9.9-0.20210512163311-63b5d3c536b0/go.mod h1:hliV/p42l8fGbc6Y9bQ70uLwIvmJyVE5k4iMKlh8wCQ=
+github.com/envoyproxy/go-control-plane v0.9.10-0.20210907150352-cf90f659a021/go.mod h1:AFq3mo9L8Lqqiid3OhADV3RfLJnjiw63cSpi+fDTRC0=
+github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c=
+github.com/fortytw2/leaktest v1.3.0 h1:u8491cBMTQ8ft8aeV+adlcytMZylmA5nnwwkRZjI8vw=
+github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
 github.com/go-chi/chi/v5 v5.0.10 h1:rLz5avzKpjqxrYwXNfmjkrYYXOyLJd37pz53UFHC6vk=
 github.com/go-chi/chi/v5 v5.0.10/go.mod h1:DslCQbL2OYiznFReuXYUmQ2hGd1aDpCnlMNITLSKoi8=
 github.com/go-fonts/latin-modern v0.3.1 h1:/cT8A7uavYKvglYXvrdDw4oS5ZLkcOU22fa2HJ1/JVM=
 github.com/go-fonts/latin-modern v0.3.1/go.mod h1:ysEQXnuT/sCDOAONxC7ImeEDVINbltClhasMAqEtRK0=
 github.com/go-fonts/liberation v0.3.1 h1:9RPT2NhUpxQ7ukUvz3jeUckmN42T9D9TpjtQcqK/ceM=
+github.com/go-gl/glfw v0.0.0-20190409004039-e6da0acd62b1/go.mod h1:vR7hzQXu2zJy9AVAgeJqvqgH9Q5CA+iKCZ2gyEVpxRU=
+github.com/go-gl/glfw/v3.3/glfw v0.0.0-20191125211704-12ad95a8df72/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
+github.com/go-gl/glfw/v3.3/glfw v0.0.0-20200222043503-6f7a984d4dc4/go.mod h1:tQ2UAYgL5IevRw8kRxooKSPJfGvJ9fJQFa0TUsXzTg8=
 github.com/go-gorp/gorp v2.0.0+incompatible h1:dIQPsBtl6/H1MjVseWuWPXa7ET4p6Dve4j3Hg+UjqYw=
 github.com/go-gorp/gorp v2.0.0+incompatible/go.mod h1:7IfkAQnO7jfT/9IQ3R9wL1dFhukN6aQxzKTHnkxzA/E=
 github.com/go-latex/latex v0.0.0-20230307184459-12ec69307ad9 h1:NxXI5pTAtpEaU49bpLpQoDsu1zrteW/vxzTz8Cd2UAs=
+github.com/go-logfmt/logfmt v0.5.1/go.mod h1:WYhtIu8zTZfxdn5+rREduYbwxfcBr/Vr6KEVveWlfTs=
+github.com/go-logr/logr v1.2.4 h1:g01GSCwiDw2xSZfjJ2/T9M+S6pFdcNtFYsp+Y43HYDQ=
+github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag=
 github.com/go-openapi/jsonpointer v0.19.3/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg=
 github.com/go-openapi/jsonpointer v0.19.5/go.mod h1:Pl9vOtqEWErmShwVjC8pYs9cog34VGT37dQOVbmoatg=
 github.com/go-openapi/jsonpointer v0.19.6/go.mod h1:osyAmYz/mB/C3I+WsTTSgw1ONzaLJoLCyoi6/zppojs=
@@ -61,13 +171,108 @@ github.com/go-text/typesetting v0.0.0-20231013144250-6cc35dbfae7d/go.mod h1:evDB
 github.com/go-text/typesetting-utils v0.0.0-20230616150549-2a7df14b6a22 h1:LBQTFxP2MfsyEDqSKmUBZaDuDHN1vpqDyOZjcqS7MYI=
 github.com/golang/freetype v0.0.0-20170609003504-e2365dfdc4a0 h1:DACJavvAHhabrF08vX0COfcOBJRhZ8lUbR+ZWIs0Y5g=
 github.com/golang/freetype v0.0.0-20170609003504-e2365dfdc4a0/go.mod h1:E/TSTwGwJL78qG/PmXZO1EjYhfJinVAhrmmHX6Z8B9k=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
+github.com/golang/groupcache v0.0.0-20190702054246-869f871628b6/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20191227052852-215e87163ea7/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20200121045136-8c9f03a8e57e/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da h1:oI5xCqsCo564l8iNU+DwB5epxmsaqB+rhGL0m5jtYqE=
+github.com/golang/groupcache v0.0.0-20210331224755-41bb18bfe9da/go.mod h1:cIg4eruTrX1D+g88fzRXU5OdNfaM+9IcxsU14FzY7Hc=
+github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
+github.com/golang/mock v1.2.0/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
+github.com/golang/mock v1.3.1/go.mod h1:sBzyDLLjw3U8JLTeZvSv8jJB+tU5PVekmnlKIyFUx0Y=
+github.com/golang/mock v1.4.0/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.1/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.3/go.mod h1:UOMv5ysSaYNkG+OFQykRIcU/QvvxJf3p21QfJ2Bt3cw=
+github.com/golang/mock v1.4.4/go.mod h1:l3mdAwkq5BuhzHwde/uurv3sEJeZMXNpwsxVWU71h+4=
+github.com/golang/mock v1.5.0/go.mod h1:CWnOUgYIOo4TcNZ0wHX3YZCqsaM1I1Jvs6v3mP3KVu8=
 github.com/golang/mock v1.6.0 h1:ErTB+efbowRARo13NNdxyJji2egdxLGQhRaY+DUumQc=
 github.com/golang/mock v1.6.0/go.mod h1:p6yTPP+5HYm5mzsMV8JkE6ZKdX+/wYM6Hr+LicevLPs=
+github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
+github.com/golang/protobuf v1.3.4/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
+github.com/golang/protobuf v1.3.5/go.mod h1:6O5/vntMXwX2lRkT1hjjk0nAC1IDOTvTlVgjlRvqsdk=
+github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
+github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
+github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
+github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
+github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
+github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8=
+github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.5.0/go.mod h1:FsONVRAS9T7sI+LIUmWTfcYkHO4aIWwzhcaSAoJOfIk=
+github.com/golang/protobuf v1.5.1/go.mod h1:DopwsBzvsk0Fs44TXzsVbJyPhcCPeIwnvohx4u74HPM=
+github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
+github.com/golang/protobuf v1.5.3 h1:KhyjKVUg7Usr/dYsdSqoFveMYd5ko72D+zANwlG1mmg=
+github.com/golang/protobuf v1.5.3/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
+github.com/golang/snappy v0.0.3/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q=
+github.com/golang/snappy v0.0.4 h1:yAGX7huGHXlcLOEtBnF4w7FQwA26wojNCwOYAEhLjQM=
+github.com/golang/snappy v0.0.4/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q=
+github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
+github.com/google/btree v1.0.0/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
+github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
+github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.4.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.1/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.2/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.3/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.6/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.7/go.mod h1:n+brtR0CgQNWTVd5ZUFpTBC8YFBDLK/h/bpaJ8/DtOE=
+github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI=
+github.com/google/martian v2.1.0+incompatible/go.mod h1:9I4somxYTbIHy5NJKHRl3wXiIaQGbYVAs8BPL6v8lEs=
+github.com/google/martian/v3 v3.0.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
+github.com/google/martian/v3 v3.1.0/go.mod h1:y5Zk1BBys9G+gd6Jrk0W3cC1+ELVxBWuIGO+w/tUAp0=
+github.com/google/martian/v3 v3.2.1/go.mod h1:oBOf6HBosgwRXnUGWUB05QECsc6uvmMiJ3+6W4l/CUk=
+github.com/google/pprof v0.0.0-20181206194817-3ea8567a2e57/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
+github.com/google/pprof v0.0.0-20190515194954-54271f7e092f/go.mod h1:zfwlbNMJ+OItoe0UupaVj+oy1omPYYDuagoSzA8v9mc=
+github.com/google/pprof v0.0.0-20191218002539-d4f498aebedc/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200212024743-f11f1df84d12/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200229191704-1ebb73c60ed3/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200430221834-fc25d7d30c6d/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20200708004538-1a94d8640e99/go.mod h1:ZgVRPoUq/hfqzAqh7sHMqb3I9Rq5C59dIz2SbBwJ4eM=
+github.com/google/pprof v0.0.0-20201023163331-3e6fc7fc9c4c/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20201203190320-1bf35d6f28c2/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20210122040257-d980be63207e/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20210226084205-cbba55b83ad5/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20210601050228-01bbb1931b22/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20210609004039-a478d1d731e9/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
+github.com/google/pprof v0.0.0-20210720184732-4bb14d4b1be1/go.mod h1:kpwsk12EmLew5upagYY7GY0pfYCcupk39gWOCRROcvE=
 github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI=
-github.com/google/uuid v1.3.1 h1:KjJaJ9iWZ3jOFZIf1Lqf4laDRCasjl0BCmnEGxkdLb4=
-github.com/google/uuid v1.3.1/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/google/s2a-go v0.1.7 h1:60BLSyTrOV4/haCDW4zb1guZItoSq8foHCXrAnjBo/o=
+github.com/google/s2a-go v0.1.7/go.mod h1:50CgR4k1jNlWBu4UfS4AcfhVe1r6pdZPygJ3R8F0Qdw=
+github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/google/uuid v1.4.0 h1:MtMxsa51/r9yyhkyLsVeVt0B+BGQZzpQiTQ4eHZ8bc4=
+github.com/google/uuid v1.4.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/googleapis/enterprise-certificate-proxy v0.3.2 h1:Vie5ybvEvT75RniqhfFxPRy3Bf7vr3h0cechB90XaQs=
+github.com/googleapis/enterprise-certificate-proxy v0.3.2/go.mod h1:VLSiSSBs/ksPL8kq3OBOQ6WRI2QnaFynd1DCjZ62+V0=
+github.com/googleapis/gax-go/v2 v2.0.4/go.mod h1:0Wqv26UfaUD9n4G6kQubkQ+KchISgw+vpHVxEJEs9eg=
+github.com/googleapis/gax-go/v2 v2.0.5/go.mod h1:DWXyrwAJ9X0FpwwEdw+IPEYBICEFu5mhpdKc/us6bOk=
+github.com/googleapis/gax-go/v2 v2.1.0/go.mod h1:Q3nei7sK6ybPYH7twZdmQpAd1MKb7pfu6SK+H1/DsU0=
+github.com/googleapis/gax-go/v2 v2.1.1/go.mod h1:hddJymUZASv3XPyGkUpKj8pPO47Rmb0eJc8R6ouapiM=
+github.com/googleapis/gax-go/v2 v2.12.0 h1:A+gCJKdRfqXkr+BIRGtZLibNXf0m1f9E4HG56etFpas=
+github.com/googleapis/gax-go/v2 v2.12.0/go.mod h1:y+aIqrI5eb1YGMVJfuV3185Ts/D7qKpsEkdD5+I6QGU=
 github.com/gorilla/css v1.0.0 h1:BQqNyPTi50JCFMTw/b67hByjMVXZRwGha6wxVGkeihY=
 github.com/gorilla/css v1.0.0/go.mod h1:Dn721qIggHpt4+EFCcTLTU/vk5ySda2ReITrtgBl60c=
+github.com/gorilla/securecookie v1.1.1/go.mod h1:ra0sb63/xPlUeL+yeDciTfxMRAA+MP+HVt/4epWDjd4=
+github.com/gorilla/sessions v1.2.1/go.mod h1:dk2InVEVJ0sfLlnXv9EAgkf6ecYs/i80K/zI+bUmuGM=
+github.com/grpc-ecosystem/grpc-gateway v1.16.0/go.mod h1:BDjrQk3hbvj6Nolgz8mAMFbcEtjT1g+wF4CSlocrBnw=
+github.com/hashicorp/errwrap v1.0.0 h1:hLrqtEDnRye3+sgx6z4qVLNuviH3MR5aQ0ykNJa/UYA=
+github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-multierror v1.1.1 h1:H5DkEtf6CXdFp0N0Em5UCwQpXMWke8IA0+lD48awMYo=
+github.com/hashicorp/go-multierror v1.1.1/go.mod h1:iw975J/qwKPdAO1clOe2L8331t/9/fmwbPZ6JB6eMoM=
+github.com/hashicorp/go-uuid v1.0.2/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
+github.com/hashicorp/go-uuid v1.0.3 h1:2gKiV6YVmrJ1i2CKKa9obLvRieoRGviZFL26PcT/Co8=
+github.com/hashicorp/go-uuid v1.0.3/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
+github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/ianlancetaylor/demangle v0.0.0-20181102032728-5e5cf60278f6/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
+github.com/ianlancetaylor/demangle v0.0.0-20200824232613-28f6c0f3b639/go.mod h1:aSSvb/t6k1mPoxDqO4vJh6VOCGPwU4O0C2/Eqndh1Sc=
 github.com/jackc/pgpassfile v1.0.0 h1:/6Hmqy13Ss2zCq62VdNG8tM1wchn8zjSGOBJ6icpsIM=
 github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5eyVu/W2HEg=
 github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a h1:bbPeKD0xmW/Y25WS6cokEszi5g+S0QxI/d45PkRi7Nk=
@@ -76,12 +281,31 @@ github.com/jackc/pgx/v5 v5.4.3 h1:cxFyXhxlvAifxnkKKdlxv8XqUf59tDlYjnV5YYfsJJY=
 github.com/jackc/pgx/v5 v5.4.3/go.mod h1:Ig06C2Vu0t5qXC60W8sqIthScaEnFvojjj9dSljmHRA=
 github.com/jackc/puddle/v2 v2.2.1 h1:RhxXJtFG022u4ibrCSMSiu5aOq1i77R3OHKNJj77OAk=
 github.com/jackc/puddle/v2 v2.2.1/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4=
+github.com/jcmturner/aescts/v2 v2.0.0 h1:9YKLH6ey7H4eDBXW8khjYslgyqG2xZikXP0EQFKrle8=
+github.com/jcmturner/aescts/v2 v2.0.0/go.mod h1:AiaICIRyfYg35RUkr8yESTqvSy7csK90qZ5xfvvsoNs=
+github.com/jcmturner/dnsutils/v2 v2.0.0 h1:lltnkeZGL0wILNvrNiVCR6Ro5PGU/SeBvVO/8c/iPbo=
+github.com/jcmturner/dnsutils/v2 v2.0.0/go.mod h1:b0TnjGOvI/n42bZa+hmXL+kFJZsFT7G4t3HTlQ184QM=
+github.com/jcmturner/gofork v1.7.6 h1:QH0l3hzAU1tfT3rZCnW5zXl+orbkNMMRGJfdJjHVETg=
+github.com/jcmturner/gofork v1.7.6/go.mod h1:1622LH6i/EZqLloHfE7IeZ0uEJwMSUyQ/nDd82IeqRo=
+github.com/jcmturner/goidentity/v6 v6.0.1 h1:VKnZd2oEIMorCTsFBnJWbExfNN7yZr3EhJAxwOkZg6o=
+github.com/jcmturner/goidentity/v6 v6.0.1/go.mod h1:X1YW3bgtvwAXju7V3LCIMpY0Gbxyjn/mY9zx4tFonSg=
+github.com/jcmturner/gokrb5/v8 v8.4.4 h1:x1Sv4HaTpepFkXbt2IkL29DXRf8sOfZXo8eRKh687T8=
+github.com/jcmturner/gokrb5/v8 v8.4.4/go.mod h1:1btQEpgT6k+unzCwX1KdWMEwPPkkgBtP+F6aCACiMrs=
+github.com/jcmturner/rpc/v2 v2.0.3 h1:7FXXj8Ti1IaVFpSAziCZWNzbNuZmnvw/i6CqLNdWfZY=
+github.com/jcmturner/rpc/v2 v2.0.3/go.mod h1:VUJYCIDm3PVOEHw8sgt091/20OJjskO/YJki3ELg/Hc=
 github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0=
 github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4=
 github.com/josharian/intern v1.0.0 h1:vlS4z54oSdjm0bgjRigI+G1HpF+tI+9rE5LLzOg8HmY=
 github.com/josharian/intern v1.0.0/go.mod h1:5DoeVV0s6jJacbCEi61lwdGj/aVlrQvzHFFd8Hwg//Y=
+github.com/jpillora/backoff v1.0.0/go.mod h1:J/6gKK9jxlEcS3zixgDgUAsiuZ7yrSoa/FX5e0EB2j4=
+github.com/json-iterator/go v1.1.12/go.mod h1:e30LSqwooZae/UwlEbR2852Gd8hjQvJoHmT4TnhNGBo=
+github.com/jstemmer/go-junit-report v0.0.0-20190106144839-af01ea7f8024/go.mod h1:6v2b51hI/fHJwM22ozAgKL4VKDeJcHhJFhtBdhmNjmU=
+github.com/jstemmer/go-junit-report v0.9.1/go.mod h1:Brl9GWCQeLvo8nXZwPNNblvFj/XSXhF0NWZEnDohbsk=
+github.com/julienschmidt/httprouter v1.3.0/go.mod h1:JR6WtHb+2LUe8TCKY3cZOxFyyO8IZAc4RVcycCCAKdM=
 github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
 github.com/klauspost/compress v1.4.1/go.mod h1:RyIbtBH6LamlWaDj8nUwkbUhJ87Yi3uG0guNDohfE1A=
+github.com/klauspost/compress v1.16.7 h1:2mk3MPGNzKyxErAw8YaohYh69+pa4sIQSC0fPGCFR9I=
+github.com/klauspost/compress v1.16.7/go.mod h1:ntbaceVETuRiXiv4DpjP66DpAtAGkEQskQzEyD//IeE=
 github.com/klauspost/cpuid v1.2.0/go.mod h1:Pj4uuM528wm8OyEC2QMXAi2YiTZ96dNQPGgoMS4s3ek=
 github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
 github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
@@ -100,29 +324,50 @@ github.com/mailru/easyjson v0.0.0-20190626092158-b2ccc519800e/go.mod h1:C1wdFJiN
 github.com/mailru/easyjson v0.7.6/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc=
 github.com/mailru/easyjson v0.7.7 h1:UGYAvKxe3sBsEDzO8ZeWOSlIQfWFlxbzLZe7hwFURr0=
 github.com/mailru/easyjson v0.7.7/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc=
+github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 h1:jWpvCLoY8Z/e3VKvlsiIGKtc+UG6U5vzxaoagmhXfyg=
+github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0/go.mod h1:QUyp042oQthUoa9bqDv0ER0wrtXnBruoNd7aNjkbP+k=
 github.com/microcosm-cc/bluemonday v1.0.26 h1:xbqSvqzQMeEHCqMi64VAs4d8uy6Mequs3rQ0k/Khz58=
 github.com/microcosm-cc/bluemonday v1.0.26/go.mod h1:JyzOCs9gkyQyjs+6h10UEVSe02CGwkhd72Xdqh78TWs=
+github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
+github.com/modern-go/reflect2 v1.0.2/go.mod h1:yWuevngMOJpCy52FWWMvUC8ws7m/LJsjYzDa0/r8luk=
+github.com/mwitkow/go-conntrack v0.0.0-20190716064945-2f068394615f/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
 github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e/go.mod h1:zD1mROLANZcx1PVRCS0qkT7pwLkGfwJo4zjcN/Tysno=
 github.com/pashagolub/pgxmock/v2 v2.12.0 h1:IVRmQtVFNCoq7NOZ+PdfvB6fwnLJmEuWDhnc3yrDxBs=
 github.com/pashagolub/pgxmock/v2 v2.12.0/go.mod h1:D3YslkN/nJ4+umVqWmbwfSXugJIjPMChkGBG47OJpNw=
+github.com/pierrec/lz4/v4 v4.1.18 h1:xaKrnTkyoqfh1YItXl56+6KJNVYWlEEPuAQW9xsplYQ=
+github.com/pierrec/lz4/v4 v4.1.18/go.mod h1:gZWDp/Ze/IJXGXf23ltt2EXimqmTUXEy0GFuRQyBid4=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
 github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 h1:Jamvg5psRIccs7FGNTlIRMkT8wgtp5eCXdBlqhYGL6U=
 github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
+github.com/prometheus/client_golang v1.17.0 h1:rl2sfwZMtSthVU752MqfjQozy7blglC+1SOtjMAMh+Q=
+github.com/prometheus/client_golang v1.17.0/go.mod h1:VeL+gMmOAxkS2IqfCq0ZmHSL+LjWfWDUmp1mBz9JgUY=
+github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/prometheus/client_model v0.5.0 h1:VQw1hfvPvk3Uv6Qf29VrPF32JB6rtbgI6cYPYQjL0Qw=
+github.com/prometheus/client_model v0.5.0/go.mod h1:dTiFglRmd66nLR9Pv9f0mZi7B7fk5Pm3gvsjB5tr+kI=
+github.com/prometheus/common v0.45.0 h1:2BGz0eBc2hdMDLnO/8n0jeB3oPrt2D08CekT0lneoxM=
+github.com/prometheus/common v0.45.0/go.mod h1:YJmSTw9BoKxJplESWWxlbyttQR4uaEcGyv9MZjVOJsY=
+github.com/prometheus/procfs v0.12.0 h1:jluTpSng7V9hY0O2R9DzzJHYb2xULk9VTR1V1R/k6Bo=
+github.com/prometheus/procfs v0.12.0/go.mod h1:pcuDEFsWDnvcgNzo4EEweacyhjeA9Zk3cnaOZAZEfOo=
 github.com/proullon/ramsql v0.0.1 h1:tI7qN48Oj1LTmgdo4aWlvI9z45a4QlWaXlmdJ+IIfbU=
 github.com/proullon/ramsql v0.0.1/go.mod h1:jG8oAQG0ZPHPyxg5QlMERS31airDC+ZuqiAe8DUvFVo=
+github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475 h1:N/ElC8H3+5XpJzTSTfLsJV/mx9Q9g7kxmchpfZyxgzM=
+github.com/rcrowley/go-metrics v0.0.0-20201227073835-cf1acfcdf475/go.mod h1:bCqnVzQkZxMG4s8nGwiZ5l3QUCyqpo9Y+/ZMZ9VjZe4=
 github.com/redis/go-redis/v9 v9.2.1 h1:WlYJg71ODF0dVspZZCpYmoF1+U1Jjk9Rwd7pq6QmlCg=
 github.com/redis/go-redis/v9 v9.2.1/go.mod h1:hdY0cQFCN4fnSYT6TkisLufl/4W5UIXyv0b/CLO2V2M=
+github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6LYCDYWNEvQ=
 github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4=
 github.com/rogpeppe/go-internal v1.11.0 h1:cWPaGQEPrBb5/AsnsZesgZZ9yb1OQ+GOISoDNXVBh4M=
 github.com/rogpeppe/go-internal v1.11.0/go.mod h1:ddIwULY96R17DhadqLgMfk9H9tvdUzkipdSkR5nkCZA=
 github.com/rs/cors v1.10.1 h1:L0uuZVXIKlI1SShY2nhFfo44TYvDPQ1w4oFkUJNfhyo=
 github.com/rs/cors v1.10.1/go.mod h1:XyqrcTp5zjWr1wsJ8PIRZssZ8b/WMcMf71DJnit4EMU=
+github.com/spaolacci/murmur3 v0.0.0-20180118202830-f09979ecbc72/go.mod h1:JwIasOWyU6f++ZhiEuf87xNszmSA2myDM2Kzu9HwQUA=
 github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
 github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
 github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
 github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
 github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
 github.com/stretchr/testify v1.6.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
 github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
 github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
@@ -145,7 +390,26 @@ github.com/tdewolff/parse/v2 v2.7.3/go.mod h1:9p2qMIHpjRSTr1qnFxQr+igogyTUTlwvf9
 github.com/tdewolff/test v1.0.10/go.mod h1:6DAvZliBAAnD7rhVgwaM7DE5/d9NMOAJ09SqYqeK4QE=
 github.com/tdewolff/test v1.0.11-0.20231101010635-f1265d231d52 h1:gAQliwn+zJrkjAHVcBEYW/RFvd2St4yYimisvozAYlA=
 github.com/ulikunitz/xz v0.5.6/go.mod h1:2bypXElzHzzJZwzH67Y6wb67pO62Rzfn7BSiF4ABRW8=
+github.com/yuin/goldmark v1.1.25/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.1.32/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
+github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
+github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5taEt/CY=
+go.opencensus.io v0.21.0/go.mod h1:mSImk1erAIZhrmZN+AvHh14ztQfjbGwt4TtuofqLduU=
+go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8=
+go.opencensus.io v0.22.2/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.3/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.4/go.mod h1:yxeiOL68Rb0Xd1ddK5vPZ/oVn4vY4Ynel7k9FzqtOIw=
+go.opencensus.io v0.22.5/go.mod h1:5pWMHQbX5EPX2/62yrJeAkowc+lfs/XD7Uxpq3pI6kk=
+go.opencensus.io v0.23.0/go.mod h1:XItmlyltB5F7CS4xOC1DcqMoFqwtC6OG2xF7mCv7P7E=
+go.opencensus.io v0.24.0 h1:y73uSU6J157QMP2kn2r30vwW1A2W2WFwSCGnAVxeaD0=
+go.opencensus.io v0.24.0/go.mod h1:vNK8G9p7aAivkbmorf4v+7Hgx+Zs0yY+0fOtgBfjQKo=
+go.opentelemetry.io/otel v1.19.0 h1:MuS/TNf4/j4IXsZuJegVzI1cwut7Qc00344rgH7p8bs=
+go.opentelemetry.io/otel/metric v1.19.0 h1:aTzpGtV0ar9wlV4Sna9sdJyII5jTVJEvKETPiOKwvpE=
+go.opentelemetry.io/otel/sdk v1.19.0 h1:6USY6zH+L8uMH8L3t1enZPR3WFEmSTADlqldyHtJi3o=
+go.opentelemetry.io/otel/trace v1.19.0 h1:DFVQmlVbfVeOuBRrwdtaehRrWiL1JoVs9CPIQ1Dzxpg=
+go.opentelemetry.io/proto/otlp v0.7.0/go.mod h1:PqfVotwruBrMGOCsRd/89rSnXhoiJIqeYNgFYFoEGnI=
 go.uber.org/atomic v1.5.0/go.mod h1:sABNBOSYdrvTF6hTgEIbc7YasKWGhgEQZyfxyTvoXHQ=
 go.uber.org/config v1.4.0 h1:upnMPpMm6WlbZtXoasNkK4f0FhxwS+W4Iqz5oNznehQ=
 go.uber.org/config v1.4.0/go.mod h1:aCyrMHmUAc/s2h9sv1koP84M9ZF/4K+g2oleyESO/Ig=
@@ -158,62 +422,427 @@ go.uber.org/zap v1.26.0 h1:sI7k6L95XOKS281NhVKOFCUNIvv9e0w4BF8N3u+tCRo=
 go.uber.org/zap v1.26.0/go.mod h1:dtElttAiwGvoJ/vj4IwHBS/gXsEu/pZ50mUIRWuG0so=
 golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
 golang.org/x/crypto v0.0.0-20190510104115-cbcb75029529/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
+golang.org/x/crypto v0.0.0-20190605123033-f99c8df09eb5/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
+golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
+golang.org/x/crypto v0.6.0/go.mod h1:OFC/31mSvZgRz0V1QTNCzfAI1aIRzbiufJtkMIlEp58=
 golang.org/x/crypto v0.14.0 h1:wBqGXzWJW6m1XrIKlAH0Hs1JJ7+9KBwnIO8v66Q9cHc=
 golang.org/x/crypto v0.14.0/go.mod h1:MVFd36DqK4CsrnJYDkBA3VC4m2GkXAM0PvzMCn4JQf4=
+golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
+golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
+golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8=
+golang.org/x/exp v0.0.0-20190829153037-c13cbed26979/go.mod h1:86+5VVa7VpoJ4kLfm080zCjGlMRFzhUhsZKEZO7MGek=
+golang.org/x/exp v0.0.0-20191030013958-a1ab85dbe136/go.mod h1:JXzH8nQsPlswgeRAPE3MuO9GYsAcnJvJ4vnMwN/5qkY=
+golang.org/x/exp v0.0.0-20191129062945-2f5052295587/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
+golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM=
+golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU=
+golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js=
+golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
 golang.org/x/image v0.0.0-20210504121937-7319ad40d33e/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
 golang.org/x/image v0.13.0 h1:3cge/F/QTkNLauhf2QoE9zp+7sr+ZcL4HnoZmdwg9sg=
 golang.org/x/image v0.13.0/go.mod h1:6mmbMOeV28HuMTgA6OSRkdXKYw/t5W9Uwn2Yv1r3Yxk=
+golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
+golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
+golang.org/x/lint v0.0.0-20190301231843-5614ed5bae6f/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
+golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/lint v0.0.0-20190409202823-959b441ac422/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/lint v0.0.0-20190909230951-414d861bb4ac/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
 golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
-golang.org/x/lint v0.0.0-20201208152925-83fdc39ff7b5 h1:2M3HP5CCK1Si9FQhwnzYhXdG6DXeebvUHFpre8QvbyI=
+golang.org/x/lint v0.0.0-20191125180803-fdd1cda4f05f/go.mod h1:5qLYkcX4OjUUV8bRuDixDT3tpyyb+LUpUlRWLxfhWrs=
+golang.org/x/lint v0.0.0-20200130185559-910be7a94367/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/lint v0.0.0-20200302205851-738671d3881b/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
 golang.org/x/lint v0.0.0-20201208152925-83fdc39ff7b5/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/lint v0.0.0-20210508222113-6edffad5e616 h1:VLliZ0d+/avPrXXH+OakdXhpJuEoBZuwh1m2j7U6Iug=
+golang.org/x/lint v0.0.0-20210508222113-6edffad5e616/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/mobile v0.0.0-20190312151609-d3739f865fa6/go.mod h1:z+o9i4GpDbdi3rU15maQ/Ox0txvL9dWGYEHz965HBQE=
+golang.org/x/mobile v0.0.0-20190719004257-d2bd2a29d028/go.mod h1:E/iHnbuqvinMTCcRqshq8CkpyQDoeVncDDYHnLhea+o=
 golang.org/x/mod v0.0.0-20190513183733-4bf6d317e70e/go.mod h1:mXi4GBBbnImb6dmsKGUJ2LatrhH/nqhxcFungHvyanc=
+golang.org/x/mod v0.1.0/go.mod h1:0QHyrYULN0/3qlju5TqG8bIK38QM8yzMo5ekMj3DlcY=
 golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
+golang.org/x/mod v0.1.1-0.20191107180719-034126e5016b/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
+golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.4.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.4.1/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
 golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4=
 golang.org/x/mod v0.13.0 h1:I/DsJXRlw/8l/0c24sM9yb0T4z9liZTduXvdAWYiysY=
+golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
 golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
 golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190503192946-f4e77d36d62c/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190603091049-60506f45cf65/go.mod h1:HSz+uSET+XFnRR8LxR5pz3Of3rY3CfYBVs4xY44aLks=
 golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20190628185345-da137c7871d7/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20190724013045-ca1201d0de80/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20191209160850-c0dbc17a3553/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200114155413-6afb5195e5aa/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200202094626-16171245cfb2/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200222125558-5a598a2470a0/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200301022130-244492dfa37a/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200324143707-d3edc9973b7e/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200501053045-e0ff5e5a1de5/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200506145744-7e3656a0809f/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200513185701-a91f0712d120/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200520182314-0ba52f642ac2/go.mod h1:qpuaurCH72eLCgpAm/N6yyVIVM9cpaDIP3A8BGJEC5A=
+golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20200707034311-ab3426394381/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20200822124328-c89045814202/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
+golang.org/x/net v0.0.0-20201031054903-ff519b6c9102/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
+golang.org/x/net v0.0.0-20201110031124-69a78807bb2b/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
+golang.org/x/net v0.0.0-20201209123823-ac852fbbde11/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20210119194325-5f4716e94777/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20210316092652-d523dce5a7f4/go.mod h1:RBQZq4jEuRlivfhVLdyRGr576XBO4/greRjx4P4O3yc=
 golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
+golang.org/x/net v0.0.0-20210503060351-7fd8e65b6420/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
 golang.org/x/net v0.0.0-20210510120150-4163338589ed/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
 golang.org/x/net v0.0.0-20210805182204-aaa1db679c0d/go.mod h1:9nx3DQGgdP8bBQD5qxJ1jj9UTztislL4KSBs9R2vV5Y=
+golang.org/x/net v0.0.0-20220127200216-cd36cc0744dd/go.mod h1:CfG3xpIq0wQ8r1q4Su4UZFWDARRcnwPjda9FqA0JpMk=
+golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c=
+golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs=
+golang.org/x/net v0.7.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs=
 golang.org/x/net v0.17.0 h1:pVaXccu2ozPjCXewfr1S7xza/zcXTity9cCdXQYSjIM=
 golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE=
+golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
+golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20190604053449-0f29369cfe45/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20191202225959-858c2ad4c8b6/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20200902213428-5d25da1a8d43/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20201109201403-9fd604954f58/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20201208152858-08078c50e5b5/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210218202405-ba52d332ba99/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210220000619-9bb904979d93/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210313182246-cd4f82c27b84/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210514164344-f6687ab2804c/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210628180205-a41e5a781914/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210805134026-6f1e6394065a/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20210819190943-2bc19b11175f/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.0.0-20211104180415-d3ed0bb246c8/go.mod h1:KelEdhl1UZF7XfJ4dDtk6s++YSgaE7mD/BuKKDLBl4A=
+golang.org/x/oauth2 v0.13.0 h1:jDDenyj+WgFtmV3zYVoi8aE2BwtXFLWOA67ZfNWftiY=
+golang.org/x/oauth2 v0.13.0/go.mod h1:/JMhi4ZRXAf4HG9LiNmxvk+45+96RUlVThiH8FzNBn0=
+golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20200317015054-43a5402ce75a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20200625203802-6e8e738ad208/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.4.0 h1:zxkM55ReGkDlKSM+Fu41A+zmbZuaPVbGMzvvdUPznYQ=
 golang.org/x/sync v0.4.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y=
+golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190312061237-fead79001313/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190606165138-5da285871e9c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190624142023-c5567b49c5d0/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190726091711-fc99dfbffb4e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191001151750-bb3f8db39f24/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191204072324-ce4227a45e2e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191228213918-04cbcbbfeed8/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200113162924-86b910548bc1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200122134326-e047566fdf82/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200202164722-d101bd2416d5/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200212091648-12a6c2dcc1e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200302150141-5c8b2ff67527/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200331124033-c3d80250170d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200501052902-10377860bb8e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200511232937-7e40ca221e25/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200515095857-1151b9dac4a9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200523222454-059865788121/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200803210538-64077c9b5642/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200905004654-be1d3432aa8f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210104204734-6f8348627aad/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210119212857-b64e53b001e4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210220050731-9a76102bfb43/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210305230114-8fe3ee5dd75b/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210315160823-c6e025ad8005/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210320140829-1e4c9ba3b0c4/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210423082822-04245dca01da/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210514084401-e8d321eab015/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210603125802-9665404d3644/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210616094352-59db8d763f22/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210806184541-e5e7981a1069/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210823070655-63515b42dcdf/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210908233432-aa78b53d3365/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20211124211545-fe61309f8881/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20211210111614-af8b64212486/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20211216021012-1d35b9e2eb4e/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220128215802-99c3d69c2c27/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220209214540-3681064d5158/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.13.0 h1:Af8nKPmuFypiUBjVoU9V20FiaFXOcuZI21p0ycVYYGE=
 golang.org/x/sys v0.13.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
+golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
+golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k=
+golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
 golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
+golang.org/x/text v0.3.1-0.20180807135948-17ff2d5776d2/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
 golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
 golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.5/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
 golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
 golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
+golang.org/x/text v0.3.8/go.mod h1:E6s5w1FMmriuDzIBO73fBruAKo1PCIq6d2Q6DHfQ8WQ=
+golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8=
 golang.org/x/text v0.13.0 h1:ablQoSUd0tRdKxZewP80B+BaqeKJuVhuRxj/dkrun3k=
 golang.org/x/text v0.13.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE=
+golang.org/x/text v0.14.0 h1:ScX5w1eTa3QqT8oi6+ziP7dTV1S2+ALU0bI+0zXKWiQ=
+golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
+golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
+golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
+golang.org/x/time v0.0.0-20191024005414-555d28b269f0/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
 golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
 golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+golang.org/x/tools v0.0.0-20190312151545-0bb0c0a6e846/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+golang.org/x/tools v0.0.0-20190312170243-e65039ee4138/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+golang.org/x/tools v0.0.0-20190425150028-36563e24a262/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
+golang.org/x/tools v0.0.0-20190506145303-2d16b83fe98c/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
+golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
+golang.org/x/tools v0.0.0-20190606124116-d0a3d012864b/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
 golang.org/x/tools v0.0.0-20190621195816-6e04913cbbac/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
+golang.org/x/tools v0.0.0-20190628153133-6cdbf07be9d0/go.mod h1:/rFqwRUd4F7ZHNgwSSTFct+R/Kf4OFW1sUzUTQQTgfc=
+golang.org/x/tools v0.0.0-20190816200558-6889da9d5479/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20190911174233-4f2ddba30aff/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191012152004-8de300cfc20a/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191029041327-9cc4af7d6b2c/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191029190741-b9c20aec41a5/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191104232314-dc038396d1f0/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191113191852-77e3bb0ad9e7/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191115202509-3a792d9c32b2/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191125144606-a911d9008d1f/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191130070609-6e064ea0cf2d/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20191216173652-a0e659d51361/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20191227053925-7b8e75db28f4/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200117161641-43d50277825c/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200122220014-bf1340f18c4a/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
 golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200204074204-1cc6d1ef6c74/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200207183749-b753a1ba74fa/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200212150539-ea181f53ac56/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200224181240-023911ca70b2/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200227222343-706bc42d1f0d/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
+golang.org/x/tools v0.0.0-20200304193943-95d2e580d8eb/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
+golang.org/x/tools v0.0.0-20200312045724-11d5b4c81c7d/go.mod h1:o4KQGtdN14AW+yjsvvwRTJJuXz8XRtIHtEnmAXLyFUw=
+golang.org/x/tools v0.0.0-20200331025713-a30bf2db82d4/go.mod h1:Sl4aGygMT6LrqrWclx+PTx3U+LnKx/seiNR+3G19Ar8=
+golang.org/x/tools v0.0.0-20200501065659-ab2804fb9c9d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200512131952-2bc93b1c0c88/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200515010526-7d3b6ebf133d/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200618134242-20370b0cb4b2/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
+golang.org/x/tools v0.0.0-20200729194436-6467de6f59a7/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200804011535-6c149bb5ef0d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200825202427-b303f430e36d/go.mod h1:njjCfa9FT2d7l9Bc6FUM5FLjQPp3cFF28FI3qnDFljA=
+golang.org/x/tools v0.0.0-20200904185747-39188db58858/go.mod h1:Cj7w3i3Rnn0Xh82ur9kSqwfTHTeVxaDqrfMjpcNT6bE=
+golang.org/x/tools v0.0.0-20201110124207-079ba7bd75cd/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20201201161351-ac6f37ff4c2a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20201208233053-a543418bbed2/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.0.0-20210105154028-b0ab187a4818/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
+golang.org/x/tools v0.1.0/go.mod h1:xkSsbof2nBLbhDlRMhhhyNLN/zl3eTqcnHD5viDpcZ0=
 golang.org/x/tools v0.1.1/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.3/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.4/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.5/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc=
 golang.org/x/tools v0.14.0 h1:jvNa2pY0M4r62jkRQ6RwEZZyPcymeL9XZMLBbV7U2nc=
 golang.org/x/tools v0.14.0/go.mod h1:uYBEerGOWcJyEORxN+Ek8+TT266gXkNlHdJBwexUsBg=
 golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
+golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 gonum.org/v1/plot v0.14.0 h1:+LBDVFYwFe4LHhdP8coW6296MBEY4nQ+Y4vuUpJopcE=
+google.golang.org/api v0.4.0/go.mod h1:8k5glujaEP+g9n7WNsDg8QP6cUVNI86fCNMcbazEtwE=
+google.golang.org/api v0.7.0/go.mod h1:WtwebWUNSVBH/HAw79HIFXZNqEvBhG+Ra+ax0hx3E3M=
+google.golang.org/api v0.8.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
+google.golang.org/api v0.9.0/go.mod h1:o4eAsZoiT+ibD93RtjEohWalFOjRDx6CVaqeizhEnKg=
+google.golang.org/api v0.13.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.14.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.15.0/go.mod h1:iLdEw5Ide6rF15KTC1Kkl0iskquN2gFfn9o9XIsbkAI=
+google.golang.org/api v0.17.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.18.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.19.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.20.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.22.0/go.mod h1:BwFmGc8tA3vsd7r/7kR8DY7iEEGSU04BFxCo5jP/sfE=
+google.golang.org/api v0.24.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
+google.golang.org/api v0.28.0/go.mod h1:lIXQywCXRcnZPGlsd8NbLnOjtAoL6em04bJ9+z0MncE=
+google.golang.org/api v0.29.0/go.mod h1:Lcubydp8VUV7KeIHD9z2Bys/sm/vGKnG1UHuDBSrHWM=
+google.golang.org/api v0.30.0/go.mod h1:QGmEvQ87FHZNiUVJkT14jQNYJ4ZJjdRF23ZXz5138Fc=
+google.golang.org/api v0.35.0/go.mod h1:/XrVsuzM0rZmrsbjJutiuftIzeuTQcEeaYcSk/mQ1dg=
+google.golang.org/api v0.36.0/go.mod h1:+z5ficQTmoYpPn8LCUNVpK5I7hwkpjbcgqA7I34qYtE=
+google.golang.org/api v0.40.0/go.mod h1:fYKFpnQN0DsDSKRVRcQSDQNtqWPfM9i+zNPxepjRCQ8=
+google.golang.org/api v0.41.0/go.mod h1:RkxM5lITDfTzmyKFPt+wGrCJbVfniCr2ool8kTBzRTU=
+google.golang.org/api v0.43.0/go.mod h1:nQsDGjRXMo4lvh5hP0TKqF244gqhGcr/YSIykhUk/94=
+google.golang.org/api v0.47.0/go.mod h1:Wbvgpq1HddcWVtzsVLyfLp8lDg6AA241LmgIL59tHXo=
+google.golang.org/api v0.48.0/go.mod h1:71Pr1vy+TAZRPkPs/xlCf5SsU8WjuAWv1Pfjbtukyy4=
+google.golang.org/api v0.50.0/go.mod h1:4bNT5pAuq5ji4SRZm+5QIkjny9JAyVD/3gaSihNefaw=
+google.golang.org/api v0.51.0/go.mod h1:t4HdrdoNgyN5cbEfm7Lum0lcLDLiise1F8qDKX00sOU=
+google.golang.org/api v0.54.0/go.mod h1:7C4bFFOvVDGXjfDTAsgGwDgAxRDeQ4X8NvUedIt6z3k=
+google.golang.org/api v0.55.0/go.mod h1:38yMfeP1kfjsl8isn0tliTjIb1rJXcQi4UXlbqivdVE=
+google.golang.org/api v0.56.0/go.mod h1:38yMfeP1kfjsl8isn0tliTjIb1rJXcQi4UXlbqivdVE=
+google.golang.org/api v0.57.0/go.mod h1:dVPlbZyBo2/OjBpmvNdpn2GRm6rPy75jyU7bmhdrMgI=
+google.golang.org/api v0.61.0/go.mod h1:xQRti5UdCmoCEqFxcz93fTl338AVqDgyaDRuOZ3hg9I=
+google.golang.org/api v0.63.0/go.mod h1:gs4ij2ffTRXwuzzgJl/56BdwJaA194ijkfn++9tDuPo=
+google.golang.org/api v0.67.0/go.mod h1:ShHKP8E60yPsKNw/w8w+VYaj9H6buA5UqDp8dhbQZ6g=
+google.golang.org/api v0.70.0/go.mod h1:Bs4ZM2HGifEvXwd50TtW70ovgJffJYw2oRCOFU/SkfA=
+google.golang.org/api v0.149.0 h1:b2CqT6kG+zqJIVKRQ3ELJVLN1PwHZ6DJ3dW8yl82rgY=
+google.golang.org/api v0.149.0/go.mod h1:Mwn1B7JTXrzXtnvmzQE2BD6bYZQ8DShKZDZbeN9I7qI=
+google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
+google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
+google.golang.org/appengine v1.5.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
+google.golang.org/appengine v1.6.1/go.mod h1:i06prIuMbXzDqacNJfV5OdTW448YApPu5ww/cMBSeb0=
+google.golang.org/appengine v1.6.5/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
+google.golang.org/appengine v1.6.6/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
+google.golang.org/appengine v1.6.7/go.mod h1:8WjMMxjGQR8xUklV/ARdw2HLXBOI7O7uCIDZVag1xfc=
+google.golang.org/appengine v1.6.8 h1:IhEN5q69dyKagZPYMSdIjS2HqprW324FRQZJcGqPAsM=
+google.golang.org/appengine v1.6.8/go.mod h1:1jJ3jBArFh5pcgW8gCtRJnepW8FzD1V44FJffLiz/Ds=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
+google.golang.org/genproto v0.0.0-20190307195333-5fe7a883aa19/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/genproto v0.0.0-20190418145605-e7d98fc518a7/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/genproto v0.0.0-20190801165951-fa694d86fc64/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
+google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
+google.golang.org/genproto v0.0.0-20190911173649-1774047e7e51/go.mod h1:IbNlFCBrqXvoKpeg0TB2l7cyZUmoaFKYIwrEpbDKLA8=
+google.golang.org/genproto v0.0.0-20191108220845-16a3f7862a1a/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191115194625-c23dd37a84c9/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191216164720-4f79533eabd1/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20191230161307-f3c370f40bfb/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200115191322-ca5a22157cba/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200122232147-0452cf42e150/go.mod h1:n3cpQtvxv34hfy77yVDNjmbRyujviMdxYliBSkLhpCc=
+google.golang.org/genproto v0.0.0-20200204135345-fa8e72b47b90/go.mod h1:GmwEX6Z4W5gMy59cAlVYjN9JhxgbQH6Gn+gFDQe2lzA=
+google.golang.org/genproto v0.0.0-20200212174721-66ed5ce911ce/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200224152610-e50cd9704f63/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200228133532-8c2c7df3a383/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200305110556-506484158171/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200312145019-da6875a35672/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200331122359-1ee6d9798940/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200430143042-b979b6f78d84/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200511104702-f5ebc3bea380/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200513103714-09dca8ec2884/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200515170657-fc4c6c6a6587/go.mod h1:YsZOwe1myG/8QRHRsmBRE1LrgQY60beZKjly0O1fX9U=
+google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo=
+google.golang.org/genproto v0.0.0-20200618031413-b414f8b61790/go.mod h1:jDfRM7FcilCzHH/e9qn6dsT145K34l5v+OpcnNgKAAA=
+google.golang.org/genproto v0.0.0-20200729003335-053ba62fc06f/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200804131852-c06518451d9c/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200825200019-8632dd797987/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20200904004341-0bd0a958aa1d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201109203340-2640f1f9cdfb/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201201144952-b05cb90ed32e/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201210142538-e3217bee35cc/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20201214200347-8c77b98c765d/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210222152913-aa3ee6e6a81c/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210303154014-9728d6b83eeb/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210310155132-4ce2db91004e/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210319143718-93e7006c17a6/go.mod h1:FWY/as6DDZQgahTzZj3fqbO1CbirC29ZNUFHwi0/+no=
+google.golang.org/genproto v0.0.0-20210402141018-6c239bbf2bb1/go.mod h1:9lPAdzaEmUacj36I+k7YKbEc5CXzPIeORRgDAUOu28A=
+google.golang.org/genproto v0.0.0-20210513213006-bf773b8c8384/go.mod h1:P3QM42oQyzQSnHPnZ/vqoCdDmzH28fzWByN9asMeM8A=
+google.golang.org/genproto v0.0.0-20210602131652-f16073e35f0c/go.mod h1:UODoCrxHCcBojKKwX1terBiRUaqAsFqJiF615XL43r0=
+google.golang.org/genproto v0.0.0-20210604141403-392c879c8b08/go.mod h1:UODoCrxHCcBojKKwX1terBiRUaqAsFqJiF615XL43r0=
+google.golang.org/genproto v0.0.0-20210608205507-b6d2f5bf0d7d/go.mod h1:UODoCrxHCcBojKKwX1terBiRUaqAsFqJiF615XL43r0=
+google.golang.org/genproto v0.0.0-20210624195500-8bfb893ecb84/go.mod h1:SzzZ/N+nwJDaO1kznhnlzqS8ocJICar6hYhVyhi++24=
+google.golang.org/genproto v0.0.0-20210713002101-d411969a0d9a/go.mod h1:AxrInvYm1dci+enl5hChSFPOmmUF1+uAa/UsgNRWd7k=
+google.golang.org/genproto v0.0.0-20210716133855-ce7ef5c701ea/go.mod h1:AxrInvYm1dci+enl5hChSFPOmmUF1+uAa/UsgNRWd7k=
+google.golang.org/genproto v0.0.0-20210728212813-7823e685a01f/go.mod h1:ob2IJxKrgPT52GcgX759i1sleT07tiKowYBGbczaW48=
+google.golang.org/genproto v0.0.0-20210805201207-89edb61ffb67/go.mod h1:ob2IJxKrgPT52GcgX759i1sleT07tiKowYBGbczaW48=
+google.golang.org/genproto v0.0.0-20210813162853-db860fec028c/go.mod h1:cFeNkxwySK631ADgubI+/XFU/xp8FD5KIVV4rj8UC5w=
+google.golang.org/genproto v0.0.0-20210821163610-241b8fcbd6c8/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY=
+google.golang.org/genproto v0.0.0-20210828152312-66f60bf46e71/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY=
+google.golang.org/genproto v0.0.0-20210831024726-fe130286e0e2/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY=
+google.golang.org/genproto v0.0.0-20210903162649-d08c68adba83/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY=
+google.golang.org/genproto v0.0.0-20210909211513-a8c4777a87af/go.mod h1:eFjDcFEctNawg4eG61bRv87N7iHBWyVhJu7u1kqDUXY=
+google.golang.org/genproto v0.0.0-20210924002016-3dee208752a0/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20211118181313-81c1377c94b1/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20211206160659-862468c7d6e0/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20211208223120-3a66f561d7aa/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20211221195035-429b39de9b1c/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20220126215142-9970aeb2e350/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20220207164111-0872dc986b00/go.mod h1:5CzLGKJ67TSI2B9POpiiyGha0AjJvZIUgRMt1dSmuhc=
+google.golang.org/genproto v0.0.0-20220218161850-94dd64e39d7c/go.mod h1:kGP+zUP2Ddo0ayMi4YuN7C3WZyJvGLZRh8Z5wnAqvEI=
+google.golang.org/genproto v0.0.0-20220222213610-43724f9ea8cf/go.mod h1:kGP+zUP2Ddo0ayMi4YuN7C3WZyJvGLZRh8Z5wnAqvEI=
+google.golang.org/genproto v0.0.0-20231212172506-995d672761c0 h1:YJ5pD9rF8o9Qtta0Cmy9rdBwkSjrTCT6XTiUQVOtIos=
+google.golang.org/genproto v0.0.0-20231212172506-995d672761c0/go.mod h1:l/k7rMz0vFTBPy+tFSGvXEd3z+BcoG1k7EHbqm+YBsY=
+google.golang.org/genproto/googleapis/api v0.0.0-20231211222908-989df2bf70f3 h1:EWIeHfGuUf00zrVZGEgYFxok7plSAXBGcH7NNdMAWvA=
+google.golang.org/genproto/googleapis/api v0.0.0-20231211222908-989df2bf70f3/go.mod h1:k2dtGpRrbsSyKcNPKKI5sstZkrNCZwpU/ns96JoHbGg=
+google.golang.org/genproto/googleapis/rpc v0.0.0-20231211222908-989df2bf70f3 h1:kzJAXnzZoFbe5bhZd4zjUuHos/I31yH4thfMb/13oVY=
+google.golang.org/genproto/googleapis/rpc v0.0.0-20231211222908-989df2bf70f3/go.mod h1:eJVxU6o+4G1PSczBr85xmyvSNYAKvAYgkub40YGomFM=
+google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
+google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38=
+google.golang.org/grpc v1.21.1/go.mod h1:oYelfM1adQP15Ek0mdvEgi9Df8B9CZIaU1084ijfRaM=
+google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
+google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY=
+google.golang.org/grpc v1.26.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.27.1/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.28.0/go.mod h1:rpkK4SK4GF4Ach/+MFLZUBavHOvF2JJB5uozKKal+60=
+google.golang.org/grpc v1.29.1/go.mod h1:itym6AZVZYACWQqET3MqgPpjcuV5QH3BxFS3IjizoKk=
+google.golang.org/grpc v1.30.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.31.0/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.31.1/go.mod h1:N36X2cJ7JwdamYAgDz+s+rVMFjt3numwzf/HckM8pak=
+google.golang.org/grpc v1.33.1/go.mod h1:fr5YgcSWrqhRRxogOsw7RzIpsmvOZ6IcH4kBYTpR3n0=
+google.golang.org/grpc v1.33.2/go.mod h1:JMHMWHQWaTccqQQlmk3MJZS+GWXOdAesneDmEnv2fbc=
+google.golang.org/grpc v1.34.0/go.mod h1:WotjhfgOW/POjDeRt8vscBtXq+2VjORFy659qA51WJ8=
+google.golang.org/grpc v1.35.0/go.mod h1:qjiiYl8FncCW8feJPdyg3v6XW24KsRHe+dy9BAGRRjU=
+google.golang.org/grpc v1.36.0/go.mod h1:qjiiYl8FncCW8feJPdyg3v6XW24KsRHe+dy9BAGRRjU=
+google.golang.org/grpc v1.36.1/go.mod h1:qjiiYl8FncCW8feJPdyg3v6XW24KsRHe+dy9BAGRRjU=
+google.golang.org/grpc v1.37.0/go.mod h1:NREThFqKR1f3iQ6oBuvc5LadQuXVGo9rkm5ZGrQdJfM=
+google.golang.org/grpc v1.37.1/go.mod h1:NREThFqKR1f3iQ6oBuvc5LadQuXVGo9rkm5ZGrQdJfM=
+google.golang.org/grpc v1.38.0/go.mod h1:NREThFqKR1f3iQ6oBuvc5LadQuXVGo9rkm5ZGrQdJfM=
+google.golang.org/grpc v1.39.0/go.mod h1:PImNr+rS9TWYb2O4/emRugxiyHZ5JyHW5F+RPnDzfrE=
+google.golang.org/grpc v1.39.1/go.mod h1:PImNr+rS9TWYb2O4/emRugxiyHZ5JyHW5F+RPnDzfrE=
+google.golang.org/grpc v1.40.0/go.mod h1:ogyxbiOoUXAkP+4+xa6PZSE9DZgIHtSpzjDTB9KAK34=
+google.golang.org/grpc v1.40.1/go.mod h1:ogyxbiOoUXAkP+4+xa6PZSE9DZgIHtSpzjDTB9KAK34=
+google.golang.org/grpc v1.44.0/go.mod h1:k+4IHHFw41K8+bbowsex27ge2rCb65oeWqe4jJ590SU=
+google.golang.org/grpc v1.60.0 h1:6FQAR0kM31P6MRdeluor2w2gPaS4SVNrD/DNTxrQ15k=
+google.golang.org/grpc v1.60.0/go.mod h1:OlCHIeLYqSSsLi6i49B5QGdzaMZK9+M7LXN2FKz4eGM=
+google.golang.org/grpc/cmd/protoc-gen-go-grpc v1.1.0/go.mod h1:6Kw0yEErY5E/yWrBtf03jp27GLLJujG4z/JK95pnjjw=
+google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
+google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
+google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
+google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
+google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
+google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.24.0/go.mod h1:r/3tXBNzIEhYS9I1OUVjXDlt8tc493IdKGjtUeSXeh4=
+google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c=
+google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw=
+google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc=
+google.golang.org/protobuf v1.27.1/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc=
+google.golang.org/protobuf v1.31.0 h1:g0LDEJHgrBl9N9r17Ru3sqWhkIx2NB67okBHPwC7hs8=
+google.golang.org/protobuf v1.31.0/go.mod h1:HV8QOd/L58Z+nl8r43ehVNZIU/HEI6OcFqwMG9pJV4I=
 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/check.v1 v1.0.0-20200227125254-8fa46927fb4f/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
@@ -221,6 +850,7 @@ gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntN
 gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
 gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
 gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.3/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.2.5/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
 gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
@@ -228,6 +858,17 @@ gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C
 gopkg.in/yaml.v3 v3.0.0-20200615113413-eeeca48fe776/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
+honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+honnef.co/go/tools v0.0.0-20190106161140-3f1c8253044a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+honnef.co/go/tools v0.0.0-20190418001031-e561f6794a2a/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
 honnef.co/go/tools v0.0.1-2019.2.3/go.mod h1:a3bituU0lyd329TUQxRnasdCoJDkEUEAqEt0JzvZhAg=
+honnef.co/go/tools v0.0.1-2020.1.3/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
+honnef.co/go/tools v0.0.1-2020.1.4/go.mod h1:X/FiERA/W4tHapMX5mGpAtMSVEeEUOyHaw9vFzvIQ3k=
+nhooyr.io/websocket v1.8.10 h1:mv4p+MnGrLDcPlBoWsvPP7XCzTYMXP9F9eIGoKbgx7Q=
+nhooyr.io/websocket v1.8.10/go.mod h1:rN9OFWIUwuxg4fR5tELlYC04bXYowCP9GX47ivo2l+c=
+rsc.io/binaryregexp v0.2.0/go.mod h1:qTv7/COck+e2FymRvadv62gMdZztPaShugOCi3I+8D8=
+rsc.io/quote/v3 v3.1.0/go.mod h1:yEA65RcK8LyAZtP9Kv3t0HmxON59tX3rD+tICJqUlj0=
+rsc.io/sampler v1.3.0/go.mod h1:T1hPZKmBbMNahiBKFy5HrXp6adAjACjK9JXDnKaTXpA=
 star-tex.org/x/tex v0.4.0 h1:AXUwgpnHLCxZUWW3qrmjv6ezNhH3PjUVBuLLejz2cgU=
 star-tex.org/x/tex v0.4.0/go.mod h1:w91ycsU/DkkCr7GWr60GPWqp3gn2U+6VX71T0o8k8qE=
diff --git a/internal/api/auth/auth.pb.go b/internal/api/auth/auth.pb.go
new file mode 100644
index 0000000..24c7be4
--- /dev/null
+++ b/internal/api/auth/auth.pb.go
@@ -0,0 +1,483 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.28.1
+// 	protoc        v3.6.1
+// source: api/proto/auth.proto
+
+package auth
+
+import (
+	empty "github.com/golang/protobuf/ptypes/empty"
+	timestamp "github.com/golang/protobuf/ptypes/timestamp"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type Credentials struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Password string `protobuf:"bytes,1,opt,name=password,proto3" json:"password,omitempty"`
+	Username string `protobuf:"bytes,2,opt,name=username,proto3" json:"username,omitempty"`
+}
+
+func (x *Credentials) Reset() {
+	*x = Credentials{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_auth_proto_msgTypes[0]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Credentials) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Credentials) ProtoMessage() {}
+
+func (x *Credentials) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_auth_proto_msgTypes[0]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Credentials.ProtoReflect.Descriptor instead.
+func (*Credentials) Descriptor() ([]byte, []int) {
+	return file_api_proto_auth_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Credentials) GetPassword() string {
+	if x != nil {
+		return x.Password
+	}
+	return ""
+}
+
+func (x *Credentials) GetUsername() string {
+	if x != nil {
+		return x.Username
+	}
+	return ""
+}
+
+type RegisterData struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Cred  *Credentials `protobuf:"bytes,1,opt,name=cred,proto3" json:"cred,omitempty"`
+	Email string       `protobuf:"bytes,2,opt,name=email,proto3" json:"email,omitempty"`
+}
+
+func (x *RegisterData) Reset() {
+	*x = RegisterData{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_auth_proto_msgTypes[1]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *RegisterData) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*RegisterData) ProtoMessage() {}
+
+func (x *RegisterData) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_auth_proto_msgTypes[1]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use RegisterData.ProtoReflect.Descriptor instead.
+func (*RegisterData) Descriptor() ([]byte, []int) {
+	return file_api_proto_auth_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *RegisterData) GetCred() *Credentials {
+	if x != nil {
+		return x.Cred
+	}
+	return nil
+}
+
+func (x *RegisterData) GetEmail() string {
+	if x != nil {
+		return x.Email
+	}
+	return ""
+}
+
+type User struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Id       int64  `protobuf:"varint,1,opt,name=id,proto3" json:"id,omitempty"`
+	Username string `protobuf:"bytes,2,opt,name=username,proto3" json:"username,omitempty"`
+	Avatar   string `protobuf:"bytes,3,opt,name=avatar,proto3" json:"avatar,omitempty"`
+}
+
+func (x *User) Reset() {
+	*x = User{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_auth_proto_msgTypes[2]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *User) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*User) ProtoMessage() {}
+
+func (x *User) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_auth_proto_msgTypes[2]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use User.ProtoReflect.Descriptor instead.
+func (*User) Descriptor() ([]byte, []int) {
+	return file_api_proto_auth_proto_rawDescGZIP(), []int{2}
+}
+
+func (x *User) GetId() int64 {
+	if x != nil {
+		return x.Id
+	}
+	return 0
+}
+
+func (x *User) GetUsername() string {
+	if x != nil {
+		return x.Username
+	}
+	return ""
+}
+
+func (x *User) GetAvatar() string {
+	if x != nil {
+		return x.Avatar
+	}
+	return ""
+}
+
+type Session struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Key    string               `protobuf:"bytes,1,opt,name=key,proto3" json:"key,omitempty"`
+	UserID int64                `protobuf:"varint,2,opt,name=userID,proto3" json:"userID,omitempty"`
+	Expire *timestamp.Timestamp `protobuf:"bytes,3,opt,name=expire,proto3" json:"expire,omitempty"`
+}
+
+func (x *Session) Reset() {
+	*x = Session{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_auth_proto_msgTypes[3]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Session) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Session) ProtoMessage() {}
+
+func (x *Session) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_auth_proto_msgTypes[3]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Session.ProtoReflect.Descriptor instead.
+func (*Session) Descriptor() ([]byte, []int) {
+	return file_api_proto_auth_proto_rawDescGZIP(), []int{3}
+}
+
+func (x *Session) GetKey() string {
+	if x != nil {
+		return x.Key
+	}
+	return ""
+}
+
+func (x *Session) GetUserID() int64 {
+	if x != nil {
+		return x.UserID
+	}
+	return 0
+}
+
+func (x *Session) GetExpire() *timestamp.Timestamp {
+	if x != nil {
+		return x.Expire
+	}
+	return nil
+}
+
+type UserID struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Id int64 `protobuf:"varint,1,opt,name=id,proto3" json:"id,omitempty"`
+}
+
+func (x *UserID) Reset() {
+	*x = UserID{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_auth_proto_msgTypes[4]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *UserID) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*UserID) ProtoMessage() {}
+
+func (x *UserID) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_auth_proto_msgTypes[4]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use UserID.ProtoReflect.Descriptor instead.
+func (*UserID) Descriptor() ([]byte, []int) {
+	return file_api_proto_auth_proto_rawDescGZIP(), []int{4}
+}
+
+func (x *UserID) GetId() int64 {
+	if x != nil {
+		return x.Id
+	}
+	return 0
+}
+
+var File_api_proto_auth_proto protoreflect.FileDescriptor
+
+var file_api_proto_auth_proto_rawDesc = []byte{
+	0x0a, 0x14, 0x61, 0x70, 0x69, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x2f, 0x61, 0x75, 0x74, 0x68,
+	0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x04, 0x61, 0x75, 0x74, 0x68, 0x1a, 0x1b, 0x67, 0x6f,
+	0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x65, 0x6d,
+	0x70, 0x74, 0x79, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x1a, 0x1f, 0x67, 0x6f, 0x6f, 0x67, 0x6c,
+	0x65, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x74, 0x69, 0x6d, 0x65, 0x73,
+	0x74, 0x61, 0x6d, 0x70, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x22, 0x45, 0x0a, 0x0b, 0x43, 0x72,
+	0x65, 0x64, 0x65, 0x6e, 0x74, 0x69, 0x61, 0x6c, 0x73, 0x12, 0x1a, 0x0a, 0x08, 0x70, 0x61, 0x73,
+	0x73, 0x77, 0x6f, 0x72, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x70, 0x61, 0x73,
+	0x73, 0x77, 0x6f, 0x72, 0x64, 0x12, 0x1a, 0x0a, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e, 0x61, 0x6d,
+	0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e, 0x61, 0x6d,
+	0x65, 0x22, 0x4b, 0x0a, 0x0c, 0x52, 0x65, 0x67, 0x69, 0x73, 0x74, 0x65, 0x72, 0x44, 0x61, 0x74,
+	0x61, 0x12, 0x25, 0x0a, 0x04, 0x63, 0x72, 0x65, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32,
+	0x11, 0x2e, 0x61, 0x75, 0x74, 0x68, 0x2e, 0x43, 0x72, 0x65, 0x64, 0x65, 0x6e, 0x74, 0x69, 0x61,
+	0x6c, 0x73, 0x52, 0x04, 0x63, 0x72, 0x65, 0x64, 0x12, 0x14, 0x0a, 0x05, 0x65, 0x6d, 0x61, 0x69,
+	0x6c, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x65, 0x6d, 0x61, 0x69, 0x6c, 0x22, 0x4a,
+	0x0a, 0x04, 0x55, 0x73, 0x65, 0x72, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01,
+	0x28, 0x03, 0x52, 0x02, 0x69, 0x64, 0x12, 0x1a, 0x0a, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e, 0x61,
+	0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e, 0x61,
+	0x6d, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x61, 0x76, 0x61, 0x74, 0x61, 0x72, 0x18, 0x03, 0x20, 0x01,
+	0x28, 0x09, 0x52, 0x06, 0x61, 0x76, 0x61, 0x74, 0x61, 0x72, 0x22, 0x67, 0x0a, 0x07, 0x53, 0x65,
+	0x73, 0x73, 0x69, 0x6f, 0x6e, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20, 0x01,
+	0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x16, 0x0a, 0x06, 0x75, 0x73, 0x65, 0x72, 0x49,
+	0x44, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x75, 0x73, 0x65, 0x72, 0x49, 0x44, 0x12,
+	0x32, 0x0a, 0x06, 0x65, 0x78, 0x70, 0x69, 0x72, 0x65, 0x18, 0x03, 0x20, 0x01, 0x28, 0x0b, 0x32,
+	0x1a, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75,
+	0x66, 0x2e, 0x54, 0x69, 0x6d, 0x65, 0x73, 0x74, 0x61, 0x6d, 0x70, 0x52, 0x06, 0x65, 0x78, 0x70,
+	0x69, 0x72, 0x65, 0x22, 0x18, 0x0a, 0x06, 0x55, 0x73, 0x65, 0x72, 0x49, 0x44, 0x12, 0x0e, 0x0a,
+	0x02, 0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x02, 0x69, 0x64, 0x32, 0xcc, 0x01,
+	0x0a, 0x04, 0x41, 0x75, 0x74, 0x68, 0x12, 0x38, 0x0a, 0x08, 0x52, 0x65, 0x67, 0x69, 0x73, 0x74,
+	0x65, 0x72, 0x12, 0x12, 0x2e, 0x61, 0x75, 0x74, 0x68, 0x2e, 0x52, 0x65, 0x67, 0x69, 0x73, 0x74,
+	0x65, 0x72, 0x44, 0x61, 0x74, 0x61, 0x1a, 0x16, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45, 0x6d, 0x70, 0x74, 0x79, 0x22, 0x00,
+	0x12, 0x2b, 0x0a, 0x05, 0x4c, 0x6f, 0x67, 0x69, 0x6e, 0x12, 0x11, 0x2e, 0x61, 0x75, 0x74, 0x68,
+	0x2e, 0x43, 0x72, 0x65, 0x64, 0x65, 0x6e, 0x74, 0x69, 0x61, 0x6c, 0x73, 0x1a, 0x0d, 0x2e, 0x61,
+	0x75, 0x74, 0x68, 0x2e, 0x53, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x22, 0x00, 0x12, 0x31, 0x0a,
+	0x06, 0x4c, 0x6f, 0x67, 0x6f, 0x75, 0x74, 0x12, 0x0d, 0x2e, 0x61, 0x75, 0x74, 0x68, 0x2e, 0x53,
+	0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x1a, 0x16, 0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45, 0x6d, 0x70, 0x74, 0x79, 0x22, 0x00,
+	0x12, 0x2a, 0x0a, 0x09, 0x47, 0x65, 0x74, 0x55, 0x73, 0x65, 0x72, 0x49, 0x44, 0x12, 0x0d, 0x2e,
+	0x61, 0x75, 0x74, 0x68, 0x2e, 0x53, 0x65, 0x73, 0x73, 0x69, 0x6f, 0x6e, 0x1a, 0x0c, 0x2e, 0x61,
+	0x75, 0x74, 0x68, 0x2e, 0x55, 0x73, 0x65, 0x72, 0x49, 0x44, 0x22, 0x00, 0x42, 0x35, 0x5a, 0x33,
+	0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67, 0x6f, 0x2d, 0x70, 0x61,
+	0x72, 0x6b, 0x2d, 0x6d, 0x61, 0x69, 0x6c, 0x2d, 0x72, 0x75, 0x2f, 0x32, 0x30, 0x32, 0x33, 0x5f,
+	0x32, 0x5f, 0x4f, 0x4e, 0x44, 0x5f, 0x74, 0x65, 0x61, 0x6d, 0x2f, 0x61, 0x70, 0x69, 0x2f, 0x61,
+	0x75, 0x74, 0x68, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+}
+
+var (
+	file_api_proto_auth_proto_rawDescOnce sync.Once
+	file_api_proto_auth_proto_rawDescData = file_api_proto_auth_proto_rawDesc
+)
+
+func file_api_proto_auth_proto_rawDescGZIP() []byte {
+	file_api_proto_auth_proto_rawDescOnce.Do(func() {
+		file_api_proto_auth_proto_rawDescData = protoimpl.X.CompressGZIP(file_api_proto_auth_proto_rawDescData)
+	})
+	return file_api_proto_auth_proto_rawDescData
+}
+
+var file_api_proto_auth_proto_msgTypes = make([]protoimpl.MessageInfo, 5)
+var file_api_proto_auth_proto_goTypes = []interface{}{
+	(*Credentials)(nil),         // 0: auth.Credentials
+	(*RegisterData)(nil),        // 1: auth.RegisterData
+	(*User)(nil),                // 2: auth.User
+	(*Session)(nil),             // 3: auth.Session
+	(*UserID)(nil),              // 4: auth.UserID
+	(*timestamp.Timestamp)(nil), // 5: google.protobuf.Timestamp
+	(*empty.Empty)(nil),         // 6: google.protobuf.Empty
+}
+var file_api_proto_auth_proto_depIdxs = []int32{
+	0, // 0: auth.RegisterData.cred:type_name -> auth.Credentials
+	5, // 1: auth.Session.expire:type_name -> google.protobuf.Timestamp
+	1, // 2: auth.Auth.Register:input_type -> auth.RegisterData
+	0, // 3: auth.Auth.Login:input_type -> auth.Credentials
+	3, // 4: auth.Auth.Logout:input_type -> auth.Session
+	3, // 5: auth.Auth.GetUserID:input_type -> auth.Session
+	6, // 6: auth.Auth.Register:output_type -> google.protobuf.Empty
+	3, // 7: auth.Auth.Login:output_type -> auth.Session
+	6, // 8: auth.Auth.Logout:output_type -> google.protobuf.Empty
+	4, // 9: auth.Auth.GetUserID:output_type -> auth.UserID
+	6, // [6:10] is the sub-list for method output_type
+	2, // [2:6] is the sub-list for method input_type
+	2, // [2:2] is the sub-list for extension type_name
+	2, // [2:2] is the sub-list for extension extendee
+	0, // [0:2] is the sub-list for field type_name
+}
+
+func init() { file_api_proto_auth_proto_init() }
+func file_api_proto_auth_proto_init() {
+	if File_api_proto_auth_proto != nil {
+		return
+	}
+	if !protoimpl.UnsafeEnabled {
+		file_api_proto_auth_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Credentials); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_auth_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*RegisterData); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_auth_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*User); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_auth_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Session); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_auth_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*UserID); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: file_api_proto_auth_proto_rawDesc,
+			NumEnums:      0,
+			NumMessages:   5,
+			NumExtensions: 0,
+			NumServices:   1,
+		},
+		GoTypes:           file_api_proto_auth_proto_goTypes,
+		DependencyIndexes: file_api_proto_auth_proto_depIdxs,
+		MessageInfos:      file_api_proto_auth_proto_msgTypes,
+	}.Build()
+	File_api_proto_auth_proto = out.File
+	file_api_proto_auth_proto_rawDesc = nil
+	file_api_proto_auth_proto_goTypes = nil
+	file_api_proto_auth_proto_depIdxs = nil
+}
diff --git a/internal/api/auth/auth_grpc.pb.go b/internal/api/auth/auth_grpc.pb.go
new file mode 100644
index 0000000..bc4a5e7
--- /dev/null
+++ b/internal/api/auth/auth_grpc.pb.go
@@ -0,0 +1,214 @@
+// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
+// versions:
+// - protoc-gen-go-grpc v1.2.0
+// - protoc             v3.6.1
+// source: api/proto/auth.proto
+
+package auth
+
+import (
+	context "context"
+	empty "github.com/golang/protobuf/ptypes/empty"
+	grpc "google.golang.org/grpc"
+	codes "google.golang.org/grpc/codes"
+	status "google.golang.org/grpc/status"
+)
+
+// This is a compile-time assertion to ensure that this generated file
+// is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
+const _ = grpc.SupportPackageIsVersion7
+
+// AuthClient is the client API for Auth service.
+//
+// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
+type AuthClient interface {
+	Register(ctx context.Context, in *RegisterData, opts ...grpc.CallOption) (*empty.Empty, error)
+	Login(ctx context.Context, in *Credentials, opts ...grpc.CallOption) (*Session, error)
+	Logout(ctx context.Context, in *Session, opts ...grpc.CallOption) (*empty.Empty, error)
+	GetUserID(ctx context.Context, in *Session, opts ...grpc.CallOption) (*UserID, error)
+}
+
+type authClient struct {
+	cc grpc.ClientConnInterface
+}
+
+func NewAuthClient(cc grpc.ClientConnInterface) AuthClient {
+	return &authClient{cc}
+}
+
+func (c *authClient) Register(ctx context.Context, in *RegisterData, opts ...grpc.CallOption) (*empty.Empty, error) {
+	out := new(empty.Empty)
+	err := c.cc.Invoke(ctx, "/auth.Auth/Register", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *authClient) Login(ctx context.Context, in *Credentials, opts ...grpc.CallOption) (*Session, error) {
+	out := new(Session)
+	err := c.cc.Invoke(ctx, "/auth.Auth/Login", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *authClient) Logout(ctx context.Context, in *Session, opts ...grpc.CallOption) (*empty.Empty, error) {
+	out := new(empty.Empty)
+	err := c.cc.Invoke(ctx, "/auth.Auth/Logout", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *authClient) GetUserID(ctx context.Context, in *Session, opts ...grpc.CallOption) (*UserID, error) {
+	out := new(UserID)
+	err := c.cc.Invoke(ctx, "/auth.Auth/GetUserID", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+// AuthServer is the server API for Auth service.
+// All implementations must embed UnimplementedAuthServer
+// for forward compatibility
+type AuthServer interface {
+	Register(context.Context, *RegisterData) (*empty.Empty, error)
+	Login(context.Context, *Credentials) (*Session, error)
+	Logout(context.Context, *Session) (*empty.Empty, error)
+	GetUserID(context.Context, *Session) (*UserID, error)
+	mustEmbedUnimplementedAuthServer()
+}
+
+// UnimplementedAuthServer must be embedded to have forward compatible implementations.
+type UnimplementedAuthServer struct {
+}
+
+func (UnimplementedAuthServer) Register(context.Context, *RegisterData) (*empty.Empty, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method Register not implemented")
+}
+func (UnimplementedAuthServer) Login(context.Context, *Credentials) (*Session, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method Login not implemented")
+}
+func (UnimplementedAuthServer) Logout(context.Context, *Session) (*empty.Empty, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method Logout not implemented")
+}
+func (UnimplementedAuthServer) GetUserID(context.Context, *Session) (*UserID, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method GetUserID not implemented")
+}
+func (UnimplementedAuthServer) mustEmbedUnimplementedAuthServer() {}
+
+// UnsafeAuthServer may be embedded to opt out of forward compatibility for this service.
+// Use of this interface is not recommended, as added methods to AuthServer will
+// result in compilation errors.
+type UnsafeAuthServer interface {
+	mustEmbedUnimplementedAuthServer()
+}
+
+func RegisterAuthServer(s grpc.ServiceRegistrar, srv AuthServer) {
+	s.RegisterService(&Auth_ServiceDesc, srv)
+}
+
+func _Auth_Register_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(RegisterData)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(AuthServer).Register(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/auth.Auth/Register",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(AuthServer).Register(ctx, req.(*RegisterData))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Auth_Login_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(Credentials)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(AuthServer).Login(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/auth.Auth/Login",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(AuthServer).Login(ctx, req.(*Credentials))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Auth_Logout_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(Session)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(AuthServer).Logout(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/auth.Auth/Logout",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(AuthServer).Logout(ctx, req.(*Session))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Auth_GetUserID_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(Session)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(AuthServer).GetUserID(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/auth.Auth/GetUserID",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(AuthServer).GetUserID(ctx, req.(*Session))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+// Auth_ServiceDesc is the grpc.ServiceDesc for Auth service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var Auth_ServiceDesc = grpc.ServiceDesc{
+	ServiceName: "auth.Auth",
+	HandlerType: (*AuthServer)(nil),
+	Methods: []grpc.MethodDesc{
+		{
+			MethodName: "Register",
+			Handler:    _Auth_Register_Handler,
+		},
+		{
+			MethodName: "Login",
+			Handler:    _Auth_Login_Handler,
+		},
+		{
+			MethodName: "Logout",
+			Handler:    _Auth_Logout_Handler,
+		},
+		{
+			MethodName: "GetUserID",
+			Handler:    _Auth_GetUserID_Handler,
+		},
+	},
+	Streams:  []grpc.StreamDesc{},
+	Metadata: "api/proto/auth.proto",
+}
diff --git a/internal/api/messenger/messenger.pb.go b/internal/api/messenger/messenger.pb.go
new file mode 100644
index 0000000..a9b7c6a
--- /dev/null
+++ b/internal/api/messenger/messenger.pb.go
@@ -0,0 +1,812 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.28.1
+// 	protoc        v3.6.1
+// source: api/proto/messenger.proto
+
+package messenger
+
+import (
+	empty "github.com/golang/protobuf/ptypes/empty"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type MsgID struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Id int64 `protobuf:"varint,1,opt,name=id,proto3" json:"id,omitempty"`
+}
+
+func (x *MsgID) Reset() {
+	*x = MsgID{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[0]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *MsgID) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*MsgID) ProtoMessage() {}
+
+func (x *MsgID) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[0]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use MsgID.ProtoReflect.Descriptor instead.
+func (*MsgID) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *MsgID) GetId() int64 {
+	if x != nil {
+		return x.Id
+	}
+	return 0
+}
+
+type Message struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Id       *MsgID `protobuf:"bytes,1,opt,name=id,proto3" json:"id,omitempty"`
+	UserFrom int64  `protobuf:"varint,2,opt,name=user_from,json=userFrom,proto3" json:"user_from,omitempty"`
+	UserTo   int64  `protobuf:"varint,3,opt,name=user_to,json=userTo,proto3" json:"user_to,omitempty"`
+	Content  string `protobuf:"bytes,4,opt,name=content,proto3" json:"content,omitempty"`
+}
+
+func (x *Message) Reset() {
+	*x = Message{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[1]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Message) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Message) ProtoMessage() {}
+
+func (x *Message) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[1]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Message.ProtoReflect.Descriptor instead.
+func (*Message) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *Message) GetId() *MsgID {
+	if x != nil {
+		return x.Id
+	}
+	return nil
+}
+
+func (x *Message) GetUserFrom() int64 {
+	if x != nil {
+		return x.UserFrom
+	}
+	return 0
+}
+
+func (x *Message) GetUserTo() int64 {
+	if x != nil {
+		return x.UserTo
+	}
+	return 0
+}
+
+func (x *Message) GetContent() string {
+	if x != nil {
+		return x.Content
+	}
+	return ""
+}
+
+type Chat struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	UserID1 int64 `protobuf:"varint,1,opt,name=userID1,proto3" json:"userID1,omitempty"`
+	UserID2 int64 `protobuf:"varint,2,opt,name=userID2,proto3" json:"userID2,omitempty"`
+}
+
+func (x *Chat) Reset() {
+	*x = Chat{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[2]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Chat) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Chat) ProtoMessage() {}
+
+func (x *Chat) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[2]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Chat.ProtoReflect.Descriptor instead.
+func (*Chat) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{2}
+}
+
+func (x *Chat) GetUserID1() int64 {
+	if x != nil {
+		return x.UserID1
+	}
+	return 0
+}
+
+func (x *Chat) GetUserID2() int64 {
+	if x != nil {
+		return x.UserID2
+	}
+	return 0
+}
+
+type FeedChatRequest struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Count  int64 `protobuf:"varint,1,opt,name=count,proto3" json:"count,omitempty"`
+	LastID int64 `protobuf:"varint,2,opt,name=lastID,proto3" json:"lastID,omitempty"`
+}
+
+func (x *FeedChatRequest) Reset() {
+	*x = FeedChatRequest{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[3]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FeedChatRequest) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FeedChatRequest) ProtoMessage() {}
+
+func (x *FeedChatRequest) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[3]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FeedChatRequest.ProtoReflect.Descriptor instead.
+func (*FeedChatRequest) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{3}
+}
+
+func (x *FeedChatRequest) GetCount() int64 {
+	if x != nil {
+		return x.Count
+	}
+	return 0
+}
+
+func (x *FeedChatRequest) GetLastID() int64 {
+	if x != nil {
+		return x.LastID
+	}
+	return 0
+}
+
+type FeedMessageRequest struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Chat   *Chat `protobuf:"bytes,1,opt,name=chat,proto3" json:"chat,omitempty"`
+	Count  int64 `protobuf:"varint,2,opt,name=count,proto3" json:"count,omitempty"`
+	LastID int64 `protobuf:"varint,3,opt,name=lastID,proto3" json:"lastID,omitempty"`
+}
+
+func (x *FeedMessageRequest) Reset() {
+	*x = FeedMessageRequest{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[4]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FeedMessageRequest) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FeedMessageRequest) ProtoMessage() {}
+
+func (x *FeedMessageRequest) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[4]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FeedMessageRequest.ProtoReflect.Descriptor instead.
+func (*FeedMessageRequest) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{4}
+}
+
+func (x *FeedMessageRequest) GetChat() *Chat {
+	if x != nil {
+		return x.Chat
+	}
+	return nil
+}
+
+func (x *FeedMessageRequest) GetCount() int64 {
+	if x != nil {
+		return x.Count
+	}
+	return 0
+}
+
+func (x *FeedMessageRequest) GetLastID() int64 {
+	if x != nil {
+		return x.LastID
+	}
+	return 0
+}
+
+type WichWhomChat struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	UserID   int64  `protobuf:"varint,1,opt,name=userID,proto3" json:"userID,omitempty"`
+	Username string `protobuf:"bytes,2,opt,name=username,proto3" json:"username,omitempty"`
+	Avatar   string `protobuf:"bytes,3,opt,name=avatar,proto3" json:"avatar,omitempty"`
+}
+
+func (x *WichWhomChat) Reset() {
+	*x = WichWhomChat{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[5]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *WichWhomChat) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*WichWhomChat) ProtoMessage() {}
+
+func (x *WichWhomChat) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[5]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use WichWhomChat.ProtoReflect.Descriptor instead.
+func (*WichWhomChat) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{5}
+}
+
+func (x *WichWhomChat) GetUserID() int64 {
+	if x != nil {
+		return x.UserID
+	}
+	return 0
+}
+
+func (x *WichWhomChat) GetUsername() string {
+	if x != nil {
+		return x.Username
+	}
+	return ""
+}
+
+func (x *WichWhomChat) GetAvatar() string {
+	if x != nil {
+		return x.Avatar
+	}
+	return ""
+}
+
+type ChatWithUser struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	LastMessageID int64         `protobuf:"varint,1,opt,name=lastMessageID,proto3" json:"lastMessageID,omitempty"`
+	Chat          *WichWhomChat `protobuf:"bytes,2,opt,name=chat,proto3" json:"chat,omitempty"`
+}
+
+func (x *ChatWithUser) Reset() {
+	*x = ChatWithUser{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[6]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *ChatWithUser) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*ChatWithUser) ProtoMessage() {}
+
+func (x *ChatWithUser) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[6]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use ChatWithUser.ProtoReflect.Descriptor instead.
+func (*ChatWithUser) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{6}
+}
+
+func (x *ChatWithUser) GetLastMessageID() int64 {
+	if x != nil {
+		return x.LastMessageID
+	}
+	return 0
+}
+
+func (x *ChatWithUser) GetChat() *WichWhomChat {
+	if x != nil {
+		return x.Chat
+	}
+	return nil
+}
+
+type FeedMessage struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Messages []*Message `protobuf:"bytes,1,rep,name=messages,proto3" json:"messages,omitempty"`
+	LastID   int64      `protobuf:"varint,2,opt,name=lastID,proto3" json:"lastID,omitempty"`
+}
+
+func (x *FeedMessage) Reset() {
+	*x = FeedMessage{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[7]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FeedMessage) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FeedMessage) ProtoMessage() {}
+
+func (x *FeedMessage) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[7]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FeedMessage.ProtoReflect.Descriptor instead.
+func (*FeedMessage) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{7}
+}
+
+func (x *FeedMessage) GetMessages() []*Message {
+	if x != nil {
+		return x.Messages
+	}
+	return nil
+}
+
+func (x *FeedMessage) GetLastID() int64 {
+	if x != nil {
+		return x.LastID
+	}
+	return 0
+}
+
+type FeedChat struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Chats  []*ChatWithUser `protobuf:"bytes,1,rep,name=chats,proto3" json:"chats,omitempty"`
+	LastID int64           `protobuf:"varint,2,opt,name=lastID,proto3" json:"lastID,omitempty"`
+}
+
+func (x *FeedChat) Reset() {
+	*x = FeedChat{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_messenger_proto_msgTypes[8]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *FeedChat) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*FeedChat) ProtoMessage() {}
+
+func (x *FeedChat) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_messenger_proto_msgTypes[8]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use FeedChat.ProtoReflect.Descriptor instead.
+func (*FeedChat) Descriptor() ([]byte, []int) {
+	return file_api_proto_messenger_proto_rawDescGZIP(), []int{8}
+}
+
+func (x *FeedChat) GetChats() []*ChatWithUser {
+	if x != nil {
+		return x.Chats
+	}
+	return nil
+}
+
+func (x *FeedChat) GetLastID() int64 {
+	if x != nil {
+		return x.LastID
+	}
+	return 0
+}
+
+var File_api_proto_messenger_proto protoreflect.FileDescriptor
+
+var file_api_proto_messenger_proto_rawDesc = []byte{
+	0x0a, 0x19, 0x61, 0x70, 0x69, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x2f, 0x6d, 0x65, 0x73, 0x73,
+	0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x09, 0x6d, 0x65, 0x73,
+	0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x1a, 0x1b, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70,
+	0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x65, 0x6d, 0x70, 0x74, 0x79, 0x2e, 0x70, 0x72,
+	0x6f, 0x74, 0x6f, 0x22, 0x17, 0x0a, 0x05, 0x4d, 0x73, 0x67, 0x49, 0x44, 0x12, 0x0e, 0x0a, 0x02,
+	0x69, 0x64, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x02, 0x69, 0x64, 0x22, 0x7b, 0x0a, 0x07,
+	0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x20, 0x0a, 0x02, 0x69, 0x64, 0x18, 0x01, 0x20,
+	0x01, 0x28, 0x0b, 0x32, 0x10, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e,
+	0x4d, 0x73, 0x67, 0x49, 0x44, 0x52, 0x02, 0x69, 0x64, 0x12, 0x1b, 0x0a, 0x09, 0x75, 0x73, 0x65,
+	0x72, 0x5f, 0x66, 0x72, 0x6f, 0x6d, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x08, 0x75, 0x73,
+	0x65, 0x72, 0x46, 0x72, 0x6f, 0x6d, 0x12, 0x17, 0x0a, 0x07, 0x75, 0x73, 0x65, 0x72, 0x5f, 0x74,
+	0x6f, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x75, 0x73, 0x65, 0x72, 0x54, 0x6f, 0x12,
+	0x18, 0x0a, 0x07, 0x63, 0x6f, 0x6e, 0x74, 0x65, 0x6e, 0x74, 0x18, 0x04, 0x20, 0x01, 0x28, 0x09,
+	0x52, 0x07, 0x63, 0x6f, 0x6e, 0x74, 0x65, 0x6e, 0x74, 0x22, 0x3a, 0x0a, 0x04, 0x43, 0x68, 0x61,
+	0x74, 0x12, 0x18, 0x0a, 0x07, 0x75, 0x73, 0x65, 0x72, 0x49, 0x44, 0x31, 0x18, 0x01, 0x20, 0x01,
+	0x28, 0x03, 0x52, 0x07, 0x75, 0x73, 0x65, 0x72, 0x49, 0x44, 0x31, 0x12, 0x18, 0x0a, 0x07, 0x75,
+	0x73, 0x65, 0x72, 0x49, 0x44, 0x32, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x07, 0x75, 0x73,
+	0x65, 0x72, 0x49, 0x44, 0x32, 0x22, 0x3f, 0x0a, 0x0f, 0x46, 0x65, 0x65, 0x64, 0x43, 0x68, 0x61,
+	0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e,
+	0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x16,
+	0x0a, 0x06, 0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06,
+	0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x22, 0x67, 0x0a, 0x12, 0x46, 0x65, 0x65, 0x64, 0x4d, 0x65,
+	0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x12, 0x23, 0x0a, 0x04,
+	0x63, 0x68, 0x61, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x0f, 0x2e, 0x6d, 0x65, 0x73,
+	0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x43, 0x68, 0x61, 0x74, 0x52, 0x04, 0x63, 0x68, 0x61,
+	0x74, 0x12, 0x14, 0x0a, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03,
+	0x52, 0x05, 0x63, 0x6f, 0x75, 0x6e, 0x74, 0x12, 0x16, 0x0a, 0x06, 0x6c, 0x61, 0x73, 0x74, 0x49,
+	0x44, 0x18, 0x03, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x22,
+	0x5a, 0x0a, 0x0c, 0x57, 0x69, 0x63, 0x68, 0x57, 0x68, 0x6f, 0x6d, 0x43, 0x68, 0x61, 0x74, 0x12,
+	0x16, 0x0a, 0x06, 0x75, 0x73, 0x65, 0x72, 0x49, 0x44, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52,
+	0x06, 0x75, 0x73, 0x65, 0x72, 0x49, 0x44, 0x12, 0x1a, 0x0a, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e,
+	0x61, 0x6d, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x08, 0x75, 0x73, 0x65, 0x72, 0x6e,
+	0x61, 0x6d, 0x65, 0x12, 0x16, 0x0a, 0x06, 0x61, 0x76, 0x61, 0x74, 0x61, 0x72, 0x18, 0x03, 0x20,
+	0x01, 0x28, 0x09, 0x52, 0x06, 0x61, 0x76, 0x61, 0x74, 0x61, 0x72, 0x22, 0x61, 0x0a, 0x0c, 0x43,
+	0x68, 0x61, 0x74, 0x57, 0x69, 0x74, 0x68, 0x55, 0x73, 0x65, 0x72, 0x12, 0x24, 0x0a, 0x0d, 0x6c,
+	0x61, 0x73, 0x74, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x49, 0x44, 0x18, 0x01, 0x20, 0x01,
+	0x28, 0x03, 0x52, 0x0d, 0x6c, 0x61, 0x73, 0x74, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x49,
+	0x44, 0x12, 0x2b, 0x0a, 0x04, 0x63, 0x68, 0x61, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32,
+	0x17, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x57, 0x69, 0x63, 0x68,
+	0x57, 0x68, 0x6f, 0x6d, 0x43, 0x68, 0x61, 0x74, 0x52, 0x04, 0x63, 0x68, 0x61, 0x74, 0x22, 0x55,
+	0x0a, 0x0b, 0x46, 0x65, 0x65, 0x64, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x2e, 0x0a,
+	0x08, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32,
+	0x12, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x4d, 0x65, 0x73, 0x73,
+	0x61, 0x67, 0x65, 0x52, 0x08, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x73, 0x12, 0x16, 0x0a,
+	0x06, 0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03, 0x52, 0x06, 0x6c,
+	0x61, 0x73, 0x74, 0x49, 0x44, 0x22, 0x51, 0x0a, 0x08, 0x46, 0x65, 0x65, 0x64, 0x43, 0x68, 0x61,
+	0x74, 0x12, 0x2d, 0x0a, 0x05, 0x63, 0x68, 0x61, 0x74, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b,
+	0x32, 0x17, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x43, 0x68, 0x61,
+	0x74, 0x57, 0x69, 0x74, 0x68, 0x55, 0x73, 0x65, 0x72, 0x52, 0x05, 0x63, 0x68, 0x61, 0x74, 0x73,
+	0x12, 0x16, 0x0a, 0x06, 0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x18, 0x02, 0x20, 0x01, 0x28, 0x03,
+	0x52, 0x06, 0x6c, 0x61, 0x73, 0x74, 0x49, 0x44, 0x32, 0x8e, 0x03, 0x0a, 0x09, 0x4d, 0x65, 0x73,
+	0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x12, 0x4c, 0x0a, 0x17, 0x55, 0x73, 0x65, 0x72, 0x43, 0x68,
+	0x61, 0x74, 0x73, 0x57, 0x69, 0x74, 0x68, 0x4f, 0x74, 0x68, 0x65, 0x72, 0x55, 0x73, 0x65, 0x72,
+	0x73, 0x12, 0x1a, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x46, 0x65,
+	0x65, 0x64, 0x43, 0x68, 0x61, 0x74, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x13, 0x2e,
+	0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x46, 0x65, 0x65, 0x64, 0x43, 0x68,
+	0x61, 0x74, 0x22, 0x00, 0x12, 0x35, 0x0a, 0x0b, 0x53, 0x65, 0x6e, 0x64, 0x4d, 0x65, 0x73, 0x73,
+	0x61, 0x67, 0x65, 0x12, 0x12, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e,
+	0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x1a, 0x10, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e,
+	0x67, 0x65, 0x72, 0x2e, 0x4d, 0x73, 0x67, 0x49, 0x44, 0x22, 0x00, 0x12, 0x4a, 0x0a, 0x0f, 0x4d,
+	0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x46, 0x72, 0x6f, 0x6d, 0x43, 0x68, 0x61, 0x74, 0x12, 0x1d,
+	0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x46, 0x65, 0x65, 0x64, 0x4d,
+	0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x65, 0x71, 0x75, 0x65, 0x73, 0x74, 0x1a, 0x16, 0x2e,
+	0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x46, 0x65, 0x65, 0x64, 0x4d, 0x65,
+	0x73, 0x73, 0x61, 0x67, 0x65, 0x22, 0x00, 0x12, 0x3d, 0x0a, 0x0d, 0x55, 0x70, 0x64, 0x61, 0x74,
+	0x65, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x12, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65,
+	0x6e, 0x67, 0x65, 0x72, 0x2e, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x1a, 0x16, 0x2e, 0x67,
+	0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45,
+	0x6d, 0x70, 0x74, 0x79, 0x22, 0x00, 0x12, 0x3b, 0x0a, 0x0d, 0x44, 0x65, 0x6c, 0x65, 0x74, 0x65,
+	0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x10, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e,
+	0x67, 0x65, 0x72, 0x2e, 0x4d, 0x73, 0x67, 0x49, 0x44, 0x1a, 0x16, 0x2e, 0x67, 0x6f, 0x6f, 0x67,
+	0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66, 0x2e, 0x45, 0x6d, 0x70, 0x74,
+	0x79, 0x22, 0x00, 0x12, 0x34, 0x0a, 0x0a, 0x47, 0x65, 0x74, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67,
+	0x65, 0x12, 0x10, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e, 0x4d, 0x73,
+	0x67, 0x49, 0x44, 0x1a, 0x12, 0x2e, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x2e,
+	0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x22, 0x00, 0x42, 0x43, 0x5a, 0x41, 0x67, 0x69, 0x74,
+	0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67, 0x6f, 0x2d, 0x70, 0x61, 0x72, 0x6b, 0x2d,
+	0x6d, 0x61, 0x69, 0x6c, 0x2d, 0x72, 0x75, 0x2f, 0x32, 0x30, 0x32, 0x33, 0x5f, 0x32, 0x5f, 0x4f,
+	0x4e, 0x44, 0x5f, 0x74, 0x65, 0x61, 0x6d, 0x2f, 0x69, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c,
+	0x2f, 0x61, 0x70, 0x69, 0x2f, 0x6d, 0x65, 0x73, 0x73, 0x65, 0x6e, 0x67, 0x65, 0x72, 0x62, 0x06,
+	0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+}
+
+var (
+	file_api_proto_messenger_proto_rawDescOnce sync.Once
+	file_api_proto_messenger_proto_rawDescData = file_api_proto_messenger_proto_rawDesc
+)
+
+func file_api_proto_messenger_proto_rawDescGZIP() []byte {
+	file_api_proto_messenger_proto_rawDescOnce.Do(func() {
+		file_api_proto_messenger_proto_rawDescData = protoimpl.X.CompressGZIP(file_api_proto_messenger_proto_rawDescData)
+	})
+	return file_api_proto_messenger_proto_rawDescData
+}
+
+var file_api_proto_messenger_proto_msgTypes = make([]protoimpl.MessageInfo, 9)
+var file_api_proto_messenger_proto_goTypes = []interface{}{
+	(*MsgID)(nil),              // 0: messenger.MsgID
+	(*Message)(nil),            // 1: messenger.Message
+	(*Chat)(nil),               // 2: messenger.Chat
+	(*FeedChatRequest)(nil),    // 3: messenger.FeedChatRequest
+	(*FeedMessageRequest)(nil), // 4: messenger.FeedMessageRequest
+	(*WichWhomChat)(nil),       // 5: messenger.WichWhomChat
+	(*ChatWithUser)(nil),       // 6: messenger.ChatWithUser
+	(*FeedMessage)(nil),        // 7: messenger.FeedMessage
+	(*FeedChat)(nil),           // 8: messenger.FeedChat
+	(*empty.Empty)(nil),        // 9: google.protobuf.Empty
+}
+var file_api_proto_messenger_proto_depIdxs = []int32{
+	0,  // 0: messenger.Message.id:type_name -> messenger.MsgID
+	2,  // 1: messenger.FeedMessageRequest.chat:type_name -> messenger.Chat
+	5,  // 2: messenger.ChatWithUser.chat:type_name -> messenger.WichWhomChat
+	1,  // 3: messenger.FeedMessage.messages:type_name -> messenger.Message
+	6,  // 4: messenger.FeedChat.chats:type_name -> messenger.ChatWithUser
+	3,  // 5: messenger.Messenger.UserChatsWithOtherUsers:input_type -> messenger.FeedChatRequest
+	1,  // 6: messenger.Messenger.SendMessage:input_type -> messenger.Message
+	4,  // 7: messenger.Messenger.MessageFromChat:input_type -> messenger.FeedMessageRequest
+	1,  // 8: messenger.Messenger.UpdateMessage:input_type -> messenger.Message
+	0,  // 9: messenger.Messenger.DeleteMessage:input_type -> messenger.MsgID
+	0,  // 10: messenger.Messenger.GetMessage:input_type -> messenger.MsgID
+	8,  // 11: messenger.Messenger.UserChatsWithOtherUsers:output_type -> messenger.FeedChat
+	0,  // 12: messenger.Messenger.SendMessage:output_type -> messenger.MsgID
+	7,  // 13: messenger.Messenger.MessageFromChat:output_type -> messenger.FeedMessage
+	9,  // 14: messenger.Messenger.UpdateMessage:output_type -> google.protobuf.Empty
+	9,  // 15: messenger.Messenger.DeleteMessage:output_type -> google.protobuf.Empty
+	1,  // 16: messenger.Messenger.GetMessage:output_type -> messenger.Message
+	11, // [11:17] is the sub-list for method output_type
+	5,  // [5:11] is the sub-list for method input_type
+	5,  // [5:5] is the sub-list for extension type_name
+	5,  // [5:5] is the sub-list for extension extendee
+	0,  // [0:5] is the sub-list for field type_name
+}
+
+func init() { file_api_proto_messenger_proto_init() }
+func file_api_proto_messenger_proto_init() {
+	if File_api_proto_messenger_proto != nil {
+		return
+	}
+	if !protoimpl.UnsafeEnabled {
+		file_api_proto_messenger_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*MsgID); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Message); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Chat); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FeedChatRequest); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FeedMessageRequest); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*WichWhomChat); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[6].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*ChatWithUser); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[7].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FeedMessage); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_messenger_proto_msgTypes[8].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*FeedChat); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: file_api_proto_messenger_proto_rawDesc,
+			NumEnums:      0,
+			NumMessages:   9,
+			NumExtensions: 0,
+			NumServices:   1,
+		},
+		GoTypes:           file_api_proto_messenger_proto_goTypes,
+		DependencyIndexes: file_api_proto_messenger_proto_depIdxs,
+		MessageInfos:      file_api_proto_messenger_proto_msgTypes,
+	}.Build()
+	File_api_proto_messenger_proto = out.File
+	file_api_proto_messenger_proto_rawDesc = nil
+	file_api_proto_messenger_proto_goTypes = nil
+	file_api_proto_messenger_proto_depIdxs = nil
+}
diff --git a/internal/api/messenger/messenger_grpc.pb.go b/internal/api/messenger/messenger_grpc.pb.go
new file mode 100644
index 0000000..b2fb9eb
--- /dev/null
+++ b/internal/api/messenger/messenger_grpc.pb.go
@@ -0,0 +1,286 @@
+// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
+// versions:
+// - protoc-gen-go-grpc v1.2.0
+// - protoc             v3.6.1
+// source: api/proto/messenger.proto
+
+package messenger
+
+import (
+	context "context"
+	empty "github.com/golang/protobuf/ptypes/empty"
+	grpc "google.golang.org/grpc"
+	codes "google.golang.org/grpc/codes"
+	status "google.golang.org/grpc/status"
+)
+
+// This is a compile-time assertion to ensure that this generated file
+// is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
+const _ = grpc.SupportPackageIsVersion7
+
+// MessengerClient is the client API for Messenger service.
+//
+// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
+type MessengerClient interface {
+	UserChatsWithOtherUsers(ctx context.Context, in *FeedChatRequest, opts ...grpc.CallOption) (*FeedChat, error)
+	SendMessage(ctx context.Context, in *Message, opts ...grpc.CallOption) (*MsgID, error)
+	MessageFromChat(ctx context.Context, in *FeedMessageRequest, opts ...grpc.CallOption) (*FeedMessage, error)
+	UpdateMessage(ctx context.Context, in *Message, opts ...grpc.CallOption) (*empty.Empty, error)
+	DeleteMessage(ctx context.Context, in *MsgID, opts ...grpc.CallOption) (*empty.Empty, error)
+	GetMessage(ctx context.Context, in *MsgID, opts ...grpc.CallOption) (*Message, error)
+}
+
+type messengerClient struct {
+	cc grpc.ClientConnInterface
+}
+
+func NewMessengerClient(cc grpc.ClientConnInterface) MessengerClient {
+	return &messengerClient{cc}
+}
+
+func (c *messengerClient) UserChatsWithOtherUsers(ctx context.Context, in *FeedChatRequest, opts ...grpc.CallOption) (*FeedChat, error) {
+	out := new(FeedChat)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/UserChatsWithOtherUsers", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *messengerClient) SendMessage(ctx context.Context, in *Message, opts ...grpc.CallOption) (*MsgID, error) {
+	out := new(MsgID)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/SendMessage", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *messengerClient) MessageFromChat(ctx context.Context, in *FeedMessageRequest, opts ...grpc.CallOption) (*FeedMessage, error) {
+	out := new(FeedMessage)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/MessageFromChat", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *messengerClient) UpdateMessage(ctx context.Context, in *Message, opts ...grpc.CallOption) (*empty.Empty, error) {
+	out := new(empty.Empty)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/UpdateMessage", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *messengerClient) DeleteMessage(ctx context.Context, in *MsgID, opts ...grpc.CallOption) (*empty.Empty, error) {
+	out := new(empty.Empty)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/DeleteMessage", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *messengerClient) GetMessage(ctx context.Context, in *MsgID, opts ...grpc.CallOption) (*Message, error) {
+	out := new(Message)
+	err := c.cc.Invoke(ctx, "/messenger.Messenger/GetMessage", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+// MessengerServer is the server API for Messenger service.
+// All implementations must embed UnimplementedMessengerServer
+// for forward compatibility
+type MessengerServer interface {
+	UserChatsWithOtherUsers(context.Context, *FeedChatRequest) (*FeedChat, error)
+	SendMessage(context.Context, *Message) (*MsgID, error)
+	MessageFromChat(context.Context, *FeedMessageRequest) (*FeedMessage, error)
+	UpdateMessage(context.Context, *Message) (*empty.Empty, error)
+	DeleteMessage(context.Context, *MsgID) (*empty.Empty, error)
+	GetMessage(context.Context, *MsgID) (*Message, error)
+	mustEmbedUnimplementedMessengerServer()
+}
+
+// UnimplementedMessengerServer must be embedded to have forward compatible implementations.
+type UnimplementedMessengerServer struct {
+}
+
+func (UnimplementedMessengerServer) UserChatsWithOtherUsers(context.Context, *FeedChatRequest) (*FeedChat, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method UserChatsWithOtherUsers not implemented")
+}
+func (UnimplementedMessengerServer) SendMessage(context.Context, *Message) (*MsgID, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method SendMessage not implemented")
+}
+func (UnimplementedMessengerServer) MessageFromChat(context.Context, *FeedMessageRequest) (*FeedMessage, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method MessageFromChat not implemented")
+}
+func (UnimplementedMessengerServer) UpdateMessage(context.Context, *Message) (*empty.Empty, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method UpdateMessage not implemented")
+}
+func (UnimplementedMessengerServer) DeleteMessage(context.Context, *MsgID) (*empty.Empty, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method DeleteMessage not implemented")
+}
+func (UnimplementedMessengerServer) GetMessage(context.Context, *MsgID) (*Message, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method GetMessage not implemented")
+}
+func (UnimplementedMessengerServer) mustEmbedUnimplementedMessengerServer() {}
+
+// UnsafeMessengerServer may be embedded to opt out of forward compatibility for this service.
+// Use of this interface is not recommended, as added methods to MessengerServer will
+// result in compilation errors.
+type UnsafeMessengerServer interface {
+	mustEmbedUnimplementedMessengerServer()
+}
+
+func RegisterMessengerServer(s grpc.ServiceRegistrar, srv MessengerServer) {
+	s.RegisterService(&Messenger_ServiceDesc, srv)
+}
+
+func _Messenger_UserChatsWithOtherUsers_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(FeedChatRequest)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).UserChatsWithOtherUsers(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/UserChatsWithOtherUsers",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).UserChatsWithOtherUsers(ctx, req.(*FeedChatRequest))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Messenger_SendMessage_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(Message)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).SendMessage(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/SendMessage",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).SendMessage(ctx, req.(*Message))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Messenger_MessageFromChat_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(FeedMessageRequest)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).MessageFromChat(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/MessageFromChat",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).MessageFromChat(ctx, req.(*FeedMessageRequest))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Messenger_UpdateMessage_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(Message)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).UpdateMessage(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/UpdateMessage",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).UpdateMessage(ctx, req.(*Message))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Messenger_DeleteMessage_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(MsgID)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).DeleteMessage(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/DeleteMessage",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).DeleteMessage(ctx, req.(*MsgID))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _Messenger_GetMessage_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(MsgID)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(MessengerServer).GetMessage(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/messenger.Messenger/GetMessage",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(MessengerServer).GetMessage(ctx, req.(*MsgID))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+// Messenger_ServiceDesc is the grpc.ServiceDesc for Messenger service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var Messenger_ServiceDesc = grpc.ServiceDesc{
+	ServiceName: "messenger.Messenger",
+	HandlerType: (*MessengerServer)(nil),
+	Methods: []grpc.MethodDesc{
+		{
+			MethodName: "UserChatsWithOtherUsers",
+			Handler:    _Messenger_UserChatsWithOtherUsers_Handler,
+		},
+		{
+			MethodName: "SendMessage",
+			Handler:    _Messenger_SendMessage_Handler,
+		},
+		{
+			MethodName: "MessageFromChat",
+			Handler:    _Messenger_MessageFromChat_Handler,
+		},
+		{
+			MethodName: "UpdateMessage",
+			Handler:    _Messenger_UpdateMessage_Handler,
+		},
+		{
+			MethodName: "DeleteMessage",
+			Handler:    _Messenger_DeleteMessage_Handler,
+		},
+		{
+			MethodName: "GetMessage",
+			Handler:    _Messenger_GetMessage_Handler,
+		},
+	},
+	Streams:  []grpc.StreamDesc{},
+	Metadata: "api/proto/messenger.proto",
+}
diff --git a/internal/api/realtime/realtime.pb.go b/internal/api/realtime/realtime.pb.go
new file mode 100644
index 0000000..3b3ed8f
--- /dev/null
+++ b/internal/api/realtime/realtime.pb.go
@@ -0,0 +1,626 @@
+// Code generated by protoc-gen-go. DO NOT EDIT.
+// versions:
+// 	protoc-gen-go v1.28.1
+// 	protoc        v3.6.1
+// source: api/proto/realtime.proto
+
+package realtime
+
+import (
+	empty "github.com/golang/protobuf/ptypes/empty"
+	protoreflect "google.golang.org/protobuf/reflect/protoreflect"
+	protoimpl "google.golang.org/protobuf/runtime/protoimpl"
+	reflect "reflect"
+	sync "sync"
+)
+
+const (
+	// Verify that this generated code is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(20 - protoimpl.MinVersion)
+	// Verify that runtime/protoimpl is sufficiently up-to-date.
+	_ = protoimpl.EnforceVersion(protoimpl.MaxVersion - 20)
+)
+
+type EventType int32
+
+const (
+	EventType_EV_CREATE EventType = 0
+	EventType_EV_DELETE EventType = 1
+	EventType_EV_UPDATE EventType = 2
+)
+
+// Enum value maps for EventType.
+var (
+	EventType_name = map[int32]string{
+		0: "EV_CREATE",
+		1: "EV_DELETE",
+		2: "EV_UPDATE",
+	}
+	EventType_value = map[string]int32{
+		"EV_CREATE": 0,
+		"EV_DELETE": 1,
+		"EV_UPDATE": 2,
+	}
+)
+
+func (x EventType) Enum() *EventType {
+	p := new(EventType)
+	*p = x
+	return p
+}
+
+func (x EventType) String() string {
+	return protoimpl.X.EnumStringOf(x.Descriptor(), protoreflect.EnumNumber(x))
+}
+
+func (EventType) Descriptor() protoreflect.EnumDescriptor {
+	return file_api_proto_realtime_proto_enumTypes[0].Descriptor()
+}
+
+func (EventType) Type() protoreflect.EnumType {
+	return &file_api_proto_realtime_proto_enumTypes[0]
+}
+
+func (x EventType) Number() protoreflect.EnumNumber {
+	return protoreflect.EnumNumber(x)
+}
+
+// Deprecated: Use EventType.Descriptor instead.
+func (EventType) EnumDescriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{0}
+}
+
+type Channels struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Chans []*Channel `protobuf:"bytes,1,rep,name=chans,proto3" json:"chans,omitempty"`
+}
+
+func (x *Channels) Reset() {
+	*x = Channels{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[0]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Channels) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Channels) ProtoMessage() {}
+
+func (x *Channels) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[0]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Channels.ProtoReflect.Descriptor instead.
+func (*Channels) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{0}
+}
+
+func (x *Channels) GetChans() []*Channel {
+	if x != nil {
+		return x.Chans
+	}
+	return nil
+}
+
+type Channel struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Topic string `protobuf:"bytes,1,opt,name=topic,proto3" json:"topic,omitempty"`
+	Name  string `protobuf:"bytes,2,opt,name=name,proto3" json:"name,omitempty"`
+}
+
+func (x *Channel) Reset() {
+	*x = Channel{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[1]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Channel) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Channel) ProtoMessage() {}
+
+func (x *Channel) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[1]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Channel.ProtoReflect.Descriptor instead.
+func (*Channel) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{1}
+}
+
+func (x *Channel) GetTopic() string {
+	if x != nil {
+		return x.Topic
+	}
+	return ""
+}
+
+func (x *Channel) GetName() string {
+	if x != nil {
+		return x.Name
+	}
+	return ""
+}
+
+type EventObject struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Id   int64     `protobuf:"varint,1,opt,name=id,proto3" json:"id,omitempty"`
+	Type EventType `protobuf:"varint,2,opt,name=type,proto3,enum=realtime.EventType" json:"type,omitempty"`
+}
+
+func (x *EventObject) Reset() {
+	*x = EventObject{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[2]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *EventObject) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*EventObject) ProtoMessage() {}
+
+func (x *EventObject) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[2]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use EventObject.ProtoReflect.Descriptor instead.
+func (*EventObject) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{2}
+}
+
+func (x *EventObject) GetId() int64 {
+	if x != nil {
+		return x.Id
+	}
+	return 0
+}
+
+func (x *EventObject) GetType() EventType {
+	if x != nil {
+		return x.Type
+	}
+	return EventType_EV_CREATE
+}
+
+type EventMap struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Type int64             `protobuf:"varint,1,opt,name=type,proto3" json:"type,omitempty"`
+	M    map[string]string `protobuf:"bytes,2,rep,name=m,proto3" json:"m,omitempty" protobuf_key:"bytes,1,opt,name=key,proto3" protobuf_val:"bytes,2,opt,name=value,proto3"`
+}
+
+func (x *EventMap) Reset() {
+	*x = EventMap{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[3]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *EventMap) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*EventMap) ProtoMessage() {}
+
+func (x *EventMap) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[3]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use EventMap.ProtoReflect.Descriptor instead.
+func (*EventMap) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{3}
+}
+
+func (x *EventMap) GetType() int64 {
+	if x != nil {
+		return x.Type
+	}
+	return 0
+}
+
+func (x *EventMap) GetM() map[string]string {
+	if x != nil {
+		return x.M
+	}
+	return nil
+}
+
+type Message struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	// Types that are assignable to Body:
+	//
+	//	*Message_Object
+	//	*Message_Content
+	Body isMessage_Body `protobuf_oneof:"body"`
+}
+
+func (x *Message) Reset() {
+	*x = Message{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[4]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *Message) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*Message) ProtoMessage() {}
+
+func (x *Message) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[4]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use Message.ProtoReflect.Descriptor instead.
+func (*Message) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{4}
+}
+
+func (m *Message) GetBody() isMessage_Body {
+	if m != nil {
+		return m.Body
+	}
+	return nil
+}
+
+func (x *Message) GetObject() *EventObject {
+	if x, ok := x.GetBody().(*Message_Object); ok {
+		return x.Object
+	}
+	return nil
+}
+
+func (x *Message) GetContent() *EventMap {
+	if x, ok := x.GetBody().(*Message_Content); ok {
+		return x.Content
+	}
+	return nil
+}
+
+type isMessage_Body interface {
+	isMessage_Body()
+}
+
+type Message_Object struct {
+	Object *EventObject `protobuf:"bytes,1,opt,name=object,proto3,oneof"`
+}
+
+type Message_Content struct {
+	Content *EventMap `protobuf:"bytes,2,opt,name=content,proto3,oneof"`
+}
+
+func (*Message_Object) isMessage_Body() {}
+
+func (*Message_Content) isMessage_Body() {}
+
+type PublishMessage struct {
+	state         protoimpl.MessageState
+	sizeCache     protoimpl.SizeCache
+	unknownFields protoimpl.UnknownFields
+
+	Channel *Channel `protobuf:"bytes,1,opt,name=channel,proto3" json:"channel,omitempty"`
+	Message *Message `protobuf:"bytes,2,opt,name=message,proto3" json:"message,omitempty"`
+}
+
+func (x *PublishMessage) Reset() {
+	*x = PublishMessage{}
+	if protoimpl.UnsafeEnabled {
+		mi := &file_api_proto_realtime_proto_msgTypes[5]
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		ms.StoreMessageInfo(mi)
+	}
+}
+
+func (x *PublishMessage) String() string {
+	return protoimpl.X.MessageStringOf(x)
+}
+
+func (*PublishMessage) ProtoMessage() {}
+
+func (x *PublishMessage) ProtoReflect() protoreflect.Message {
+	mi := &file_api_proto_realtime_proto_msgTypes[5]
+	if protoimpl.UnsafeEnabled && x != nil {
+		ms := protoimpl.X.MessageStateOf(protoimpl.Pointer(x))
+		if ms.LoadMessageInfo() == nil {
+			ms.StoreMessageInfo(mi)
+		}
+		return ms
+	}
+	return mi.MessageOf(x)
+}
+
+// Deprecated: Use PublishMessage.ProtoReflect.Descriptor instead.
+func (*PublishMessage) Descriptor() ([]byte, []int) {
+	return file_api_proto_realtime_proto_rawDescGZIP(), []int{5}
+}
+
+func (x *PublishMessage) GetChannel() *Channel {
+	if x != nil {
+		return x.Channel
+	}
+	return nil
+}
+
+func (x *PublishMessage) GetMessage() *Message {
+	if x != nil {
+		return x.Message
+	}
+	return nil
+}
+
+var File_api_proto_realtime_proto protoreflect.FileDescriptor
+
+var file_api_proto_realtime_proto_rawDesc = []byte{
+	0x0a, 0x18, 0x61, 0x70, 0x69, 0x2f, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x2f, 0x72, 0x65, 0x61, 0x6c,
+	0x74, 0x69, 0x6d, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x12, 0x08, 0x72, 0x65, 0x61, 0x6c,
+	0x74, 0x69, 0x6d, 0x65, 0x1a, 0x1b, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2f, 0x70, 0x72, 0x6f,
+	0x74, 0x6f, 0x62, 0x75, 0x66, 0x2f, 0x65, 0x6d, 0x70, 0x74, 0x79, 0x2e, 0x70, 0x72, 0x6f, 0x74,
+	0x6f, 0x22, 0x33, 0x0a, 0x08, 0x43, 0x68, 0x61, 0x6e, 0x6e, 0x65, 0x6c, 0x73, 0x12, 0x27, 0x0a,
+	0x05, 0x63, 0x68, 0x61, 0x6e, 0x73, 0x18, 0x01, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x11, 0x2e, 0x72,
+	0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65, 0x2e, 0x43, 0x68, 0x61, 0x6e, 0x6e, 0x65, 0x6c, 0x52,
+	0x05, 0x63, 0x68, 0x61, 0x6e, 0x73, 0x22, 0x33, 0x0a, 0x07, 0x43, 0x68, 0x61, 0x6e, 0x6e, 0x65,
+	0x6c, 0x12, 0x14, 0x0a, 0x05, 0x74, 0x6f, 0x70, 0x69, 0x63, 0x18, 0x01, 0x20, 0x01, 0x28, 0x09,
+	0x52, 0x05, 0x74, 0x6f, 0x70, 0x69, 0x63, 0x12, 0x12, 0x0a, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x18,
+	0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x04, 0x6e, 0x61, 0x6d, 0x65, 0x22, 0x46, 0x0a, 0x0b, 0x45,
+	0x76, 0x65, 0x6e, 0x74, 0x4f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x12, 0x0e, 0x0a, 0x02, 0x69, 0x64,
+	0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x02, 0x69, 0x64, 0x12, 0x27, 0x0a, 0x04, 0x74, 0x79,
+	0x70, 0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0e, 0x32, 0x13, 0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74,
+	0x69, 0x6d, 0x65, 0x2e, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, 0x52, 0x04, 0x74,
+	0x79, 0x70, 0x65, 0x22, 0x7d, 0x0a, 0x08, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x4d, 0x61, 0x70, 0x12,
+	0x12, 0x0a, 0x04, 0x74, 0x79, 0x70, 0x65, 0x18, 0x01, 0x20, 0x01, 0x28, 0x03, 0x52, 0x04, 0x74,
+	0x79, 0x70, 0x65, 0x12, 0x27, 0x0a, 0x01, 0x6d, 0x18, 0x02, 0x20, 0x03, 0x28, 0x0b, 0x32, 0x19,
+	0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65, 0x2e, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x4d,
+	0x61, 0x70, 0x2e, 0x4d, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x52, 0x01, 0x6d, 0x1a, 0x34, 0x0a, 0x06,
+	0x4d, 0x45, 0x6e, 0x74, 0x72, 0x79, 0x12, 0x10, 0x0a, 0x03, 0x6b, 0x65, 0x79, 0x18, 0x01, 0x20,
+	0x01, 0x28, 0x09, 0x52, 0x03, 0x6b, 0x65, 0x79, 0x12, 0x14, 0x0a, 0x05, 0x76, 0x61, 0x6c, 0x75,
+	0x65, 0x18, 0x02, 0x20, 0x01, 0x28, 0x09, 0x52, 0x05, 0x76, 0x61, 0x6c, 0x75, 0x65, 0x3a, 0x02,
+	0x38, 0x01, 0x22, 0x72, 0x0a, 0x07, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x2f, 0x0a,
+	0x06, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x15, 0x2e,
+	0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65, 0x2e, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x4f, 0x62,
+	0x6a, 0x65, 0x63, 0x74, 0x48, 0x00, 0x52, 0x06, 0x6f, 0x62, 0x6a, 0x65, 0x63, 0x74, 0x12, 0x2e,
+	0x0a, 0x07, 0x63, 0x6f, 0x6e, 0x74, 0x65, 0x6e, 0x74, 0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32,
+	0x12, 0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65, 0x2e, 0x45, 0x76, 0x65, 0x6e, 0x74,
+	0x4d, 0x61, 0x70, 0x48, 0x00, 0x52, 0x07, 0x63, 0x6f, 0x6e, 0x74, 0x65, 0x6e, 0x74, 0x42, 0x06,
+	0x0a, 0x04, 0x62, 0x6f, 0x64, 0x79, 0x22, 0x6a, 0x0a, 0x0e, 0x50, 0x75, 0x62, 0x6c, 0x69, 0x73,
+	0x68, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x12, 0x2b, 0x0a, 0x07, 0x63, 0x68, 0x61, 0x6e,
+	0x6e, 0x65, 0x6c, 0x18, 0x01, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x11, 0x2e, 0x72, 0x65, 0x61, 0x6c,
+	0x74, 0x69, 0x6d, 0x65, 0x2e, 0x43, 0x68, 0x61, 0x6e, 0x6e, 0x65, 0x6c, 0x52, 0x07, 0x63, 0x68,
+	0x61, 0x6e, 0x6e, 0x65, 0x6c, 0x12, 0x2b, 0x0a, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65,
+	0x18, 0x02, 0x20, 0x01, 0x28, 0x0b, 0x32, 0x11, 0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d,
+	0x65, 0x2e, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x52, 0x07, 0x6d, 0x65, 0x73, 0x73, 0x61,
+	0x67, 0x65, 0x2a, 0x38, 0x0a, 0x09, 0x45, 0x76, 0x65, 0x6e, 0x74, 0x54, 0x79, 0x70, 0x65, 0x12,
+	0x0d, 0x0a, 0x09, 0x45, 0x56, 0x5f, 0x43, 0x52, 0x45, 0x41, 0x54, 0x45, 0x10, 0x00, 0x12, 0x0d,
+	0x0a, 0x09, 0x45, 0x56, 0x5f, 0x44, 0x45, 0x4c, 0x45, 0x54, 0x45, 0x10, 0x01, 0x12, 0x0d, 0x0a,
+	0x09, 0x45, 0x56, 0x5f, 0x55, 0x50, 0x44, 0x41, 0x54, 0x45, 0x10, 0x02, 0x32, 0x81, 0x01, 0x0a,
+	0x08, 0x52, 0x65, 0x61, 0x6c, 0x54, 0x69, 0x6d, 0x65, 0x12, 0x3d, 0x0a, 0x07, 0x50, 0x75, 0x62,
+	0x6c, 0x69, 0x73, 0x68, 0x12, 0x18, 0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65, 0x2e,
+	0x50, 0x75, 0x62, 0x6c, 0x69, 0x73, 0x68, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x1a, 0x16,
+	0x2e, 0x67, 0x6f, 0x6f, 0x67, 0x6c, 0x65, 0x2e, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x62, 0x75, 0x66,
+	0x2e, 0x45, 0x6d, 0x70, 0x74, 0x79, 0x22, 0x00, 0x12, 0x36, 0x0a, 0x09, 0x53, 0x75, 0x62, 0x73,
+	0x63, 0x72, 0x69, 0x62, 0x65, 0x12, 0x12, 0x2e, 0x72, 0x65, 0x61, 0x6c, 0x74, 0x69, 0x6d, 0x65,
+	0x2e, 0x43, 0x68, 0x61, 0x6e, 0x6e, 0x65, 0x6c, 0x73, 0x1a, 0x11, 0x2e, 0x72, 0x65, 0x61, 0x6c,
+	0x74, 0x69, 0x6d, 0x65, 0x2e, 0x4d, 0x65, 0x73, 0x73, 0x61, 0x67, 0x65, 0x22, 0x00, 0x30, 0x01,
+	0x42, 0x42, 0x5a, 0x40, 0x67, 0x69, 0x74, 0x68, 0x75, 0x62, 0x2e, 0x63, 0x6f, 0x6d, 0x2f, 0x67,
+	0x6f, 0x2d, 0x70, 0x61, 0x72, 0x6b, 0x2d, 0x6d, 0x61, 0x69, 0x6c, 0x2d, 0x72, 0x75, 0x2f, 0x32,
+	0x30, 0x32, 0x33, 0x5f, 0x32, 0x5f, 0x4f, 0x4e, 0x44, 0x5f, 0x74, 0x65, 0x61, 0x6d, 0x2f, 0x69,
+	0x6e, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x6c, 0x2f, 0x61, 0x70, 0x69, 0x2f, 0x72, 0x65, 0x61, 0x6c,
+	0x74, 0x69, 0x6d, 0x65, 0x62, 0x06, 0x70, 0x72, 0x6f, 0x74, 0x6f, 0x33,
+}
+
+var (
+	file_api_proto_realtime_proto_rawDescOnce sync.Once
+	file_api_proto_realtime_proto_rawDescData = file_api_proto_realtime_proto_rawDesc
+)
+
+func file_api_proto_realtime_proto_rawDescGZIP() []byte {
+	file_api_proto_realtime_proto_rawDescOnce.Do(func() {
+		file_api_proto_realtime_proto_rawDescData = protoimpl.X.CompressGZIP(file_api_proto_realtime_proto_rawDescData)
+	})
+	return file_api_proto_realtime_proto_rawDescData
+}
+
+var file_api_proto_realtime_proto_enumTypes = make([]protoimpl.EnumInfo, 1)
+var file_api_proto_realtime_proto_msgTypes = make([]protoimpl.MessageInfo, 7)
+var file_api_proto_realtime_proto_goTypes = []interface{}{
+	(EventType)(0),         // 0: realtime.EventType
+	(*Channels)(nil),       // 1: realtime.Channels
+	(*Channel)(nil),        // 2: realtime.Channel
+	(*EventObject)(nil),    // 3: realtime.EventObject
+	(*EventMap)(nil),       // 4: realtime.EventMap
+	(*Message)(nil),        // 5: realtime.Message
+	(*PublishMessage)(nil), // 6: realtime.PublishMessage
+	nil,                    // 7: realtime.EventMap.MEntry
+	(*empty.Empty)(nil),    // 8: google.protobuf.Empty
+}
+var file_api_proto_realtime_proto_depIdxs = []int32{
+	2, // 0: realtime.Channels.chans:type_name -> realtime.Channel
+	0, // 1: realtime.EventObject.type:type_name -> realtime.EventType
+	7, // 2: realtime.EventMap.m:type_name -> realtime.EventMap.MEntry
+	3, // 3: realtime.Message.object:type_name -> realtime.EventObject
+	4, // 4: realtime.Message.content:type_name -> realtime.EventMap
+	2, // 5: realtime.PublishMessage.channel:type_name -> realtime.Channel
+	5, // 6: realtime.PublishMessage.message:type_name -> realtime.Message
+	6, // 7: realtime.RealTime.Publish:input_type -> realtime.PublishMessage
+	1, // 8: realtime.RealTime.Subscribe:input_type -> realtime.Channels
+	8, // 9: realtime.RealTime.Publish:output_type -> google.protobuf.Empty
+	5, // 10: realtime.RealTime.Subscribe:output_type -> realtime.Message
+	9, // [9:11] is the sub-list for method output_type
+	7, // [7:9] is the sub-list for method input_type
+	7, // [7:7] is the sub-list for extension type_name
+	7, // [7:7] is the sub-list for extension extendee
+	0, // [0:7] is the sub-list for field type_name
+}
+
+func init() { file_api_proto_realtime_proto_init() }
+func file_api_proto_realtime_proto_init() {
+	if File_api_proto_realtime_proto != nil {
+		return
+	}
+	if !protoimpl.UnsafeEnabled {
+		file_api_proto_realtime_proto_msgTypes[0].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Channels); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_realtime_proto_msgTypes[1].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Channel); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_realtime_proto_msgTypes[2].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*EventObject); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_realtime_proto_msgTypes[3].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*EventMap); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_realtime_proto_msgTypes[4].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*Message); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+		file_api_proto_realtime_proto_msgTypes[5].Exporter = func(v interface{}, i int) interface{} {
+			switch v := v.(*PublishMessage); i {
+			case 0:
+				return &v.state
+			case 1:
+				return &v.sizeCache
+			case 2:
+				return &v.unknownFields
+			default:
+				return nil
+			}
+		}
+	}
+	file_api_proto_realtime_proto_msgTypes[4].OneofWrappers = []interface{}{
+		(*Message_Object)(nil),
+		(*Message_Content)(nil),
+	}
+	type x struct{}
+	out := protoimpl.TypeBuilder{
+		File: protoimpl.DescBuilder{
+			GoPackagePath: reflect.TypeOf(x{}).PkgPath(),
+			RawDescriptor: file_api_proto_realtime_proto_rawDesc,
+			NumEnums:      1,
+			NumMessages:   7,
+			NumExtensions: 0,
+			NumServices:   1,
+		},
+		GoTypes:           file_api_proto_realtime_proto_goTypes,
+		DependencyIndexes: file_api_proto_realtime_proto_depIdxs,
+		EnumInfos:         file_api_proto_realtime_proto_enumTypes,
+		MessageInfos:      file_api_proto_realtime_proto_msgTypes,
+	}.Build()
+	File_api_proto_realtime_proto = out.File
+	file_api_proto_realtime_proto_rawDesc = nil
+	file_api_proto_realtime_proto_goTypes = nil
+	file_api_proto_realtime_proto_depIdxs = nil
+}
diff --git a/internal/api/realtime/realtime_grpc.pb.go b/internal/api/realtime/realtime_grpc.pb.go
new file mode 100644
index 0000000..420b61e
--- /dev/null
+++ b/internal/api/realtime/realtime_grpc.pb.go
@@ -0,0 +1,170 @@
+// Code generated by protoc-gen-go-grpc. DO NOT EDIT.
+// versions:
+// - protoc-gen-go-grpc v1.2.0
+// - protoc             v3.6.1
+// source: api/proto/realtime.proto
+
+package realtime
+
+import (
+	context "context"
+	empty "github.com/golang/protobuf/ptypes/empty"
+	grpc "google.golang.org/grpc"
+	codes "google.golang.org/grpc/codes"
+	status "google.golang.org/grpc/status"
+)
+
+// This is a compile-time assertion to ensure that this generated file
+// is compatible with the grpc package it is being compiled against.
+// Requires gRPC-Go v1.32.0 or later.
+const _ = grpc.SupportPackageIsVersion7
+
+// RealTimeClient is the client API for RealTime service.
+//
+// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://pkg.go.dev/google.golang.org/grpc/?tab=doc#ClientConn.NewStream.
+type RealTimeClient interface {
+	Publish(ctx context.Context, in *PublishMessage, opts ...grpc.CallOption) (*empty.Empty, error)
+	Subscribe(ctx context.Context, in *Channels, opts ...grpc.CallOption) (RealTime_SubscribeClient, error)
+}
+
+type realTimeClient struct {
+	cc grpc.ClientConnInterface
+}
+
+func NewRealTimeClient(cc grpc.ClientConnInterface) RealTimeClient {
+	return &realTimeClient{cc}
+}
+
+func (c *realTimeClient) Publish(ctx context.Context, in *PublishMessage, opts ...grpc.CallOption) (*empty.Empty, error) {
+	out := new(empty.Empty)
+	err := c.cc.Invoke(ctx, "/realtime.RealTime/Publish", in, out, opts...)
+	if err != nil {
+		return nil, err
+	}
+	return out, nil
+}
+
+func (c *realTimeClient) Subscribe(ctx context.Context, in *Channels, opts ...grpc.CallOption) (RealTime_SubscribeClient, error) {
+	stream, err := c.cc.NewStream(ctx, &RealTime_ServiceDesc.Streams[0], "/realtime.RealTime/Subscribe", opts...)
+	if err != nil {
+		return nil, err
+	}
+	x := &realTimeSubscribeClient{stream}
+	if err := x.ClientStream.SendMsg(in); err != nil {
+		return nil, err
+	}
+	if err := x.ClientStream.CloseSend(); err != nil {
+		return nil, err
+	}
+	return x, nil
+}
+
+type RealTime_SubscribeClient interface {
+	Recv() (*Message, error)
+	grpc.ClientStream
+}
+
+type realTimeSubscribeClient struct {
+	grpc.ClientStream
+}
+
+func (x *realTimeSubscribeClient) Recv() (*Message, error) {
+	m := new(Message)
+	if err := x.ClientStream.RecvMsg(m); err != nil {
+		return nil, err
+	}
+	return m, nil
+}
+
+// RealTimeServer is the server API for RealTime service.
+// All implementations must embed UnimplementedRealTimeServer
+// for forward compatibility
+type RealTimeServer interface {
+	Publish(context.Context, *PublishMessage) (*empty.Empty, error)
+	Subscribe(*Channels, RealTime_SubscribeServer) error
+	mustEmbedUnimplementedRealTimeServer()
+}
+
+// UnimplementedRealTimeServer must be embedded to have forward compatible implementations.
+type UnimplementedRealTimeServer struct {
+}
+
+func (UnimplementedRealTimeServer) Publish(context.Context, *PublishMessage) (*empty.Empty, error) {
+	return nil, status.Errorf(codes.Unimplemented, "method Publish not implemented")
+}
+func (UnimplementedRealTimeServer) Subscribe(*Channels, RealTime_SubscribeServer) error {
+	return status.Errorf(codes.Unimplemented, "method Subscribe not implemented")
+}
+func (UnimplementedRealTimeServer) mustEmbedUnimplementedRealTimeServer() {}
+
+// UnsafeRealTimeServer may be embedded to opt out of forward compatibility for this service.
+// Use of this interface is not recommended, as added methods to RealTimeServer will
+// result in compilation errors.
+type UnsafeRealTimeServer interface {
+	mustEmbedUnimplementedRealTimeServer()
+}
+
+func RegisterRealTimeServer(s grpc.ServiceRegistrar, srv RealTimeServer) {
+	s.RegisterService(&RealTime_ServiceDesc, srv)
+}
+
+func _RealTime_Publish_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
+	in := new(PublishMessage)
+	if err := dec(in); err != nil {
+		return nil, err
+	}
+	if interceptor == nil {
+		return srv.(RealTimeServer).Publish(ctx, in)
+	}
+	info := &grpc.UnaryServerInfo{
+		Server:     srv,
+		FullMethod: "/realtime.RealTime/Publish",
+	}
+	handler := func(ctx context.Context, req interface{}) (interface{}, error) {
+		return srv.(RealTimeServer).Publish(ctx, req.(*PublishMessage))
+	}
+	return interceptor(ctx, in, info, handler)
+}
+
+func _RealTime_Subscribe_Handler(srv interface{}, stream grpc.ServerStream) error {
+	m := new(Channels)
+	if err := stream.RecvMsg(m); err != nil {
+		return err
+	}
+	return srv.(RealTimeServer).Subscribe(m, &realTimeSubscribeServer{stream})
+}
+
+type RealTime_SubscribeServer interface {
+	Send(*Message) error
+	grpc.ServerStream
+}
+
+type realTimeSubscribeServer struct {
+	grpc.ServerStream
+}
+
+func (x *realTimeSubscribeServer) Send(m *Message) error {
+	return x.ServerStream.SendMsg(m)
+}
+
+// RealTime_ServiceDesc is the grpc.ServiceDesc for RealTime service.
+// It's only intended for direct use with grpc.RegisterService,
+// and not to be introspected or modified (even as a copy)
+var RealTime_ServiceDesc = grpc.ServiceDesc{
+	ServiceName: "realtime.RealTime",
+	HandlerType: (*RealTimeServer)(nil),
+	Methods: []grpc.MethodDesc{
+		{
+			MethodName: "Publish",
+			Handler:    _RealTime_Publish_Handler,
+		},
+	},
+	Streams: []grpc.StreamDesc{
+		{
+			StreamName:    "Subscribe",
+			Handler:       _RealTime_Subscribe_Handler,
+			ServerStreams: true,
+		},
+	},
+	Metadata: "api/proto/realtime.proto",
+}
diff --git a/internal/api/server/router/router.go b/internal/api/server/router/router.go
index 368fb08..cb1bfa4 100644
--- a/internal/api/server/router/router.go
+++ b/internal/api/server/router/router.go
@@ -2,6 +2,7 @@ package router
 
 import (
 	"net/http"
+	"time"
 
 	"github.com/go-chi/chi/v5"
 	"github.com/rs/cors"
@@ -9,13 +10,17 @@ import (
 
 	_ "github.com/go-park-mail-ru/2023_2_OND_team/docs"
 	deliveryHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1"
+	deliveryWS "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/websocket"
 	mw "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/monitoring"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/security"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	authCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/auth"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
 )
 
+const requestTimeout = 10 * time.Second
+
 type Router struct {
 	Mux *chi.Mux
 }
@@ -24,24 +29,26 @@ func New() Router {
 	return Router{chi.NewMux()}
 }
 
-func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, sm session.SessionManager, log *logger.Logger) {
+func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, wsHandler *deliveryWS.HandlerWebSocket, ac authCase.Usecase, metrics monitoring.Metrics, log *logger.Logger) {
 	cfgCSRF := security.DefaultCSRFConfig()
 	cfgCSRF.PathToGet = "/api/v1/csrf"
 
 	c := cors.New(cors.Options{
-		AllowedOrigins: []string{"https://pinspire.online", "https://pinspire.online:1443",
-			"https://pinspire.online:1444", "https://pinspire.online:1445", "https://pinspire.online:1446"},
+		AllowedOrigins: []string{"https://pinspire.site", "https://pinspire.site:1443",
+			"https://pinspire.site:1444", "https://pinspire.site:1445", "https://pinspire.site:1446", "https://pinspire.site:8081"},
 		AllowedMethods:   []string{http.MethodGet, http.MethodPost, http.MethodDelete, http.MethodPut},
 		AllowCredentials: true,
 		AllowedHeaders:   []string{"content-type", cfgCSRF.Header},
 		ExposedHeaders:   []string{cfgCSRF.HeaderSet},
 	})
 
-	r.Mux.Use(mw.RequestID(log), mw.Logger(log), c.Handler,
-		security.CSRF(cfgCSRF), mw.SetResponseHeaders(map[string]string{
+	r.Mux.Use(mw.SetRequestTimeout(requestTimeout), mw.RequestID(log), mw.Logger(log),
+		monitoring.Monitoring("/metrics", metrics), c.Handler,
+		security.CSRF(cfgCSRF),
+		mw.SetResponseHeaders(map[string]string{
 			"Content-Type": "application/json",
 		}),
-		auth.NewAuthMiddleware(sm).ContextWithUserID)
+		auth.NewAuthMiddleware(ac).ContextWithUserID)
 
 	r.Mux.Route("/api/v1", func(r chi.Router) {
 		r.Get("/docs/*", httpSwagger.WrapHandler)
@@ -60,6 +67,27 @@ func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, sm session.Sess
 			r.Get("/info", handler.GetProfileInfo)
 			r.Put("/edit", handler.ProfileEditInfo)
 			r.Put("/avatar", handler.ProfileEditAvatar)
+			r.Get("/header", handler.GetProfileHeaderInfo)
+		})
+
+		r.Route("/user", func(r chi.Router) {
+			r.Get("/info/{userID:\\d+}", handler.GetUserInfo)
+		})
+
+		r.Route("/subscription", func(r chi.Router) {
+			r.Route("/user", func(r chi.Router) {
+				r.With(auth.RequireAuth).Group(func(r chi.Router) {
+					r.Post("/create", handler.Subscribe)
+					r.Delete("/delete", handler.Unsubscribe)
+				})
+				r.Get("/get", handler.GetSubscriptionInfoForUser)
+			})
+		})
+
+		r.Route("/search", func(r chi.Router) {
+			r.Get("/users", handler.SearchUsers)
+			r.Get("/boards", handler.SearchBoards)
+			r.Get("/pins", handler.SearchPins)
 		})
 
 		r.Route("/pin", func(r chi.Router) {
@@ -73,6 +101,15 @@ func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, sm session.Sess
 				r.Delete("/like/{pinID:\\d+}", handler.DeleteLikePin)
 				r.Delete("/delete/{pinID:\\d+}", handler.DeletePin)
 			})
+
+			r.Route("/comment", func(r chi.Router) {
+				r.Get("/feed/{pinID:\\d+}", handler.ViewFeedComment)
+
+				r.With(auth.RequireAuth).Group(func(r chi.Router) {
+					r.Post("/{pinID:\\d+}", handler.WriteComment)
+					r.Delete("/{commentID:\\d+}", handler.DeleteComment)
+				})
+			})
 		})
 
 		r.Route("/board", func(r chi.Router) {
@@ -83,6 +120,7 @@ func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, sm session.Sess
 			})
 			r.With(auth.RequireAuth).Group(func(r chi.Router) {
 				r.Post("/add/pins/{boardID:\\d+}", handler.AddPinsToBoard)
+				r.Delete("/delete/pin/{boardID:\\d+}", handler.DeletePinFromBoard)
 				r.Post("/create", handler.CreateNewBoard)
 				r.Put("/update/{boardID:\\d+}", handler.UpdateBoardInfo)
 				r.Delete("/delete/{boardID:\\d+}", handler.DeleteBoard)
@@ -92,5 +130,18 @@ func (r Router) RegisterRoute(handler *deliveryHTTP.HandlerHTTP, sm session.Sess
 		r.Route("/feed", func(r chi.Router) {
 			r.Get("/pin", handler.FeedPins)
 		})
+
+		r.With(auth.RequireAuth).Route("/chat", func(r chi.Router) {
+			r.Get("/personal", handler.FeedChats)
+			r.Get("/get/{userID:\\d+}", handler.GetMessagesFromChat)
+			r.Post("/send/{userID:\\d+}", handler.SendMessageToUser)
+			r.Put("/update/{messageID:\\d+}", handler.UpdateMessage)
+			r.Delete("/delete/{messageID:\\d+}", handler.DeleteMessage)
+		})
+	})
+
+	r.Mux.With(auth.RequireAuth).Route("/websocket/connect", func(r chi.Router) {
+		r.Get("/chat", wsHandler.Chat)
+		r.Get("/notification", wsHandler.Notification)
 	})
 }
diff --git a/internal/app/app.go b/internal/app/app.go
index e6031b5..f2706ef 100644
--- a/internal/app/app.go
+++ b/internal/app/app.go
@@ -2,38 +2,66 @@ package app
 
 import (
 	"context"
+	"encoding/base64"
+	"os"
 	"time"
 
-	"github.com/joho/godotenv"
+	goaway "github.com/TwiN/go-away"
 	"github.com/microcosm-cc/bluemonday"
+	"google.golang.org/api/option"
+	"google.golang.org/grpc"
+	"google.golang.org/grpc/credentials/insecure"
 
+	vision "cloud.google.com/go/vision/v2/apiv1"
+	authProto "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/api/server"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/api/server/router"
 	deliveryHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1"
+	deliveryWS "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/websocket"
+	notify "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/metrics"
+	commentNotify "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/notification/comment"
 	boardRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/board/postgres"
+	commentRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/comment"
 	imgRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/image"
 	pinRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/pin"
-	sessionRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/session"
+	searchRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/search/postgres"
+	subRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/subscription/postgres"
 	userRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/auth"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/board"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/comment"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/image"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/message"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/pin"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime/chat"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime/notification"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/search"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/subscription"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
+	validate "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
 )
 
 var (
-	timeoutForConnPG    = 5 * time.Second
-	timeoutForConnRedis = 5 * time.Second
+	_timeoutForConnPG     = 5 * time.Second
+	timeoutCloudVisionAPI = 10 * time.Second
 )
 
 const uploadFiles = "upload/"
 
 func Run(ctx context.Context, log *log.Logger, cfg ConfigFiles) {
-	godotenv.Load()
+	metrics := metrics.New("pinspire")
+	err := metrics.Registry()
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
 
-	ctx, cancelCtxPG := context.WithTimeout(ctx, timeoutForConnPG)
+	ctx, cancelCtxPG := context.WithTimeout(ctx, _timeoutForConnPG)
 	defer cancelCtxPG()
 
 	pool, err := NewPoolPG(ctx)
@@ -43,29 +71,79 @@ func Run(ctx context.Context, log *log.Logger, cfg ConfigFiles) {
 	}
 	defer pool.Close()
 
-	ctx, cancelCtxRedis := context.WithTimeout(ctx, timeoutForConnRedis)
-	defer cancelCtxRedis()
+	connMessMS, err := grpc.Dial(os.Getenv("MESSENGER_SERVICE_HOST")+":"+os.Getenv("MESSENGER_SERVICE_PORT"), grpc.WithTransportCredentials(insecure.NewCredentials()))
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer connMessMS.Close()
 
-	redisCfg, err := NewConfig(cfg.RedisConfigFile)
+	connRealtime, err := grpc.Dial(os.Getenv("REALTIME_SERVICE_HOST")+":"+os.Getenv("REALTIME_SERVICE_PORT"), grpc.WithTransportCredentials(insecure.NewCredentials()))
 	if err != nil {
 		log.Error(err.Error())
 		return
 	}
+	defer connRealtime.Close()
 
-	redisCl, err := NewRedisClient(ctx, redisCfg)
+	rtClient := rt.NewRealTimeClient(connRealtime)
+
+	commentRepository := commentRepo.NewCommentRepoPG(pool)
+
+	visionCtx, cancel := context.WithTimeout(ctx, timeoutCloudVisionAPI)
+	defer cancel()
+
+	token, err := base64.StdEncoding.DecodeString(os.Getenv("GOOGLE_APPLICATION_CREDENTIALS"))
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	visionClient, err := vision.NewImageAnnotatorClient(visionCtx, option.WithCredentialsJSON(token))
 	if err != nil {
 		log.Error(err.Error())
 		return
 	}
-	defer redisCl.Close()
 
-	sm := session.New(log, sessionRepo.NewSessionRepo(redisCl))
-	imgCase := image.New(log, imgRepo.NewImageRepoFS(uploadFiles))
-	userCase := user.New(log, imgCase, userRepo.NewUserRepoPG(pool))
+	profanityCensor := goaway.NewProfanityDetector().WithCustomDictionary(
+		append(goaway.DefaultProfanities, validate.GetLabels()...),
+		goaway.DefaultFalsePositives,
+		goaway.DefaultFalseNegatives,
+	)
+
+	imgCase := image.New(log, imgRepo.NewImageRepoFS(uploadFiles), image.NewFilter(visionClient, validate.NewCensor(profanityCensor)))
+	messageCase := message.New(log, messenger.NewMessengerClient(connMessMS), chat.New(realtime.NewRealTimeChatClient(rtClient), log))
 	pinCase := pin.New(log, imgCase, pinRepo.NewPinRepoPG(pool))
-	boardCase := board.New(log, boardRepo.NewBoardRepoPG(pool), userRepo.NewUserRepoPG(pool), bluemonday.UGCPolicy())
 
-	handler := deliveryHTTP.New(log, sm, userCase, pinCase, boardCase)
+	notifyBuilder, err := notify.NewWithType(notify.NotifyComment)
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+
+	notifyCase := notification.New(realtime.NewRealTimeNotificationClient(rtClient), log,
+		notification.Register(commentNotify.NewCommentNotify(notifyBuilder, comment.New(commentRepository, pinCase, nil), pinCase)))
+
+	conn, err := grpc.Dial(cfg.AddrAuthServer, grpc.WithTransportCredentials(insecure.NewCredentials()))
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer conn.Close()
+	ac := auth.New(authProto.NewAuthClient(conn))
+
+	handler := deliveryHTTP.New(log, deliveryHTTP.NewConverterHTTP(validate.NewSanitizerXSS(bluemonday.UGCPolicy()), validate.NewCensor(profanityCensor)), deliveryHTTP.UsecaseHub{
+		AuhtCase:         ac,
+		UserCase:         user.New(log, imgCase, userRepo.NewUserRepoPG(pool)),
+		PinCase:          pinCase,
+		BoardCase:        board.New(log, boardRepo.NewBoardRepoPG(pool), userRepo.NewUserRepoPG(pool)),
+		SubscriptionCase: subscription.New(log, subRepo.NewSubscriptionRepoPG(pool), userRepo.NewUserRepoPG(pool)),
+		SearchCase:       search.New(log, searchRepo.NewSearchRepoPG(pool)),
+		MessageCase:      messageCase,
+		CommentCase:      comment.New(commentRepo.NewCommentRepoPG(pool), pinCase, notifyCase),
+	})
+
+	wsHandler := deliveryWS.New(log, messageCase, notifyCase,
+		deliveryWS.SetOriginPatterns([]string{"pinspire.site", "pinspire.site:*"}))
+
 	cfgServ, err := server.NewConfig(cfg.ServerConfigFile)
 	if err != nil {
 		log.Error(err.Error())
@@ -73,7 +151,7 @@ func Run(ctx context.Context, log *log.Logger, cfg ConfigFiles) {
 	}
 	server := server.New(log, cfgServ)
 	router := router.New()
-	router.RegisterRoute(handler, sm, log)
+	router.RegisterRoute(handler, wsHandler, ac, metrics, log)
 
 	if err := server.Run(router.Mux); err != nil {
 		log.Error(err.Error())
diff --git a/internal/app/auth/auth.go b/internal/app/auth/auth.go
new file mode 100644
index 0000000..ddfc24e
--- /dev/null
+++ b/internal/app/auth/auth.go
@@ -0,0 +1,89 @@
+package auth
+
+import (
+	"context"
+	"net"
+	"os"
+	"time"
+
+	"github.com/joho/godotenv"
+	"google.golang.org/grpc"
+
+	authProto "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/app"
+	authMS "github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/auth/delivery/grpc"
+	grpcMetrics "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/metrics/grpc"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/grpc/interceptor"
+	sessRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/session"
+	userRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+var (
+	_timeoutForConnPG    = 5 * time.Second
+	_timeoutForConnRedis = 5 * time.Second
+)
+
+func Run(ctx context.Context, log *logger.Logger, cfg Config) {
+	godotenv.Load()
+
+	metrics := grpcMetrics.New("auth")
+	if err := metrics.Registry(); err != nil {
+		log.Error(err.Error())
+		return
+	}
+
+	l, err := net.Listen("tcp", cfg.Addr)
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer l.Close()
+
+	ctxPG, cancelCtxPG := context.WithTimeout(ctx, _timeoutForConnPG)
+	defer cancelCtxPG()
+
+	pool, err := app.NewPoolPG(ctxPG)
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer pool.Close()
+
+	ctxRedis, cancelCtxRedis := context.WithTimeout(ctx, _timeoutForConnRedis)
+	defer cancelCtxRedis()
+
+	// redisCfg, err := app.NewConfig(cfg.RedisFileConfig)
+	redisCfg := app.RedisConfig{
+		Addr:     os.Getenv("REDIS_HOST") + ":" + os.Getenv("REDIS_PORT"),
+		Password: os.Getenv("REDIS_PASSWORD"),
+	}
+	// if err != nil {
+	// 	log.Error(err.Error())
+	// 	return
+	// }
+
+	redisCl, err := app.NewRedisClient(ctxRedis, redisCfg)
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer redisCl.Close()
+
+	sm := session.New(log, sessRepo.NewSessionRepo(redisCl))
+	u := user.New(log, nil, userRepo.NewUserRepoPG(pool))
+
+	s := grpc.NewServer(grpc.ChainUnaryInterceptor(
+		interceptor.Monitoring(metrics, "0.0.0.0:8086"),
+		interceptor.Logger(log),
+	))
+	authProto.RegisterAuthServer(s, authMS.New(log, sm, u))
+
+	log.Info("service auht start", logger.F{"addr", cfg.Addr})
+	if err = s.Serve(l); err != nil {
+		log.Error(err.Error())
+		return
+	}
+}
diff --git a/internal/app/auth/config.go b/internal/app/auth/config.go
new file mode 100644
index 0000000..e31181b
--- /dev/null
+++ b/internal/app/auth/config.go
@@ -0,0 +1,6 @@
+package auth
+
+type Config struct {
+	Addr            string
+	RedisFileConfig string
+}
diff --git a/internal/app/config.go b/internal/app/config.go
index e667344..4fb3bb2 100644
--- a/internal/app/config.go
+++ b/internal/app/config.go
@@ -8,21 +8,21 @@ import (
 
 type ConfigFiles struct {
 	ServerConfigFile string
-	RedisConfigFile  string
+	AddrAuthServer   string
 }
 
-type redisConfig struct {
+type RedisConfig struct {
 	Password string
 	Addr     string
 }
 
-func NewConfig(filename string) (redisConfig, error) {
+func NewConfig(filename string) (RedisConfig, error) {
 	cfg, err := config.ParseConfig(filename)
 	if err != nil {
-		return redisConfig{}, fmt.Errorf("new redis config: %w", err)
+		return RedisConfig{}, fmt.Errorf("new redis config: %w", err)
 	}
 
-	return redisConfig{
+	return RedisConfig{
 		Password: cfg.Get("requirepass"),
 		Addr:     cfg.Get("host") + ":" + cfg.Get("port"),
 	}, nil
diff --git a/internal/app/messenger/messenger.go b/internal/app/messenger/messenger.go
new file mode 100644
index 0000000..27ca153
--- /dev/null
+++ b/internal/app/messenger/messenger.go
@@ -0,0 +1,62 @@
+package messenger
+
+import (
+	"context"
+	"net"
+	"time"
+
+	"github.com/joho/godotenv"
+	"google.golang.org/grpc"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/app"
+	messMS "github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/messenger/delivery/grpc"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/messenger/usecase/message"
+	grpcMetrics "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/metrics/grpc"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/grpc/interceptor"
+	mesRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+const _timeoutForConnPG = 5 * time.Second
+
+func Run(ctx context.Context, log *logger.Logger) {
+	godotenv.Load()
+
+	metrics := grpcMetrics.New("messenger")
+	if err := metrics.Registry(); err != nil {
+		log.Error(err.Error())
+		return
+	}
+
+	ctx, cancelCtxPG := context.WithTimeout(ctx, _timeoutForConnPG)
+	defer cancelCtxPG()
+
+	pool, err := app.NewPoolPG(ctx)
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+	defer pool.Close()
+
+	messageCase := message.New(mesRepo.NewMessageRepo(pool))
+
+	server := grpc.NewServer(grpc.ChainUnaryInterceptor(
+		interceptor.Monitoring(metrics, "0.0.0.0:8096"),
+		interceptor.Logger(log),
+		interceptor.Auth(),
+	))
+	messenger.RegisterMessengerServer(server, messMS.New(log, messageCase))
+
+	l, err := net.Listen("tcp", "0.0.0.0:8095")
+	if err != nil {
+		log.Error(err.Error())
+		return
+	}
+
+	log.Info("server messenger start", logger.F{"addr", "localhost:8095"})
+	if err := server.Serve(l); err != nil {
+		log.Error(err.Error())
+		return
+	}
+}
diff --git a/internal/app/redis_conn.go b/internal/app/redis_conn.go
index 8a7527c..8ee910e 100644
--- a/internal/app/redis_conn.go
+++ b/internal/app/redis_conn.go
@@ -7,7 +7,7 @@ import (
 	redis "github.com/redis/go-redis/v9"
 )
 
-func NewRedisClient(ctx context.Context, cfg redisConfig) (*redis.Client, error) {
+func NewRedisClient(ctx context.Context, cfg RedisConfig) (*redis.Client, error) {
 	redisCl := redis.NewClient(&redis.Options{
 		Addr:     cfg.Addr,
 		Password: cfg.Password,
diff --git a/internal/microservices/auth/delivery/grpc/server.go b/internal/microservices/auth/delivery/grpc/server.go
new file mode 100644
index 0000000..1118b07
--- /dev/null
+++ b/internal/microservices/auth/delivery/grpc/server.go
@@ -0,0 +1,94 @@
+package auth
+
+import (
+	"context"
+
+	"github.com/golang/protobuf/ptypes/empty"
+	"google.golang.org/grpc/codes"
+	"google.golang.org/grpc/status"
+	"google.golang.org/protobuf/types/known/timestamppb"
+
+	authProto "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	userUsecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+type Usecase interface {
+	Register(ctx context.Context, user *user.User) error
+	Authentication(ctx context.Context, credentials userUsecase.UserCredentials) (*user.User, error)
+}
+
+type AuthServer struct {
+	authProto.UnimplementedAuthServer
+
+	log      *logger.Logger
+	sm       session.SessionManager
+	userCase Usecase
+}
+
+func New(log *logger.Logger, sm session.SessionManager, userCase Usecase) AuthServer {
+	return AuthServer{
+		UnimplementedAuthServer: authProto.UnimplementedAuthServer{},
+		log:                     log,
+		sm:                      sm,
+		userCase:                userCase,
+	}
+}
+
+func (as AuthServer) Register(ctx context.Context, rd *authProto.RegisterData) (*empty.Empty, error) {
+	user := &user.User{
+		Email:    rd.Email,
+		Username: rd.Cred.Username,
+		Password: rd.Cred.Password,
+	}
+
+	err := as.userCase.Register(ctx, user)
+	if err != nil {
+		as.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "")
+	}
+	return &empty.Empty{}, nil
+}
+
+func (as AuthServer) Login(ctx context.Context, cred *authProto.Credentials) (*authProto.Session, error) {
+	user, err := as.userCase.Authentication(ctx, userUsecase.UserCredentials{
+		Username: cred.Username,
+		Password: cred.Password,
+	})
+	if err != nil {
+		as.log.Error(err.Error())
+		return nil, status.Error(codes.Unauthenticated, "failed authentication")
+	}
+
+	session, err := as.sm.CreateNewSessionForUser(ctx, user.ID)
+	if err != nil {
+		as.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "failed to create a session for the user")
+	}
+
+	return &authProto.Session{
+		Key:    session.Key,
+		UserID: int64(session.UserID),
+		Expire: timestamppb.New(session.Expire),
+	}, nil
+}
+
+func (as AuthServer) Logout(ctx context.Context, sess *authProto.Session) (*empty.Empty, error) {
+	err := as.sm.DeleteUserSession(ctx, sess.Key)
+	if err != nil {
+		as.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "delete user session")
+	}
+	return &empty.Empty{}, nil
+}
+
+func (as AuthServer) GetUserID(ctx context.Context, sess *authProto.Session) (*authProto.UserID, error) {
+	userID, err := as.sm.GetUserIDBySessionKey(ctx, sess.Key)
+	if err != nil {
+		as.log.Error(err.Error())
+		return nil, status.Error(codes.NotFound, "session not found")
+	}
+	return &authProto.UserID{Id: int64(userID)}, nil
+}
diff --git a/internal/microservices/messenger/delivery/grpc/convert.go b/internal/microservices/messenger/delivery/grpc/convert.go
new file mode 100644
index 0000000..fed3fd8
--- /dev/null
+++ b/internal/microservices/messenger/delivery/grpc/convert.go
@@ -0,0 +1,36 @@
+package grpc
+
+import (
+	mess "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+)
+
+func convertFeedChat(feed message.FeedUserChats) []*mess.ChatWithUser {
+	res := make([]*mess.ChatWithUser, len(feed))
+
+	for ind := range feed {
+		res[ind] = &mess.ChatWithUser{
+			LastMessageID: int64(feed[ind].MessageLastID),
+			Chat: &mess.WichWhomChat{
+				UserID:   int64(feed[ind].WichWhomChat.ID),
+				Username: feed[ind].WichWhomChat.Username,
+				Avatar:   feed[ind].WichWhomChat.Avatar,
+			},
+		}
+	}
+	return res
+}
+
+func convertFeedMessage(feed []message.Message) []*mess.Message {
+	res := make([]*mess.Message, len(feed))
+
+	for ind := range res {
+		res[ind] = &mess.Message{
+			Id:       &mess.MsgID{Id: int64(feed[ind].ID)},
+			UserFrom: int64(feed[ind].From),
+			UserTo:   int64(feed[ind].To),
+			Content:  feed[ind].Content.String,
+		}
+	}
+	return res
+}
diff --git a/internal/microservices/messenger/delivery/grpc/server.go b/internal/microservices/messenger/delivery/grpc/server.go
new file mode 100644
index 0000000..eeb23ce
--- /dev/null
+++ b/internal/microservices/messenger/delivery/grpc/server.go
@@ -0,0 +1,113 @@
+package grpc
+
+import (
+	"context"
+
+	mess "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/messenger/usecase/message"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/golang/protobuf/ptypes/empty"
+	"github.com/jackc/pgx/v5/pgtype"
+	"google.golang.org/grpc/codes"
+	"google.golang.org/grpc/status"
+)
+
+const AuthenticatedMetadataKey = "user_id"
+
+type MessengerServer struct {
+	mess.UnimplementedMessengerServer
+
+	log         *logger.Logger
+	messageCase message.Usecase
+}
+
+func New(log *logger.Logger, msgCase message.Usecase) MessengerServer {
+	return MessengerServer{
+		log:         log,
+		messageCase: msgCase,
+	}
+}
+
+func (m MessengerServer) UserChatsWithOtherUsers(ctx context.Context, r *mess.FeedChatRequest) (*mess.FeedChat, error) {
+	userID := ctx.Value(auth.KeyCurrentUserID).(int)
+
+	feed, lastID, err := m.messageCase.GetUserChatsWithOtherUsers(ctx, userID, int(r.GetCount()), int(r.GetLastID()))
+	if err != nil {
+		m.log.Error(err.Error())
+	}
+
+	return &mess.FeedChat{Chats: convertFeedChat(feed), LastID: int64(lastID)}, nil
+}
+
+func (m MessengerServer) SendMessage(ctx context.Context, msg *mess.Message) (*mess.MsgID, error) {
+	userID := ctx.Value(auth.KeyCurrentUserID).(int)
+
+	msgID, err := m.messageCase.SendMessage(ctx, &entity.Message{
+		From:    userID,
+		To:      int(msg.UserTo),
+		Content: pgtype.Text{String: msg.GetContent(), Valid: true},
+	})
+
+	if err != nil {
+		m.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "send message error")
+	}
+
+	return &mess.MsgID{Id: int64(msgID)}, nil
+}
+
+func (m MessengerServer) MessageFromChat(ctx context.Context, r *mess.FeedMessageRequest) (*mess.FeedMessage, error) {
+	feed, lastID, err := m.messageCase.GetMessagesFromChat(ctx, entity.Chat{int(r.Chat.GetUserID1()), int(r.Chat.GetUserID2())},
+		int(r.GetCount()), int(r.GetLastID()))
+	if err != nil {
+		m.log.Error(err.Error())
+	}
+
+	return &mess.FeedMessage{
+		Messages: convertFeedMessage(feed),
+		LastID:   int64(lastID),
+	}, nil
+}
+
+func (m MessengerServer) UpdateMessage(ctx context.Context, msg *mess.Message) (*empty.Empty, error) {
+	userID := ctx.Value(auth.KeyCurrentUserID).(int)
+
+	err := m.messageCase.UpdateContentMessage(ctx, userID, &entity.Message{
+		ID:      int(msg.Id.GetId()),
+		Content: pgtype.Text{String: msg.Content, Valid: true},
+	})
+	if err != nil {
+		return nil, status.Error(codes.Internal, "update message error")
+	}
+
+	return &empty.Empty{}, nil
+}
+
+func (m MessengerServer) DeleteMessage(ctx context.Context, msgID *mess.MsgID) (*empty.Empty, error) {
+	userID := ctx.Value(auth.KeyCurrentUserID).(int)
+
+	err := m.messageCase.DeleteMessage(ctx, userID, int(msgID.GetId()))
+	if err != nil {
+		m.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "delete message")
+	}
+
+	return &empty.Empty{}, nil
+}
+
+func (m MessengerServer) GetMessage(ctx context.Context, msgID *mess.MsgID) (*mess.Message, error) {
+	msg, err := m.messageCase.GetMessage(ctx, int(msgID.GetId()))
+	if err != nil {
+		m.log.Error(err.Error())
+		return nil, status.Error(codes.Internal, "get message")
+	}
+
+	return &mess.Message{
+		Id:       msgID,
+		UserFrom: int64(msg.From),
+		UserTo:   int64(msg.To),
+		Content:  msg.Content.String,
+	}, nil
+}
diff --git a/internal/microservices/messenger/usecase/message/check.go b/internal/microservices/messenger/usecase/message/check.go
new file mode 100644
index 0000000..136082f
--- /dev/null
+++ b/internal/microservices/messenger/usecase/message/check.go
@@ -0,0 +1,17 @@
+package message
+
+import (
+	"context"
+	"fmt"
+)
+
+func (m *messageCase) isAvailableForChanges(ctx context.Context, userID, mesID int) (bool, error) {
+	mes, err := m.repo.GetMessageByID(ctx, mesID)
+	if err != nil {
+		return false, fmt.Errorf("get message for check available: %w", err)
+	}
+	if mes.From == userID {
+		return true, nil
+	}
+	return false, nil
+}
diff --git a/internal/microservices/messenger/usecase/message/mock/message_mock.go b/internal/microservices/messenger/usecase/message/mock/message_mock.go
new file mode 100644
index 0000000..65e877a
--- /dev/null
+++ b/internal/microservices/messenger/usecase/message/mock/message_mock.go
@@ -0,0 +1,126 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	message "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// DeleteMessage mocks base method.
+func (m *MockUsecase) DeleteMessage(ctx context.Context, userID, mesID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeleteMessage", ctx, userID, mesID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeleteMessage indicates an expected call of DeleteMessage.
+func (mr *MockUsecaseMockRecorder) DeleteMessage(ctx, userID, mesID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteMessage", reflect.TypeOf((*MockUsecase)(nil).DeleteMessage), ctx, userID, mesID)
+}
+
+// GetMessage mocks base method.
+func (m *MockUsecase) GetMessage(ctx context.Context, messageID int) (*message.Message, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessage", ctx, messageID)
+	ret0, _ := ret[0].(*message.Message)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetMessage indicates an expected call of GetMessage.
+func (mr *MockUsecaseMockRecorder) GetMessage(ctx, messageID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessage", reflect.TypeOf((*MockUsecase)(nil).GetMessage), ctx, messageID)
+}
+
+// GetMessagesFromChat mocks base method.
+func (m *MockUsecase) GetMessagesFromChat(ctx context.Context, chat message.Chat, count, lastID int) ([]message.Message, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessagesFromChat", ctx, chat, count, lastID)
+	ret0, _ := ret[0].([]message.Message)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetMessagesFromChat indicates an expected call of GetMessagesFromChat.
+func (mr *MockUsecaseMockRecorder) GetMessagesFromChat(ctx, chat, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessagesFromChat", reflect.TypeOf((*MockUsecase)(nil).GetMessagesFromChat), ctx, chat, count, lastID)
+}
+
+// GetUserChatsWithOtherUsers mocks base method.
+func (m *MockUsecase) GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (message.FeedUserChats, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserChatsWithOtherUsers", ctx, userID, count, lastID)
+	ret0, _ := ret[0].(message.FeedUserChats)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetUserChatsWithOtherUsers indicates an expected call of GetUserChatsWithOtherUsers.
+func (mr *MockUsecaseMockRecorder) GetUserChatsWithOtherUsers(ctx, userID, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserChatsWithOtherUsers", reflect.TypeOf((*MockUsecase)(nil).GetUserChatsWithOtherUsers), ctx, userID, count, lastID)
+}
+
+// SendMessage mocks base method.
+func (m *MockUsecase) SendMessage(ctx context.Context, mes *message.Message) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "SendMessage", ctx, mes)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// SendMessage indicates an expected call of SendMessage.
+func (mr *MockUsecaseMockRecorder) SendMessage(ctx, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SendMessage", reflect.TypeOf((*MockUsecase)(nil).SendMessage), ctx, mes)
+}
+
+// UpdateContentMessage mocks base method.
+func (m *MockUsecase) UpdateContentMessage(ctx context.Context, userID int, mes *message.Message) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "UpdateContentMessage", ctx, userID, mes)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// UpdateContentMessage indicates an expected call of UpdateContentMessage.
+func (mr *MockUsecaseMockRecorder) UpdateContentMessage(ctx, userID, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateContentMessage", reflect.TypeOf((*MockUsecase)(nil).UpdateContentMessage), ctx, userID, mes)
+}
diff --git a/internal/microservices/messenger/usecase/message/usecase.go b/internal/microservices/messenger/usecase/message/usecase.go
new file mode 100644
index 0000000..d68c3b1
--- /dev/null
+++ b/internal/microservices/messenger/usecase/message/usecase.go
@@ -0,0 +1,80 @@
+package message
+
+import (
+	"context"
+	"errors"
+	"fmt"
+
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	mesRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/message"
+)
+
+var ErrNoAccess = errors.New("there is no access to perform this action")
+
+//go:generate mockgen -destination=./mock/message_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, int, error)
+	SendMessage(ctx context.Context, mes *entity.Message) (int, error)
+	GetMessagesFromChat(ctx context.Context, chat entity.Chat, count, lastID int) (feed []entity.Message, newLastID int, err error)
+	UpdateContentMessage(ctx context.Context, userID int, mes *entity.Message) error
+	DeleteMessage(ctx context.Context, userID, mesID int) error
+	GetMessage(ctx context.Context, messageID int) (*entity.Message, error)
+}
+
+type messageCase struct {
+	repo mesRepo.Repository
+}
+
+func New(repo mesRepo.Repository) *messageCase {
+	return &messageCase{repo}
+}
+
+func (m *messageCase) SendMessage(ctx context.Context, mes *entity.Message) (int, error) {
+	return m.repo.AddNewMessage(ctx, mes)
+}
+
+func (m *messageCase) GetMessagesFromChat(ctx context.Context, chat entity.Chat, count, lastID int) (feed []entity.Message, newLastID int, err error) {
+	feed, err = m.repo.GetMessages(ctx, chat, count, lastID)
+	if err != nil {
+		err = fmt.Errorf("get message: %w", err)
+	}
+	if len(feed) != 0 {
+		newLastID = feed[len(feed)-1].ID
+	}
+	return
+}
+
+func (m *messageCase) UpdateContentMessage(ctx context.Context, userID int, mes *entity.Message) error {
+	if ok, err := m.isAvailableForChanges(ctx, userID, mes.ID); err != nil {
+		return fmt.Errorf("update message: %w", err)
+	} else if !ok {
+		return ErrNoAccess
+	}
+	return m.repo.UpdateContentMessage(ctx, mes.ID, mes.Content.String)
+}
+
+func (m *messageCase) DeleteMessage(ctx context.Context, userID, mesID int) error {
+	if ok, err := m.isAvailableForChanges(ctx, userID, mesID); err != nil {
+		return fmt.Errorf("delete message: %w", err)
+	} else if !ok {
+		return ErrNoAccess
+	}
+	return m.repo.DelMessage(ctx, mesID)
+}
+
+func (m *messageCase) GetMessage(ctx context.Context, messageID int) (*entity.Message, error) {
+	return m.repo.GetMessageByID(ctx, messageID)
+}
+
+func (m *messageCase) GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, int, error) {
+	var newLastID int
+	feed, err := m.repo.GetUserChats(ctx, userID, count, lastID)
+	if len(feed) != 0 {
+		newLastID = feed[len(feed)-1].MessageLastID
+	}
+
+	if err != nil {
+		return feed, newLastID, fmt.Errorf("get user chats with other users: %w", err)
+	}
+	return feed, newLastID, nil
+}
diff --git a/internal/microservices/realtime/kafka_broker.go b/internal/microservices/realtime/kafka_broker.go
new file mode 100644
index 0000000..d9922b0
--- /dev/null
+++ b/internal/microservices/realtime/kafka_broker.go
@@ -0,0 +1,163 @@
+package realtime
+
+import (
+	"errors"
+	"fmt"
+	"hash"
+	"hash/fnv"
+	"sync"
+	"time"
+
+	"github.com/IBM/sarama"
+)
+
+var ErrAlreadyMaxNumberTopic = errors.New("the maximum number has already been created topics")
+
+const _timeoutCreateTopic = time.Second
+
+type KafkaConfig struct {
+	Addres            []string
+	PartitionsOnTopic int
+	MaxNumTopic       int
+}
+
+type kafkaBroker struct {
+	node           *Node
+	mainClient     sarama.Client
+	existingTopics map[string]struct{}
+	cfg            KafkaConfig
+	producer       sarama.SyncProducer
+
+	m sync.RWMutex
+}
+
+var _ Broker = (*kafkaBroker)(nil)
+
+func NewKafkaBroker(node *Node, cfg KafkaConfig) (*kafkaBroker, error) {
+	clientCfg := sarama.NewConfig()
+	clientCfg.Producer.Return.Successes = true
+	clientCfg.Producer.Partitioner = sarama.NewCustomHashPartitioner(func() hash.Hash32 { return fnv.New32() })
+
+	client, err := sarama.NewClient(cfg.Addres, clientCfg)
+	if err != nil {
+		return nil, fmt.Errorf("new client for kafka broker: %w", err)
+	}
+	producer, err := sarama.NewSyncProducerFromClient(client)
+	if err != nil {
+		return nil, fmt.Errorf("new sync producer for kafka broker: %w", err)
+	}
+
+	k := &kafkaBroker{
+		node:           node,
+		cfg:            cfg,
+		mainClient:     client,
+		producer:       producer,
+		m:              sync.RWMutex{},
+		existingTopics: make(map[string]struct{}),
+	}
+	return k, nil
+}
+
+func (k *kafkaBroker) Publish(topic string, channel string, message []byte) error {
+	created, err := k.checkOrCreateTopic(topic)
+	if err != nil {
+		return fmt.Errorf("publish to topic %s: %w", topic, err)
+	}
+
+	if created {
+		err = k.serveTopic(topic)
+		if err != nil {
+			return fmt.Errorf("serve new topic %s: %w", topic, err)
+		}
+	}
+
+	_, _, err = k.producer.SendMessage(&sarama.ProducerMessage{
+		Topic: topic,
+		Key:   sarama.ByteEncoder(channel),
+		Value: sarama.ByteEncoder(message),
+	})
+	if err != nil {
+		return fmt.Errorf("send message with topic %s and channel %s to kafka server: %w", topic, channel, err)
+	}
+	return nil
+}
+
+func (k *kafkaBroker) Close() {
+	k.producer.Close()
+	k.mainClient.Close()
+}
+
+func (k *kafkaBroker) checkOrCreateTopic(topic string) (bool, error) {
+	isExists := false
+	var countTopics int
+	k.m.RLock()
+	if _, ok := k.existingTopics[topic]; ok {
+		isExists = true
+	} else {
+		countTopics = len(k.existingTopics)
+	}
+	k.m.RUnlock()
+
+	if isExists {
+		return false, nil
+	}
+	if countTopics == k.cfg.MaxNumTopic {
+		return false, ErrAlreadyMaxNumberTopic
+	}
+
+	detail := &sarama.TopicDetail{
+		NumPartitions:     int32(k.cfg.PartitionsOnTopic),
+		ReplicationFactor: -1,
+	}
+	_, err := k.mainClient.LeastLoadedBroker().CreateTopics(&sarama.CreateTopicsRequest{
+		ValidateOnly: true,
+		Timeout:      _timeoutCreateTopic,
+		TopicDetails: map[string]*sarama.TopicDetail{topic: detail},
+	})
+	if err != nil {
+		return false, fmt.Errorf("create topic: %w", err)
+	}
+
+	k.m.Lock()
+	if _, ok := k.existingTopics[topic]; !ok && len(k.existingTopics) == k.cfg.MaxNumTopic {
+		k.m.Unlock()
+		go delTopic(topic, k.mainClient)
+		return false, ErrAlreadyMaxNumberTopic
+	}
+	k.existingTopics[topic] = struct{}{}
+	k.m.Unlock()
+
+	k.mainClient.RefreshController()
+	return true, nil
+}
+
+func delTopic(topic string, client sarama.Client) {
+	client.LeastLoadedBroker().DeleteTopics(&sarama.DeleteTopicsRequest{
+		Topics:  []string{topic},
+		Timeout: _timeoutCreateTopic,
+	})
+}
+
+func (k *kafkaBroker) serveTopic(topic string) error {
+	cons, err := sarama.NewConsumer(k.cfg.Addres, sarama.NewConfig())
+	if err != nil {
+		return fmt.Errorf("serve topic %s: %w", topic, err)
+	}
+
+	for i := int32(0); int(i) < k.node.numWorkers; i++ {
+		go func(partition int32) {
+			offset, err := k.mainClient.GetOffset(topic, partition, -1)
+			if err != nil {
+				return
+			}
+			partConsumer, err := cons.ConsumePartition(topic, int32(partition), offset)
+			if err != nil {
+				return
+			}
+			for message := range partConsumer.Messages() {
+				k.node.SendOut(Channel{Name: string(message.Key), Topic: topic}, message.Value)
+			}
+		}(i)
+	}
+	return nil
+}
diff --git a/internal/microservices/realtime/node.go b/internal/microservices/realtime/node.go
new file mode 100644
index 0000000..53d64cc
--- /dev/null
+++ b/internal/microservices/realtime/node.go
@@ -0,0 +1,81 @@
+package realtime
+
+import (
+	"fmt"
+	"os"
+	"sync"
+
+	"google.golang.org/protobuf/proto"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+)
+
+type Node struct {
+	subscriptions [_numWorkers]SubscriberHub
+	broker        Broker
+	numWorkers    int
+	mu            sync.RWMutex
+}
+
+func NewNode() (*Node, error) {
+	node := &Node{}
+	broker, err := NewKafkaBroker(node, KafkaConfig{
+		// Addres:            []string{"localhost:9092"},
+		Addres:            []string{os.Getenv("KAFKA_BROKER_ADDRESS") + ":" + os.Getenv("KAFKA_BROKER_PORT")},
+		PartitionsOnTopic: _numWorkers,
+		MaxNumTopic:       10,
+	})
+	if err != nil {
+		return nil, fmt.Errorf("new kafka broker: %w", err)
+	}
+
+	node.broker = broker
+
+	for ind := range node.subscriptions {
+		node.subscriptions[ind] = make(SubscriberHub)
+	}
+
+	node.numWorkers = _numWorkers
+	node.mu = sync.RWMutex{}
+	return node, nil
+}
+
+func (n *Node) SendOut(channel Channel, message []byte) {
+	clients := []*Client{}
+	ind := index(channel.Name)
+
+	n.mu.RLock()
+	if m, ok := n.subscriptions[ind][channel]; ok {
+		for _, client := range m {
+			clients = append(clients, client)
+		}
+	}
+	n.mu.RUnlock()
+
+	for _, client := range clients {
+		mes := &rt.Message{}
+		err := proto.Unmarshal(message, mes)
+		if err != nil {
+			fmt.Println(err)
+		}
+		client.transport.Send(mes)
+	}
+}
+
+func (n *Node) AddSubscriber(c *rt.Channel, client *Client) {
+	channel := Channel{
+		Name:  c.GetName(),
+		Topic: c.GetTopic(),
+	}
+
+	ind := index(channel.Name)
+
+	n.mu.Lock()
+	defer n.mu.Unlock()
+	subscribeChannel, ok := n.subscriptions[ind][channel]
+	if !ok {
+		subscribeChannel = make(map[string]*Client)
+		n.subscriptions[ind][channel] = subscribeChannel
+	}
+	subscribeChannel[client.id.String()] = client
+}
diff --git a/internal/microservices/realtime/server.go b/internal/microservices/realtime/server.go
new file mode 100644
index 0000000..0574eef
--- /dev/null
+++ b/internal/microservices/realtime/server.go
@@ -0,0 +1,61 @@
+package realtime
+
+import (
+	"context"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+	"github.com/golang/protobuf/ptypes/empty"
+	"github.com/google/uuid"
+	"google.golang.org/grpc/codes"
+	"google.golang.org/grpc/status"
+	"google.golang.org/protobuf/proto"
+)
+
+const _numWorkers = 64
+
+type Server struct {
+	rt.UnimplementedRealTimeServer
+
+	node *Node
+}
+
+func NewServer(node *Node) Server {
+	return Server{
+		UnimplementedRealTimeServer: rt.UnimplementedRealTimeServer{},
+		node:                        node,
+	}
+}
+
+type Broker interface {
+	Publish(topic string, channel string, message []byte) error
+	Close()
+}
+
+func (s Server) Publish(ctx context.Context, pm *rt.PublishMessage) (*empty.Empty, error) {
+	message, err := proto.Marshal(pm.Message)
+	if err != nil {
+		return nil, status.Error(codes.Internal, "marshaling message")
+	}
+	if err := s.node.broker.Publish(pm.Channel.GetTopic(), pm.Channel.GetName(), message); err != nil {
+		return nil, status.Error(codes.Internal, "publish message")
+	}
+	return &empty.Empty{}, nil
+}
+
+func (s Server) Subscribe(chans *rt.Channels, ss rt.RealTime_SubscribeServer) error {
+	id, err := uuid.NewRandom()
+	if err != nil {
+		return status.Error(codes.Internal, "generate uuid v4")
+	}
+	client := &Client{
+		id:        id,
+		transport: ss,
+	}
+
+	for _, ch := range chans.GetChans() {
+		s.node.AddSubscriber(ch, client)
+	}
+
+	<-ss.Context().Done()
+	return nil
+}
diff --git a/internal/microservices/realtime/types.go b/internal/microservices/realtime/types.go
new file mode 100644
index 0000000..d0239e3
--- /dev/null
+++ b/internal/microservices/realtime/types.go
@@ -0,0 +1,27 @@
+package realtime
+
+import (
+	"hash/fnv"
+
+	"github.com/google/uuid"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+)
+
+type Channel struct {
+	Name  string
+	Topic string
+}
+
+type SubscriberHub map[Channel]map[string]*Client
+
+type Client struct {
+	id        uuid.UUID
+	transport rt.RealTime_SubscribeServer
+}
+
+func index(nameChannel string) uint32 {
+	h := fnv.New32()
+	h.Write([]byte(nameChannel))
+	return h.Sum32() % _numWorkers
+}
diff --git a/internal/pkg/delivery/http/v1/auth.go b/internal/pkg/delivery/http/v1/auth.go
index 3fa680a..0c0149a 100644
--- a/internal/pkg/delivery/http/v1/auth.go
+++ b/internal/pkg/delivery/http/v1/auth.go
@@ -1,14 +1,15 @@
 package v1
 
 import (
-	"encoding/json"
 	"net/http"
 	"time"
 
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/session"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
 	usecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/mailru/easyjson"
 )
 
 // Login godoc
@@ -55,8 +56,8 @@ func (h *HandlerHTTP) CheckLogin(w http.ResponseWriter, r *http.Request) {
 func (h *HandlerHTTP) Login(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
 
-	params := usecase.UserCredentials{}
-	err := json.NewDecoder(r.Body).Decode(&params)
+	params := &usecase.UserCredentials{}
+	err := easyjson.UnmarshalFromReader(r.Body, params)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info("failed to parse parameters", log.F{"error", err.Error()})
@@ -76,17 +77,7 @@ func (h *HandlerHTTP) Login(w http.ResponseWriter, r *http.Request) {
 		return
 	}
 
-	user, err := h.userCase.Authentication(r.Context(), params)
-	if err != nil {
-		logger.Warn(err.Error())
-		err = responseError(w, "bad_credentials", "incorrect user credentials")
-		if err != nil {
-			logger.Error(err.Error())
-		}
-		return
-	}
-
-	session, err := h.sm.CreateNewSessionForUser(r.Context(), user.ID)
+	session, err := h.authCase.Login(r.Context(), params.Username, params.Password)
 	if err != nil {
 		logger.Error(err.Error())
 		err = responseError(w, "session", "failed to create a session for the user")
@@ -131,7 +122,7 @@ func (h *HandlerHTTP) Signup(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
 
 	user := &user.User{}
-	err := json.NewDecoder(r.Body).Decode(user)
+	err := easyjson.UnmarshalFromReader(r.Body, user)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info("failed to parse parameters", log.F{"error", err.Error()})
@@ -151,7 +142,7 @@ func (h *HandlerHTTP) Signup(w http.ResponseWriter, r *http.Request) {
 		return
 	}
 
-	err = h.userCase.Register(r.Context(), user)
+	err = h.authCase.Register(r.Context(), user)
 	if err != nil {
 		logger.Warn(err.Error())
 		err = responseError(w, "uniq_fields", "there is already an account with this username or email")
@@ -178,6 +169,7 @@ func (h *HandlerHTTP) Signup(w http.ResponseWriter, r *http.Request) {
 //	@Router			/api/v1/auth/logout [delete]
 func (h *HandlerHTTP) Logout(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
 
 	cookie, err := r.Cookie("session_key")
 	if err != nil {
@@ -193,7 +185,11 @@ func (h *HandlerHTTP) Logout(w http.ResponseWriter, r *http.Request) {
 	cookie.Path = "/"
 	http.SetCookie(w, cookie)
 
-	err = h.sm.DeleteUserSession(r.Context(), cookie.Value)
+	err = h.authCase.Logout(r.Context(), &session.Session{
+		Key:    cookie.Value,
+		UserID: userID,
+		Expire: cookie.Expires,
+	})
 	if err != nil {
 		logger.Error(err.Error())
 		err = responseError(w, "session", "the user logged out, but his session did not end")
diff --git a/internal/pkg/delivery/http/v1/auth_test.go b/internal/pkg/delivery/http/v1/auth_test.go
index 29949ea..95c6744 100644
--- a/internal/pkg/delivery/http/v1/auth_test.go
+++ b/internal/pkg/delivery/http/v1/auth_test.go
@@ -10,6 +10,7 @@ import (
 	"strings"
 	"testing"
 
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
@@ -45,7 +46,7 @@ func TestCheckLogin(t *testing.T) {
 	badCases := []struct {
 		name    string
 		cookie  *http.Cookie
-		expResp JsonErrResponse
+		expResp structs.JsonErrResponse
 	}{
 		{
 			"sending empty cookie",
@@ -53,7 +54,7 @@ func TestCheckLogin(t *testing.T) {
 				Name:  "",
 				Value: "",
 			},
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "no user was found for this session",
 				Code:    "no_auth",
@@ -65,7 +66,7 @@ func TestCheckLogin(t *testing.T) {
 				Name:  "session_key",
 				Value: "doesn't exist",
 			},
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "no user was found for this session",
 				Code:    "no_auth",
@@ -77,7 +78,7 @@ func TestCheckLogin(t *testing.T) {
 				Name:  "session_key",
 				Value: "f4280a941b664d02",
 			},
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "no user was found for this session",
 				Code:    "no_auth",
@@ -93,7 +94,7 @@ func TestCheckLogin(t *testing.T) {
 
 			service.CheckLogin(w, req)
 
-			var actualResp JsonErrResponse
+			var actualResp structs.JsonErrResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 		})
@@ -116,12 +117,12 @@ func testLogin(t *testing.T) {
 	goodCases := []struct {
 		name    string
 		rawBody string
-		expResp JsonResponse
+		expResp structs.JsonResponse
 	}{
 		{
 			"providing correct and valid user credentials",
 			`{"username":"dogsLover", "password":"big_string"}`,
-			JsonResponse{
+			structs.JsonResponse{
 				Status:  "ok",
 				Message: "a new session has been created for the user",
 				Body:    nil,
@@ -136,7 +137,7 @@ func testLogin(t *testing.T) {
 
 			service.Login(w, req)
 
-			var actualResp JsonResponse
+			var actualResp structs.JsonResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 			require.True(t, checkAuthCookie(w.Result().Cookies()))
@@ -146,12 +147,12 @@ func testLogin(t *testing.T) {
 	badCases := []struct {
 		name    string
 		rawBody string
-		expResp JsonErrResponse
+		expResp structs.JsonErrResponse
 	}{
 		{
 			"providing invalid credentials - broken body",
 			"{'username': 'dogsLover', 'password': 'big_string'",
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "the correct username and password are expected to be received in JSON format",
 				Code:    "parse_body",
@@ -160,7 +161,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - no username",
 			`{"password":"big_string"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -169,7 +170,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - no password",
 			`{"username":"dogsLover"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -178,7 +179,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - short username",
 			`{"username":"do", "password":"big_string"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -187,7 +188,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - long username",
 			`{"username":"dojsbrjfbdrjhbhjldrbgbdrhjgbdjrbgjdhbgjhdbrghbdhj,gbdhjrbgjhdbvkvghkevfghjdvrfhvdhrvbjdfgdrgdr","password":"big_string"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -196,7 +197,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - short password",
 			`{"username":"dogsLover","password":"bi"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -205,7 +206,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing invalid credentials - long password",
 			`{"username":"dogsLover","password":"biyugsgrusgubskhvfhkdgvfgvdvrjgbsjhgjkshzkljfskfwjkhkfjisuidgoquakflsjuzeofiow3i"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "invalid user credentials",
 				Code:    "invalid_credentials",
@@ -214,7 +215,7 @@ func testLogin(t *testing.T) {
 		{
 			"providing incorrect credentials - no user with such credentials",
 			`{"username":"dogsLover", "password":"doesn't_exist"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "incorrect user credentials",
 				Code:    "bad_credentials",
@@ -229,7 +230,7 @@ func testLogin(t *testing.T) {
 
 			service.Login(w, req)
 
-			var actualResp JsonErrResponse
+			var actualResp structs.JsonErrResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 			require.False(t, checkAuthCookie(w.Result().Cookies()))
@@ -252,12 +253,12 @@ func testSignUp(t *testing.T) {
 	goodCases := []struct {
 		name    string
 		rawBody string
-		expResp JsonResponse
+		expResp structs.JsonResponse
 	}{
 		{
 			"providing correct and valid data for signup",
 			`{"username":"newbie", "password":"getHigh123", "email":"world@uandex.ru"}`,
-			JsonResponse{
+			structs.JsonResponse{
 				Status:  "ok",
 				Message: "the user has been successfully registered",
 				Body:    nil,
@@ -272,7 +273,7 @@ func testSignUp(t *testing.T) {
 
 			service.Signup(w, req)
 
-			var actualResp JsonResponse
+			var actualResp structs.JsonResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 		})
@@ -281,12 +282,12 @@ func testSignUp(t *testing.T) {
 	badCases := []struct {
 		name    string
 		rawBody string
-		expResp JsonErrResponse
+		expResp structs.JsonErrResponse
 	}{
 		{
 			"user with such data already exists",
 			`{"username":"dogsLover", "password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "there is already an account with this username or email",
 				Code:    "uniq_fields",
@@ -295,7 +296,7 @@ func testSignUp(t *testing.T) {
 		{
 			"invalid data - broken body",
 			`{"username":"dogsLover", "password":"big_string", "email":"dogslove@gmail.com"`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "the correct username, email and password are expected to be received in JSON format",
 				Code:    "parse_body",
@@ -304,7 +305,7 @@ func testSignUp(t *testing.T) {
 		{
 			"invalid data - no username",
 			`{"password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "username",
 				Code:    "invalid_params",
@@ -313,7 +314,7 @@ func testSignUp(t *testing.T) {
 		{
 			"invalid data - no username, password",
 			`{"email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "password,username",
 				Code:    "invalid_params",
@@ -322,7 +323,7 @@ func testSignUp(t *testing.T) {
 		{
 			"invalid data - short username",
 			`{"username":"sh", "password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "username",
 				Code:    "invalid_params",
@@ -331,7 +332,7 @@ func testSignUp(t *testing.T) {
 		{
 			"invalid data - incorrect email",
 			`{"username":"sh", "password":"big_string", "email":"dog"}`,
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "email,username",
 				Code:    "invalid_params",
@@ -346,7 +347,7 @@ func testSignUp(t *testing.T) {
 
 			service.Signup(w, req)
 
-			var actualResp JsonErrResponse
+			var actualResp structs.JsonErrResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 		})
@@ -368,7 +369,7 @@ func testLogout(t *testing.T) {
 	goodCases := []struct {
 		name    string
 		cookie  *http.Cookie
-		expResp JsonResponse
+		expResp structs.JsonResponse
 	}{
 		{
 			"user is logged in - providing valid cookie",
@@ -376,7 +377,7 @@ func testLogout(t *testing.T) {
 				Name:  "session_key",
 				Value: "461afabf38b3147c",
 			},
-			JsonResponse{
+			structs.JsonResponse{
 				Status:  "ok",
 				Message: "the user has successfully logged out",
 				Body:    nil,
@@ -392,7 +393,7 @@ func testLogout(t *testing.T) {
 
 			service.Logout(w, req)
 
-			var actualResp JsonResponse
+			var actualResp structs.JsonResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 		})
@@ -401,7 +402,7 @@ func testLogout(t *testing.T) {
 	badCases := []struct {
 		name    string
 		cookie  *http.Cookie
-		expResp JsonErrResponse
+		expResp structs.JsonErrResponse
 	}{
 		{
 			"user isn't logged in - providing invalid cookie",
@@ -409,7 +410,7 @@ func testLogout(t *testing.T) {
 				Name:  "not_auth_cookie",
 				Value: "blablalba",
 			},
-			JsonErrResponse{
+			structs.JsonErrResponse{
 				Status:  "error",
 				Message: "to log out, you must first log in",
 				Code:    "no_auth",
@@ -425,7 +426,7 @@ func testLogout(t *testing.T) {
 
 			service.Logout(w, req)
 
-			var actualResp JsonErrResponse
+			var actualResp structs.JsonErrResponse
 			json.NewDecoder(w.Result().Body).Decode(&actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
 		})
diff --git a/internal/pkg/delivery/http/v1/board.go b/internal/pkg/delivery/http/v1/board.go
index f4e5f4d..ba7e9e3 100644
--- a/internal/pkg/delivery/http/v1/board.go
+++ b/internal/pkg/delivery/http/v1/board.go
@@ -2,134 +2,35 @@ package v1
 
 import (
 	"encoding/json"
-	"errors"
-	"fmt"
 	"net/http"
 	"strconv"
 
 	"github.com/go-chi/chi/v5"
 	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/board"
+	"github.com/mailru/easyjson"
 
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
-	bCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/board"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
 )
 
 var TimeFormat = "2006-01-02"
 
-var (
-	ErrEmptyTitle        = errors.New("empty or null board title has been provided")
-	ErrEmptyPubOpt       = errors.New("null public option has been provided")
-	ErrInvalidBoardTitle = errors.New("invalid or empty board title has been provided")
-	ErrInvalidTagTitles  = errors.New("invalid tag titles have been provided")
-	ErrInvalidUsername   = errors.New("invalid username has been provided")
-)
-
-var (
-	wrappedErrors      = map[error]string{ErrInvalidTagTitles: "bad_Tagtitles"}
-	errCodeCompability = map[error]string{
-		ErrInvalidBoardTitle:     "bad_boardTitle",
-		ErrEmptyTitle:            "empty_boardTitle",
-		ErrEmptyPubOpt:           "bad_pubOpt",
-		ErrInvalidUsername:       "bad_username",
-		bCase.ErrInvalidUsername: "non_existingUser",
-		bCase.ErrNoSuchBoard:     "no_board",
-		bCase.ErrNoAccess:        "no_access",
-	}
-)
-
-// data for board creation/update
-type BoardData struct {
-	Title       *string  `json:"title" example:"new board"`
-	Description *string  `json:"description" example:"long desc"`
-	Public      *bool    `json:"public" example:"true"`
-	Tags        []string `json:"tags" example:"['blue', 'car']"`
-}
-
-// board view for delivery layer
-type CertainBoard struct {
-	ID          int      `json:"board_id" example:"22"`
-	Title       string   `json:"title" example:"new board"`
-	Description string   `json:"description" example:"long desc"`
-	CreatedAt   string   `json:"created_at" example:"07-11-2023"`
-	PinsNumber  int      `json:"pins_number" example:"12"`
-	Pins        []string `json:"pins" example:"['/pic1', '/pic2']"`
-	Tags        []string `json:"tags" example:"['love', 'green']"`
-}
-
-func ToCertainBoardFromService(board entity.BoardWithContent) CertainBoard {
-	return CertainBoard{
-		ID:          board.BoardInfo.ID,
-		Title:       board.BoardInfo.Title,
-		Description: board.BoardInfo.Description,
-		CreatedAt:   board.BoardInfo.CreatedAt.Format(TimeFormat),
-		PinsNumber:  board.PinsNumber,
-		Pins:        board.Pins,
-		Tags:        board.TagTitles,
-	}
-}
-
-func (data *BoardData) Validate() error {
-	if data.Title == nil || *data.Title == "" {
-		return ErrInvalidBoardTitle
-	}
-	if data.Description == nil {
-		data.Description = new(string)
-		*data.Description = ""
-	}
-	if data.Public == nil {
-		return ErrEmptyPubOpt
-	}
-	if !isValidBoardTitle(*data.Title) {
-		return ErrInvalidBoardTitle
-	}
-	if err := checkIsValidTagTitles(data.Tags); err != nil {
-		return fmt.Errorf("%s: %w", err.Error(), ErrInvalidTagTitles)
-	}
-	return nil
-}
-
-func getErrCodeMessage(err error) (string, string) {
-	var (
-		code              string
-		general, specific bool
-	)
-
-	code, general = generalErrCodeCompability[err]
-	if general {
-		return code, err.Error()
-	}
-
-	code, specific = errCodeCompability[err]
-	if !specific {
-		for wrappedErr, code_ := range wrappedErrors {
-			if errors.Is(err, wrappedErr) {
-				specific = true
-				code = code_
-			}
-		}
-	}
-	if specific {
-		return code, err.Error()
-	}
-
-	return ErrInternalError.Error(), generalErrCodeCompability[ErrInternalError]
-}
-
 func (h *HandlerHTTP) CreateNewBoard(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
-	if contentType := w.Header().Get("Content-Type"); contentType != ApplicationJson {
-		code, message := getErrCodeMessage(ErrBadContentType)
+	if contentType := r.Header.Get("Content-Type"); contentType != ApplicationJson {
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadContentType)
 		responseError(w, code, message)
 		return
 	}
 
-	var newBoard BoardData
-	err := json.NewDecoder(r.Body).Decode(&newBoard)
+	var newBoard structs.BoardData
+	err := easyjson.UnmarshalFromReader(r.Body, &newBoard)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info("create board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadBody)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadBody)
 		responseError(w, code, message)
 		return
 	}
@@ -137,7 +38,7 @@ func (h *HandlerHTTP) CreateNewBoard(w http.ResponseWriter, r *http.Request) {
 	err = newBoard.Validate()
 	if err != nil {
 		logger.Info("create board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
@@ -145,7 +46,6 @@ func (h *HandlerHTTP) CreateNewBoard(w http.ResponseWriter, r *http.Request) {
 	tagTitles := make([]string, 0)
 	if newBoard.Tags != nil {
 		tagTitles = append(tagTitles, newBoard.Tags...)
-
 	}
 	authorID := r.Context().Value(auth.KeyCurrentUserID).(int)
 
@@ -158,7 +58,7 @@ func (h *HandlerHTTP) CreateNewBoard(w http.ResponseWriter, r *http.Request) {
 
 	if err != nil {
 		logger.Info("create board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
@@ -167,7 +67,7 @@ func (h *HandlerHTTP) CreateNewBoard(w http.ResponseWriter, r *http.Request) {
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
@@ -176,8 +76,8 @@ func (h *HandlerHTTP) GetUserBoards(w http.ResponseWriter, r *http.Request) {
 
 	username := chi.URLParam(r, "username")
 	if !isValidUsername(username) {
-		logger.Info("update board", log.F{"message", ErrInvalidUsername.Error()})
-		code, message := getErrCodeMessage(ErrInvalidUsername)
+		logger.Info("update board", log.F{"message", errHTTP.ErrInvalidUsername.Error()})
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrInvalidUsername)
 		responseError(w, code, message)
 		return
 	}
@@ -185,20 +85,20 @@ func (h *HandlerHTTP) GetUserBoards(w http.ResponseWriter, r *http.Request) {
 	boards, err := h.boardCase.GetBoardsByUsername(r.Context(), username)
 	if err != nil {
 		logger.Info("get user boards", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
 
-	userBoards := make([]CertainBoard, 0, len(boards))
+	userBoards := make([]structs.CertainBoard, 0, len(boards))
 	for _, board := range boards {
-		userBoards = append(userBoards, ToCertainBoardFromService(board))
+		userBoards = append(userBoards, h.converter.ToCertainBoardFromService(&board))
 	}
 	err = responseOk(http.StatusOK, w, "got user boards successfully", userBoards)
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
@@ -208,24 +108,24 @@ func (h *HandlerHTTP) GetCertainBoard(w http.ResponseWriter, r *http.Request) {
 	boardID, err := strconv.ParseInt(chi.URLParam(r, "boardID"), 10, 64)
 	if err != nil {
 		logger.Info("get certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadUrlParam)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadUrlParam)
 		responseError(w, code, message)
 		return
 	}
 
-	board, err := h.boardCase.GetCertainBoard(r.Context(), int(boardID))
+	board, username, err := h.boardCase.GetCertainBoard(r.Context(), int(boardID))
 	if err != nil {
 		logger.Info("get certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
 
-	err = responseOk(http.StatusOK, w, "got certain board successfully", ToCertainBoardFromService(board))
+	err = responseOk(http.StatusOK, w, "got certain board successfully", h.converter.ToCertainBoardUsernameFromService(&board, username))
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
@@ -235,31 +135,31 @@ func (h *HandlerHTTP) GetBoardInfoForUpdate(w http.ResponseWriter, r *http.Reque
 	boardID, err := strconv.ParseInt(chi.URLParam(r, "boardID"), 10, 64)
 	if err != nil {
 		logger.Info("get certain board info for update", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadUrlParam)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadUrlParam)
 		responseError(w, code, message)
 		return
 	}
 
 	board, tagTitles, err := h.boardCase.GetBoardInfoForUpdate(r.Context(), int(boardID))
 	if err != nil {
-		logger.Info("get certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		logger.Info("get certain board info for update", log.F{"message", err.Error()})
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
 
-	err = responseOk(http.StatusOK, w, "got certain board successfully", map[string]interface{}{"board": board, "tags": tagTitles})
+	err = responseOk(http.StatusOK, w, "got certain board successfully", map[string]interface{}{"board": h.converter.ToBoardFromService(&board), "tags": tagTitles})
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
 func (h *HandlerHTTP) UpdateBoardInfo(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
-	if contentType := w.Header().Get("Content-Type"); contentType != ApplicationJson {
-		code, message := getErrCodeMessage(ErrBadContentType)
+	if contentType := r.Header.Get("Content-Type"); contentType != ApplicationJson {
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadContentType)
 		responseError(w, code, message)
 		return
 	}
@@ -267,17 +167,17 @@ func (h *HandlerHTTP) UpdateBoardInfo(w http.ResponseWriter, r *http.Request) {
 	boardID, err := strconv.ParseInt(chi.URLParam(r, "boardID"), 10, 64)
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadUrlParam)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadUrlParam)
 		responseError(w, code, message)
 		return
 	}
 
-	var updatedData BoardData
-	err = json.NewDecoder(r.Body).Decode(&updatedData)
+	var updatedData structs.BoardData
+	err = easyjson.UnmarshalFromReader(r.Body, &updatedData)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadBody)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadBody)
 		responseError(w, code, message)
 		return
 	}
@@ -285,7 +185,7 @@ func (h *HandlerHTTP) UpdateBoardInfo(w http.ResponseWriter, r *http.Request) {
 	err = updatedData.Validate()
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
@@ -304,7 +204,7 @@ func (h *HandlerHTTP) UpdateBoardInfo(w http.ResponseWriter, r *http.Request) {
 	err = h.boardCase.UpdateBoardInfo(r.Context(), updatedBoard, tagTitles)
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
@@ -313,7 +213,7 @@ func (h *HandlerHTTP) UpdateBoardInfo(w http.ResponseWriter, r *http.Request) {
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
@@ -323,7 +223,7 @@ func (h *HandlerHTTP) DeleteBoard(w http.ResponseWriter, r *http.Request) {
 	boardID, err := strconv.ParseInt(chi.URLParam(r, "boardID"), 10, 64)
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(ErrBadUrlParam)
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadUrlParam)
 		responseError(w, code, message)
 		return
 	}
@@ -331,7 +231,7 @@ func (h *HandlerHTTP) DeleteBoard(w http.ResponseWriter, r *http.Request) {
 	err = h.boardCase.DeleteCertainBoard(r.Context(), int(boardID))
 	if err != nil {
 		logger.Info("update certain board", log.F{"message", err.Error()})
-		code, message := getErrCodeMessage(err)
+		code, message := errHTTP.GetErrCodeMessage(err)
 		responseError(w, code, message)
 		return
 	}
@@ -340,7 +240,7 @@ func (h *HandlerHTTP) DeleteBoard(w http.ResponseWriter, r *http.Request) {
 	if err != nil {
 		logger.Error(err.Error())
 		w.WriteHeader(http.StatusInternalServerError)
-		w.Write([]byte(ErrInternalError.Error()))
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
 	}
 }
 
@@ -401,3 +301,45 @@ func (h *HandlerHTTP) AddPinsToBoard(w http.ResponseWriter, r *http.Request) {
 		logger.Error(err.Error())
 	}
 }
+
+func (h *HandlerHTTP) DeletePinFromBoard(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+
+	boardID, err := strconv.ParseInt(chi.URLParam(r, "boardID"), 10, 64)
+	if err != nil {
+		logger.Info("delete pin from board", log.F{"message", err.Error()})
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadUrlParam)
+		responseError(w, code, message)
+		return
+	}
+
+	if contentType := r.Header.Get("Content-Type"); contentType != ApplicationJson {
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadContentType)
+		responseError(w, code, message)
+		return
+	}
+
+	delPinFromBoard := structs.DeletePinFromBoard{}
+	err = easyjson.UnmarshalFromReader(r.Body, &delPinFromBoard)
+	defer r.Body.Close()
+	if err != nil {
+		code, message := errHTTP.GetErrCodeMessage(errHTTP.ErrBadBody)
+		responseError(w, code, message)
+		return
+	}
+
+	err = h.boardCase.DeletePinFromBoard(r.Context(), int(boardID), delPinFromBoard.PinID)
+	if err != nil {
+		logger.Info("delete pin from board", log.F{"message", err.Error()})
+		code, message := errHTTP.GetErrCodeMessage(err)
+		responseError(w, code, message)
+		return
+	}
+
+	err = responseOk(http.StatusOK, w, "deleted pin from board successfully", nil)
+	if err != nil {
+		logger.Error(err.Error())
+		w.WriteHeader(http.StatusInternalServerError)
+		w.Write([]byte(errHTTP.ErrInternalError.Error()))
+	}
+}
diff --git a/internal/pkg/delivery/http/v1/board_validation.go b/internal/pkg/delivery/http/v1/board_validation.go
deleted file mode 100644
index 0cabf18..0000000
--- a/internal/pkg/delivery/http/v1/board_validation.go
+++ /dev/null
@@ -1,48 +0,0 @@
-package v1
-
-import (
-	"fmt"
-	"unicode"
-)
-
-func isValidTagTitle(title string) bool {
-	if len(title) > 20 {
-		return false
-	}
-
-	for _, sym := range title {
-		if !(unicode.IsNumber(sym) || unicode.IsLetter(sym) || unicode.IsPunct(sym) || unicode.IsSpace(sym)) {
-			return false
-		}
-	}
-	return true
-}
-
-func checkIsValidTagTitles(titles []string) error {
-	if len(titles) > 7 {
-		return fmt.Errorf("too many titles")
-	}
-
-	invalidTitles := make([]string, 0)
-	for _, title := range titles {
-		if !isValidTagTitle(title) {
-			invalidTitles = append(invalidTitles, title)
-		}
-	}
-	if len(invalidTitles) > 0 {
-		return fmt.Errorf("%v", invalidTitles)
-	}
-	return nil
-}
-
-func isValidBoardTitle(title string) bool {
-	if len(title) == 0 || len(title) > 40 {
-		return false
-	}
-	for _, sym := range title {
-		if !(unicode.IsNumber(sym) || unicode.IsLetter(sym) || unicode.IsPunct(sym) || unicode.IsSpace(sym)) {
-			return false
-		}
-	}
-	return true
-}
diff --git a/internal/pkg/delivery/http/v1/chat.go b/internal/pkg/delivery/http/v1/chat.go
new file mode 100644
index 0000000..bf7b229
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/chat.go
@@ -0,0 +1,179 @@
+package v1
+
+import (
+	"net/http"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+)
+
+func (h *HandlerHTTP) FeedChats(w http.ResponseWriter, r *http.Request) {
+	log := h.getRequestLogger(r)
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+
+	count, lastID, err := FetchValidParamForLoadFeed(r.URL)
+	if err != nil {
+		log.Info(err.Error())
+		err = responseError(w, "parse_url", "bad request url for getting feed chat")
+		if err != nil {
+			log.Error(err.Error())
+		}
+		return
+	}
+
+	chats, newLastID, err := h.messageCase.GetUserChatsWithOtherUsers(r.Context(), userID, count, lastID)
+	if err != nil {
+		log.Errorf(err.Error())
+	}
+	err = responseOk(http.StatusOK, w, "success get feed user chats", map[string]any{
+		"chats":  chats,
+		"lastID": newLastID,
+	})
+	if err != nil {
+		log.Fatal(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) SendMessageToUser(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+
+	fromUserID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	toUserID, err := fetchURLParamInt(r, "userID")
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "parse_url", "could not extract to whom the message is being sent")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	mes := &message.Message{}
+	err = decodeBody(r, mes)
+	defer r.Body.Close()
+	if err != nil {
+		logger.Info(err.Error())
+		err = responseError(w, "parse_body", "invalid request body")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+	mes.From = fromUserID
+	mes.To = toUserID
+
+	idNewMessage, err := h.messageCase.SendMessage(r.Context(), userID, mes)
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "send_message", "failed to send message")
+	} else {
+		err = responseOk(http.StatusCreated, w, "the message was sent successfully",
+			map[string]int{"id": idNewMessage})
+	}
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) DeleteMessage(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	messageID, err := fetchURLParamInt(r, "messageID")
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "parse_url", "could not extract to whom the message is being sent")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	err = h.messageCase.DeleteMessage(r.Context(), userID, &message.Message{ID: messageID})
+	if err != nil {
+		logger.Warn(err.Error())
+		err = responseError(w, "delete_message", "fail deleting a message")
+	} else {
+		err = responseOk(http.StatusOK, w, "the message was successfully deleted", nil)
+	}
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) UpdateMessage(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	messageID, err := fetchURLParamInt(r, "messageID")
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "parse_url", "could not extract to whom the message is being sent")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	mes := &message.Message{}
+	err = decodeBody(r, mes)
+	defer r.Body.Close()
+	if err != nil {
+		logger.Info(err.Error())
+		err = responseError(w, "parse_body", "invalid request body")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+	mes.ID = messageID
+
+	err = h.messageCase.UpdateContentMessage(r.Context(), userID, mes)
+	if err != nil {
+		logger.Warn(err.Error())
+		err = responseError(w, "update_message", "fail updating a message")
+	} else {
+		err = responseOk(http.StatusOK, w, "the message was successfully updated", nil)
+	}
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) GetMessagesFromChat(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	userID2, err := fetchURLParamInt(r, "userID")
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "parse_url", "could not extract to whom the message is being sent")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	count, lastID, err := FetchValidParamForLoadFeed(r.URL)
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "bad_request", "failed to get parameters for receiving a message from a chat")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	feed, newLastID, err := h.messageCase.GetMessagesFromChat(r.Context(), userID, message.Chat{userID, userID2}, count, lastID)
+	if err != nil {
+		logger.Warn(err.Error())
+	}
+	err = responseOk(http.StatusOK, w, "messages received successfully", map[string]any{
+		"messages": h.converter.ToMessagesFromService(feed),
+		"lastID":   newLastID,
+	})
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
diff --git a/internal/pkg/delivery/http/v1/comment.go b/internal/pkg/delivery/http/v1/comment.go
new file mode 100644
index 0000000..3f0e25f
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/comment.go
@@ -0,0 +1,118 @@
+package v1
+
+import (
+	"net/http"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	"github.com/mailru/easyjson"
+)
+
+func (h *HandlerHTTP) WriteComment(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+
+	pinID, err := fetchURLParamInt(r, "pinID")
+	if err != nil {
+		err = responseError(w, "parse_url", "the request url could not be get pin id")
+		if err != nil {
+			logger.Error(err.Error())
+			return
+		}
+	}
+
+	comment := &comment.Comment{}
+	err = easyjson.UnmarshalFromReader(r.Body, comment)
+	defer r.Body.Close()
+	if err != nil {
+		logger.Warn(err.Error())
+
+		err = responseError(w, "parse_body", "the request body could not be parsed to send a comment")
+		if err != nil {
+			logger.Error(err.Error())
+			return
+		}
+	}
+
+	comment.PinID = pinID
+	_, err = h.commentCase.PutCommentOnPin(r.Context(), userID, comment)
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "create_comment", "couldn't leave a comment under the selected pin")
+	} else {
+		err = responseOk(http.StatusCreated, w, "the comment has been added successfully", nil)
+	}
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) DeleteComment(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+
+	commentID, err := fetchURLParamInt(r, "commentID")
+	if err != nil {
+		err = responseError(w, "parse_url", "the request url could not be get pin id")
+		if err != nil {
+			logger.Error(err.Error())
+			return
+		}
+	}
+
+	err = h.commentCase.DeleteComment(r.Context(), userID, commentID)
+	if err != nil {
+		logger.Error(err.Error())
+		err = responseError(w, "delete_comment", "couldn't delete pin comment")
+	} else {
+		err = responseOk(http.StatusOK, w, "the comment was successfully deleted", nil)
+	}
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
+
+func (h *HandlerHTTP) ViewFeedComment(w http.ResponseWriter, r *http.Request) {
+	logger := h.getRequestLogger(r)
+	userID, ok := r.Context().Value(auth.KeyCurrentUserID).(int)
+	if !ok {
+		userID = user.UserUnknown
+	}
+
+	pinID, err := fetchURLParamInt(r, "pinID")
+	if err != nil {
+		err = responseError(w, "parse_url", "the request url could not be get pin id")
+		if err != nil {
+			logger.Error(err.Error())
+			return
+		}
+	}
+
+	count, lastID, err := FetchValidParamForLoadFeed(r.URL)
+	if err != nil {
+		err = responseError(w, "query_param", "the parameters for displaying the pin feed could not be extracted from the request")
+		if err != nil {
+			logger.Error(err.Error())
+			return
+		}
+	}
+
+	feed, newLastID, err := h.commentCase.GetFeedCommentOnPin(r.Context(), userID, pinID, count, lastID)
+	if err != nil && len(feed) == 0 {
+		err = responseError(w, "feed_view", "error displaying pin comments")
+		if err != nil {
+			logger.Error(err.Error())
+		}
+		return
+	}
+
+	if err != nil {
+		logger.Error(err.Error())
+	}
+
+	err = responseOk(http.StatusOK, w, "feed comment to pin", map[string]any{"comments": h.converter.ToCommentsFromService(feed), "lastID": newLastID})
+	if err != nil {
+		logger.Error(err.Error())
+	}
+}
diff --git a/internal/pkg/delivery/http/v1/converter.go b/internal/pkg/delivery/http/v1/converter.go
new file mode 100644
index 0000000..c5c9346
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/converter.go
@@ -0,0 +1,136 @@
+package v1
+
+import (
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/board"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+type converterHTTP struct {
+	sanitizer validation.SanitizerXSS
+	censor    validation.ProfanityCensor
+}
+
+func NewConverterHTTP(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) converterHTTP {
+	return converterHTTP{sanitizer, censor}
+}
+
+func (c *converterHTTP) ToCertainBoardFromService(board *entity.BoardWithContent) structs.CertainBoard {
+	b := structs.CertainBoard{
+		ID:          board.BoardInfo.ID,
+		AuthorID:    board.BoardInfo.AuthorID,
+		Title:       board.BoardInfo.Title,
+		Description: board.BoardInfo.Description,
+		CreatedAt:   board.BoardInfo.CreatedAt.Format(TimeFormat),
+		PinsNumber:  board.PinsNumber,
+		Pins:        board.Pins,
+		Tags:        board.TagTitles,
+	}
+	b.Sanitize(c.sanitizer, c.censor)
+	return b
+}
+
+func (c *converterHTTP) ToCertainBoardUsernameFromService(board *entity.BoardWithContent, username string) structs.CertainBoardWithUsername {
+	b := structs.CertainBoardWithUsername{
+		ID:             board.BoardInfo.ID,
+		AuthorID:       board.BoardInfo.AuthorID,
+		AuthorUsername: username,
+		Title:          board.BoardInfo.Title,
+		Description:    board.BoardInfo.Description,
+		CreatedAt:      board.BoardInfo.CreatedAt.Format(TimeFormat),
+		PinsNumber:     board.PinsNumber,
+		Pins:           board.Pins,
+		Tags:           board.TagTitles,
+	}
+	b.Sanitize(c.sanitizer, c.censor)
+	return b
+}
+
+func (c *converterHTTP) ToBoardFromService(board *entity.Board) *entity.Board {
+	board.Sanitize(c.sanitizer, c.censor)
+	return board
+}
+
+func (c *converterHTTP) ToUsersForSearchFromService(users []search.UserForSearch) []search.UserForSearch {
+	for id := range users {
+		users[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return users
+}
+
+func (c *converterHTTP) ToBoardsForSearchFromService(boards []search.BoardForSearch) []search.BoardForSearch {
+	for id := range boards {
+		boards[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return boards
+}
+
+func (c *converterHTTP) ToPinsForSearchFromService(pins []search.PinForSearch) []search.PinForSearch {
+	for id := range pins {
+		pins[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return pins
+}
+
+func (c *converterHTTP) ToSubscriptionUsersFromService(users []user.SubscriptionUser) []user.SubscriptionUser {
+	for id := range users {
+		users[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return users
+}
+
+func (c *converterHTTP) ToUserInfoFromService(user *userEntity.User, isSubscribed bool, subsCount int) structs.UserInfo {
+	u := structs.UserInfo{
+		ID:           user.ID,
+		Username:     user.Username,
+		Avatar:       user.Avatar,
+		Name:         user.Name.String,
+		Surname:      user.Surname.String,
+		About:        user.AboutMe.String,
+		IsSubscribed: isSubscribed,
+		SubsCount:    subsCount,
+	}
+	u.Sanitize(c.sanitizer, c.censor)
+	return u
+}
+
+func (c *converterHTTP) ToProfileInfoFromService(user *userEntity.User, subsCount int) structs.ProfileInfo {
+	p := structs.ProfileInfo{
+		ID:        user.ID,
+		Username:  user.Username,
+		Avatar:    user.Avatar,
+		SubsCount: subsCount,
+	}
+	p.Sanitize(c.sanitizer, c.censor)
+	return p
+}
+
+func (c *converterHTTP) ToUserFromService(user *userEntity.User) *userEntity.User {
+	user.Sanitize(c.sanitizer, c.censor)
+	return user
+}
+
+func (c *converterHTTP) ToPinFromService(pin *pin.Pin) *pin.Pin {
+	pin.Sanitize(c.sanitizer, c.censor)
+	return pin
+}
+
+func (c *converterHTTP) ToMessagesFromService(mes []message.Message) []message.Message {
+	for id := range mes {
+		mes[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return mes
+}
+
+func (c *converterHTTP) ToCommentsFromService(comments []comment.Comment) []comment.Comment {
+	for id := range comments {
+		comments[id].Sanitize(c.sanitizer, c.censor)
+	}
+	return comments
+}
diff --git a/internal/pkg/delivery/http/v1/errors/board.go b/internal/pkg/delivery/http/v1/errors/board.go
new file mode 100644
index 0000000..0d2106c
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/errors/board.go
@@ -0,0 +1,57 @@
+package errors
+
+import (
+	"errors"
+
+	bCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/board"
+)
+
+// for backward compatibility
+var (
+	ErrEmptyTitle        = errors.New("empty or null board title has been provided")
+	ErrEmptyPubOpt       = errors.New("null public option has been provided")
+	ErrInvalidBoardTitle = errors.New("invalid or empty board title has been provided")
+	ErrInvalidTagTitles  = errors.New("invalid tag titles have been provided")
+	ErrInvalidUsername   = errors.New("invalid username has been provided")
+)
+
+var (
+	WrappedErrors      = map[error]string{ErrInvalidTagTitles: "bad_Tagtitles"}
+	ErrCodeCompability = map[error]string{
+		ErrInvalidBoardTitle:     "bad_boardTitle",
+		ErrEmptyTitle:            "empty_boardTitle",
+		ErrEmptyPubOpt:           "bad_pubOpt",
+		ErrInvalidUsername:       "bad_username",
+		bCase.ErrInvalidUsername: "non_existingUser",
+		bCase.ErrNoSuchBoard:     "no_board",
+		bCase.ErrNoAccess:        "no_access",
+		bCase.ErrNoPinOnBoard:    "no_pin",
+	}
+)
+
+func GetErrCodeMessage(err error) (string, string) {
+	var (
+		code              string
+		general, specific bool
+	)
+
+	code, general = generalErrCodeCompability[err]
+	if general {
+		return code, err.Error()
+	}
+
+	code, specific = ErrCodeCompability[err]
+	if !specific {
+		for wrappedErr, code_ := range WrappedErrors {
+			if errors.Is(err, wrappedErr) {
+				specific = true
+				code = code_
+			}
+		}
+	}
+	if specific {
+		return code, err.Error()
+	}
+
+	return ErrInternalError.Error(), generalErrCodeCompability[ErrInternalError]
+}
diff --git a/internal/pkg/delivery/http/v1/errors/general.go b/internal/pkg/delivery/http/v1/errors/general.go
new file mode 100644
index 0000000..d60b0c3
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/errors/general.go
@@ -0,0 +1,111 @@
+package errors
+
+import (
+	"errors"
+	"fmt"
+	"net/http"
+
+	errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+)
+
+// for backward compatibility - begin
+var (
+	ErrBadBody        = errors.New("can't parse body, JSON with correct data types is expected")
+	ErrBadUrlParam    = errors.New("bad URL param has been provided")
+	ErrBadQueryParam  = errors.New("invalid query parameters have been provided")
+	ErrInternalError  = errors.New("internal server error occured")
+	ErrBadContentType = errors.New("application/json is expected")
+)
+
+var (
+	generalErrCodeCompability = map[error]string{
+		ErrBadBody:        "bad_body",
+		ErrBadQueryParam:  "bad_queryParams",
+		ErrInternalError:  "internal_error",
+		ErrBadContentType: "bad_contentType",
+		ErrBadUrlParam:    "bad_urlParam",
+	}
+)
+
+// for backward compatibility - end
+
+type ErrInvalidBody struct{}
+
+func (e *ErrInvalidBody) Error() string {
+	return "invalid body"
+}
+
+func (e *ErrInvalidBody) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrInvalidQueryParam struct {
+	Params map[string]string
+}
+
+func (e *ErrInvalidQueryParam) Error() string {
+	return fmt.Sprintf("invalid query params: %v", e.Params)
+}
+
+func (e *ErrInvalidQueryParam) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrInvalidContentType struct {
+	PreferredType string
+}
+
+func (e *ErrInvalidContentType) Error() string {
+	return fmt.Sprintf("invalid content type, should be %s", e.PreferredType)
+}
+
+func (e *ErrInvalidContentType) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrInvalidUrlParams struct {
+	Params map[string]string
+}
+
+func (e *ErrInvalidUrlParams) Error() string {
+	return fmt.Sprintf("invalid URL params: %v", e.Params)
+}
+
+func (e *ErrInvalidUrlParams) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrMissingBodyParams struct {
+	Params []string
+}
+
+func (e *ErrMissingBodyParams) Error() string {
+	return fmt.Sprintf("missing body params: %v", e.Params)
+}
+
+func (e *ErrMissingBodyParams) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+func GetCodeStatusHttp(err error) (ErrCode string, httpStatus int) {
+
+	var declaredErr errPkg.DeclaredError
+	if errors.As(err, &declaredErr) {
+		switch declaredErr.Type() {
+		case errPkg.ErrInvalidInput:
+			return "bad_input", http.StatusBadRequest
+		case errPkg.ErrNotFound:
+			return "not_found", http.StatusNotFound
+		case errPkg.ErrAlreadyExists:
+			return "already_exists", http.StatusConflict
+		case errPkg.ErrNoAuth:
+			return "no_auth", http.StatusUnauthorized
+		case errPkg.ErrNoAccess:
+			return "no_access", http.StatusForbidden
+		case errPkg.ErrTimeout:
+			return "timeout", http.StatusRequestTimeout
+		}
+	}
+
+	return "internal_error", http.StatusInternalServerError
+}
diff --git a/internal/pkg/delivery/http/v1/errors/search.go b/internal/pkg/delivery/http/v1/errors/search.go
new file mode 100644
index 0000000..74abdec
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/errors/search.go
@@ -0,0 +1,23 @@
+package errors
+
+import errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+
+type ErrNoData struct{}
+
+func (e *ErrNoData) Error() string {
+	return "Can't find any user/board/pin"
+}
+
+func (e *ErrNoData) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
+
+type ErrInvalidTemplate struct{}
+
+func (e *ErrInvalidTemplate) Error() string {
+	return "Invalid template has been provided"
+}
+
+func (e *ErrInvalidTemplate) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
diff --git a/internal/pkg/delivery/http/v1/feed.go b/internal/pkg/delivery/http/v1/feed.go
index 4a32690..02d71a1 100644
--- a/internal/pkg/delivery/http/v1/feed.go
+++ b/internal/pkg/delivery/http/v1/feed.go
@@ -8,8 +8,8 @@ import (
 	"strconv"
 
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
-	usecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/pin"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
 )
 
@@ -17,7 +17,7 @@ func (h *HandlerHTTP) FeedPins(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
 	userID, isAuth := r.Context().Value(auth.KeyCurrentUserID).(int)
 	if !isAuth {
-		userID = usecase.UserUnknown
+		userID = user.UserUnknown
 	}
 
 	logger.Info("request on getting feed of pins", log.F{"rawQuery", r.URL.RawQuery})
diff --git a/internal/pkg/delivery/http/v1/handler.go b/internal/pkg/delivery/http/v1/handler.go
index 2500fb1..ef7cf15 100644
--- a/internal/pkg/delivery/http/v1/handler.go
+++ b/internal/pkg/delivery/http/v1/handler.go
@@ -1,27 +1,52 @@
 package v1
 
 import (
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/auth"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/board"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/message"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/pin"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/search"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/subscription"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
 )
 
 type HandlerHTTP struct {
-	log       *logger.Logger
-	userCase  user.Usecase
-	pinCase   pin.Usecase
-	boardCase board.Usecase
-	sm        session.SessionManager
+	log         *logger.Logger
+	converter   converterHTTP
+	authCase    auth.Usecase
+	userCase    user.Usecase
+	pinCase     pin.Usecase
+	boardCase   board.Usecase
+	subCase     subscription.Usecase
+	searchCase  search.Usecase
+	messageCase message.Usecase
+	commentCase comment.Usecase
 }
 
-func New(log *logger.Logger, sm session.SessionManager, user user.Usecase, pin pin.Usecase, board board.Usecase) *HandlerHTTP {
+func New(log *logger.Logger, converter converterHTTP, hub UsecaseHub) *HandlerHTTP {
 	return &HandlerHTTP{
-		log:       log,
-		userCase:  user,
-		pinCase:   pin,
-		boardCase: board,
-		sm:        sm,
+		log:         log,
+		converter:   converter,
+		authCase:    hub.AuhtCase,
+		userCase:    hub.UserCase,
+		pinCase:     hub.PinCase,
+		boardCase:   hub.BoardCase,
+		subCase:     hub.SubscriptionCase,
+		searchCase:  hub.SearchCase,
+		messageCase: hub.MessageCase,
+		commentCase: hub.CommentCase,
 	}
 }
+
+type UsecaseHub struct {
+	AuhtCase         auth.Usecase
+	UserCase         user.Usecase
+	PinCase          pin.Usecase
+	BoardCase        board.Usecase
+	SubscriptionCase subscription.Usecase
+	SearchCase       search.Usecase
+	MessageCase      message.Usecase
+	CommentCase      comment.Usecase
+}
diff --git a/internal/pkg/delivery/http/v1/parse.go b/internal/pkg/delivery/http/v1/parse.go
new file mode 100644
index 0000000..d200898
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/parse.go
@@ -0,0 +1,25 @@
+package v1
+
+import (
+	"encoding/json"
+	"fmt"
+	"net/http"
+	"strconv"
+
+	"github.com/go-chi/chi/v5"
+)
+
+func fetchURLParamInt(r *http.Request, param string) (int, error) {
+	paramInt64, err := strconv.ParseInt(chi.URLParam(r, param), 10, 64)
+	if err != nil {
+		return 0, fmt.Errorf("fetch integer param from query request %s: %w", r.URL.RawQuery, err)
+	}
+	return int(paramInt64), nil
+}
+
+func decodeBody(r *http.Request, v any) error {
+	if err := json.NewDecoder(r.Body).Decode(v); err != nil {
+		return fmt.Errorf("decode body: %w", err)
+	}
+	return nil
+}
diff --git a/internal/pkg/delivery/http/v1/pin.go b/internal/pkg/delivery/http/v1/pin.go
index be7c2c9..783f811 100644
--- a/internal/pkg/delivery/http/v1/pin.go
+++ b/internal/pkg/delivery/http/v1/pin.go
@@ -1,16 +1,17 @@
 package v1
 
 import (
-	"encoding/json"
 	"net/http"
 	"strconv"
 	"strings"
 
 	chi "github.com/go-chi/chi/v5"
+	"github.com/mailru/easyjson"
 
 	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	img "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/image"
 	usecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/pin"
 )
 
@@ -73,7 +74,11 @@ func (h *HandlerHTTP) CreateNewPin(w http.ResponseWriter, r *http.Request) {
 	err = h.pinCase.CreateNewPin(r.Context(), newPin, mime.Header.Get("Content-Type"), mime.Size, picture)
 	if err != nil {
 		logger.Error(err.Error())
-		err = responseError(w, "add_pin", "failed to create pin")
+		if err == img.ErrExplicitImage {
+			err = responseError(w, "explicit_pin", err.Error())
+		} else {
+			err = responseError(w, "add_pin", "failed to create pin")
+		}
 	} else {
 		err = responseOk(http.StatusCreated, w, "pin successfully created", nil)
 	}
@@ -129,8 +134,7 @@ func (h *HandlerHTTP) EditPin(w http.ResponseWriter, r *http.Request) {
 	_, _ = userID, pinID
 
 	pinUpdate := &usecase.PinUpdateData{}
-
-	err = json.NewDecoder(r.Body).Decode(pinUpdate)
+	err = easyjson.UnmarshalFromReader(r.Body, pinUpdate)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info(err.Error())
@@ -168,14 +172,14 @@ func (h *HandlerHTTP) ViewPin(w http.ResponseWriter, r *http.Request) {
 
 	userID, ok := r.Context().Value(auth.KeyCurrentUserID).(int)
 	if !ok {
-		userID = usecase.UserUnknown
+		userID = user.UserUnknown
 	}
 	pin, err := h.pinCase.ViewAnPin(r.Context(), int(pinID), userID)
 	if err != nil {
 		logger.Error(err.Error())
 		err = responseError(w, "edit_pin", "internal error")
 	} else {
-		err = responseOk(http.StatusOK, w, "pin was successfully received", pin)
+		err = responseOk(http.StatusOK, w, "pin was successfully received", h.converter.ToPinFromService(pin))
 	}
 	if err != nil {
 		logger.Error(err.Error())
diff --git a/internal/pkg/delivery/http/v1/pin_test.go b/internal/pkg/delivery/http/v1/pin_test.go
index 9f5bf20..358d6d2 100644
--- a/internal/pkg/delivery/http/v1/pin_test.go
+++ b/internal/pkg/delivery/http/v1/pin_test.go
@@ -9,6 +9,7 @@ import (
 	"strconv"
 	"testing"
 
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
 	pinCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/pin"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
@@ -30,11 +31,11 @@ func TestGetPins(t *testing.T) {
 
 	badCases := []struct {
 		rawURL  string
-		expResp JsonErrResponse
+		expResp structs.JsonErrResponse
 	}{
 		{
 			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 0, 3),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -42,7 +43,7 @@ func TestGetPins(t *testing.T) {
 		},
 		{
 			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, -2, 3),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -50,7 +51,7 @@ func TestGetPins(t *testing.T) {
 		},
 		{
 			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 213123, 3),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -58,7 +59,7 @@ func TestGetPins(t *testing.T) {
 		},
 		{
 			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 0, -1),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -66,7 +67,7 @@ func TestGetPins(t *testing.T) {
 		},
 		{
 			rawURL: fmt.Sprintf("%s?count=&lastID=%d", rawUrl, 3),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -74,7 +75,7 @@ func TestGetPins(t *testing.T) {
 		},
 		{
 			rawURL: fmt.Sprintf("%s?lastID=%d", rawUrl, 3),
-			expResp: JsonErrResponse{
+			expResp: structs.JsonErrResponse{
 				Status:  "error",
 				Message: "expected parameters: count(positive integer: [1; 1000]), maxID, minID(positive integers, the absence of these parameters is equal to the value 0)",
 				Code:    "bad_params",
@@ -90,7 +91,7 @@ func TestGetPins(t *testing.T) {
 
 			resp := w.Result()
 			body, _ := io.ReadAll(resp.Body)
-			var actualResp JsonErrResponse
+			var actualResp structs.JsonErrResponse
 
 			json.Unmarshal(body, &actualResp)
 			require.Equal(t, tCase.expResp, actualResp)
diff --git a/internal/pkg/delivery/http/v1/profile.go b/internal/pkg/delivery/http/v1/profile.go
index 4a58a3d..7e812f6 100644
--- a/internal/pkg/delivery/http/v1/profile.go
+++ b/internal/pkg/delivery/http/v1/profile.go
@@ -1,22 +1,48 @@
 package v1
 
 import (
-	"encoding/json"
 	"fmt"
 	"net/http"
+	"strconv"
 
+	"github.com/go-chi/chi/v5"
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/mailru/easyjson"
 )
 
+func (h *HandlerHTTP) GetUserInfo(w http.ResponseWriter, r *http.Request) {
+	userIdParam := chi.URLParam(r, "userID")
+	userID, err := strconv.ParseInt(userIdParam, 10, 64)
+	if err != nil {
+		h.responseErr(w, r, &errHTTP.ErrInvalidUrlParams{Params: map[string]string{"userID": userIdParam}})
+		return
+	}
+
+	if user, isSubscribed, subsCount, err := h.userCase.GetUserInfo(r.Context(), int(userID)); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got user info successfully", h.converter.ToUserInfoFromService(user, isSubscribed, subsCount)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func (h *HandlerHTTP) GetProfileHeaderInfo(w http.ResponseWriter, r *http.Request) {
+	if user, subsCount, err := h.userCase.GetProfileInfo(r.Context()); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got profile info successfully", h.converter.ToProfileInfoFromService(user, subsCount)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
 func (h *HandlerHTTP) ProfileEditInfo(w http.ResponseWriter, r *http.Request) {
 	logger := h.getRequestLogger(r)
 
 	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
 
 	data := &user.ProfileUpdateData{}
-	err := json.NewDecoder(r.Body).Decode(data)
+	err := easyjson.UnmarshalFromReader(r.Body, data)
 	defer r.Body.Close()
 	if err != nil {
 		logger.Info("json decode: " + err.Error())
@@ -98,7 +124,7 @@ func (h *HandlerHTTP) GetProfileInfo(w http.ResponseWriter, r *http.Request) {
 		logger.Error(err.Error())
 		err = responseError(w, "get_info", "failed to get user information")
 	} else {
-		err = responseOk(http.StatusOK, w, "user data has been successfully received", user)
+		err = responseOk(http.StatusOK, w, "user data has been successfully received", h.converter.ToUserFromService(user))
 	}
 
 	if err != nil {
diff --git a/internal/pkg/delivery/http/v1/profile_test.go b/internal/pkg/delivery/http/v1/profile_test.go
index d927e7f..5c87e00 100644
--- a/internal/pkg/delivery/http/v1/profile_test.go
+++ b/internal/pkg/delivery/http/v1/profile_test.go
@@ -11,6 +11,7 @@ import (
 	"github.com/golang/mock/gomock"
 	"github.com/stretchr/testify/require"
 
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/user/mock"
@@ -47,11 +48,11 @@ func TestGetProfileInfo(t *testing.T) {
 	res := rec.Result()
 	defer res.Body.Close()
 
-	actualBody := JsonResponse{Body: &user.User{}}
+	actualBody := structs.JsonResponse{Body: &user.User{}}
 	err = json.NewDecoder(res.Body).Decode(&actualBody)
 	require.NoError(t, err)
 	fmt.Println(actualBody.Body)
-	wantBody := JsonResponse{
+	wantBody := structs.JsonResponse{
 		Status:  "ok",
 		Message: "user data has been successfully received",
 		Body:    &wantUser,
diff --git a/internal/pkg/delivery/http/v1/response.go b/internal/pkg/delivery/http/v1/response.go
index ba0b3bd..7b77059 100644
--- a/internal/pkg/delivery/http/v1/response.go
+++ b/internal/pkg/delivery/http/v1/response.go
@@ -1,53 +1,26 @@
 package v1
 
 import (
-	"encoding/json"
-	"errors"
 	"fmt"
 	"net/http"
-)
 
-var (
-	ErrBadBody        = errors.New("can't parse body, JSON with correct data types is expected")
-	ErrBadUrlParam    = errors.New("bad URL param has been provided")
-	ErrBadQueryParam  = errors.New("invalid query parameters have been provided")
-	ErrInternalError  = errors.New("internal server error occured")
-	ErrBadContentType = errors.New("application/json is expected")
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"github.com/mailru/easyjson"
 )
 
-var (
-	generalErrCodeCompability = map[error]string{
-		ErrBadBody:        "bad_body",
-		ErrBadQueryParam:  "bad_queryParams",
-		ErrInternalError:  "internal_error",
-		ErrBadContentType: "bad_contentType",
-		ErrBadUrlParam:    "bad_urlParam",
-	}
-)
-
-type JsonResponse struct {
-	Status  string      `json:"status" example:"ok"`
-	Message string      `json:"message" example:"Response message"`
-	Body    interface{} `json:"body" extensions:"x-omitempty"`
-} // @name JsonResponse
-
-type JsonErrResponse struct {
-	Status  string `json:"status" example:"error"`
-	Message string `json:"message" example:"Error description"`
-	Code    string `json:"code"`
-} // @name JsonErrResponse
-
 func SetContentTypeJSON(w http.ResponseWriter) {
 	w.Header().Set("Content-Type", "application/json")
 }
 
 func responseOk(statusCode int, w http.ResponseWriter, message string, body any) error {
-	res := JsonResponse{
+	res := structs.JsonResponse{
 		Status:  "ok",
 		Message: message,
 		Body:    body,
 	}
-	resBytes, err := json.Marshal(res)
+	resBytes, err := easyjson.Marshal(res)
 	if err != nil {
 		w.WriteHeader(http.StatusInternalServerError)
 		return fmt.Errorf("responseOk: %w", err)
@@ -59,15 +32,41 @@ func responseOk(statusCode int, w http.ResponseWriter, message string, body any)
 }
 
 func responseError(w http.ResponseWriter, code, message string) error {
-	res := JsonErrResponse{
+	res := structs.JsonErrResponse{
 		Status:  "error",
 		Message: message,
 		Code:    code,
 	}
-	resBytes, err := json.Marshal(res)
+	resBytes, err := easyjson.Marshal(res)
+	if err != nil {
+		return fmt.Errorf("responseError: %w", err)
+	}
+	_, err = w.Write(resBytes)
+	return err
+}
+
+func (h *HandlerHTTP) responseErr(w http.ResponseWriter, r *http.Request, err error) error {
+	log := logger.GetLoggerFromCtx(r.Context())
+
+	code, status := errHTTP.GetCodeStatusHttp(err)
+	var msg string
+	if status == http.StatusInternalServerError {
+		log.Warnf("unexpected application error: %s", err.Error())
+		msg = "internal error occured"
+	} else {
+		msg = err.Error()
+	}
+
+	res := structs.JsonErrResponse{
+		Status:  "error",
+		Message: msg,
+		Code:    code,
+	}
+	resBytes, err := easyjson.Marshal(res)
 	if err != nil {
 		return fmt.Errorf("responseError: %w", err)
 	}
+	w.WriteHeader(status)
 	_, err = w.Write(resBytes)
 	return err
 }
diff --git a/internal/pkg/delivery/http/v1/search.go b/internal/pkg/delivery/http/v1/search.go
new file mode 100644
index 0000000..ae72332
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/search.go
@@ -0,0 +1,162 @@
+package v1
+
+import (
+	"net/http"
+	"strconv"
+
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+)
+
+var (
+	defaultSearchCount  = 20
+	maxSearchCount      = 50
+	defaultSearchOffset = 0
+	maxSearchOffset     = 50
+)
+
+var (
+	userSortOpts  = []string{"id", "subscribers"}
+	boardSortOpts = []string{"id", "pins"}
+	pinSortOpts   = []string{"id", "likes"}
+)
+
+var (
+	defaultSearchSort = "id"
+	defaultSortOder   = "desc"
+)
+
+func (h *HandlerHTTP) SearchUsers(w http.ResponseWriter, r *http.Request) {
+	opts, err := GetSearchOpts(r, userSortOpts, defaultSearchSort)
+	if err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	if users, err := h.searchCase.GetUsers(r.Context(), opts); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got users sucessfully", h.converter.ToUsersForSearchFromService(users)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func (h *HandlerHTTP) SearchBoards(w http.ResponseWriter, r *http.Request) {
+	opts, err := GetSearchOpts(r, boardSortOpts, defaultSearchSort)
+	if err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	if boards, err := h.searchCase.GetBoards(r.Context(), opts); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got boards sucessfully", h.converter.ToBoardsForSearchFromService(boards)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func (h *HandlerHTTP) SearchPins(w http.ResponseWriter, r *http.Request) {
+	opts, err := GetSearchOpts(r, pinSortOpts, defaultSearchSort)
+	if err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	if pins, err := h.searchCase.GetPins(r.Context(), opts); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got pins sucessfully", h.converter.ToPinsForSearchFromService(pins)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func GetSearchOpts(r *http.Request, sortOpts []string, defaultSortOpt string) (*search.SearchOpts, error) {
+	opts := &search.SearchOpts{}
+	invalidParams := map[string]string{}
+
+	generalOpts, err := GetGeneralOpts(r, invalidParams)
+	if err != nil {
+		return nil, err
+	}
+	opts.General = *generalOpts
+
+	if sortBy := r.URL.Query().Get("sortBy"); sortBy != "" {
+		if !isCorrentSortOpt(sortOpts, sortBy) {
+			invalidParams["sortBy"] = sortBy
+		} else {
+			opts.SortBy = sortBy
+		}
+	} else {
+		opts.SortBy = defaultSortOpt
+	}
+
+	if len(invalidParams) > 0 {
+		return nil, &errHTTP.ErrInvalidQueryParam{Params: invalidParams}
+	}
+
+	return opts, nil
+}
+
+func isCorrentSortOpt(correctOpts []string, opt string) bool {
+	for _, correctOpt := range correctOpts {
+		if opt == correctOpt {
+			return true
+		}
+	}
+	return false
+}
+
+func GetGeneralOpts(r *http.Request, invalidParams map[string]string) (*search.GeneralOpts, error) {
+	opts := &search.GeneralOpts{}
+
+	if templateParam := r.URL.Query().Get("template"); templateParam != "" {
+		if template := search.Template(templateParam); !template.Validate() {
+			invalidParams["template"] = string(template)
+		} else {
+			opts.Template = template
+		}
+	} else {
+		return nil, &errHTTP.ErrNoData{}
+	}
+
+	if sortOrder := r.URL.Query().Get("order"); sortOrder != "" {
+		if sortOrder != "asc" && sortOrder != "desc" {
+			invalidParams["order"] = sortOrder
+		} else {
+			opts.SortOrder = sortOrder
+		}
+	} else {
+		opts.SortOrder = defaultSortOder
+	}
+
+	if countParam := r.URL.Query().Get("count"); countParam != "" {
+		if count, err := strconv.ParseInt(countParam, 10, 64); err != nil || count < 0 {
+			invalidParams["count"] = countParam
+		} else {
+			opts.Count = int(count)
+		}
+	} else {
+		opts.Count = defaultSearchCount
+	}
+
+	if offsetParam := r.URL.Query().Get("offset"); offsetParam != "" {
+		if offset, err := strconv.ParseInt(offsetParam, 10, 64); err != nil || offset < 0 {
+			invalidParams["offset"] = offsetParam
+		} else {
+			opts.Offset = int(offset)
+		}
+	} else {
+		opts.Offset = defaultSearchOffset
+	}
+
+	if opts.Count > maxSearchCount {
+		opts.Count = maxSearchCount
+	}
+	if opts.Offset > maxSearchOffset {
+		opts.Offset = maxSearchOffset
+	}
+
+	userID, _ := r.Context().Value(auth.KeyCurrentUserID).(int)
+	opts.CurrUserID = userID
+
+	return opts, nil
+}
diff --git a/internal/pkg/delivery/http/v1/structs/board.go b/internal/pkg/delivery/http/v1/structs/board.go
new file mode 100644
index 0000000..4c04755
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/board.go
@@ -0,0 +1,136 @@
+package structs
+
+import (
+	"fmt"
+	"unicode"
+
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+//go:generate easyjson board.go
+
+// data for board creation/update
+//
+//easyjson:json
+type BoardData struct {
+	Title       *string  `json:"title" example:"new board"`
+	Description *string  `json:"description" example:"long desc"`
+	Public      *bool    `json:"public" example:"true"`
+	Tags        []string `json:"tags" example:"['blue', 'car']"`
+}
+
+// board view for delivery layer
+//
+//easyjson:json
+type CertainBoard struct {
+	ID          int      `json:"board_id" example:"22"`
+	AuthorID    int      `json:"author_id" example:"22"`
+	Title       string   `json:"title" example:"new board"`
+	Description string   `json:"description" example:"long desc"`
+	CreatedAt   string   `json:"created_at" example:"07-11-2023"`
+	PinsNumber  int      `json:"pins_number" example:"12"`
+	Pins        []string `json:"pins" example:"['/pic1', '/pic2']"`
+	Tags        []string `json:"tags" example:"['love', 'green']"`
+}
+
+//easyjson:json
+type CertainBoardWithUsername struct {
+	ID             int      `json:"board_id" example:"22"`
+	AuthorID       int      `json:"author_id" example:"22"`
+	AuthorUsername string   `json:"author_username" example:"Bob"`
+	Title          string   `json:"title" example:"new board"`
+	Description    string   `json:"description" example:"long desc"`
+	CreatedAt      string   `json:"created_at" example:"07-11-2023"`
+	PinsNumber     int      `json:"pins_number" example:"12"`
+	Pins           []string `json:"pins" example:"['/pic1', '/pic2']"`
+	Tags           []string `json:"tags" example:"['love', 'green']"`
+}
+
+func (b *CertainBoard) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if b != nil {
+		b.Title = sanitizer.Sanitize(censor.Sanitize(b.Title))
+		b.Description = sanitizer.Sanitize(censor.Sanitize(b.Description))
+		for id, title := range b.Tags {
+			b.Tags[id] = sanitizer.Sanitize(censor.Sanitize(title))
+		}
+	}
+}
+
+func (b *CertainBoardWithUsername) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if b != nil {
+		b.Title = sanitizer.Sanitize(censor.Sanitize(b.Title))
+		b.Description = sanitizer.Sanitize(censor.Sanitize(b.Description))
+		b.AuthorUsername = sanitizer.Sanitize(censor.Sanitize(b.AuthorUsername))
+		for id, title := range b.Tags {
+			b.Tags[id] = sanitizer.Sanitize(censor.Sanitize(title))
+		}
+	}
+}
+
+//easyjson:json
+type DeletePinFromBoard struct {
+	PinID int `json:"pin_id" example:"22"`
+}
+
+func (data *BoardData) Validate() error {
+	if data.Title == nil || *data.Title == "" {
+		return errHTTP.ErrInvalidBoardTitle
+	}
+	if data.Description == nil {
+		data.Description = new(string)
+		*data.Description = ""
+	}
+	if data.Public == nil {
+		return errHTTP.ErrEmptyPubOpt
+	}
+	if !isValidBoardTitle(*data.Title) {
+		return errHTTP.ErrInvalidBoardTitle
+	}
+	if err := checkIsValidTagTitles(data.Tags); err != nil {
+		return fmt.Errorf("%s: %w", err.Error(), errHTTP.ErrInvalidTagTitles)
+	}
+	return nil
+}
+
+func isValidTagTitle(title string) bool {
+	if len(title) > 20 {
+		return false
+	}
+
+	for _, sym := range title {
+		if !(unicode.IsNumber(sym) || unicode.IsLetter(sym) || unicode.IsPunct(sym) || unicode.IsSpace(sym)) {
+			return false
+		}
+	}
+	return true
+}
+
+func checkIsValidTagTitles(titles []string) error {
+	if len(titles) > 7 {
+		return fmt.Errorf("too many titles")
+	}
+
+	invalidTitles := make([]string, 0)
+	for _, title := range titles {
+		if !isValidTagTitle(title) {
+			invalidTitles = append(invalidTitles, title)
+		}
+	}
+	if len(invalidTitles) > 0 {
+		return fmt.Errorf("%v", invalidTitles)
+	}
+	return nil
+}
+
+func isValidBoardTitle(title string) bool {
+	if len(title) == 0 || len(title) > 40 {
+		return false
+	}
+	for _, sym := range title {
+		if !(unicode.IsNumber(sym) || unicode.IsLetter(sym) || unicode.IsPunct(sym) || unicode.IsSpace(sym)) {
+			return false
+		}
+	}
+	return true
+}
diff --git a/internal/pkg/delivery/http/v1/structs/board_easyjson.go b/internal/pkg/delivery/http/v1/structs/board_easyjson.go
new file mode 100644
index 0000000..b847d66
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/board_easyjson.go
@@ -0,0 +1,605 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package structs
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(in *jlexer.Lexer, out *DeletePinFromBoard) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "pin_id":
+			out.PinID = int(in.Int())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(out *jwriter.Writer, in DeletePinFromBoard) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"pin_id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.PinID))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v DeletePinFromBoard) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v DeletePinFromBoard) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *DeletePinFromBoard) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *DeletePinFromBoard) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(l, v)
+}
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(in *jlexer.Lexer, out *CertainBoardWithUsername) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "board_id":
+			out.ID = int(in.Int())
+		case "author_id":
+			out.AuthorID = int(in.Int())
+		case "author_username":
+			out.AuthorUsername = string(in.String())
+		case "title":
+			out.Title = string(in.String())
+		case "description":
+			out.Description = string(in.String())
+		case "created_at":
+			out.CreatedAt = string(in.String())
+		case "pins_number":
+			out.PinsNumber = int(in.Int())
+		case "pins":
+			if in.IsNull() {
+				in.Skip()
+				out.Pins = nil
+			} else {
+				in.Delim('[')
+				if out.Pins == nil {
+					if !in.IsDelim(']') {
+						out.Pins = make([]string, 0, 4)
+					} else {
+						out.Pins = []string{}
+					}
+				} else {
+					out.Pins = (out.Pins)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v1 string
+					v1 = string(in.String())
+					out.Pins = append(out.Pins, v1)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		case "tags":
+			if in.IsNull() {
+				in.Skip()
+				out.Tags = nil
+			} else {
+				in.Delim('[')
+				if out.Tags == nil {
+					if !in.IsDelim(']') {
+						out.Tags = make([]string, 0, 4)
+					} else {
+						out.Tags = []string{}
+					}
+				} else {
+					out.Tags = (out.Tags)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v2 string
+					v2 = string(in.String())
+					out.Tags = append(out.Tags, v2)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(out *jwriter.Writer, in CertainBoardWithUsername) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"board_id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"author_id\":"
+		out.RawString(prefix)
+		out.Int(int(in.AuthorID))
+	}
+	{
+		const prefix string = ",\"author_username\":"
+		out.RawString(prefix)
+		out.String(string(in.AuthorUsername))
+	}
+	{
+		const prefix string = ",\"title\":"
+		out.RawString(prefix)
+		out.String(string(in.Title))
+	}
+	{
+		const prefix string = ",\"description\":"
+		out.RawString(prefix)
+		out.String(string(in.Description))
+	}
+	{
+		const prefix string = ",\"created_at\":"
+		out.RawString(prefix)
+		out.String(string(in.CreatedAt))
+	}
+	{
+		const prefix string = ",\"pins_number\":"
+		out.RawString(prefix)
+		out.Int(int(in.PinsNumber))
+	}
+	{
+		const prefix string = ",\"pins\":"
+		out.RawString(prefix)
+		if in.Pins == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v3, v4 := range in.Pins {
+				if v3 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v4))
+			}
+			out.RawByte(']')
+		}
+	}
+	{
+		const prefix string = ",\"tags\":"
+		out.RawString(prefix)
+		if in.Tags == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v5, v6 := range in.Tags {
+				if v5 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v6))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CertainBoardWithUsername) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CertainBoardWithUsername) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CertainBoardWithUsername) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CertainBoardWithUsername) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(l, v)
+}
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(in *jlexer.Lexer, out *CertainBoard) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "board_id":
+			out.ID = int(in.Int())
+		case "author_id":
+			out.AuthorID = int(in.Int())
+		case "title":
+			out.Title = string(in.String())
+		case "description":
+			out.Description = string(in.String())
+		case "created_at":
+			out.CreatedAt = string(in.String())
+		case "pins_number":
+			out.PinsNumber = int(in.Int())
+		case "pins":
+			if in.IsNull() {
+				in.Skip()
+				out.Pins = nil
+			} else {
+				in.Delim('[')
+				if out.Pins == nil {
+					if !in.IsDelim(']') {
+						out.Pins = make([]string, 0, 4)
+					} else {
+						out.Pins = []string{}
+					}
+				} else {
+					out.Pins = (out.Pins)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v7 string
+					v7 = string(in.String())
+					out.Pins = append(out.Pins, v7)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		case "tags":
+			if in.IsNull() {
+				in.Skip()
+				out.Tags = nil
+			} else {
+				in.Delim('[')
+				if out.Tags == nil {
+					if !in.IsDelim(']') {
+						out.Tags = make([]string, 0, 4)
+					} else {
+						out.Tags = []string{}
+					}
+				} else {
+					out.Tags = (out.Tags)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v8 string
+					v8 = string(in.String())
+					out.Tags = append(out.Tags, v8)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(out *jwriter.Writer, in CertainBoard) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"board_id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"author_id\":"
+		out.RawString(prefix)
+		out.Int(int(in.AuthorID))
+	}
+	{
+		const prefix string = ",\"title\":"
+		out.RawString(prefix)
+		out.String(string(in.Title))
+	}
+	{
+		const prefix string = ",\"description\":"
+		out.RawString(prefix)
+		out.String(string(in.Description))
+	}
+	{
+		const prefix string = ",\"created_at\":"
+		out.RawString(prefix)
+		out.String(string(in.CreatedAt))
+	}
+	{
+		const prefix string = ",\"pins_number\":"
+		out.RawString(prefix)
+		out.Int(int(in.PinsNumber))
+	}
+	{
+		const prefix string = ",\"pins\":"
+		out.RawString(prefix)
+		if in.Pins == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v9, v10 := range in.Pins {
+				if v9 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v10))
+			}
+			out.RawByte(']')
+		}
+	}
+	{
+		const prefix string = ",\"tags\":"
+		out.RawString(prefix)
+		if in.Tags == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v11, v12 := range in.Tags {
+				if v11 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v12))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v CertainBoard) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v CertainBoard) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *CertainBoard) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *CertainBoard) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs2(l, v)
+}
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(in *jlexer.Lexer, out *BoardData) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "title":
+			if in.IsNull() {
+				in.Skip()
+				out.Title = nil
+			} else {
+				if out.Title == nil {
+					out.Title = new(string)
+				}
+				*out.Title = string(in.String())
+			}
+		case "description":
+			if in.IsNull() {
+				in.Skip()
+				out.Description = nil
+			} else {
+				if out.Description == nil {
+					out.Description = new(string)
+				}
+				*out.Description = string(in.String())
+			}
+		case "public":
+			if in.IsNull() {
+				in.Skip()
+				out.Public = nil
+			} else {
+				if out.Public == nil {
+					out.Public = new(bool)
+				}
+				*out.Public = bool(in.Bool())
+			}
+		case "tags":
+			if in.IsNull() {
+				in.Skip()
+				out.Tags = nil
+			} else {
+				in.Delim('[')
+				if out.Tags == nil {
+					if !in.IsDelim(']') {
+						out.Tags = make([]string, 0, 4)
+					} else {
+						out.Tags = []string{}
+					}
+				} else {
+					out.Tags = (out.Tags)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v13 string
+					v13 = string(in.String())
+					out.Tags = append(out.Tags, v13)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(out *jwriter.Writer, in BoardData) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"title\":"
+		out.RawString(prefix[1:])
+		if in.Title == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Title))
+		}
+	}
+	{
+		const prefix string = ",\"description\":"
+		out.RawString(prefix)
+		if in.Description == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Description))
+		}
+	}
+	{
+		const prefix string = ",\"public\":"
+		out.RawString(prefix)
+		if in.Public == nil {
+			out.RawString("null")
+		} else {
+			out.Bool(bool(*in.Public))
+		}
+	}
+	{
+		const prefix string = ",\"tags\":"
+		out.RawString(prefix)
+		if in.Tags == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v14, v15 := range in.Tags {
+				if v14 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v15))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v BoardData) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v BoardData) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *BoardData) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *BoardData) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs3(l, v)
+}
diff --git a/internal/pkg/delivery/http/v1/structs/response.go b/internal/pkg/delivery/http/v1/structs/response.go
new file mode 100644
index 0000000..2be893b
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/response.go
@@ -0,0 +1,17 @@
+package structs
+
+//go:generate easyjson response.go
+
+//easyjson:json
+type JsonResponse struct {
+	Status  string      `json:"status" example:"ok"`
+	Message string      `json:"message" example:"Response message"`
+	Body    interface{} `json:"body" extensions:"x-omitempty"`
+} // @name JsonResponse
+
+//easyjson:json
+type JsonErrResponse struct {
+	Status  string `json:"status" example:"error"`
+	Message string `json:"message" example:"Error description"`
+	Code    string `json:"code"`
+} // @name JsonErrResponse
diff --git a/internal/pkg/delivery/http/v1/structs/response_easyjson.go b/internal/pkg/delivery/http/v1/structs/response_easyjson.go
new file mode 100644
index 0000000..91dfdd8
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/response_easyjson.go
@@ -0,0 +1,191 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package structs
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(in *jlexer.Lexer, out *JsonResponse) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "status":
+			out.Status = string(in.String())
+		case "message":
+			out.Message = string(in.String())
+		case "body":
+			if m, ok := out.Body.(easyjson.Unmarshaler); ok {
+				m.UnmarshalEasyJSON(in)
+			} else if m, ok := out.Body.(json.Unmarshaler); ok {
+				_ = m.UnmarshalJSON(in.Raw())
+			} else {
+				out.Body = in.Interface()
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(out *jwriter.Writer, in JsonResponse) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"status\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Status))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		out.String(string(in.Message))
+	}
+	{
+		const prefix string = ",\"body\":"
+		out.RawString(prefix)
+		if m, ok := in.Body.(easyjson.Marshaler); ok {
+			m.MarshalEasyJSON(out)
+		} else if m, ok := in.Body.(json.Marshaler); ok {
+			out.Raw(m.MarshalJSON())
+		} else {
+			out.Raw(json.Marshal(in.Body))
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v JsonResponse) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v JsonResponse) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *JsonResponse) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *JsonResponse) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(l, v)
+}
+func easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(in *jlexer.Lexer, out *JsonErrResponse) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "status":
+			out.Status = string(in.String())
+		case "message":
+			out.Message = string(in.String())
+		case "code":
+			out.Code = string(in.String())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(out *jwriter.Writer, in JsonErrResponse) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"status\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Status))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		out.String(string(in.Message))
+	}
+	{
+		const prefix string = ",\"code\":"
+		out.RawString(prefix)
+		out.String(string(in.Code))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v JsonErrResponse) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v JsonErrResponse) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6ff3ac1dEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *JsonErrResponse) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *JsonErrResponse) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6ff3ac1dDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(l, v)
+}
diff --git a/internal/pkg/delivery/http/v1/structs/subscription.go b/internal/pkg/delivery/http/v1/structs/subscription.go
new file mode 100644
index 0000000..73bee4d
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/subscription.go
@@ -0,0 +1,17 @@
+package structs
+
+import errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+
+//go:generate easyjson subscription.go
+
+//easyjson:json
+type SubscriptionAction struct {
+	To *int `json:"to" example:"2"`
+}
+
+func (s *SubscriptionAction) Validate() error {
+	if s.To == nil {
+		return &errHTTP.ErrMissingBodyParams{Params: []string{"to"}}
+	}
+	return nil
+}
diff --git a/internal/pkg/delivery/http/v1/structs/subscription_easyjson.go b/internal/pkg/delivery/http/v1/structs/subscription_easyjson.go
new file mode 100644
index 0000000..b1e0fd9
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/subscription_easyjson.go
@@ -0,0 +1,97 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package structs
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjsonFfbd3743DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(in *jlexer.Lexer, out *SubscriptionAction) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "to":
+			if in.IsNull() {
+				in.Skip()
+				out.To = nil
+			} else {
+				if out.To == nil {
+					out.To = new(int)
+				}
+				*out.To = int(in.Int())
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonFfbd3743EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(out *jwriter.Writer, in SubscriptionAction) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"to\":"
+		out.RawString(prefix[1:])
+		if in.To == nil {
+			out.RawString("null")
+		} else {
+			out.Int(int(*in.To))
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SubscriptionAction) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonFfbd3743EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SubscriptionAction) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonFfbd3743EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SubscriptionAction) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonFfbd3743DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SubscriptionAction) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonFfbd3743DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(l, v)
+}
diff --git a/internal/pkg/delivery/http/v1/structs/user.go b/internal/pkg/delivery/http/v1/structs/user.go
new file mode 100644
index 0000000..ab7d8f8
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/user.go
@@ -0,0 +1,42 @@
+package structs
+
+import (
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+//go:generate easyjson user.go
+
+//easyjson:json
+type UserInfo struct {
+	ID           int    `json:"id" example:"123"`
+	Username     string `json:"username" example:"Snapshot"`
+	Avatar       string `json:"avatar" example:"/pic1"`
+	Name         string `json:"name" example:"Bob"`
+	Surname      string `json:"surname" example:"Dylan"`
+	About        string `json:"about" example:"Cool guy"`
+	IsSubscribed bool   `json:"is_subscribed" example:"true"`
+	SubsCount    int    `json:"subscribers" example:"23"`
+}
+
+func (u *UserInfo) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if u != nil {
+		u.Username = sanitizer.Sanitize(censor.Sanitize(u.Username))
+		u.Name = sanitizer.Sanitize(censor.Sanitize(u.Name))
+		u.Surname = sanitizer.Sanitize(censor.Sanitize(u.Surname))
+		u.About = sanitizer.Sanitize(censor.Sanitize(u.About))
+	}
+}
+
+//easyjson:json
+type ProfileInfo struct {
+	ID        int    `json:"id" example:"1"`
+	Username  string `json:"username" example:"baobab"`
+	Avatar    string `json:"avatar" example:"/pic1"`
+	SubsCount int    `json:"subscribers" example:"12"`
+}
+
+func (p *ProfileInfo) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if p != nil {
+		p.Username = sanitizer.Sanitize(censor.Sanitize(p.Username))
+	}
+}
diff --git a/internal/pkg/delivery/http/v1/structs/user_easyjson.go b/internal/pkg/delivery/http/v1/structs/user_easyjson.go
new file mode 100644
index 0000000..e62ee17
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/structs/user_easyjson.go
@@ -0,0 +1,221 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package structs
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(in *jlexer.Lexer, out *UserInfo) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "username":
+			out.Username = string(in.String())
+		case "avatar":
+			out.Avatar = string(in.String())
+		case "name":
+			out.Name = string(in.String())
+		case "surname":
+			out.Surname = string(in.String())
+		case "about":
+			out.About = string(in.String())
+		case "is_subscribed":
+			out.IsSubscribed = bool(in.Bool())
+		case "subscribers":
+			out.SubsCount = int(in.Int())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(out *jwriter.Writer, in UserInfo) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix)
+		out.String(string(in.Username))
+	}
+	{
+		const prefix string = ",\"avatar\":"
+		out.RawString(prefix)
+		out.String(string(in.Avatar))
+	}
+	{
+		const prefix string = ",\"name\":"
+		out.RawString(prefix)
+		out.String(string(in.Name))
+	}
+	{
+		const prefix string = ",\"surname\":"
+		out.RawString(prefix)
+		out.String(string(in.Surname))
+	}
+	{
+		const prefix string = ",\"about\":"
+		out.RawString(prefix)
+		out.String(string(in.About))
+	}
+	{
+		const prefix string = ",\"is_subscribed\":"
+		out.RawString(prefix)
+		out.Bool(bool(in.IsSubscribed))
+	}
+	{
+		const prefix string = ",\"subscribers\":"
+		out.RawString(prefix)
+		out.Int(int(in.SubsCount))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v UserInfo) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v UserInfo) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *UserInfo) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *UserInfo) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs(l, v)
+}
+func easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(in *jlexer.Lexer, out *ProfileInfo) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "username":
+			out.Username = string(in.String())
+		case "avatar":
+			out.Avatar = string(in.String())
+		case "subscribers":
+			out.SubsCount = int(in.Int())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(out *jwriter.Writer, in ProfileInfo) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix)
+		out.String(string(in.Username))
+	}
+	{
+		const prefix string = ",\"avatar\":"
+		out.RawString(prefix)
+		out.String(string(in.Avatar))
+	}
+	{
+		const prefix string = ",\"subscribers\":"
+		out.RawString(prefix)
+		out.Int(int(in.SubsCount))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ProfileInfo) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ProfileInfo) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ProfileInfo) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ProfileInfo) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryHttpV1Structs1(l, v)
+}
diff --git a/internal/pkg/delivery/http/v1/subscription.go b/internal/pkg/delivery/http/v1/subscription.go
new file mode 100644
index 0000000..7e18482
--- /dev/null
+++ b/internal/pkg/delivery/http/v1/subscription.go
@@ -0,0 +1,145 @@
+package v1
+
+import (
+	"net/http"
+	"strconv"
+
+	errHTTP "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/errors"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/delivery/http/v1/structs"
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	"github.com/mailru/easyjson"
+)
+
+var (
+	defaultSubCount   = 20
+	defaultSubLastID  = 1 << 30
+	subscriptionsView = "subscriptions"
+	subscribersView   = "subscribers"
+	maxCount          = 50
+)
+
+func (h *HandlerHTTP) Subscribe(w http.ResponseWriter, r *http.Request) {
+	if contentType := r.Header.Get("Content-Type"); contentType != ApplicationJson {
+		h.responseErr(w, r, &errHTTP.ErrInvalidContentType{PreferredType: ApplicationJson})
+		return
+	}
+
+	sub := structs.SubscriptionAction{}
+
+	if err := easyjson.UnmarshalFromReader(r.Body, &sub); err != nil {
+		h.responseErr(w, r, &errHTTP.ErrInvalidBody{})
+		return
+	}
+	defer r.Body.Close()
+	if err := sub.Validate(); err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	from := r.Context().Value(auth.KeyCurrentUserID).(int)
+	if err := h.subCase.SubscribeToUser(r.Context(), from, *sub.To); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "subscribed successfully", nil); err != nil {
+		h.responseErr(w, r, err)
+	}
+
+}
+
+func (h *HandlerHTTP) Unsubscribe(w http.ResponseWriter, r *http.Request) {
+	if contentType := r.Header.Get("Content-Type"); contentType != ApplicationJson {
+		h.responseErr(w, r, &errHTTP.ErrInvalidContentType{PreferredType: ApplicationJson})
+		return
+	}
+
+	sub := structs.SubscriptionAction{}
+	if err := easyjson.UnmarshalFromReader(r.Body, &sub); err != nil {
+		h.responseErr(w, r, &errHTTP.ErrInvalidBody{})
+		return
+	}
+	defer r.Body.Close()
+	if err := sub.Validate(); err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	from := r.Context().Value(auth.KeyCurrentUserID).(int)
+	if err := h.subCase.UnsubscribeFromUser(r.Context(), from, *sub.To); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "unsubscribed successfully", nil); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func (h *HandlerHTTP) GetSubscriptionInfoForUser(w http.ResponseWriter, r *http.Request) {
+	opts, err := GetOpts(r)
+	if err != nil {
+		h.responseErr(w, r, err)
+		return
+	}
+
+	if users, err := h.subCase.GetSubscriptionInfoForUser(r.Context(), opts); err != nil {
+		h.responseErr(w, r, err)
+	} else if err := responseOk(http.StatusOK, w, "got subscription info successfully", h.converter.ToSubscriptionUsersFromService(users)); err != nil {
+		h.responseErr(w, r, err)
+	}
+}
+
+func GetOpts(r *http.Request) (*userEntity.SubscriptionOpts, error) {
+	opts := &userEntity.SubscriptionOpts{}
+	invalidParams := map[string]string{}
+
+	var (
+		userID, count, lastID int64
+		filter                string
+		err                   error
+	)
+	if userIdParam := r.URL.Query().Get("userID"); userIdParam != "" {
+		if userID, err = strconv.ParseInt(userIdParam, 10, 64); err != nil || userID < 0 {
+			invalidParams["userID"] = userIdParam
+		} else {
+			opts.UserID = int(userID)
+		}
+	} else {
+		opts.UserID, _ = r.Context().Value(auth.KeyCurrentUserID).(int)
+	}
+
+	if countParam := r.URL.Query().Get("count"); countParam != "" {
+		if count, err = strconv.ParseInt(countParam, 10, 64); err != nil || count < 0 {
+			invalidParams["count"] = countParam
+		} else {
+			opts.Count = int(count)
+		}
+	} else {
+		opts.Count = defaultSubCount
+	}
+
+	if lastIdParam := r.URL.Query().Get("lastID"); lastIdParam != "" {
+		if lastID, err = strconv.ParseInt(lastIdParam, 10, 64); err != nil || lastID < 0 {
+			invalidParams["lastID"] = lastIdParam
+		} else {
+			opts.LastID = int(lastID)
+		}
+	} else {
+		opts.LastID = defaultSubLastID
+	}
+
+	if filter = r.URL.Query().Get("view"); filter != "" {
+		if filter != subscriptionsView && filter != subscribersView {
+			invalidParams["view"] = filter
+		} else {
+			opts.Filter = filter
+		}
+	} else {
+		invalidParams["view"] = filter
+	}
+
+	if opts.Count > maxCount {
+		opts.Count = maxCount
+	}
+	if len(invalidParams) > 0 {
+		return nil, &errHTTP.ErrInvalidQueryParam{invalidParams}
+	}
+	return opts, nil
+}
diff --git a/internal/pkg/delivery/http/v1/validation.go b/internal/pkg/delivery/http/v1/validation.go
index 5d8bfb5..9d73fce 100644
--- a/internal/pkg/delivery/http/v1/validation.go
+++ b/internal/pkg/delivery/http/v1/validation.go
@@ -35,32 +35,25 @@ func (b *errorFields) Err() error {
 	return b
 }
 
-func FetchValidParamForLoadTape(u *url.URL) (count int, minID int, maxID int, err error) {
+func FetchValidParamForLoadFeed(u *url.URL) (count, lastID int, err error) {
 	if param := u.Query().Get("count"); len(param) > 0 {
 		c, err := strconv.ParseInt(param, 10, 64)
 		if err != nil {
-			return 0, 0, 0, fmt.Errorf("fetch count param for load tape: %w", err)
+			return 0, 0, fmt.Errorf("fetch count param for load tape: %w", err)
 		}
 		count = int(c)
 	} else {
-		return 0, 0, 0, ErrCountParameterMissing
+		return 0, 0, ErrCountParameterMissing
 	}
-	if param := u.Query().Get("minID"); len(param) > 0 {
+	if param := u.Query().Get("lastID"); len(param) > 0 {
 		id, err := strconv.ParseInt(param, 10, 64)
 		if err != nil {
-			return 0, 0, 0, fmt.Errorf("fetch lastID param for load tape: %w", err)
+			return 0, 0, fmt.Errorf("fetch lastID param for load tape: %w", err)
 		}
-		minID = int(id)
+		lastID = int(id)
 	}
-	if param := u.Query().Get("maxID"); len(param) > 0 {
-		id, err := strconv.ParseInt(param, 10, 64)
-		if err != nil {
-			return 0, 0, 0, fmt.Errorf("fetch lastID param for load tape: %w", err)
-		}
-		maxID = int(id)
-	}
-	if count <= 0 || count > 1000 || minID < 0 || maxID < 0 {
-		return 0, 0, 0, ErrBadParams
+	if count <= 0 || count > 1000 || lastID < 0 {
+		return 0, 0, ErrBadParams
 	}
 	return
 }
diff --git a/internal/pkg/delivery/websocket/chat.go b/internal/pkg/delivery/websocket/chat.go
new file mode 100644
index 0000000..50b0f21
--- /dev/null
+++ b/internal/pkg/delivery/websocket/chat.go
@@ -0,0 +1,114 @@
+package websocket
+
+import (
+	"context"
+	"fmt"
+	"net/http"
+
+	ws "nhooyr.io/websocket"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+)
+
+func (h *HandlerWebSocket) Chat(w http.ResponseWriter, r *http.Request) {
+	conn, err := h.upgradeWSConnect(w, r)
+	if err != nil {
+		h.log.Error(err.Error())
+		w.WriteHeader(http.StatusBadRequest)
+		w.Write([]byte(`{"status":"error","code":"websocket_connect","message":"fail connect"}`))
+		return
+	}
+	defer conn.CloseNow()
+
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	ctx, cancel := context.WithTimeout(context.Background(), _ctxOnServeConnect)
+	defer cancel()
+
+	socket := newSocketJSON(conn)
+
+	err = h.subscribeOnChat(ctx, socket, userID)
+	if err != nil {
+		h.log.Error(err.Error())
+		conn.Close(ws.StatusInternalError, "subscribe_fail")
+		return
+	}
+
+	err = h.serveChat(ctx, socket, userID)
+	if err != nil && ws.CloseStatus(err) == -1 {
+		h.log.Error(err.Error())
+		conn.Close(ws.StatusInternalError, "serve_chat")
+	}
+}
+
+func (h *HandlerWebSocket) serveChat(ctx context.Context, rw CtxReadWriter, userID int) error {
+	request := &PublishRequest{}
+	var err error
+	for {
+		err = rw.Read(ctx, request)
+		if err != nil {
+			h.log.Error(err.Error())
+			return fmt.Errorf("read message: %w", err)
+		}
+
+		h.handlePublishRequestMessage(ctx, rw, userID, request)
+	}
+}
+
+func (h *HandlerWebSocket) handlePublishRequestMessage(ctx context.Context, w CtxWriter, userID int, req *PublishRequest) {
+	fmt.Println(req)
+	switch req.Message.Type {
+	case "create":
+		req.Message.Message.From = userID
+		id, err := h.messageCase.SendMessage(ctx, userID, &req.Message.Message)
+		if err != nil {
+			h.log.Warn(err.Error())
+			return
+		}
+		w.Write(ctx, newResponseOnRequest(req.ID, "ok", "", "publish success", map[string]any{"id": id, "eventType": "create"}))
+
+	case "update":
+		err := h.messageCase.UpdateContentMessage(ctx, userID, &req.Message.Message)
+		if err != nil {
+			h.log.Warn(err.Error())
+			return
+		}
+		w.Write(ctx, newResponseOnRequest(req.ID, "ok", "", "publish success", map[string]string{"eventType": "update"}))
+
+	case "delete":
+		err := h.messageCase.DeleteMessage(ctx, userID, &req.Message.Message)
+		if err != nil {
+			h.log.Warn(err.Error())
+			return
+		}
+		w.Write(ctx, newResponseOnRequest(req.ID, "ok", "", "publish success", map[string]string{"eventType": "delete"}))
+
+	default:
+		w.Write(ctx, newResponseOnRequest(req.ID, "error", "unsupported", "unsupported eventType", nil))
+	}
+}
+
+func (h *HandlerWebSocket) subscribeOnChat(ctx context.Context, w CtxWriter, userID int) error {
+	chanEvMsg, err := h.messageCase.SubscribeUserToAllChats(ctx, userID)
+	if err != nil {
+		return fmt.Errorf("subscribe user on chat: %w", err)
+	}
+
+	go func() {
+		for eventMessage := range chanEvMsg {
+			if eventMessage.Err != nil {
+				h.log.Error(eventMessage.Err.Error())
+				return
+			}
+
+			err = w.Write(ctx, newMessageFromChannel("ok", "", Object{
+				Type:    eventMessage.Type,
+				Message: *eventMessage.Message,
+			}))
+			if err != nil {
+				h.log.Error(err.Error())
+				return
+			}
+		}
+	}()
+	return nil
+}
diff --git a/internal/pkg/delivery/websocket/notification.go b/internal/pkg/delivery/websocket/notification.go
new file mode 100644
index 0000000..a24852e
--- /dev/null
+++ b/internal/pkg/delivery/websocket/notification.go
@@ -0,0 +1,54 @@
+package websocket
+
+import (
+	"context"
+	"fmt"
+	"net/http"
+
+	ws "nhooyr.io/websocket"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+)
+
+func (h *HandlerWebSocket) Notification(w http.ResponseWriter, r *http.Request) {
+	conn, err := h.upgradeWSConnect(w, r)
+	if err != nil {
+		h.log.Error(err.Error())
+		w.WriteHeader(http.StatusBadRequest)
+		w.Write([]byte(`{"status":"error","code":"websocket_connect","message":"fail connect"}`))
+		return
+	}
+	defer conn.CloseNow()
+
+	userID := r.Context().Value(auth.KeyCurrentUserID).(int)
+	ctx, cancel := context.WithTimeout(context.Background(), _ctxOnServeConnect)
+	defer cancel()
+
+	socket := newSocketJSON(conn)
+
+	err = h.subscribeOnNotificationAndServe(ctx, socket, userID)
+	if err != nil && ws.CloseStatus(err) == -1 {
+		h.log.Error(err.Error())
+		conn.Close(ws.StatusInternalError, "subscribe_fail")
+	}
+}
+
+func (h *HandlerWebSocket) subscribeOnNotificationAndServe(ctx context.Context, w CtxWriter, userID int) error {
+	chanNotify, err := h.notifySub.SubscribeOnAllNotifications(ctx, userID)
+	if err != nil {
+		return fmt.Errorf("subscribe on Notification")
+	}
+
+	for notify := range chanNotify {
+		if notify.Err() != nil {
+			return notify.Err()
+		}
+
+		err = w.Write(ctx, notify)
+		if err != nil {
+			h.log.Error(err.Error())
+		}
+	}
+
+	return nil
+}
diff --git a/internal/pkg/delivery/websocket/socket.go b/internal/pkg/delivery/websocket/socket.go
new file mode 100644
index 0000000..4269c6a
--- /dev/null
+++ b/internal/pkg/delivery/websocket/socket.go
@@ -0,0 +1,37 @@
+package websocket
+
+import (
+	"context"
+
+	ws "nhooyr.io/websocket"
+	"nhooyr.io/websocket/wsjson"
+)
+
+type CtxReader interface {
+	Read(ctx context.Context, v any) error
+}
+
+type CtxWriter interface {
+	Write(ctx context.Context, v any) error
+}
+
+type CtxReadWriter interface {
+	CtxReader
+	CtxWriter
+}
+
+type socketJSON struct {
+	*ws.Conn
+}
+
+func newSocketJSON(conn *ws.Conn) socketJSON {
+	return socketJSON{conn}
+}
+
+func (s socketJSON) Write(ctx context.Context, v any) error {
+	return wsjson.Write(ctx, s.Conn, v)
+}
+
+func (s socketJSON) Read(ctx context.Context, v any) error {
+	return wsjson.Read(ctx, s.Conn, v)
+}
diff --git a/internal/pkg/delivery/websocket/types.go b/internal/pkg/delivery/websocket/types.go
new file mode 100644
index 0000000..1271683
--- /dev/null
+++ b/internal/pkg/delivery/websocket/types.go
@@ -0,0 +1,65 @@
+package websocket
+
+import "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+
+//go:generate easyjson --all
+
+type Object struct {
+	Type    string          `json:"eventType,omitempty"`
+	Message message.Message `json:"message"`
+}
+
+type PublishRequest struct {
+	ID      int    `json:"requestID"`
+	Message Object `json:"message"`
+}
+
+type MessageFromChannel struct {
+	Type    string          `json:"type"`
+	Message ResponseMessage `json:"message"`
+}
+
+type ResponseMessage struct {
+	Object
+	Status      string `json:"status"`
+	Code        string `json:"code,omitempty"`
+	MessageText string `json:"messageText,omitempty"`
+}
+
+type ResponseOnRequest struct {
+	ID      int    `json:"requestID"`
+	Type    string `json:"type"`
+	Status  string `json:"status"`
+	Code    string `json:"code,omitempty"`
+	Message string `json:"message"`
+	Body    any    `json:"body,omitempty"`
+}
+
+func newResponseOnRequest(id int, status, code, message string, body any) *ResponseOnRequest {
+	return &ResponseOnRequest{
+		ID:      id,
+		Type:    "response",
+		Status:  status,
+		Code:    code,
+		Message: message,
+		Body:    body,
+	}
+}
+
+func newMessageFromChannel(status, code string, v any) *MessageFromChannel {
+	mes := &MessageFromChannel{
+		Type: "event",
+		Message: ResponseMessage{
+			Status: status,
+			Code:   code,
+		},
+	}
+	if v, ok := v.(Object); ok {
+		mes.Message.Object = v
+		return mes
+	}
+	if v, ok := v.(string); ok {
+		mes.Message.MessageText = v
+	}
+	return mes
+}
diff --git a/internal/pkg/delivery/websocket/types_easyjson.go b/internal/pkg/delivery/websocket/types_easyjson.go
new file mode 100644
index 0000000..11db088
--- /dev/null
+++ b/internal/pkg/delivery/websocket/types_easyjson.go
@@ -0,0 +1,451 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package websocket
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(in *jlexer.Lexer, out *ResponseOnRequest) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "requestID":
+			out.ID = int(in.Int())
+		case "type":
+			out.Type = string(in.String())
+		case "status":
+			out.Status = string(in.String())
+		case "code":
+			out.Code = string(in.String())
+		case "message":
+			out.Message = string(in.String())
+		case "body":
+			if m, ok := out.Body.(easyjson.Unmarshaler); ok {
+				m.UnmarshalEasyJSON(in)
+			} else if m, ok := out.Body.(json.Unmarshaler); ok {
+				_ = m.UnmarshalJSON(in.Raw())
+			} else {
+				out.Body = in.Interface()
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(out *jwriter.Writer, in ResponseOnRequest) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"requestID\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"type\":"
+		out.RawString(prefix)
+		out.String(string(in.Type))
+	}
+	{
+		const prefix string = ",\"status\":"
+		out.RawString(prefix)
+		out.String(string(in.Status))
+	}
+	if in.Code != "" {
+		const prefix string = ",\"code\":"
+		out.RawString(prefix)
+		out.String(string(in.Code))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		out.String(string(in.Message))
+	}
+	if in.Body != nil {
+		const prefix string = ",\"body\":"
+		out.RawString(prefix)
+		if m, ok := in.Body.(easyjson.Marshaler); ok {
+			m.MarshalEasyJSON(out)
+		} else if m, ok := in.Body.(json.Marshaler); ok {
+			out.Raw(m.MarshalJSON())
+		} else {
+			out.Raw(json.Marshal(in.Body))
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ResponseOnRequest) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ResponseOnRequest) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ResponseOnRequest) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ResponseOnRequest) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket(l, v)
+}
+func easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(in *jlexer.Lexer, out *ResponseMessage) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "status":
+			out.Status = string(in.String())
+		case "code":
+			out.Code = string(in.String())
+		case "messageText":
+			out.MessageText = string(in.String())
+		case "eventType":
+			out.Type = string(in.String())
+		case "message":
+			(out.Message).UnmarshalEasyJSON(in)
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(out *jwriter.Writer, in ResponseMessage) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"status\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Status))
+	}
+	if in.Code != "" {
+		const prefix string = ",\"code\":"
+		out.RawString(prefix)
+		out.String(string(in.Code))
+	}
+	if in.MessageText != "" {
+		const prefix string = ",\"messageText\":"
+		out.RawString(prefix)
+		out.String(string(in.MessageText))
+	}
+	if in.Type != "" {
+		const prefix string = ",\"eventType\":"
+		out.RawString(prefix)
+		out.String(string(in.Type))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		(in.Message).MarshalEasyJSON(out)
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ResponseMessage) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ResponseMessage) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ResponseMessage) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ResponseMessage) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket1(l, v)
+}
+func easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(in *jlexer.Lexer, out *PublishRequest) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "requestID":
+			out.ID = int(in.Int())
+		case "message":
+			(out.Message).UnmarshalEasyJSON(in)
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(out *jwriter.Writer, in PublishRequest) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"requestID\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		(in.Message).MarshalEasyJSON(out)
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PublishRequest) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PublishRequest) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PublishRequest) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PublishRequest) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket2(l, v)
+}
+func easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(in *jlexer.Lexer, out *Object) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "eventType":
+			out.Type = string(in.String())
+		case "message":
+			(out.Message).UnmarshalEasyJSON(in)
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(out *jwriter.Writer, in Object) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	if in.Type != "" {
+		const prefix string = ",\"eventType\":"
+		first = false
+		out.RawString(prefix[1:])
+		out.String(string(in.Type))
+	}
+	{
+		const prefix string = ",\"message\":"
+		if first {
+			first = false
+			out.RawString(prefix[1:])
+		} else {
+			out.RawString(prefix)
+		}
+		(in.Message).MarshalEasyJSON(out)
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Object) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Object) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Object) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Object) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket3(l, v)
+}
+func easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(in *jlexer.Lexer, out *MessageFromChannel) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "type":
+			out.Type = string(in.String())
+		case "message":
+			(out.Message).UnmarshalEasyJSON(in)
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(out *jwriter.Writer, in MessageFromChannel) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"type\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Type))
+	}
+	{
+		const prefix string = ",\"message\":"
+		out.RawString(prefix)
+		(in.Message).MarshalEasyJSON(out)
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v MessageFromChannel) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v MessageFromChannel) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson6601e8cdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *MessageFromChannel) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *MessageFromChannel) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson6601e8cdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgDeliveryWebsocket4(l, v)
+}
diff --git a/internal/pkg/delivery/websocket/websocket.go b/internal/pkg/delivery/websocket/websocket.go
new file mode 100644
index 0000000..bd7db73
--- /dev/null
+++ b/internal/pkg/delivery/websocket/websocket.go
@@ -0,0 +1,53 @@
+package websocket
+
+import (
+	"context"
+	"fmt"
+	"net/http"
+	"time"
+
+	ws "nhooyr.io/websocket"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+	usecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/message"
+	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+type notifySubscriber interface {
+	SubscribeOnAllNotifications(ctx context.Context, userID int) (<-chan *notification.NotifyMessage, error)
+}
+
+type HandlerWebSocket struct {
+	originPatterns []string
+	log            *log.Logger
+	messageCase    usecase.Usecase
+	notifySub      notifySubscriber
+}
+
+type Option func(h *HandlerWebSocket)
+
+const _ctxOnServeConnect = 24 * time.Hour
+
+func SetOriginPatterns(patterns []string) Option {
+	return func(h *HandlerWebSocket) {
+		h.originPatterns = patterns
+	}
+}
+
+func New(log *log.Logger, mesCase usecase.Usecase, notify notifySubscriber, opts ...Option) *HandlerWebSocket {
+	handlerWS := &HandlerWebSocket{log: log, messageCase: mesCase, notifySub: notify}
+
+	for _, opt := range opts {
+		opt(handlerWS)
+	}
+
+	return handlerWS
+}
+
+func (h *HandlerWebSocket) upgradeWSConnect(w http.ResponseWriter, r *http.Request) (*ws.Conn, error) {
+	conn, err := ws.Accept(w, r, &ws.AcceptOptions{OriginPatterns: h.originPatterns})
+	if err != nil {
+		return nil, fmt.Errorf("upgrade to websocket connect: %w", err)
+	}
+	return conn, nil
+}
diff --git a/internal/pkg/entity/board/board.go b/internal/pkg/entity/board/board.go
index 92c37b6..237cbc6 100644
--- a/internal/pkg/entity/board/board.go
+++ b/internal/pkg/entity/board/board.go
@@ -3,12 +3,15 @@ package board
 import (
 	"time"
 
-	"github.com/microcosm-cc/bluemonday"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
 )
 
+//go:generate easyjson board.go
+
+//easyjson:json
 type Board struct {
 	ID          int        `json:"id,omitempty" example:"15"`
-	AuthorID    int        `json:"-"`
+	AuthorID    int        `json:"author_id,omitempty"`
 	Title       string     `json:"title" example:"Sunny places"`
 	Description string     `json:"description" example:"Sunny places desc"`
 	Public      bool       `json:"public" example:"true"`
@@ -17,6 +20,7 @@ type Board struct {
 	DeletedAt   *time.Time `json:"-"`
 }
 
+//easyjson:json
 type BoardWithContent struct {
 	BoardInfo  Board
 	PinsNumber int
@@ -24,14 +28,9 @@ type BoardWithContent struct {
 	TagTitles  []string
 }
 
-func (b *Board) Sanitize(sanitizer *bluemonday.Policy) {
-	sanitizer.Sanitize(b.Title)
-	sanitizer.Sanitize(b.Description)
-}
-
-func (b *BoardWithContent) Sanitize(sanitizer *bluemonday.Policy) {
-	b.BoardInfo.Sanitize(sanitizer)
-	for id, title := range b.TagTitles {
-		b.TagTitles[id] = sanitizer.Sanitize(title)
+func (b *Board) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if b != nil {
+		b.Title = sanitizer.Sanitize(censor.Sanitize(b.Title))
+		b.Description = sanitizer.Sanitize(censor.Sanitize(b.Description))
 	}
 }
diff --git a/internal/pkg/entity/board/board_easyjson.go b/internal/pkg/entity/board/board_easyjson.go
new file mode 100644
index 0000000..12d08ef
--- /dev/null
+++ b/internal/pkg/entity/board/board_easyjson.go
@@ -0,0 +1,293 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package board
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+	time "time"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(in *jlexer.Lexer, out *BoardWithContent) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "BoardInfo":
+			(out.BoardInfo).UnmarshalEasyJSON(in)
+		case "PinsNumber":
+			out.PinsNumber = int(in.Int())
+		case "Pins":
+			if in.IsNull() {
+				in.Skip()
+				out.Pins = nil
+			} else {
+				in.Delim('[')
+				if out.Pins == nil {
+					if !in.IsDelim(']') {
+						out.Pins = make([]string, 0, 4)
+					} else {
+						out.Pins = []string{}
+					}
+				} else {
+					out.Pins = (out.Pins)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v1 string
+					v1 = string(in.String())
+					out.Pins = append(out.Pins, v1)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		case "TagTitles":
+			if in.IsNull() {
+				in.Skip()
+				out.TagTitles = nil
+			} else {
+				in.Delim('[')
+				if out.TagTitles == nil {
+					if !in.IsDelim(']') {
+						out.TagTitles = make([]string, 0, 4)
+					} else {
+						out.TagTitles = []string{}
+					}
+				} else {
+					out.TagTitles = (out.TagTitles)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v2 string
+					v2 = string(in.String())
+					out.TagTitles = append(out.TagTitles, v2)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(out *jwriter.Writer, in BoardWithContent) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"BoardInfo\":"
+		out.RawString(prefix[1:])
+		(in.BoardInfo).MarshalEasyJSON(out)
+	}
+	{
+		const prefix string = ",\"PinsNumber\":"
+		out.RawString(prefix)
+		out.Int(int(in.PinsNumber))
+	}
+	{
+		const prefix string = ",\"Pins\":"
+		out.RawString(prefix)
+		if in.Pins == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v3, v4 := range in.Pins {
+				if v3 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v4))
+			}
+			out.RawByte(']')
+		}
+	}
+	{
+		const prefix string = ",\"TagTitles\":"
+		out.RawString(prefix)
+		if in.TagTitles == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v5, v6 := range in.TagTitles {
+				if v5 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v6))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v BoardWithContent) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v BoardWithContent) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *BoardWithContent) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *BoardWithContent) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard(l, v)
+}
+func easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(in *jlexer.Lexer, out *Board) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "author_id":
+			out.AuthorID = int(in.Int())
+		case "title":
+			out.Title = string(in.String())
+		case "description":
+			out.Description = string(in.String())
+		case "public":
+			out.Public = bool(in.Bool())
+		case "created_at":
+			if in.IsNull() {
+				in.Skip()
+				out.CreatedAt = nil
+			} else {
+				if out.CreatedAt == nil {
+					out.CreatedAt = new(time.Time)
+				}
+				if data := in.Raw(); in.Ok() {
+					in.AddError((*out.CreatedAt).UnmarshalJSON(data))
+				}
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(out *jwriter.Writer, in Board) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	if in.ID != 0 {
+		const prefix string = ",\"id\":"
+		first = false
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	if in.AuthorID != 0 {
+		const prefix string = ",\"author_id\":"
+		if first {
+			first = false
+			out.RawString(prefix[1:])
+		} else {
+			out.RawString(prefix)
+		}
+		out.Int(int(in.AuthorID))
+	}
+	{
+		const prefix string = ",\"title\":"
+		if first {
+			first = false
+			out.RawString(prefix[1:])
+		} else {
+			out.RawString(prefix)
+		}
+		out.String(string(in.Title))
+	}
+	{
+		const prefix string = ",\"description\":"
+		out.RawString(prefix)
+		out.String(string(in.Description))
+	}
+	{
+		const prefix string = ",\"public\":"
+		out.RawString(prefix)
+		out.Bool(bool(in.Public))
+	}
+	if in.CreatedAt != nil {
+		const prefix string = ",\"created_at\":"
+		out.RawString(prefix)
+		out.Raw((*in.CreatedAt).MarshalJSON())
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Board) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Board) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson202377feEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Board) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Board) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson202377feDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityBoard1(l, v)
+}
diff --git a/internal/pkg/entity/comment/comment.go b/internal/pkg/entity/comment/comment.go
new file mode 100644
index 0000000..bd076cd
--- /dev/null
+++ b/internal/pkg/entity/comment/comment.go
@@ -0,0 +1,29 @@
+package comment
+
+import (
+	"github.com/jackc/pgx/v5/pgtype"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+//go:generate easyjson comment.go
+//easyjson:json
+type Comment struct {
+	ID      int         `json:"id"`
+	Author  *user.User  `json:"author"`
+	PinID   int         `json:"pinID"`
+	Content pgtype.Text `json:"content"`
+}
+
+func (c *Comment) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if c != nil {
+		if c.Author != nil {
+			c.Author.Sanitize(sanitizer, censor)
+		}
+		c.Content = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(c.Content.String)),
+			Valid:  c.Content.Valid,
+		}
+	}
+}
diff --git a/internal/pkg/entity/comment/comment_easyjson.go b/internal/pkg/entity/comment/comment_easyjson.go
new file mode 100644
index 0000000..78723f0
--- /dev/null
+++ b/internal/pkg/entity/comment/comment_easyjson.go
@@ -0,0 +1,121 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package comment
+
+import (
+	json "encoding/json"
+	user "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjsonE9abebc9DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(in *jlexer.Lexer, out *Comment) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "author":
+			if in.IsNull() {
+				in.Skip()
+				out.Author = nil
+			} else {
+				if out.Author == nil {
+					out.Author = new(user.User)
+				}
+				(*out.Author).UnmarshalEasyJSON(in)
+			}
+		case "pinID":
+			out.PinID = int(in.Int())
+		case "content":
+			if data := in.Raw(); in.Ok() {
+				in.AddError((out.Content).UnmarshalJSON(data))
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonE9abebc9EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(out *jwriter.Writer, in Comment) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"author\":"
+		out.RawString(prefix)
+		if in.Author == nil {
+			out.RawString("null")
+		} else {
+			(*in.Author).MarshalEasyJSON(out)
+		}
+	}
+	{
+		const prefix string = ",\"pinID\":"
+		out.RawString(prefix)
+		out.Int(int(in.PinID))
+	}
+	{
+		const prefix string = ",\"content\":"
+		out.RawString(prefix)
+		out.Raw((in.Content).MarshalJSON())
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Comment) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonE9abebc9EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Comment) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonE9abebc9EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Comment) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonE9abebc9DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Comment) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonE9abebc9DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityComment(l, v)
+}
diff --git a/internal/pkg/entity/message/message.go b/internal/pkg/entity/message/message.go
new file mode 100644
index 0000000..6855287
--- /dev/null
+++ b/internal/pkg/entity/message/message.go
@@ -0,0 +1,40 @@
+package message
+
+import (
+	"github.com/jackc/pgx/v5/pgtype"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+//go:generate easyjson message.go
+
+type Chat [2]int
+
+//easyjson:json
+type Message struct {
+	ID      int         `json:"id,omitempty"`
+	From    int         `json:"from"`
+	To      int         `json:"to"`
+	Content pgtype.Text `json:"content"`
+}
+
+func (m *Message) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if m != nil {
+		m.Content = pgtype.Text{
+			String: sanitizer.Sanitize(m.Content.String),
+			Valid:  m.Content.Valid,
+		}
+	}
+}
+
+func (m Message) WhatChat() Chat {
+	return Chat{m.From, m.To}
+}
+
+type FeedUserChats []ChatWithUser
+
+type ChatWithUser struct {
+	MessageLastID int       `json:"-"`
+	WichWhomChat  user.User `json:"user"`
+}
diff --git a/internal/pkg/entity/message/message_easyjson.go b/internal/pkg/entity/message/message_easyjson.go
new file mode 100644
index 0000000..91a2ec5
--- /dev/null
+++ b/internal/pkg/entity/message/message_easyjson.go
@@ -0,0 +1,114 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package message
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(in *jlexer.Lexer, out *Message) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "from":
+			out.From = int(in.Int())
+		case "to":
+			out.To = int(in.Int())
+		case "content":
+			if data := in.Raw(); in.Ok() {
+				in.AddError((out.Content).UnmarshalJSON(data))
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(out *jwriter.Writer, in Message) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	if in.ID != 0 {
+		const prefix string = ",\"id\":"
+		first = false
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"from\":"
+		if first {
+			first = false
+			out.RawString(prefix[1:])
+		} else {
+			out.RawString(prefix)
+		}
+		out.Int(int(in.From))
+	}
+	{
+		const prefix string = ",\"to\":"
+		out.RawString(prefix)
+		out.Int(int(in.To))
+	}
+	{
+		const prefix string = ",\"content\":"
+		out.RawString(prefix)
+		out.Raw((in.Content).MarshalJSON())
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v Message) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v Message) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *Message) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *Message) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityMessage(l, v)
+}
diff --git a/internal/pkg/entity/notification/message.go b/internal/pkg/entity/notification/message.go
new file mode 100644
index 0000000..aaac18b
--- /dev/null
+++ b/internal/pkg/entity/notification/message.go
@@ -0,0 +1,26 @@
+package notification
+
+//go:generate easyjson
+//easyjson:json
+type NotifyMessage struct {
+	Type    string `json:"type"`
+	Content string `json:"content"`
+	err     error
+}
+
+func (n *NotifyMessage) Err() error {
+	return n.err
+}
+
+func NewNotifyMessage(t NotifyType, content string) *NotifyMessage {
+	return &NotifyMessage{
+		Type:    TypeString(t),
+		Content: content,
+	}
+}
+
+func NewNotifyMessageWithError(err error) *NotifyMessage {
+	return &NotifyMessage{
+		err: err,
+	}
+}
diff --git a/internal/pkg/entity/notification/message_easyjson.go b/internal/pkg/entity/notification/message_easyjson.go
new file mode 100644
index 0000000..a774aab
--- /dev/null
+++ b/internal/pkg/entity/notification/message_easyjson.go
@@ -0,0 +1,92 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package notification
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(in *jlexer.Lexer, out *NotifyMessage) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "type":
+			out.Type = string(in.String())
+		case "content":
+			out.Content = string(in.String())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(out *jwriter.Writer, in NotifyMessage) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"type\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Type))
+	}
+	{
+		const prefix string = ",\"content\":"
+		out.RawString(prefix)
+		out.String(string(in.Content))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v NotifyMessage) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v NotifyMessage) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson4086215fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *NotifyMessage) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *NotifyMessage) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson4086215fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityNotification(l, v)
+}
diff --git a/internal/pkg/entity/notification/notification.go b/internal/pkg/entity/notification/notification.go
new file mode 100644
index 0000000..a21f772
--- /dev/null
+++ b/internal/pkg/entity/notification/notification.go
@@ -0,0 +1,86 @@
+package notification
+
+import (
+	"bytes"
+	"fmt"
+	"sync"
+	"text/template"
+)
+
+type NotifyType uint8
+
+const _defaultCapBuffer = 128
+
+const (
+	_ NotifyType = iota
+	NotifyComment
+
+	_notifyCustom
+)
+
+type notify struct {
+	NotifyType NotifyType
+	buf        *sync.Pool
+	tmp        *template.Template
+}
+
+func NewWithTemplate(tmp *template.Template) notify {
+	return notify{
+		NotifyType: _notifyCustom,
+		buf: &sync.Pool{
+			New: func() any { return bytes.NewBuffer(make([]byte, 0, _defaultCapBuffer)) },
+		},
+		tmp: tmp,
+	}
+}
+
+func NewWithType(t NotifyType) (notify, error) {
+	content, ok := notifyTypeTemplate[t]
+	if !ok {
+		return notify{}, fmt.Errorf("new notify with type %s: %w", TypeString(t), ErrUnknownNotifyType)
+	}
+
+	res := notify{
+		NotifyType: t,
+		buf: &sync.Pool{
+			New: func() any { return bytes.NewBuffer(make([]byte, 0, _defaultCapBuffer)) },
+		},
+	}
+
+	tmp, err := template.New(TypeString(t)).Parse(content)
+	if err != nil {
+		return notify{}, fmt.Errorf("new notify with type %s: %w", TypeString(t), err)
+	}
+
+	res.tmp = tmp
+	return res, nil
+}
+
+func (n notify) Type() NotifyType {
+	return n.NotifyType
+}
+
+func (n notify) BuildNotifyMessage(data any) (*NotifyMessage, error) {
+	content, err := n.FormatContent(data)
+	if err != nil {
+		return nil, fmt.Errorf("build notify message: %w", err)
+	}
+
+	return NewNotifyMessage(n.NotifyType, content), nil
+}
+
+func (n notify) FormatContent(data any) (string, error) {
+	buf := n.buf.Get().(*bytes.Buffer)
+
+	defer func() {
+		buf.Reset()
+		n.buf.Put(buf)
+	}()
+
+	err := n.tmp.Execute(buf, data)
+	if err != nil {
+		return "", fmt.Errorf("")
+	}
+
+	return buf.String(), nil
+}
diff --git a/internal/pkg/entity/notification/template.go b/internal/pkg/entity/notification/template.go
new file mode 100644
index 0000000..55ad3cb
--- /dev/null
+++ b/internal/pkg/entity/notification/template.go
@@ -0,0 +1,5 @@
+package notification
+
+var notifyTypeTemplate = map[NotifyType]string{
+	NotifyComment: `Пользователь {{.Username}} оставил комментарий под пином "{{.TitlePin}}".`,
+}
diff --git a/internal/pkg/entity/notification/type.go b/internal/pkg/entity/notification/type.go
new file mode 100644
index 0000000..3050265
--- /dev/null
+++ b/internal/pkg/entity/notification/type.go
@@ -0,0 +1,20 @@
+package notification
+
+import "errors"
+
+var ErrUnknownNotifyType = errors.New("unknown notify type")
+
+func TypeString(t NotifyType) string {
+	switch t {
+	case NotifyComment:
+		return "comment"
+	case _notifyCustom:
+		return "custom"
+	}
+
+	return ""
+}
+
+func NotifyTemplateByType(t NotifyType) string {
+	return notifyTypeTemplate[t]
+}
diff --git a/internal/pkg/entity/pin/pin.go b/internal/pkg/entity/pin/pin.go
index f547059..b655d1d 100644
--- a/internal/pkg/entity/pin/pin.go
+++ b/internal/pkg/entity/pin/pin.go
@@ -4,6 +4,7 @@ import (
 	"github.com/jackc/pgx/v5/pgtype"
 
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
 )
 
 type Pin struct {
@@ -20,6 +21,22 @@ type Pin struct {
 	DeletedAt pgtype.Timestamptz `json:"-"`
 } //@name Pin
 
+func (p *Pin) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if p != nil {
+		if p.Author != nil {
+			p.Author.Sanitize(sanitizer, censor)
+		}
+		p.Title = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(p.Title.String)),
+			Valid:  p.Title.Valid,
+		}
+		p.Description = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(p.Description.String)),
+			Valid:  p.Description.Valid,
+		}
+	}
+}
+
 func (p *Pin) SetTitle(title string) {
 	p.Title = pgtype.Text{
 		String: title,
diff --git a/internal/pkg/entity/search/search.go b/internal/pkg/entity/search/search.go
new file mode 100644
index 0000000..218b7cc
--- /dev/null
+++ b/internal/pkg/entity/search/search.go
@@ -0,0 +1,84 @@
+package search
+
+import (
+	"strings"
+	"unicode"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/board"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+//go:generate easyjson search.go
+
+type Template string
+
+func (t *Template) Validate() bool {
+	if len(*t) == 0 || len(*t) > 40 {
+		return false
+	}
+	for _, sym := range *t {
+		if !(unicode.IsNumber(sym) || unicode.IsLetter(sym) || unicode.IsPunct(sym) || unicode.IsSpace(sym)) {
+			return false
+		}
+	}
+	return true
+}
+
+func (t *Template) GetSubStrings(sep string) []string {
+	return strings.Split(string(*t), sep)
+}
+
+//easyjson:json
+type BoardForSearch struct {
+	BoardHeader board.Board
+	PinsNumber  int      `json:"pins_number"`
+	PreviewPins []string `json:"pins"`
+}
+
+//easyjson:json
+type PinForSearch struct {
+	ID      int    `json:"id"`
+	Title   string `json:"title"`
+	Picture string `json:"picture"`
+	Likes   int    `json:"likes"`
+}
+
+//easyjson:json
+type UserForSearch struct {
+	ID                      int    `json:"id"`
+	Username                string `json:"username"`
+	Avatar                  string `json:"avatar"`
+	SubsCount               int    `json:"subscribers"`
+	HasSubscribeFromCurUser bool   `json:"is_subscribed"`
+}
+
+func (u *UserForSearch) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if u != nil {
+		u.Username = sanitizer.Sanitize(censor.Sanitize(u.Username))
+	}
+}
+
+func (b *BoardForSearch) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if b != nil {
+		b.BoardHeader.Sanitize(sanitizer, censor)
+	}
+}
+
+func (p *PinForSearch) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if p != nil {
+		p.Title = sanitizer.Sanitize(censor.Sanitize(p.Title))
+	}
+}
+
+type SearchOpts struct {
+	General GeneralOpts
+	SortBy  string
+}
+
+type GeneralOpts struct {
+	Template   Template
+	SortOrder  string
+	CurrUserID int
+	Count      int
+	Offset     int
+}
diff --git a/internal/pkg/entity/search/search_easyjson.go b/internal/pkg/entity/search/search_easyjson.go
new file mode 100644
index 0000000..497b75f
--- /dev/null
+++ b/internal/pkg/entity/search/search_easyjson.go
@@ -0,0 +1,312 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package search
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(in *jlexer.Lexer, out *UserForSearch) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "username":
+			out.Username = string(in.String())
+		case "avatar":
+			out.Avatar = string(in.String())
+		case "subscribers":
+			out.SubsCount = int(in.Int())
+		case "is_subscribed":
+			out.HasSubscribeFromCurUser = bool(in.Bool())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(out *jwriter.Writer, in UserForSearch) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix)
+		out.String(string(in.Username))
+	}
+	{
+		const prefix string = ",\"avatar\":"
+		out.RawString(prefix)
+		out.String(string(in.Avatar))
+	}
+	{
+		const prefix string = ",\"subscribers\":"
+		out.RawString(prefix)
+		out.Int(int(in.SubsCount))
+	}
+	{
+		const prefix string = ",\"is_subscribed\":"
+		out.RawString(prefix)
+		out.Bool(bool(in.HasSubscribeFromCurUser))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v UserForSearch) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v UserForSearch) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *UserForSearch) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *UserForSearch) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch(l, v)
+}
+func easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(in *jlexer.Lexer, out *PinForSearch) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "title":
+			out.Title = string(in.String())
+		case "picture":
+			out.Picture = string(in.String())
+		case "likes":
+			out.Likes = int(in.Int())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(out *jwriter.Writer, in PinForSearch) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"title\":"
+		out.RawString(prefix)
+		out.String(string(in.Title))
+	}
+	{
+		const prefix string = ",\"picture\":"
+		out.RawString(prefix)
+		out.String(string(in.Picture))
+	}
+	{
+		const prefix string = ",\"likes\":"
+		out.RawString(prefix)
+		out.Int(int(in.Likes))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PinForSearch) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PinForSearch) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PinForSearch) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PinForSearch) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch1(l, v)
+}
+func easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(in *jlexer.Lexer, out *BoardForSearch) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "BoardHeader":
+			(out.BoardHeader).UnmarshalEasyJSON(in)
+		case "pins_number":
+			out.PinsNumber = int(in.Int())
+		case "pins":
+			if in.IsNull() {
+				in.Skip()
+				out.PreviewPins = nil
+			} else {
+				in.Delim('[')
+				if out.PreviewPins == nil {
+					if !in.IsDelim(']') {
+						out.PreviewPins = make([]string, 0, 4)
+					} else {
+						out.PreviewPins = []string{}
+					}
+				} else {
+					out.PreviewPins = (out.PreviewPins)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v1 string
+					v1 = string(in.String())
+					out.PreviewPins = append(out.PreviewPins, v1)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(out *jwriter.Writer, in BoardForSearch) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"BoardHeader\":"
+		out.RawString(prefix[1:])
+		(in.BoardHeader).MarshalEasyJSON(out)
+	}
+	{
+		const prefix string = ",\"pins_number\":"
+		out.RawString(prefix)
+		out.Int(int(in.PinsNumber))
+	}
+	{
+		const prefix string = ",\"pins\":"
+		out.RawString(prefix)
+		if in.PreviewPins == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v2, v3 := range in.PreviewPins {
+				if v2 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v3))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v BoardForSearch) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v BoardForSearch) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonD4176298EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *BoardForSearch) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *BoardForSearch) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonD4176298DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntitySearch2(l, v)
+}
diff --git a/internal/pkg/entity/user/user.go b/internal/pkg/entity/user/user.go
index 4b70349..d12f37a 100644
--- a/internal/pkg/entity/user/user.go
+++ b/internal/pkg/entity/user/user.go
@@ -1,14 +1,62 @@
 package user
 
-import "github.com/jackc/pgx/v5/pgtype"
+import (
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+	"github.com/jackc/pgx/v5/pgtype"
+)
 
+//go:generate easyjson user.go
+
+const UserUnknown = -1
+
+//easyjson:json
 type User struct {
-	ID       int         `json:"id" example:"123"`
+	ID       int         `json:"id,omitempty" example:"123"`
 	Username string      `json:"username" example:"Green"`
-	Name     pgtype.Text `json:"name" example:"Peter"`
-	Surname  pgtype.Text `json:"surname" example:"Green"`
+	Name     pgtype.Text `json:"name,omitempty" example:"Peter"`
+	Surname  pgtype.Text `json:"surname,omitempty" example:"Green"`
 	Email    string      `json:"email,omitempty" example:"digital@gmail.com"`
 	Avatar   string      `json:"avatar" example:"pinspire.online/avatars/avatar.jpg"`
-	AboutMe  pgtype.Text `json:"about_me"`
+	AboutMe  pgtype.Text `json:"about_me,omitempty"`
 	Password string      `json:"password,omitempty" example:"pass123"`
 } // @name User
+
+func (u *User) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if u != nil {
+		u.Username = sanitizer.Sanitize(censor.Sanitize(u.Username))
+		u.Email = sanitizer.Sanitize(censor.Sanitize(u.Email))
+		u.Name = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(u.Name.String)),
+			Valid:  u.Name.Valid,
+		}
+		u.Surname = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(u.Surname.String)),
+			Valid:  u.Surname.Valid,
+		}
+		u.AboutMe = pgtype.Text{
+			String: sanitizer.Sanitize(censor.Sanitize(u.AboutMe.String)),
+			Valid:  u.AboutMe.Valid,
+		}
+	}
+}
+
+//easyjson:json
+type SubscriptionUser struct {
+	ID                      int    `json:"id"`
+	Username                string `json:"username"`
+	Avatar                  string `json:"avatar"`
+	HasSubscribeFromCurUser bool   `json:"is_subscribed"`
+}
+
+func (u *SubscriptionUser) Sanitize(sanitizer validation.SanitizerXSS, censor validation.ProfanityCensor) {
+	if u != nil {
+		u.Username = sanitizer.Sanitize(censor.Sanitize(u.Username))
+	}
+}
+
+type SubscriptionOpts struct {
+	UserID int
+	Count  int
+	LastID int
+	Filter string
+}
diff --git a/internal/pkg/entity/user/user_easyjson.go b/internal/pkg/entity/user/user_easyjson.go
new file mode 100644
index 0000000..e8b0dae
--- /dev/null
+++ b/internal/pkg/entity/user/user_easyjson.go
@@ -0,0 +1,233 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package user
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(in *jlexer.Lexer, out *User) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "username":
+			out.Username = string(in.String())
+		case "name":
+			if data := in.Raw(); in.Ok() {
+				in.AddError((out.Name).UnmarshalJSON(data))
+			}
+		case "surname":
+			if data := in.Raw(); in.Ok() {
+				in.AddError((out.Surname).UnmarshalJSON(data))
+			}
+		case "email":
+			out.Email = string(in.String())
+		case "avatar":
+			out.Avatar = string(in.String())
+		case "about_me":
+			if data := in.Raw(); in.Ok() {
+				in.AddError((out.AboutMe).UnmarshalJSON(data))
+			}
+		case "password":
+			out.Password = string(in.String())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(out *jwriter.Writer, in User) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	if in.ID != 0 {
+		const prefix string = ",\"id\":"
+		first = false
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"username\":"
+		if first {
+			first = false
+			out.RawString(prefix[1:])
+		} else {
+			out.RawString(prefix)
+		}
+		out.String(string(in.Username))
+	}
+	if true {
+		const prefix string = ",\"name\":"
+		out.RawString(prefix)
+		out.Raw((in.Name).MarshalJSON())
+	}
+	if true {
+		const prefix string = ",\"surname\":"
+		out.RawString(prefix)
+		out.Raw((in.Surname).MarshalJSON())
+	}
+	if in.Email != "" {
+		const prefix string = ",\"email\":"
+		out.RawString(prefix)
+		out.String(string(in.Email))
+	}
+	{
+		const prefix string = ",\"avatar\":"
+		out.RawString(prefix)
+		out.String(string(in.Avatar))
+	}
+	if true {
+		const prefix string = ",\"about_me\":"
+		out.RawString(prefix)
+		out.Raw((in.AboutMe).MarshalJSON())
+	}
+	if in.Password != "" {
+		const prefix string = ",\"password\":"
+		out.RawString(prefix)
+		out.String(string(in.Password))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v User) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v User) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *User) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *User) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser(l, v)
+}
+func easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(in *jlexer.Lexer, out *SubscriptionUser) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "id":
+			out.ID = int(in.Int())
+		case "username":
+			out.Username = string(in.String())
+		case "avatar":
+			out.Avatar = string(in.String())
+		case "is_subscribed":
+			out.HasSubscribeFromCurUser = bool(in.Bool())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(out *jwriter.Writer, in SubscriptionUser) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"id\":"
+		out.RawString(prefix[1:])
+		out.Int(int(in.ID))
+	}
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix)
+		out.String(string(in.Username))
+	}
+	{
+		const prefix string = ",\"avatar\":"
+		out.RawString(prefix)
+		out.String(string(in.Avatar))
+	}
+	{
+		const prefix string = ",\"is_subscribed\":"
+		out.RawString(prefix)
+		out.Bool(bool(in.HasSubscribeFromCurUser))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v SubscriptionUser) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v SubscriptionUser) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson9e1087fdEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *SubscriptionUser) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *SubscriptionUser) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson9e1087fdDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgEntityUser1(l, v)
+}
diff --git a/internal/pkg/errors/types.go b/internal/pkg/errors/types.go
new file mode 100644
index 0000000..815bd5b
--- /dev/null
+++ b/internal/pkg/errors/types.go
@@ -0,0 +1,70 @@
+package errors
+
+import "fmt"
+
+type Type uint8
+
+type Layer string
+
+const (
+	Repo     Layer = "Repository"
+	Usecase  Layer = "Usecase"
+	Delivery Layer = "Delivery"
+)
+
+const (
+	_ Type = iota
+	ErrNotFound
+	ErrAlreadyExists
+	ErrInvalidInput
+	ErrNoAccess
+	ErrNoAuth
+	ErrNotImplemented
+	ErrTimeout
+)
+
+type DeclaredError interface {
+	Type() Type
+}
+
+// general application errors
+type ErrNotAuthenticated struct{}
+
+func (e *ErrNotAuthenticated) Error() string {
+	return "Auth required"
+}
+
+func (e *ErrNotAuthenticated) Type() Type {
+	return ErrNoAuth
+}
+
+type InternalError struct {
+	Message string
+	Layer   string
+}
+
+func (e *InternalError) Error() string {
+	return fmt.Sprintf("Internal error occured. Message: '%s'. Layer: %s", e.Message, e.Layer)
+}
+
+type ErrorNotImplemented struct {
+}
+
+func (e *ErrorNotImplemented) Error() string {
+	return "Functionality not implemented"
+}
+
+func (e *ErrorNotImplemented) Type() Type {
+	return ErrNotImplemented
+}
+
+type ErrTimeoutExceeded struct {
+}
+
+func (e *ErrTimeoutExceeded) Error() string {
+	return "timeout exceeded"
+}
+
+func (e *ErrTimeoutExceeded) Type() Type {
+	return ErrTimeout
+}
diff --git a/internal/pkg/metrics/grpc/metrics.go b/internal/pkg/metrics/grpc/metrics.go
new file mode 100644
index 0000000..45cf2c8
--- /dev/null
+++ b/internal/pkg/metrics/grpc/metrics.go
@@ -0,0 +1,82 @@
+package messenger
+
+import (
+	"fmt"
+	"time"
+
+	"github.com/prometheus/client_golang/prometheus"
+)
+
+type metrics struct {
+	prefix          string
+	totalHits       prometheus.Counter
+	hitsDetailOk    *prometheus.CounterVec
+	hitsDetailErr   *prometheus.CounterVec
+	timeMeasurement *prometheus.HistogramVec
+}
+
+func (m metrics) AddRequest(handler string, ok bool, executed time.Duration) {
+	m.totalHits.Inc()
+	if ok {
+		m.hitsDetailOk.WithLabelValues(handler).Inc()
+	} else {
+		m.hitsDetailErr.WithLabelValues(handler).Inc()
+	}
+	m.timeMeasurement.WithLabelValues(handler).Observe(float64(executed.Milliseconds()))
+}
+
+func New(prefix string) metrics {
+	return metrics{
+		prefix: prefix,
+		totalHits: prometheus.NewCounter(prometheus.CounterOpts{
+			Name: prefix + "_total_hits",
+			Help: "number of all requests",
+		}),
+		hitsDetailOk: prometheus.NewCounterVec(prometheus.CounterOpts{
+			Name: prefix + "_hits_detail_ok",
+			Help: "the number of requests indicating handler with normal status",
+		}, []string{"handler"}),
+		hitsDetailErr: prometheus.NewCounterVec(prometheus.CounterOpts{
+			Name: prefix + "_hits_detail_err",
+			Help: "the number of requests indicating its handler with error status",
+		}, []string{"handler"}),
+		timeMeasurement: prometheus.NewHistogramVec(prometheus.HistogramOpts{
+			Name:    prefix + "_request_time_execution",
+			Help:    "time of request execution with indication of its handler",
+			Buckets: []float64{10, 100, 500, 1000, 5000},
+		}, []string{"handler"}),
+	}
+}
+
+func (m metrics) Registry() (err error) {
+	defer func() {
+		if err != nil {
+			prometheus.Unregister(m.totalHits)
+			prometheus.Unregister(m.hitsDetailOk)
+			prometheus.Unregister(m.timeMeasurement)
+			prometheus.Unregister(m.hitsDetailErr)
+		}
+	}()
+
+	err = prometheus.Register(m.totalHits)
+	if err != nil {
+		return fmt.Errorf("registry metric total hits: %w", err)
+	}
+
+	err = prometheus.Register(m.hitsDetailOk)
+	if err != nil {
+		return fmt.Errorf("registry metric hits detail ok: %w", err)
+	}
+
+	err = prometheus.Register(m.hitsDetailErr)
+	if err != nil {
+		return fmt.Errorf("registry metric hits detail error: %w", err)
+	}
+
+	err = prometheus.Register(m.timeMeasurement)
+	if err != nil {
+		return fmt.Errorf("registry metric time measurement: %w", err)
+	}
+
+	return nil
+}
diff --git a/internal/pkg/metrics/metrics.go b/internal/pkg/metrics/metrics.go
new file mode 100644
index 0000000..9a7afe8
--- /dev/null
+++ b/internal/pkg/metrics/metrics.go
@@ -0,0 +1,81 @@
+package metrics
+
+import (
+	"fmt"
+	"time"
+
+	"github.com/prometheus/client_golang/prometheus"
+)
+
+type metrics struct {
+	prefix          string
+	totalHits       prometheus.Counter
+	hitsDetail      *prometheus.CounterVec
+	timeMeasurement *prometheus.HistogramVec
+}
+
+func (m metrics) AddRequest(method, path string, statusResponse int, executed time.Duration) {
+	var labelStatus string
+	switch {
+	case statusResponse < 200:
+		labelStatus = "100"
+	case statusResponse < 300:
+		labelStatus = "200"
+	case statusResponse < 400:
+		labelStatus = "300"
+	case statusResponse < 500:
+		labelStatus = "400"
+	default:
+		labelStatus = "500"
+	}
+
+	m.totalHits.Inc()
+	m.hitsDetail.WithLabelValues(method+" "+path, labelStatus).Inc()
+	m.timeMeasurement.WithLabelValues(method+" "+path, labelStatus).Observe(float64(executed.Milliseconds()))
+}
+
+func New(prefix string) metrics {
+	return metrics{
+		prefix: prefix,
+		totalHits: prometheus.NewCounter(prometheus.CounterOpts{
+			Name: prefix + "_total_hits",
+			Help: "number of all requests",
+		}),
+		hitsDetail: prometheus.NewCounterVec(prometheus.CounterOpts{
+			Name: prefix + "_hits_detail",
+			Help: "the number of requests indicating its method, path, and response status",
+		}, []string{"handler", "status"}),
+		timeMeasurement: prometheus.NewHistogramVec(prometheus.HistogramOpts{
+			Name:    prefix + "_request_time_execution",
+			Help:    "time of request execution with indication of its method, path and response status",
+			Buckets: []float64{10, 100, 500, 1000, 5000},
+		}, []string{"handler", "status"}),
+	}
+}
+
+func (m metrics) Registry() (err error) {
+	defer func() {
+		if err != nil {
+			prometheus.Unregister(m.totalHits)
+			prometheus.Unregister(m.hitsDetail)
+			prometheus.Unregister(m.timeMeasurement)
+		}
+	}()
+
+	err = prometheus.Register(m.totalHits)
+	if err != nil {
+		return fmt.Errorf("registry metric total hits: %w", err)
+	}
+
+	err = prometheus.Register(m.hitsDetail)
+	if err != nil {
+		return fmt.Errorf("registry metric hits detail: %w", err)
+	}
+
+	err = prometheus.Register(m.timeMeasurement)
+	if err != nil {
+		return fmt.Errorf("registry metric time measurement: %w", err)
+	}
+
+	return nil
+}
diff --git a/internal/pkg/middleware/auth/auth.go b/internal/pkg/middleware/auth/auth.go
index 09b50ec..30d26dd 100644
--- a/internal/pkg/middleware/auth/auth.go
+++ b/internal/pkg/middleware/auth/auth.go
@@ -4,7 +4,8 @@ import (
 	"context"
 	"net/http"
 
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/session"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/session"
+	authCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/auth"
 )
 
 type authContextValueKey string
@@ -16,17 +17,17 @@ const (
 )
 
 type authMiddleware struct {
-	sm session.SessionManager
+	authCase authCase.Usecase
 }
 
-func NewAuthMiddleware(sm session.SessionManager) authMiddleware {
-	return authMiddleware{sm}
+func NewAuthMiddleware(auth authCase.Usecase) authMiddleware {
+	return authMiddleware{auth}
 }
 
 func (am authMiddleware) ContextWithUserID(next http.Handler) http.Handler {
 	return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
 		if cookie, err := r.Cookie(SessionCookieName); err == nil {
-			if userID, err := am.sm.GetUserIDBySessionKey(r.Context(), cookie.Value); err == nil {
+			if userID, err := am.authCase.GetUserIDBySession(r.Context(), &session.Session{Key: cookie.Value, Expire: cookie.Expires}); err == nil {
 				r = r.WithContext(context.WithValue(r.Context(), KeyCurrentUserID, userID))
 			}
 		}
diff --git a/internal/pkg/middleware/grpc/interceptor/auth.go b/internal/pkg/middleware/grpc/interceptor/auth.go
new file mode 100644
index 0000000..8fd862f
--- /dev/null
+++ b/internal/pkg/middleware/grpc/interceptor/auth.go
@@ -0,0 +1,27 @@
+package interceptor
+
+import (
+	"context"
+	"strconv"
+
+	messMS "github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/messenger/delivery/grpc"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+	"google.golang.org/grpc"
+	"google.golang.org/grpc/codes"
+	"google.golang.org/grpc/metadata"
+	"google.golang.org/grpc/status"
+)
+
+func Auth() grpc.UnaryServerInterceptor {
+	return func(ctx context.Context, req any, info *grpc.UnaryServerInfo, handler grpc.UnaryHandler) (resp any, err error) {
+		md := metadata.ValueFromIncomingContext(ctx, messMS.AuthenticatedMetadataKey)
+		if len(md) != 1 {
+			return nil, status.Error(codes.Unauthenticated, "unauthenticated")
+		}
+		userID, err := strconv.ParseInt(md[0], 10, 64)
+		if err != nil {
+			return nil, status.Error(codes.Unauthenticated, "unauthenticated")
+		}
+		return handler(context.WithValue(ctx, auth.KeyCurrentUserID, int(userID)), req)
+	}
+}
diff --git a/internal/pkg/middleware/grpc/interceptor/logger.go b/internal/pkg/middleware/grpc/interceptor/logger.go
new file mode 100644
index 0000000..089dfe0
--- /dev/null
+++ b/internal/pkg/middleware/grpc/interceptor/logger.go
@@ -0,0 +1,19 @@
+package interceptor
+
+import (
+	"context"
+	"time"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+	"google.golang.org/grpc"
+)
+
+func Logger(log *logger.Logger) grpc.UnaryServerInterceptor {
+	return func(ctx context.Context, req any, info *grpc.UnaryServerInfo, handler grpc.UnaryHandler) (resp any, err error) {
+		defer func(t time.Time) {
+			log.Info("call rpc", logger.F{"handler", info.FullMethod}, logger.F{"time_execution", time.Since(t).Milliseconds()})
+		}(time.Now())
+		res, err := handler(ctx, req)
+		return res, err
+	}
+}
diff --git a/internal/pkg/middleware/grpc/interceptor/metrics.go b/internal/pkg/middleware/grpc/interceptor/metrics.go
new file mode 100644
index 0000000..2e24abc
--- /dev/null
+++ b/internal/pkg/middleware/grpc/interceptor/metrics.go
@@ -0,0 +1,33 @@
+package interceptor
+
+import (
+	"context"
+	"net/http"
+	"time"
+
+	"github.com/prometheus/client_golang/prometheus/promhttp"
+	"google.golang.org/grpc"
+)
+
+type Metrics interface {
+	AddRequest(handler string, ok bool, executed time.Duration)
+}
+
+func Monitoring(m Metrics, addres string) grpc.UnaryServerInterceptor {
+	serv := http.Server{
+		Addr:    addres,
+		Handler: promhttp.Handler(),
+	}
+	go func() { serv.ListenAndServe() }()
+	return func(ctx context.Context, req any, info *grpc.UnaryServerInfo, handler grpc.UnaryHandler) (resp any, err error) {
+		var ok = true
+		defer func(t time.Time) {
+			m.AddRequest(info.FullMethod, ok, time.Since(t))
+		}(time.Now())
+		res, err := handler(ctx, req)
+		if err != nil {
+			ok = false
+		}
+		return res, err
+	}
+}
diff --git a/internal/pkg/middleware/monitoring/metrics.go b/internal/pkg/middleware/monitoring/metrics.go
new file mode 100644
index 0000000..b8645f7
--- /dev/null
+++ b/internal/pkg/middleware/monitoring/metrics.go
@@ -0,0 +1,43 @@
+package monitoring
+
+import (
+	"net/http"
+	"time"
+
+	mw "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware"
+	"github.com/prometheus/client_golang/prometheus/promhttp"
+)
+
+type Metrics interface {
+	AddRequest(method, path string, statusResponse int, executed time.Duration)
+}
+
+type StatusReceiver interface {
+	StatusCode() int
+}
+
+func Monitoring(pathExporter string, metrics Metrics) func(http.Handler) http.Handler {
+	instrumentMetricHandler := promhttp.Handler()
+
+	return func(next http.Handler) http.Handler {
+		return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
+			if r.URL.Path == pathExporter {
+				instrumentMetricHandler.ServeHTTP(w, r)
+				return
+			}
+
+			stat, ok := w.(StatusReceiver)
+			if !ok {
+				wrapResponse := mw.NewWrapResponseWriter(w)
+				w = wrapResponse
+				stat = wrapResponse
+			}
+
+			defer func(method, path string, t time.Time) {
+				metrics.AddRequest(method, path, stat.StatusCode(), time.Since(t))
+			}(r.Method, r.URL.Path, time.Now())
+
+			next.ServeHTTP(w, r)
+		})
+	}
+}
diff --git a/internal/pkg/middleware/timeout.go b/internal/pkg/middleware/timeout.go
new file mode 100644
index 0000000..02f5d0f
--- /dev/null
+++ b/internal/pkg/middleware/timeout.go
@@ -0,0 +1,38 @@
+package middleware
+
+import (
+	"context"
+	"net/http"
+	"strconv"
+	"strings"
+	"time"
+)
+
+func SetRequestTimeout(timeout time.Duration) Middleware {
+	return func(next http.Handler) http.Handler {
+		return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
+			if clientTimeout := extractTimeout(r); clientTimeout != 0 {
+				timeout = time.Duration(clientTimeout)
+			}
+			ctx, cancel := context.WithTimeout(r.Context(), timeout)
+			defer cancel()
+			next.ServeHTTP(w, r.WithContext(ctx))
+		})
+	}
+}
+
+func extractTimeout(r *http.Request) int {
+	var keepAlive string
+	if keepAlive = r.Header.Get("Keep-Alive"); keepAlive == "" {
+		return *new(int)
+	}
+
+	if options := strings.Split(keepAlive, " "); len(options) > 0 && len(options) <= 2 {
+		if timeoutOpt := options[0]; strings.Contains(timeoutOpt, "timeout") {
+			if timeout, err := strconv.ParseInt(strings.Split(timeoutOpt, "=")[1], 10, 64); err == nil {
+				return int(timeout)
+			}
+		}
+	}
+	return *new(int)
+}
diff --git a/internal/pkg/middleware/wrap_response.go b/internal/pkg/middleware/wrap_response.go
index 552218f..cea28c8 100644
--- a/internal/pkg/middleware/wrap_response.go
+++ b/internal/pkg/middleware/wrap_response.go
@@ -1,10 +1,15 @@
 package middleware
 
 import (
+	"bufio"
+	"errors"
 	"io"
+	"net"
 	"net/http"
 )
 
+var ErrUnimplementedMethod = errors.New("unimplemented method")
+
 type wrapResponseWriter struct {
 	http.ResponseWriter
 	statusCode int
@@ -33,3 +38,24 @@ func (w *wrapResponseWriter) WriteString(data string) (written int, err error) {
 	w.written += written
 	return
 }
+
+func (w *wrapResponseWriter) Hijack() (net.Conn, *bufio.ReadWriter, error) {
+	if hijacker, ok := w.ResponseWriter.(http.Hijacker); ok {
+		return hijacker.Hijack()
+	}
+	return nil, nil, ErrUnimplementedMethod
+}
+
+func (w *wrapResponseWriter) Flush() {
+	if flusher, ok := w.ResponseWriter.(http.Flusher); ok {
+		flusher.Flush()
+	}
+}
+
+func (w *wrapResponseWriter) StatusCode() int {
+	return w.statusCode
+}
+
+func (w *wrapResponseWriter) Written() int {
+	return w.written
+}
diff --git a/internal/pkg/notification/comment/comment.go b/internal/pkg/notification/comment/comment.go
new file mode 100644
index 0000000..cc7c5c9
--- /dev/null
+++ b/internal/pkg/notification/comment/comment.go
@@ -0,0 +1,57 @@
+package comment
+
+import (
+	"context"
+	"fmt"
+	"strconv"
+
+	comm "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/notification"
+)
+
+type commentGetter interface {
+	GetCommentWithAuthor(ctx context.Context, commentID int) (*comm.Comment, error)
+}
+
+type pinGetter interface {
+	GetPinWithAuthor(ctx context.Context, pinID int) (*pin.Pin, error)
+}
+
+type commentNotify struct {
+	notification.NotifyBuilder
+
+	com commentGetter
+	pin pinGetter
+}
+
+func NewCommentNotify(builder notification.NotifyBuilder, com commentGetter, pin pinGetter) commentNotify {
+	return commentNotify{builder, com, pin}
+}
+
+func (c commentNotify) Type() entity.NotifyType {
+	return c.NotifyBuilder.Type()
+}
+
+func (c commentNotify) MessageNotify(data notification.M) (*entity.NotifyMessage, error) {
+	return c.NotifyBuilder.BuildNotifyMessage(data)
+}
+
+func (c commentNotify) ChannelsNameForSubscribe(_ context.Context, userID int) ([]string, error) {
+	return []string{strconv.Itoa(userID)}, nil
+}
+
+func (c commentNotify) ChannelNameForPublishWithData(ctx context.Context, commentID int) (string, notification.M, error) {
+	com, err := c.com.GetCommentWithAuthor(ctx, commentID)
+	if err != nil {
+		return "", nil, fmt.Errorf("get comment for receive channel name on publish: %w", err)
+	}
+
+	pin, err := c.pin.GetPinWithAuthor(ctx, com.PinID)
+	if err != nil {
+		return "", nil, fmt.Errorf("get pin for receive channel name on publish: %w", err)
+	}
+
+	return strconv.Itoa(pin.Author.ID), notification.M{"Username": com.Author.Username, "TitlePin": pin.Title.String}, nil
+}
diff --git a/internal/pkg/notification/notifier.go b/internal/pkg/notification/notifier.go
new file mode 100644
index 0000000..5f3bac8
--- /dev/null
+++ b/internal/pkg/notification/notifier.go
@@ -0,0 +1,27 @@
+package notification
+
+import (
+	"context"
+
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+)
+
+type M map[string]string
+
+type TypeNotifier interface {
+	Type() entity.NotifyType
+}
+
+type Notifier interface {
+	TypeNotifier
+
+	ChannelNameForPublishWithData(ctx context.Context, entityID int) (string, M, error)
+	ChannelsNameForSubscribe(ctx context.Context, userID int) ([]string, error)
+	MessageNotify(data M) (*entity.NotifyMessage, error)
+}
+
+type NotifyBuilder interface {
+	TypeNotifier
+
+	BuildNotifyMessage(data any) (*entity.NotifyMessage, error)
+}
diff --git a/internal/pkg/repository/board/mock/board_mock.go b/internal/pkg/repository/board/mock/board_mock.go
index d2af370..d1317aa 100644
--- a/internal/pkg/repository/board/mock/board_mock.go
+++ b/internal/pkg/repository/board/mock/board_mock.go
@@ -80,6 +80,20 @@ func (mr *MockRepositoryMockRecorder) DeleteBoardByID(ctx, boardID interface{})
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteBoardByID", reflect.TypeOf((*MockRepository)(nil).DeleteBoardByID), ctx, boardID)
 }
 
+// DeletePinFromBoard mocks base method.
+func (m *MockRepository) DeletePinFromBoard(ctx context.Context, boardID, pinID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeletePinFromBoard", ctx, boardID, pinID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeletePinFromBoard indicates an expected call of DeletePinFromBoard.
+func (mr *MockRepositoryMockRecorder) DeletePinFromBoard(ctx, boardID, pinID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeletePinFromBoard", reflect.TypeOf((*MockRepository)(nil).DeletePinFromBoard), ctx, boardID, pinID)
+}
+
 // GetBoardAuthorByBoardID mocks base method.
 func (m *MockRepository) GetBoardAuthorByBoardID(ctx context.Context, boardID int) (int, error) {
 	m.ctrl.T.Helper()
@@ -96,12 +110,13 @@ func (mr *MockRepositoryMockRecorder) GetBoardAuthorByBoardID(ctx, boardID inter
 }
 
 // GetBoardByID mocks base method.
-func (m *MockRepository) GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board.BoardWithContent, error) {
+func (m *MockRepository) GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board.BoardWithContent, string, error) {
 	m.ctrl.T.Helper()
 	ret := m.ctrl.Call(m, "GetBoardByID", ctx, boardID, hasAccess)
 	ret0, _ := ret[0].(board.BoardWithContent)
-	ret1, _ := ret[1].(error)
-	return ret0, ret1
+	ret1, _ := ret[1].(string)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
 }
 
 // GetBoardByID indicates an expected call of GetBoardByID.
diff --git a/internal/pkg/repository/board/postgres/queries.go b/internal/pkg/repository/board/postgres/queries.go
index d86f049..0dfc71b 100644
--- a/internal/pkg/repository/board/postgres/queries.go
+++ b/internal/pkg/repository/board/postgres/queries.go
@@ -9,6 +9,7 @@ const (
 	GetContributorBoardsIDs               = "SELECT board_id FROM contributor WHERE user_id = $1;"
 	DeleteBoardByIdQuery                  = "UPDATE board SET deleted_at = $1 WHERE id = $2 AND deleted_at IS NULL;"
 	DeleteCurrentBoardTags                = "DELETE FROM board_tag WHERE board_id = $1;"
+	DeletePinFromBoard                    = "DELETE FROM membership m WHERE m.board_id = $1 AND m.pin_id = $2 AND (SELECT deleted_at IS NULL FROM pin p WHERE p.id = $2);"
 	SelectAuthorOrContributorRole         = `SELECT board.author, role.name FROM board LEFT JOIN contributor
 											 ON contributor.board_id = board.id AND contributor.user_id = $1 LEFT JOIN role
 											 ON contributor.role_id = role.id
diff --git a/internal/pkg/repository/board/postgres/repo.go b/internal/pkg/repository/board/postgres/repo.go
index 681dc57..80b5325 100644
--- a/internal/pkg/repository/board/postgres/repo.go
+++ b/internal/pkg/repository/board/postgres/repo.go
@@ -114,11 +114,12 @@ func (boardRepo *boardRepoPG) GetBoardsByUserID(ctx context.Context, userID int,
 	return boards, nil
 }
 
-func (repo *boardRepoPG) GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board entity.BoardWithContent, err error) {
+func (repo *boardRepoPG) GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board entity.BoardWithContent, username string, err error) {
 	getBoardByIdQuery := repo.sqlBuilder.
 		Select(
 			"board.id",
 			"board.author",
+			"profile.username",
 			"board.title",
 			"COALESCE(board.description, '')",
 			"board.created_at",
@@ -126,6 +127,7 @@ func (repo *boardRepoPG) GetBoardByID(ctx context.Context, boardID int, hasAcces
 			"COALESCE((ARRAY_AGG(DISTINCT pin.picture) FILTER (WHERE pin.deleted_at IS NULL AND pin.picture IS NOT NULL)), ARRAY[]::TEXT[]) AS pins",
 			"COALESCE(ARRAY_AGG(DISTINCT tag.title) FILTER (WHERE tag.title IS NOT NULL), ARRAY[]::TEXT[]) AS tag_titles").
 		From("board").
+		LeftJoin("profile ON board.author = profile.id").
 		LeftJoin("board_tag ON board.id = board_tag.board_id").
 		LeftJoin("tag ON board_tag.tag_id = tag.id").
 		LeftJoin("membership ON board.id = membership.board_id").
@@ -139,6 +141,7 @@ func (repo *boardRepoPG) GetBoardByID(ctx context.Context, boardID int, hasAcces
 	getBoardByIdQuery = getBoardByIdQuery.GroupBy(
 		"board.id",
 		"board.author",
+		"profile.username",
 		"board.title",
 		"board.description",
 		"board.created_at").
@@ -146,22 +149,21 @@ func (repo *boardRepoPG) GetBoardByID(ctx context.Context, boardID int, hasAcces
 
 	sqlRow, args, err := getBoardByIdQuery.ToSql()
 	if err != nil {
-		return entity.BoardWithContent{}, fmt.Errorf("building get board by id query: %w", err)
+		return entity.BoardWithContent{}, "", fmt.Errorf("building get board by id query: %w", err)
 	}
 
 	row := repo.db.QueryRow(ctx, sqlRow, args...)
 	board = entity.BoardWithContent{}
-	err = row.Scan(&board.BoardInfo.ID, &board.BoardInfo.AuthorID, &board.BoardInfo.Title, &board.BoardInfo.Description, &board.BoardInfo.CreatedAt, &board.PinsNumber, &board.Pins, &board.TagTitles)
+	err = row.Scan(&board.BoardInfo.ID, &board.BoardInfo.AuthorID, &username, &board.BoardInfo.Title, &board.BoardInfo.Description, &board.BoardInfo.CreatedAt, &board.PinsNumber, &board.Pins, &board.TagTitles)
 	if err != nil {
 		switch err {
 		case pgx.ErrNoRows:
-			return entity.BoardWithContent{}, repository.ErrNoData
+			return entity.BoardWithContent{}, "", repository.ErrNoData
 		default:
-			return entity.BoardWithContent{}, fmt.Errorf("scan result of get board by id query: %w", err)
+			return entity.BoardWithContent{}, "", fmt.Errorf("scan result of get board by id query: %w", err)
 		}
 	}
-
-	return board, nil
+	return board, username, nil
 }
 
 func (repo *boardRepoPG) GetBoardInfoForUpdate(ctx context.Context, boardID int, hasAccess bool) (entity.Board, []string, error) {
@@ -339,6 +341,31 @@ func (repo *boardRepoPG) AddPinsOnBoard(ctx context.Context, boardID int, pinIds
 	return nil
 }
 
+func (repo *boardRepoPG) DeletePinFromBoard(ctx context.Context, boardID, pinID int) error {
+	tx, err := repo.db.Begin(ctx)
+	if err != nil {
+		return fmt.Errorf("delete pin from board - start tx: %w", err)
+	}
+
+	status, err := tx.Exec(ctx, DeletePinFromBoard, boardID, pinID)
+	if err != nil {
+		if err := tx.Rollback(ctx); err != nil {
+			return fmt.Errorf("delete pin from board - rollback tx: %w", err)
+		}
+		return fmt.Errorf("delete pin from board - exec: %w", err)
+	}
+
+	if err := tx.Commit(ctx); err != nil {
+		return fmt.Errorf("delete pin from board - commit tx: %w", err)
+	}
+
+	if status.RowsAffected() == 0 {
+		return repository.ErrNoDataAffected
+	}
+
+	return nil
+}
+
 func (b *boardRepoPG) GetProtectionStatusBoard(ctx context.Context, boardID int) (repoBoard.ProtectionBoard, error) {
 	var isPublic bool
 	err := b.db.QueryRow(ctx, SelectProtectionStatusBoard, boardID).Scan(&isPublic)
diff --git a/internal/pkg/repository/board/repo.go b/internal/pkg/repository/board/repo.go
index 5d1fb4c..d6a2b39 100644
--- a/internal/pkg/repository/board/repo.go
+++ b/internal/pkg/repository/board/repo.go
@@ -11,7 +11,7 @@ import (
 type Repository interface {
 	CreateBoard(ctx context.Context, board entity.Board, tagTitles []string) (int, error)
 	GetBoardsByUserID(ctx context.Context, userID int, isAuthor bool, accessableBoardsIDs []int) ([]entity.BoardWithContent, error)
-	GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board entity.BoardWithContent, err error)
+	GetBoardByID(ctx context.Context, boardID int, hasAccess bool) (board entity.BoardWithContent, username string, err error)
 	GetBoardAuthorByBoardID(ctx context.Context, boardID int) (int, error)
 	GetContributorsByBoardID(ctx context.Context, boardID int) ([]uEntity.User, error)
 	GetContributorBoardsIDs(ctx context.Context, contributorID int) ([]int, error)
@@ -20,6 +20,7 @@ type Repository interface {
 	DeleteBoardByID(ctx context.Context, boardID int) error
 	RoleUserHaveOnThisBoard(ctx context.Context, boardID int, userID int) (UserRole, error)
 	AddPinsOnBoard(ctx context.Context, boardID int, pinIds []int) error
+	DeletePinFromBoard(ctx context.Context, boardID, pinID int) error
 	GetProtectionStatusBoard(ctx context.Context, boardID int) (ProtectionBoard, error)
 }
 
diff --git a/internal/pkg/repository/comment/mock/comment_mock.go b/internal/pkg/repository/comment/mock/comment_mock.go
new file mode 100644
index 0000000..21cd598
--- /dev/null
+++ b/internal/pkg/repository/comment/mock/comment_mock.go
@@ -0,0 +1,95 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: repo.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	comment "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockRepository is a mock of Repository interface.
+type MockRepository struct {
+	ctrl     *gomock.Controller
+	recorder *MockRepositoryMockRecorder
+}
+
+// MockRepositoryMockRecorder is the mock recorder for MockRepository.
+type MockRepositoryMockRecorder struct {
+	mock *MockRepository
+}
+
+// NewMockRepository creates a new mock instance.
+func NewMockRepository(ctrl *gomock.Controller) *MockRepository {
+	mock := &MockRepository{ctrl: ctrl}
+	mock.recorder = &MockRepositoryMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockRepository) EXPECT() *MockRepositoryMockRecorder {
+	return m.recorder
+}
+
+// AddComment mocks base method.
+func (m *MockRepository) AddComment(ctx context.Context, comment *comment.Comment) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "AddComment", ctx, comment)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// AddComment indicates an expected call of AddComment.
+func (mr *MockRepositoryMockRecorder) AddComment(ctx, comment interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "AddComment", reflect.TypeOf((*MockRepository)(nil).AddComment), ctx, comment)
+}
+
+// EditStatusCommentOnDeletedByID mocks base method.
+func (m *MockRepository) EditStatusCommentOnDeletedByID(ctx context.Context, id int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "EditStatusCommentOnDeletedByID", ctx, id)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// EditStatusCommentOnDeletedByID indicates an expected call of EditStatusCommentOnDeletedByID.
+func (mr *MockRepositoryMockRecorder) EditStatusCommentOnDeletedByID(ctx, id interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "EditStatusCommentOnDeletedByID", reflect.TypeOf((*MockRepository)(nil).EditStatusCommentOnDeletedByID), ctx, id)
+}
+
+// GetCommensToPin mocks base method.
+func (m *MockRepository) GetCommensToPin(ctx context.Context, pinID, lastID, count int) ([]comment.Comment, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetCommensToPin", ctx, pinID, lastID, count)
+	ret0, _ := ret[0].([]comment.Comment)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetCommensToPin indicates an expected call of GetCommensToPin.
+func (mr *MockRepositoryMockRecorder) GetCommensToPin(ctx, pinID, lastID, count interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetCommensToPin", reflect.TypeOf((*MockRepository)(nil).GetCommensToPin), ctx, pinID, lastID, count)
+}
+
+// GetCommentByID mocks base method.
+func (m *MockRepository) GetCommentByID(ctx context.Context, id int) (*comment.Comment, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetCommentByID", ctx, id)
+	ret0, _ := ret[0].(*comment.Comment)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetCommentByID indicates an expected call of GetCommentByID.
+func (mr *MockRepositoryMockRecorder) GetCommentByID(ctx, id interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetCommentByID", reflect.TypeOf((*MockRepository)(nil).GetCommentByID), ctx, id)
+}
diff --git a/internal/pkg/repository/comment/queries.go b/internal/pkg/repository/comment/queries.go
new file mode 100644
index 0000000..c944664
--- /dev/null
+++ b/internal/pkg/repository/comment/queries.go
@@ -0,0 +1,19 @@
+package comment
+
+const (
+	InsertNewComment = "INSERT INTO comment (author, pin_id, content) VALUES ($1, $2, $3) RETURNING id;"
+
+	UpdateCommentOnDeleted = "UPDATE comment SET deleted_at = now() WHERE id = $1;"
+
+	SelectCommentByID = `SELECT p.id, p.username, p.avatar, c.pin_id, c.content
+						 FROM comment AS c INNER JOIN profile AS p
+						 ON c.author = p.id
+						 WHERE c.id = $1 AND c.deleted_at IS NULL;`
+
+	SelectCommentsByPinID = `SELECT c.id, p.id, p.username, p.avatar, c.content
+							 FROM comment AS c INNER JOIN profile AS p
+							 ON c.author = p.id
+							 WHERE c.pin_id = $1 AND (c.id < $2 OR $2 = 0) AND c.deleted_at IS NULL
+							 ORDER BY c.id DESC
+							 LIMIT $3;`
+)
diff --git a/internal/pkg/repository/comment/repo.go b/internal/pkg/repository/comment/repo.go
new file mode 100644
index 0000000..f0b3715
--- /dev/null
+++ b/internal/pkg/repository/comment/repo.go
@@ -0,0 +1,87 @@
+package comment
+
+import (
+	"context"
+	"errors"
+	"fmt"
+
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/internal/pgtype"
+)
+
+//go:generate mockgen -destination=./mock/comment_mock.go -package=mock -source=repo.go Repository
+type Repository interface {
+	AddComment(ctx context.Context, comment *entity.Comment) (int, error)
+	GetCommentByID(ctx context.Context, id int) (*entity.Comment, error)
+	EditStatusCommentOnDeletedByID(ctx context.Context, id int) error
+	GetCommensToPin(ctx context.Context, pinID, lastID, count int) ([]entity.Comment, error)
+}
+
+var ErrUserRequired = errors.New("the comment does not have its author specified")
+
+type commentRepoPG struct {
+	db pgtype.PgxPoolIface
+}
+
+func NewCommentRepoPG(db pgtype.PgxPoolIface) *commentRepoPG {
+	return &commentRepoPG{db}
+}
+
+func (c *commentRepoPG) AddComment(ctx context.Context, comment *entity.Comment) (int, error) {
+	if comment.Author == nil {
+		return 0, ErrUserRequired
+	}
+
+	var idInsertedComment int
+	err := c.db.QueryRow(ctx, InsertNewComment, comment.Author.ID, comment.PinID, comment.Content).
+		Scan(&idInsertedComment)
+	if err != nil {
+		return 0, fmt.Errorf("add comment in storage: %w", err)
+	}
+	return idInsertedComment, nil
+}
+
+func (c *commentRepoPG) GetCommentByID(ctx context.Context, id int) (*entity.Comment, error) {
+	comment := &entity.Comment{ID: id, Author: &user.User{}}
+
+	err := c.db.QueryRow(ctx, SelectCommentByID, id).
+		Scan(&comment.Author.ID, &comment.Author.Username, &comment.Author.Avatar, &comment.PinID, &comment.Content)
+	if err != nil {
+		return nil, fmt.Errorf("get comment by id from storage: %w", err)
+	}
+
+	return comment, nil
+}
+
+func (c *commentRepoPG) EditStatusCommentOnDeletedByID(ctx context.Context, id int) error {
+	if _, err := c.db.Exec(ctx, UpdateCommentOnDeleted, id); err != nil {
+		return fmt.Errorf("edit status comment on deleted comment by id from storage: %w", err)
+	}
+	return nil
+}
+
+func (c *commentRepoPG) GetCommensToPin(ctx context.Context, pinID, lastID, count int) ([]entity.Comment, error) {
+	rows, err := c.db.Query(ctx, SelectCommentsByPinID, pinID, lastID, count)
+	if err != nil {
+		return nil, fmt.Errorf("get comments to pin from storage: %w", err)
+	}
+	defer rows.Close()
+
+	cmts := make([]entity.Comment, 0, count)
+	cmt := entity.Comment{
+		Author: &user.User{},
+		PinID:  pinID,
+	}
+
+	for rows.Next() {
+		cmt.Author = &user.User{}
+		err = rows.Scan(&cmt.ID, &cmt.Author.ID, &cmt.Author.Username, &cmt.Author.Avatar, &cmt.Content)
+		if err != nil {
+			return cmts, fmt.Errorf("scan a comment when getting comments on a pin: %w", err)
+		}
+
+		cmts = append(cmts, cmt)
+	}
+	return cmts, nil
+}
diff --git a/internal/pkg/repository/repo.go b/internal/pkg/repository/errors.go
similarity index 82%
rename from internal/pkg/repository/repo.go
rename to internal/pkg/repository/errors.go
index eb11314..8b2a226 100644
--- a/internal/pkg/repository/repo.go
+++ b/internal/pkg/repository/errors.go
@@ -1,11 +1,10 @@
 package repository
 
-import "errors"
-
-const (
-	TimeFormat = "02.01.2006"
+import (
+	"errors"
 )
 
+// for backward compatibility
 var (
 	ErrMethodUnimplemented = errors.New("unimplemented")
 	ErrNoData              = errors.New("got no data from repository layer")
diff --git a/internal/pkg/repository/message/mock/message_mock.go b/internal/pkg/repository/message/mock/message_mock.go
new file mode 100644
index 0000000..b7b9a0e
--- /dev/null
+++ b/internal/pkg/repository/message/mock/message_mock.go
@@ -0,0 +1,124 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: repo.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	message "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockRepository is a mock of Repository interface.
+type MockRepository struct {
+	ctrl     *gomock.Controller
+	recorder *MockRepositoryMockRecorder
+}
+
+// MockRepositoryMockRecorder is the mock recorder for MockRepository.
+type MockRepositoryMockRecorder struct {
+	mock *MockRepository
+}
+
+// NewMockRepository creates a new mock instance.
+func NewMockRepository(ctrl *gomock.Controller) *MockRepository {
+	mock := &MockRepository{ctrl: ctrl}
+	mock.recorder = &MockRepositoryMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockRepository) EXPECT() *MockRepositoryMockRecorder {
+	return m.recorder
+}
+
+// AddNewMessage mocks base method.
+func (m *MockRepository) AddNewMessage(ctx context.Context, mes *message.Message) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "AddNewMessage", ctx, mes)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// AddNewMessage indicates an expected call of AddNewMessage.
+func (mr *MockRepositoryMockRecorder) AddNewMessage(ctx, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "AddNewMessage", reflect.TypeOf((*MockRepository)(nil).AddNewMessage), ctx, mes)
+}
+
+// DelMessage mocks base method.
+func (m *MockRepository) DelMessage(ctx context.Context, messageID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DelMessage", ctx, messageID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DelMessage indicates an expected call of DelMessage.
+func (mr *MockRepositoryMockRecorder) DelMessage(ctx, messageID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DelMessage", reflect.TypeOf((*MockRepository)(nil).DelMessage), ctx, messageID)
+}
+
+// GetMessageByID mocks base method.
+func (m *MockRepository) GetMessageByID(ctx context.Context, mesID int) (*message.Message, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessageByID", ctx, mesID)
+	ret0, _ := ret[0].(*message.Message)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetMessageByID indicates an expected call of GetMessageByID.
+func (mr *MockRepositoryMockRecorder) GetMessageByID(ctx, mesID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessageByID", reflect.TypeOf((*MockRepository)(nil).GetMessageByID), ctx, mesID)
+}
+
+// GetMessages mocks base method.
+func (m *MockRepository) GetMessages(ctx context.Context, chat message.Chat, count, lastID int) ([]message.Message, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessages", ctx, chat, count, lastID)
+	ret0, _ := ret[0].([]message.Message)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetMessages indicates an expected call of GetMessages.
+func (mr *MockRepositoryMockRecorder) GetMessages(ctx, chat, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessages", reflect.TypeOf((*MockRepository)(nil).GetMessages), ctx, chat, count, lastID)
+}
+
+// GetUserChats mocks base method.
+func (m *MockRepository) GetUserChats(ctx context.Context, userID, count, lastID int) (message.FeedUserChats, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserChats", ctx, userID, count, lastID)
+	ret0, _ := ret[0].(message.FeedUserChats)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetUserChats indicates an expected call of GetUserChats.
+func (mr *MockRepositoryMockRecorder) GetUserChats(ctx, userID, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserChats", reflect.TypeOf((*MockRepository)(nil).GetUserChats), ctx, userID, count, lastID)
+}
+
+// UpdateContentMessage mocks base method.
+func (m *MockRepository) UpdateContentMessage(ctx context.Context, messageID int, newContent string) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "UpdateContentMessage", ctx, messageID, newContent)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// UpdateContentMessage indicates an expected call of UpdateContentMessage.
+func (mr *MockRepositoryMockRecorder) UpdateContentMessage(ctx, messageID, newContent interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateContentMessage", reflect.TypeOf((*MockRepository)(nil).UpdateContentMessage), ctx, messageID, newContent)
+}
diff --git a/internal/pkg/repository/message/queries.go b/internal/pkg/repository/message/queries.go
new file mode 100644
index 0000000..6e3e1f8
--- /dev/null
+++ b/internal/pkg/repository/message/queries.go
@@ -0,0 +1,22 @@
+package message
+
+const (
+	SelectMessageByID = "SELECT user_from, user_to, content FROM message WHERE id = $1 AND deleted_at IS NULL;"
+	SelectUserChats   = `SELECT max(message.id) AS mmid, profile.id, username, avatar 
+						 FROM message INNER JOIN profile ON (user_to = $1 AND user_from = profile.id) OR (user_to = profile.id AND user_from = $1)
+						 WHERE (message.id < $2 OR $2 = 0)
+						 GROUP BY profile.id
+						 ORDER BY mmid DESC
+						 LIMIT $3;`
+	SelectMessageFromChat = `SELECT id, user_from, user_to, content
+							 FROM message 
+							 WHERE deleted_at IS NULL AND (id < $1 OR $1 = 0) AND
+							 	(user_from = $2 AND user_to = $3 OR user_from = $3 AND user_to = $2)
+							 ORDER BY id DESC
+							 LIMIT $4;`
+
+	InsertMessage = "INSERT INTO message (user_from, user_to, content) VALUES ($1, $2, $3) RETURNING id;"
+
+	UpdateMessageContent         = "UPDATE message SET content = $1 WHERE id = $2;"
+	UpdateMessageStatusToDeleted = "UPDATE message SET deleted_at = now() WHERE id = $1 AND deleted_at IS NULL;"
+)
diff --git a/internal/pkg/repository/message/repo.go b/internal/pkg/repository/message/repo.go
new file mode 100644
index 0000000..f556efb
--- /dev/null
+++ b/internal/pkg/repository/message/repo.go
@@ -0,0 +1,98 @@
+package message
+
+import (
+	"context"
+	"fmt"
+
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/internal/pgtype"
+)
+
+//go:generate mockgen -destination=./mock/message_mock.go -package=mock -source=repo.go Repository
+type Repository interface {
+	GetMessageByID(ctx context.Context, mesID int) (*entity.Message, error)
+	AddNewMessage(ctx context.Context, mes *entity.Message) (int, error)
+	GetMessages(ctx context.Context, chat entity.Chat, count, lastID int) ([]entity.Message, error)
+	UpdateContentMessage(ctx context.Context, messageID int, newContent string) error
+	DelMessage(ctx context.Context, messageID int) error
+	GetUserChats(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, error)
+}
+
+type messageRepo struct {
+	db pgtype.PgxPoolIface
+}
+
+func NewMessageRepo(db pgtype.PgxPoolIface) *messageRepo {
+	return &messageRepo{db}
+}
+
+func (m *messageRepo) GetMessageByID(ctx context.Context, mesID int) (*entity.Message, error) {
+	message := &entity.Message{ID: mesID}
+	err := m.db.QueryRow(ctx, SelectMessageByID, mesID).Scan(&message.From, &message.To, &message.Content)
+	if err != nil {
+		return nil, fmt.Errorf("get message by id from storage: %w", err)
+	}
+	return message, nil
+}
+
+func (m *messageRepo) AddNewMessage(ctx context.Context, mes *entity.Message) (int, error) {
+	err := m.db.QueryRow(ctx, InsertMessage, mes.From, mes.To, mes.Content).Scan(&mes.ID)
+	if err != nil {
+		return 0, fmt.Errorf("add new message in storage: %w", err)
+	}
+	return mes.ID, nil
+}
+
+func (m *messageRepo) GetMessages(ctx context.Context, chat entity.Chat, count, lastID int) ([]entity.Message, error) {
+	rows, err := m.db.Query(ctx, SelectMessageFromChat, lastID, chat[0], chat[1], count)
+	if err != nil {
+		return nil, fmt.Errorf("get message for chat from storage: %w", err)
+	}
+
+	message := entity.Message{}
+	messages := make([]entity.Message, 0, count)
+	for rows.Next() {
+		err = rows.Scan(&message.ID, &message.From, &message.To, &message.Content)
+		if err != nil {
+			return messages, fmt.Errorf("scan selected message: %w", err)
+		}
+		messages = append(messages, message)
+	}
+	return messages, nil
+}
+
+func (m *messageRepo) UpdateContentMessage(ctx context.Context, messageID int, newContent string) error {
+	_, err := m.db.Exec(ctx, UpdateMessageContent, newContent, messageID)
+	if err != nil {
+		return fmt.Errorf("update content message in storage: %w", err)
+	}
+	return nil
+}
+
+func (m *messageRepo) DelMessage(ctx context.Context, messageID int) error {
+	_, err := m.db.Exec(ctx, UpdateMessageStatusToDeleted, messageID)
+	if err != nil {
+		return fmt.Errorf("delete message from storage: %w", err)
+	}
+	return nil
+}
+
+func (m *messageRepo) GetUserChats(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, error) {
+	rows, err := m.db.Query(ctx, SelectUserChats, userID, lastID, count)
+	if err != nil {
+		return nil, fmt.Errorf("get user chats in storage: %w", err)
+	}
+	defer rows.Close()
+
+	feed := make(entity.FeedUserChats, 0, count)
+	chat := entity.ChatWithUser{}
+	for rows.Next() {
+		if err = rows.Scan(&chat.MessageLastID, &chat.WichWhomChat.ID,
+			&chat.WichWhomChat.Username, &chat.WichWhomChat.Avatar); err != nil {
+
+			return feed, fmt.Errorf("scan chat with user for feed: %w", err)
+		}
+		feed = append(feed, chat)
+	}
+	return feed, nil
+}
diff --git a/internal/pkg/repository/pin/mock/pin_mock.go b/internal/pkg/repository/pin/mock/pin_mock.go
index 416cc16..1db2477 100644
--- a/internal/pkg/repository/pin/mock/pin_mock.go
+++ b/internal/pkg/repository/pin/mock/pin_mock.go
@@ -81,17 +81,17 @@ func (mr *MockRepositoryMockRecorder) DeletePin(ctx, pinID, userID interface{})
 }
 
 // EditPin mocks base method.
-func (m *MockRepository) EditPin(ctx context.Context, pinID int, updateData pin0.S, titleTags []string) error {
+func (m *MockRepository) EditPin(ctx context.Context, pinID, userID int, updateData pin0.S, titleTags []string) error {
 	m.ctrl.T.Helper()
-	ret := m.ctrl.Call(m, "EditPin", ctx, pinID, updateData, titleTags)
+	ret := m.ctrl.Call(m, "EditPin", ctx, pinID, userID, updateData, titleTags)
 	ret0, _ := ret[0].(error)
 	return ret0
 }
 
 // EditPin indicates an expected call of EditPin.
-func (mr *MockRepositoryMockRecorder) EditPin(ctx, pinID, updateData, titleTags interface{}) *gomock.Call {
+func (mr *MockRepositoryMockRecorder) EditPin(ctx, pinID, userID, updateData, titleTags interface{}) *gomock.Call {
 	mr.mock.ctrl.T.Helper()
-	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "EditPin", reflect.TypeOf((*MockRepository)(nil).EditPin), ctx, pinID, updateData, titleTags)
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "EditPin", reflect.TypeOf((*MockRepository)(nil).EditPin), ctx, pinID, userID, updateData, titleTags)
 }
 
 // GetAuthorPin mocks base method.
diff --git a/internal/pkg/repository/search/errors.go b/internal/pkg/repository/search/errors.go
new file mode 100644
index 0000000..141884c
--- /dev/null
+++ b/internal/pkg/repository/search/errors.go
@@ -0,0 +1,36 @@
+package search
+
+import errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+
+type ErrNoUsers struct {
+}
+
+func (e *ErrNoUsers) Error() string {
+	return "Can't find any user"
+}
+
+func (e *ErrNoUsers) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
+
+type ErrNoBoards struct {
+}
+
+func (e *ErrNoBoards) Error() string {
+	return "Can't find any board"
+}
+
+func (e *ErrNoBoards) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
+
+type ErrNoPins struct {
+}
+
+func (e *ErrNoPins) Error() string {
+	return "Can't find any pin"
+}
+
+func (e *ErrNoPins) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
diff --git a/internal/pkg/repository/search/mock/search_mock.go b/internal/pkg/repository/search/mock/search_mock.go
new file mode 100644
index 0000000..026411d
--- /dev/null
+++ b/internal/pkg/repository/search/mock/search_mock.go
@@ -0,0 +1,81 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: repo.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	search "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockRepository is a mock of Repository interface.
+type MockRepository struct {
+	ctrl     *gomock.Controller
+	recorder *MockRepositoryMockRecorder
+}
+
+// MockRepositoryMockRecorder is the mock recorder for MockRepository.
+type MockRepositoryMockRecorder struct {
+	mock *MockRepository
+}
+
+// NewMockRepository creates a new mock instance.
+func NewMockRepository(ctrl *gomock.Controller) *MockRepository {
+	mock := &MockRepository{ctrl: ctrl}
+	mock.recorder = &MockRepositoryMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockRepository) EXPECT() *MockRepositoryMockRecorder {
+	return m.recorder
+}
+
+// GetFilteredBoards mocks base method.
+func (m *MockRepository) GetFilteredBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetFilteredBoards", ctx, opts)
+	ret0, _ := ret[0].([]search.BoardForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetFilteredBoards indicates an expected call of GetFilteredBoards.
+func (mr *MockRepositoryMockRecorder) GetFilteredBoards(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetFilteredBoards", reflect.TypeOf((*MockRepository)(nil).GetFilteredBoards), ctx, opts)
+}
+
+// GetFilteredPins mocks base method.
+func (m *MockRepository) GetFilteredPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetFilteredPins", ctx, opts)
+	ret0, _ := ret[0].([]search.PinForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetFilteredPins indicates an expected call of GetFilteredPins.
+func (mr *MockRepositoryMockRecorder) GetFilteredPins(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetFilteredPins", reflect.TypeOf((*MockRepository)(nil).GetFilteredPins), ctx, opts)
+}
+
+// GetFilteredUsers mocks base method.
+func (m *MockRepository) GetFilteredUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetFilteredUsers", ctx, opts)
+	ret0, _ := ret[0].([]search.UserForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetFilteredUsers indicates an expected call of GetFilteredUsers.
+func (mr *MockRepositoryMockRecorder) GetFilteredUsers(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetFilteredUsers", reflect.TypeOf((*MockRepository)(nil).GetFilteredUsers), ctx, opts)
+}
diff --git a/internal/pkg/repository/search/postgres/builder.go b/internal/pkg/repository/search/postgres/builder.go
new file mode 100644
index 0000000..989c22c
--- /dev/null
+++ b/internal/pkg/repository/search/postgres/builder.go
@@ -0,0 +1,131 @@
+package search
+
+import (
+	"fmt"
+
+	"github.com/Masterminds/squirrel"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+)
+
+func SetUserSortType(sq squirrel.SelectBuilder, opts *search.SearchOpts) squirrel.SelectBuilder {
+	switch opts.SortBy {
+	case "subscribers":
+		return sq.OrderBy(fmt.Sprintf("subscribers %s", opts.General.SortOrder))
+	default:
+		return sq.OrderBy(fmt.Sprintf("p1.id %s", opts.General.SortOrder))
+	}
+}
+
+func SetBoardSortType(sq squirrel.SelectBuilder, opts *search.SearchOpts) squirrel.SelectBuilder {
+	switch opts.SortBy {
+	case "pins":
+		return sq.OrderBy(fmt.Sprintf("pins_number %s", opts.General.SortOrder))
+	default:
+		return sq.OrderBy(fmt.Sprintf("board.id %s", opts.General.SortOrder))
+	}
+}
+
+func SetPinSortType(sq squirrel.SelectBuilder, opts *search.SearchOpts) squirrel.SelectBuilder {
+	switch opts.SortBy {
+	case "likes":
+		return sq.OrderBy(fmt.Sprintf("likes %s", opts.General.SortOrder))
+	default:
+		return sq.OrderBy(fmt.Sprintf("p.id %s", opts.General.SortOrder))
+	}
+}
+
+func (r *searchRepoPG) SelectBoardsForSearch(opts *search.SearchOpts) (string, []interface{}, error) {
+	SelectBoardsForSearch := r.sqlBuilder.Select(
+		"board.id",
+		"board.title",
+		"board.created_at",
+		"COUNT(DISTINCT pin.id) FILTER (WHERE pin.deleted_at IS NULL) AS pins_number",
+		"COALESCE((ARRAY_AGG(DISTINCT pin.picture) FILTER (WHERE pin.deleted_at IS NULL AND pin.picture IS NOT NULL))[:3], ARRAY[]::TEXT[]) AS pins",
+	).From(
+		"board",
+	).LeftJoin(
+		"membership ON board.id = membership.board_id",
+	).LeftJoin(
+		"pin ON membership.pin_id = pin.id",
+	).Where(
+		squirrel.Eq{"board.deleted_at": nil},
+	).Where(
+		squirrel.ILike{"board.title": defaultSearchTemplate(opts.General.Template).GetTempl()},
+	).Where(
+		fmt.Sprintf("(board.public OR board.author = %d OR %d IN (SELECT user_id FROM contributor WHERE board_id = board.id))", opts.General.CurrUserID, opts.General.CurrUserID),
+	).GroupBy(
+		"board.id",
+		"board.title",
+		"board.created_at",
+	)
+
+	SelectBoardsForSearch = SetBoardSortType(SelectBoardsForSearch, opts)
+	SelectBoardsForSearch = SelectBoardsForSearch.Limit(uint64(opts.General.Count)).Offset(uint64(opts.General.Offset))
+
+	return SelectBoardsForSearch.ToSql()
+}
+
+func (r *searchRepoPG) SelectUsersForSearch(opts *search.SearchOpts) (string, []interface{}, error) {
+	SelectUsersForSearch := r.sqlBuilder.Select(
+		"p1.id",
+		"p1.username",
+		"p1.avatar",
+		"COUNT(s1.who) AS subscribers",
+		"s2.who IS NOT NULL AS is_subscribed",
+	).From(
+		"profile p1",
+	).LeftJoin(
+		"subscription_user s1 ON p1.id = s1.whom",
+	).LeftJoin(
+		"profile p2 ON s1.who = p2.id",
+	).LeftJoin(
+		fmt.Sprintf("subscription_user s2 ON p1.id = s2.whom AND s2.who = %d", opts.General.CurrUserID),
+	).Where(
+		squirrel.And{
+			squirrel.Eq{"p1.deleted_at": nil},
+			squirrel.Eq{"p2.deleted_at": nil},
+			squirrel.ILike{"p1.username": defaultSearchTemplate(opts.General.Template).GetTempl()},
+		},
+	).GroupBy(
+		"p1.id",
+		"p1.username",
+		"p1.avatar",
+		"s2.who IS NOT NULL",
+	)
+
+	SelectUsersForSearch = SetUserSortType(SelectUsersForSearch, opts)
+	SelectUsersForSearch = SelectUsersForSearch.Limit(uint64(opts.General.Count)).Offset(uint64(opts.General.Offset))
+
+	return SelectUsersForSearch.ToSql()
+}
+
+func (r *searchRepoPG) SelectPinsForSearch(opts *search.SearchOpts) (string, []interface{}, error) {
+	SelectPinsForSearch := r.sqlBuilder.Select(
+		"p.id",
+		"p.title",
+		"p.picture",
+		"COUNT(pin_id) AS likes",
+	).From(
+		"pin p",
+	).LeftJoin(
+		"like_pin lp ON p.id = lp.pin_id",
+	).Where(
+		squirrel.And{
+			squirrel.Eq{"p.deleted_at": nil},
+			squirrel.Or{
+				squirrel.Eq{"p.public": true},
+				squirrel.Eq{"p.author": opts.General.CurrUserID},
+			},
+			squirrel.ILike{"p.title": defaultSearchTemplate(opts.General.Template).GetTempl()},
+		},
+	).GroupBy(
+		"p.id",
+		"p.title",
+		"p.picture",
+	)
+
+	SelectPinsForSearch = SetPinSortType(SelectPinsForSearch, opts)
+	SelectPinsForSearch = SelectPinsForSearch.Limit(uint64(opts.General.Count)).Offset(uint64(opts.General.Offset))
+
+	return SelectPinsForSearch.ToSql()
+}
diff --git a/internal/pkg/repository/search/postgres/repo.go b/internal/pkg/repository/search/postgres/repo.go
new file mode 100644
index 0000000..bc4a7e5
--- /dev/null
+++ b/internal/pkg/repository/search/postgres/repo.go
@@ -0,0 +1,129 @@
+package search
+
+import (
+	"context"
+	"errors"
+	"fmt"
+
+	"github.com/Masterminds/squirrel"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/internal/pgtype"
+	searchRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/search"
+	"github.com/jackc/pgx/v5/pgconn"
+)
+
+type defaultSearchTemplate string
+
+func (t defaultSearchTemplate) GetTempl() string {
+	return fmt.Sprintf("%%%s%%", t)
+}
+
+type searchRepoPG struct {
+	db         pgtype.PgxPoolIface
+	sqlBuilder squirrel.StatementBuilderType
+}
+
+func NewSearchRepoPG(db pgtype.PgxPoolIface) *searchRepoPG {
+	return &searchRepoPG{db, squirrel.StatementBuilder.PlaceholderFormat(squirrel.Dollar)}
+}
+
+func convertErrorPostgres(err error) error {
+
+	switch err {
+	case context.DeadlineExceeded:
+		return &errPkg.ErrTimeoutExceeded{}
+	}
+
+	var pgErr *pgconn.PgError
+	if errors.As(err, &pgErr) {
+		switch pgErr.SQLState() {
+		}
+	}
+
+	return &errPkg.InternalError{Message: err.Error(), Layer: string(errPkg.Repo)}
+}
+
+func (r *searchRepoPG) GetFilteredUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error) {
+	sqlRow, args, err := r.SelectUsersForSearch(opts)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	rows, err := r.db.Query(ctx, sqlRow, args...)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	defer rows.Close()
+
+	users := make([]search.UserForSearch, 0)
+	for rows.Next() {
+		user := search.UserForSearch{}
+		if err := rows.Scan(&user.ID, &user.Username, &user.Avatar, &user.SubsCount, &user.HasSubscribeFromCurUser); err != nil {
+			return nil, convertErrorPostgres(err)
+		}
+		users = append(users, user)
+	}
+
+	if len(users) == 0 && opts.General.Offset == 0 {
+		return nil, &searchRepo.ErrNoUsers{}
+	}
+
+	return users, nil
+}
+
+func (r *searchRepoPG) GetFilteredBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error) {
+
+	sqlRow, args, err := r.SelectBoardsForSearch(opts)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	rows, err := r.db.Query(ctx, sqlRow, args...)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	defer rows.Close()
+
+	boards := make([]search.BoardForSearch, 0)
+	for rows.Next() {
+		board := search.BoardForSearch{}
+		if err := rows.Scan(&board.BoardHeader.ID, &board.BoardHeader.Title, &board.BoardHeader.CreatedAt, &board.PinsNumber, &board.PreviewPins); err != nil {
+			return nil, convertErrorPostgres(err)
+		}
+		boards = append(boards, board)
+	}
+
+	if len(boards) == 0 && opts.General.Offset == 0 {
+		return nil, &searchRepo.ErrNoBoards{}
+	}
+
+	return boards, nil
+}
+
+func (r *searchRepoPG) GetFilteredPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error) {
+
+	sqlRow, args, err := r.SelectPinsForSearch(opts)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	rows, err := r.db.Query(ctx, sqlRow, args...)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	defer rows.Close()
+
+	pins := make([]search.PinForSearch, 0)
+	for rows.Next() {
+		pin := search.PinForSearch{}
+		if err := rows.Scan(&pin.ID, &pin.Title, &pin.Picture, &pin.Likes); err != nil {
+			return nil, convertErrorPostgres(err)
+		}
+		pins = append(pins, pin)
+	}
+
+	if len(pins) == 0 && opts.General.Offset == 0 {
+		return nil, &searchRepo.ErrNoPins{}
+	}
+
+	return pins, nil
+
+}
diff --git a/internal/pkg/repository/search/repo.go b/internal/pkg/repository/search/repo.go
new file mode 100644
index 0000000..b49c815
--- /dev/null
+++ b/internal/pkg/repository/search/repo.go
@@ -0,0 +1,14 @@
+package search
+
+import (
+	"context"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+)
+
+//go:generate mockgen -destination=./mock/search_mock.go -package=mock -source=repo.go Repository
+type Repository interface {
+	GetFilteredUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error)
+	GetFilteredPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error)
+	GetFilteredBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error)
+}
diff --git a/internal/pkg/repository/subscription/errors.go b/internal/pkg/repository/subscription/errors.go
new file mode 100644
index 0000000..79d236d
--- /dev/null
+++ b/internal/pkg/repository/subscription/errors.go
@@ -0,0 +1,23 @@
+package subscription
+
+import errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+
+type ErrSubscriptionAlreadyExist struct{}
+
+func (e *ErrSubscriptionAlreadyExist) Error() string {
+	return "subscription on that user already exists"
+}
+
+func (e *ErrSubscriptionAlreadyExist) Type() errPkg.Type {
+	return errPkg.ErrAlreadyExists
+}
+
+type ErrNonExistingSubscription struct{}
+
+func (e *ErrNonExistingSubscription) Error() string {
+	return "such subscription doesn't exist"
+}
+
+func (e *ErrNonExistingSubscription) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
diff --git a/internal/pkg/repository/subscription/mock/subscription_mock.go b/internal/pkg/repository/subscription/mock/subscription_mock.go
new file mode 100644
index 0000000..28f115a
--- /dev/null
+++ b/internal/pkg/repository/subscription/mock/subscription_mock.go
@@ -0,0 +1,94 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: repo.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	user "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockRepository is a mock of Repository interface.
+type MockRepository struct {
+	ctrl     *gomock.Controller
+	recorder *MockRepositoryMockRecorder
+}
+
+// MockRepositoryMockRecorder is the mock recorder for MockRepository.
+type MockRepositoryMockRecorder struct {
+	mock *MockRepository
+}
+
+// NewMockRepository creates a new mock instance.
+func NewMockRepository(ctrl *gomock.Controller) *MockRepository {
+	mock := &MockRepository{ctrl: ctrl}
+	mock.recorder = &MockRepositoryMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockRepository) EXPECT() *MockRepositoryMockRecorder {
+	return m.recorder
+}
+
+// CreateSubscriptionUser mocks base method.
+func (m *MockRepository) CreateSubscriptionUser(ctx context.Context, from, to int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "CreateSubscriptionUser", ctx, from, to)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// CreateSubscriptionUser indicates an expected call of CreateSubscriptionUser.
+func (mr *MockRepositoryMockRecorder) CreateSubscriptionUser(ctx, from, to interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateSubscriptionUser", reflect.TypeOf((*MockRepository)(nil).CreateSubscriptionUser), ctx, from, to)
+}
+
+// DeleteSubscriptionUser mocks base method.
+func (m *MockRepository) DeleteSubscriptionUser(ctx context.Context, from, to int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeleteSubscriptionUser", ctx, from, to)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeleteSubscriptionUser indicates an expected call of DeleteSubscriptionUser.
+func (mr *MockRepositoryMockRecorder) DeleteSubscriptionUser(ctx, from, to interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteSubscriptionUser", reflect.TypeOf((*MockRepository)(nil).DeleteSubscriptionUser), ctx, from, to)
+}
+
+// GetUserSubscribers mocks base method.
+func (m *MockRepository) GetUserSubscribers(ctx context.Context, userID, count, lastID, currUserID int) ([]user.SubscriptionUser, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserSubscribers", ctx, userID, count, lastID, currUserID)
+	ret0, _ := ret[0].([]user.SubscriptionUser)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetUserSubscribers indicates an expected call of GetUserSubscribers.
+func (mr *MockRepositoryMockRecorder) GetUserSubscribers(ctx, userID, count, lastID, currUserID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserSubscribers", reflect.TypeOf((*MockRepository)(nil).GetUserSubscribers), ctx, userID, count, lastID, currUserID)
+}
+
+// GetUserSubscriptions mocks base method.
+func (m *MockRepository) GetUserSubscriptions(ctx context.Context, userID, count, lastID, currUserID int) ([]user.SubscriptionUser, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserSubscriptions", ctx, userID, count, lastID, currUserID)
+	ret0, _ := ret[0].([]user.SubscriptionUser)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetUserSubscriptions indicates an expected call of GetUserSubscriptions.
+func (mr *MockRepositoryMockRecorder) GetUserSubscriptions(ctx, userID, count, lastID, currUserID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserSubscriptions", reflect.TypeOf((*MockRepository)(nil).GetUserSubscriptions), ctx, userID, count, lastID, currUserID)
+}
diff --git a/internal/pkg/repository/subscription/postgres/queries.go b/internal/pkg/repository/subscription/postgres/queries.go
new file mode 100644
index 0000000..4a90c47
--- /dev/null
+++ b/internal/pkg/repository/subscription/postgres/queries.go
@@ -0,0 +1,36 @@
+package subscription
+
+var (
+	CreateSubscriptionUser = "INSERT INTO subscription_user (who, whom) values ($1, $2);"
+	DeleteSubscriptionUser = "DELETE FROM subscription_user WHERE who = $1 AND whom = $2;"
+	GetUserSubscriptions   = `	
+		SELECT 
+			p.id, p.username, p.avatar, s.who IS NOT NULL AS is_subscribed
+		FROM
+			subscription_user f
+		LEFT JOIN
+			profile p ON f.whom = p.id
+		LEFT JOIN
+			subscription_user s ON f.whom = s.whom AND s.who = $1
+		WHERE
+			f.who = $2 AND p.deleted_at IS NULL AND f.whom < $3
+		ORDER BY
+			f.whom DESC
+		LIMIT
+			$4;`
+	GetUserSubscribers = `	
+		SELECT
+			p.id, p.username, p.avatar, s.who IS NOT NULL AS is_subscribed
+		FROM
+			subscription_user f
+		LEFT JOIN
+			profile p ON f.who = p.id
+		LEFT JOIN
+			subscription_user s ON f.who = s.whom AND s.who = $1
+		WHERE
+			f.whom = $2 AND p.deleted_at IS NULL AND f.who < $3
+		ORDER BY
+			f.who DESC
+		LIMIT
+			$4;`
+)
diff --git a/internal/pkg/repository/subscription/postgres/repo.go b/internal/pkg/repository/subscription/postgres/repo.go
new file mode 100644
index 0000000..49737de
--- /dev/null
+++ b/internal/pkg/repository/subscription/postgres/repo.go
@@ -0,0 +1,120 @@
+package subscription
+
+import (
+	"context"
+	"errors"
+	"strconv"
+
+	"github.com/Masterminds/squirrel"
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/internal/pgtype"
+	subRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/subscription"
+	"github.com/jackc/pgx/v5/pgconn"
+)
+
+type subscriptionRepoPG struct {
+	db         pgtype.PgxPoolIface
+	sqlBuilder squirrel.StatementBuilderType
+}
+
+func NewSubscriptionRepoPG(db pgtype.PgxPoolIface) subRepo.Repository {
+	return &subscriptionRepoPG{db: db, sqlBuilder: squirrel.StatementBuilder.PlaceholderFormat(squirrel.Dollar)}
+}
+
+func convertErrorPostgres(err error) error {
+
+	switch err {
+	case context.DeadlineExceeded:
+		return &errPkg.ErrTimeoutExceeded{}
+	}
+
+	var pgErr *pgconn.PgError
+	if errors.As(err, &pgErr) {
+		switch pgErr.SQLState() {
+		case strconv.Itoa(23505):
+			return &subRepo.ErrSubscriptionAlreadyExist{}
+		}
+	}
+	return &errPkg.InternalError{Message: err.Error(), Layer: string(errPkg.Repo)}
+}
+
+func (r *subscriptionRepoPG) CreateSubscriptionUser(ctx context.Context, from, to int) error {
+	tx, err := r.db.Begin(ctx)
+	if err != nil {
+		return convertErrorPostgres(err)
+	}
+
+	if _, err = tx.Exec(ctx, CreateSubscriptionUser, from, to); err != nil {
+		if err := tx.Rollback(ctx); err != nil {
+			return convertErrorPostgres(err)
+		}
+		return convertErrorPostgres(err)
+	}
+
+	if err = tx.Commit(ctx); err != nil {
+		return convertErrorPostgres(err)
+	}
+	return nil
+}
+
+func (r *subscriptionRepoPG) DeleteSubscriptionUser(ctx context.Context, from, to int) error {
+	tx, err := r.db.Begin(ctx)
+	if err != nil {
+		return convertErrorPostgres(err)
+	}
+
+	status, err := tx.Exec(ctx, DeleteSubscriptionUser, from, to)
+	if err != nil {
+		if err := tx.Rollback(ctx); err != nil {
+			return convertErrorPostgres(err)
+		}
+		return convertErrorPostgres(err)
+	}
+
+	if err = tx.Commit(ctx); err != nil {
+		return convertErrorPostgres(err)
+	}
+	if status.RowsAffected() == 0 {
+		return &subRepo.ErrNonExistingSubscription{}
+	}
+	return nil
+}
+
+func (r *subscriptionRepoPG) GetUserSubscriptions(ctx context.Context, userID, count, lastID int, currUserID int) ([]userEntity.SubscriptionUser, error) {
+
+	rows, err := r.db.Query(ctx, GetUserSubscriptions, currUserID, userID, lastID, count)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	defer rows.Close()
+
+	subscriptions := make([]userEntity.SubscriptionUser, 0)
+	for rows.Next() {
+		var subscription userEntity.SubscriptionUser
+		if err = rows.Scan(&subscription.ID, &subscription.Username, &subscription.Avatar, &subscription.HasSubscribeFromCurUser); err != nil {
+			return nil, convertErrorPostgres(err)
+		}
+		subscriptions = append(subscriptions, subscription)
+	}
+	return subscriptions, nil
+}
+
+func (r *subscriptionRepoPG) GetUserSubscribers(ctx context.Context, userID, count, lastID int, currUserID int) ([]userEntity.SubscriptionUser, error) {
+
+	rows, err := r.db.Query(ctx, GetUserSubscribers, currUserID, userID, lastID, count)
+	if err != nil {
+		return nil, convertErrorPostgres(err)
+	}
+	defer rows.Close()
+
+	subscribers := make([]userEntity.SubscriptionUser, 0)
+	for rows.Next() {
+		var subscriber userEntity.SubscriptionUser
+		if err = rows.Scan(&subscriber.ID, &subscriber.Username, &subscriber.Avatar, &subscriber.HasSubscribeFromCurUser); err != nil {
+			return nil, convertErrorPostgres(err)
+		}
+		subscribers = append(subscribers, subscriber)
+	}
+	return subscribers, nil
+}
diff --git a/internal/pkg/repository/subscription/repo.go b/internal/pkg/repository/subscription/repo.go
new file mode 100644
index 0000000..6c8c841
--- /dev/null
+++ b/internal/pkg/repository/subscription/repo.go
@@ -0,0 +1,15 @@
+package subscription
+
+import (
+	"context"
+
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+)
+
+//go:generate mockgen -destination=./mock/subscription_mock.go -package=mock -source=repo.go Repository
+type Repository interface {
+	CreateSubscriptionUser(ctx context.Context, from, to int) error
+	DeleteSubscriptionUser(ctx context.Context, from, to int) error
+	GetUserSubscriptions(ctx context.Context, userID, count, lastID int, currUserID int) ([]userEntity.SubscriptionUser, error)
+	GetUserSubscribers(ctx context.Context, userID, count, lastID int, currUserID int) ([]userEntity.SubscriptionUser, error)
+}
diff --git a/internal/pkg/repository/user/errors.go b/internal/pkg/repository/user/errors.go
new file mode 100644
index 0000000..e998ec3
--- /dev/null
+++ b/internal/pkg/repository/user/errors.go
@@ -0,0 +1,13 @@
+package user
+
+import errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+
+type ErrNonExistingUser struct{}
+
+func (e *ErrNonExistingUser) Error() string {
+	return "user doesn't exist"
+}
+
+func (e *ErrNonExistingUser) Type() errPkg.Type {
+	return errPkg.ErrNotFound
+}
diff --git a/internal/pkg/repository/user/mock/user_mock.go b/internal/pkg/repository/user/mock/user_mock.go
index 3fae4f7..2ecaa66 100644
--- a/internal/pkg/repository/user/mock/user_mock.go
+++ b/internal/pkg/repository/user/mock/user_mock.go
@@ -50,6 +50,20 @@ func (mr *MockRepositoryMockRecorder) AddNewUser(ctx, user interface{}) *gomock.
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "AddNewUser", reflect.TypeOf((*MockRepository)(nil).AddNewUser), ctx, user)
 }
 
+// CheckUserExistence mocks base method.
+func (m *MockRepository) CheckUserExistence(ctx context.Context, userID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "CheckUserExistence", ctx, userID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// CheckUserExistence indicates an expected call of CheckUserExistence.
+func (mr *MockRepositoryMockRecorder) CheckUserExistence(ctx, userID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CheckUserExistence", reflect.TypeOf((*MockRepository)(nil).CheckUserExistence), ctx, userID)
+}
+
 // EditUserAvatar mocks base method.
 func (m *MockRepository) EditUserAvatar(ctx context.Context, userID int, avatar string) error {
 	m.ctrl.T.Helper()
@@ -93,6 +107,22 @@ func (mr *MockRepositoryMockRecorder) GetAllUserData(ctx, userID interface{}) *g
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetAllUserData", reflect.TypeOf((*MockRepository)(nil).GetAllUserData), ctx, userID)
 }
 
+// GetProfileData mocks base method.
+func (m *MockRepository) GetProfileData(ctx context.Context, userID int) (*user.User, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetProfileData", ctx, userID)
+	ret0, _ := ret[0].(*user.User)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetProfileData indicates an expected call of GetProfileData.
+func (mr *MockRepositoryMockRecorder) GetProfileData(ctx, userID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetProfileData", reflect.TypeOf((*MockRepository)(nil).GetProfileData), ctx, userID)
+}
+
 // GetUserByUsername mocks base method.
 func (m *MockRepository) GetUserByUsername(ctx context.Context, username string) (*user.User, error) {
 	m.ctrl.T.Helper()
@@ -108,6 +138,23 @@ func (mr *MockRepositoryMockRecorder) GetUserByUsername(ctx, username interface{
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserByUsername", reflect.TypeOf((*MockRepository)(nil).GetUserByUsername), ctx, username)
 }
 
+// GetUserData mocks base method.
+func (m *MockRepository) GetUserData(ctx context.Context, userID, currUserID int) (*user.User, bool, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserData", ctx, userID, currUserID)
+	ret0, _ := ret[0].(*user.User)
+	ret1, _ := ret[1].(bool)
+	ret2, _ := ret[2].(int)
+	ret3, _ := ret[3].(error)
+	return ret0, ret1, ret2, ret3
+}
+
+// GetUserData indicates an expected call of GetUserData.
+func (mr *MockRepositoryMockRecorder) GetUserData(ctx, userID, currUserID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserData", reflect.TypeOf((*MockRepository)(nil).GetUserData), ctx, userID, currUserID)
+}
+
 // GetUserIdByUsername mocks base method.
 func (m *MockRepository) GetUserIdByUsername(ctx context.Context, username string) (int, error) {
 	m.ctrl.T.Helper()
diff --git a/internal/pkg/repository/user/queries.go b/internal/pkg/repository/user/queries.go
index f94d2b9..677b99c 100644
--- a/internal/pkg/repository/user/queries.go
+++ b/internal/pkg/repository/user/queries.go
@@ -10,4 +10,35 @@ var (
 	UpdateAvatarProfile    = "UPDATE profile SET avatar = $1 WHERE id = $2;"
 	SelectUserIdByUsername = "SELECT id FROM profile WHERE username = $1;"
 	SelectLastUserID       = "SELECT id FROM profile ORDER BY id DESC LIMIT 1;"
+	CheckUserExistence     = "SELECT username FROM profile WHERE id = $1 AND deleted_at IS NULL;"
+	GetUserInfo            = `
+		SELECT
+			p1.id, p1.username, p1.avatar, COALESCE(p1.name, '') name, COALESCE(p1.surname, '') surname, COALESCE(p1.about_me, '') about_me, s2.who IS NOT NULL as is_subscribed, COUNT(s1.who) subscribers
+		FROM
+			profile p1
+		LEFT JOIN 
+			subscription_user s1 ON p1.id = s1.whom
+		LEFT JOIN
+			profile p2 ON s1.who = p2.id
+		LEFT JOIN
+			subscription_user s2 ON s1.whom = s2.whom AND s2.who = $1
+		WHERE
+			p1.id = $2 AND p1.deleted_at IS NULL AND p2.deleted_at IS NULL
+		GROUP BY
+			p1.id, p1.username,p1.avatar, p1.name, p1.surname, p1.about_me, s2.who IS NOT NULL;
+		`
+	GetProfileInfo = `
+		SELECT
+			p1.id, p1.username, p1.avatar, COUNT(s.who) subscribers
+		FROM
+			profile p1
+		LEFT JOIN 
+			subscription_user s ON p1.id = s.whom
+		LEFT JOIN
+			profile p2 ON s.who = p2.id
+		WHERE
+			p1.id = $1 AND p1.deleted_at IS NULL AND p2.deleted_at IS NULL
+		GROUP BY
+			p1.id, p1.username, p1.avatar;
+	`
 )
diff --git a/internal/pkg/repository/user/repo.go b/internal/pkg/repository/user/repo.go
index 1fb9deb..ea4d0be 100644
--- a/internal/pkg/repository/user/repo.go
+++ b/internal/pkg/repository/user/repo.go
@@ -2,12 +2,15 @@ package user
 
 import (
 	"context"
+	"errors"
 	"fmt"
 
 	sq "github.com/Masterminds/squirrel"
 	"github.com/jackc/pgx/v5"
+	"github.com/jackc/pgx/v5/pgconn"
 
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/internal/pgtype"
 )
@@ -18,6 +21,9 @@ type Repository interface {
 	GetUserByUsername(ctx context.Context, username string) (*user.User, error)
 	GetUsernameAndAvatarByID(ctx context.Context, userID int) (username string, avatar string, err error)
 	GetUserIdByUsername(ctx context.Context, username string) (int, error)
+	GetUserData(ctx context.Context, userID, currUserID int) (user_ *user.User, isSubscribed bool, subsCount int, err error)
+	GetProfileData(ctx context.Context, userID int) (user_ *user.User, subsCount int, err error)
+	CheckUserExistence(ctx context.Context, userID int) error
 	EditUserAvatar(ctx context.Context, userID int, avatar string) error
 	GetAllUserData(ctx context.Context, userID int) (*user.User, error)
 	EditUserInfo(ctx context.Context, userID int, updateFields S) error
@@ -33,6 +39,34 @@ func NewUserRepoPG(db pgtype.PgxPoolIface) *userRepoPG {
 	return &userRepoPG{db}
 }
 
+func convertErrorPostgres(err error) error {
+
+	switch err {
+	case pgx.ErrNoRows:
+		return &ErrNonExistingUser{}
+	case context.DeadlineExceeded:
+		return &errPkg.ErrTimeoutExceeded{}
+	}
+
+	var pgErr *pgconn.PgError
+	if errors.As(err, &pgErr) {
+		switch pgErr.SQLState() {
+		// add SQL states if necessary
+		}
+	}
+	return &errPkg.InternalError{Message: err.Error(), Layer: string(errPkg.Repo)}
+}
+
+func (u *userRepoPG) CheckUserExistence(ctx context.Context, userID int) error {
+	row := u.db.QueryRow(ctx, CheckUserExistence, userID)
+	var dummy string
+	if err := row.Scan(&dummy); err != nil {
+		return convertErrorPostgres(err)
+	}
+
+	return nil
+}
+
 func (u *userRepoPG) AddNewUser(ctx context.Context, user *user.User) error {
 	_, err := u.db.Exec(ctx, InsertNewUser, user.Username, user.Password, user.Email)
 	if err != nil {
@@ -60,6 +94,27 @@ func (u *userRepoPG) GetUsernameAndAvatarByID(ctx context.Context, userID int) (
 	return
 }
 
+func (u *userRepoPG) GetUserData(ctx context.Context, userID, currUserID int) (user_ *user.User, isSubscribed bool, subsCount int, err error) {
+	user_ = &user.User{}
+	if err := u.db.QueryRow(ctx, GetUserInfo, currUserID, userID).Scan(
+		&user_.ID, &user_.Username, &user_.Avatar, &user_.Name, &user_.Surname,
+		&user_.AboutMe, &isSubscribed, &subsCount,
+	); err != nil {
+		return nil, false, 0, convertErrorPostgres(err)
+	}
+	return user_, isSubscribed, subsCount, nil
+}
+
+func (u *userRepoPG) GetProfileData(ctx context.Context, userID int) (user_ *user.User, subsCount int, err error) {
+	user_ = &user.User{}
+	if err := u.db.QueryRow(ctx, GetProfileInfo, userID).Scan(
+		&user_.ID, &user_.Username, &user_.Avatar, &subsCount,
+	); err != nil {
+		return nil, 0, convertErrorPostgres(err)
+	}
+	return user_, subsCount, nil
+}
+
 func (u *userRepoPG) EditUserAvatar(ctx context.Context, userID int, avatar string) error {
 	_, err := u.db.Exec(ctx, UpdateAvatarProfile, avatar, userID)
 	if err != nil {
diff --git a/internal/pkg/service/auth.go b/internal/pkg/service/auth.go
deleted file mode 100644
index e146083..0000000
--- a/internal/pkg/service/auth.go
+++ /dev/null
@@ -1,226 +0,0 @@
-package service
-
-import (
-	"encoding/json"
-	"net/http"
-	"time"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
-	usecase "github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/user"
-	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-// Login godoc
-//
-//	@Description	User login, check authentication, get user info
-//	@Tags			Auth
-//	@Produce		json
-//	@Param			session_key	header		string	false	"Auth session id"	example(senjs7rvdnrgkjdr)
-//	@Success		200			{object}	JsonResponse{body=user.User}
-//	@Failure		400			{object}	JsonErrResponse
-//	@Failure		404			{object}	JsonErrResponse
-//	@Failure		500			{object}	JsonErrResponse
-//	@Router			/api/v1/auth/login [get]
-func (s *Service) CheckLogin(w http.ResponseWriter, r *http.Request) {
-	s.log.Info("request on check login", log.F{"method", r.Method}, log.F{"path", r.URL.Path})
-	SetContentTypeJSON(w)
-
-	cookie, err := r.Cookie("session_key")
-	if err != nil {
-		s.log.Info("no cookie", log.F{"error", err.Error()})
-		err = responseError(w, "no_auth", "the user is not logged in")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	userID, err := s.sm.GetUserIDBySessionKey(r.Context(), cookie.Value)
-	if err != nil {
-		err = responseError(w, "no_auth", "no user session found")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	username, avatar, err := s.userCase.FindOutUsernameAndAvatar(r.Context(), userID)
-	if err != nil {
-		s.log.Error(err.Error())
-		err = responseError(w, "no_auth", "no user was found for this session")
-	} else {
-		err = responseOk(w, "user found", map[string]string{"username": username, "avatar": avatar})
-	}
-	if err != nil {
-		s.log.Error(err.Error())
-	}
-}
-
-// Login godoc
-//
-//	@Description	User login, creating new session
-//	@Tags			Auth
-//	@Accept			json
-//	@Produce		json
-//	@Param			username	body		string	true	"Username"	example(clicker123)
-//	@Param			password	body		string	true	"Password"	example(safe_pass)
-//	@Success		200			{object}	JsonResponse
-//	@Failure		400			{object}	JsonErrResponse
-//	@Failure		404			{object}	JsonErrResponse
-//	@Failure		500			{object}	JsonErrResponse
-//	@Header			200			{string}	session_key	"Auth cookie with new valid session id"
-//	@Router			/api/v1/auth/login [post]
-func (s *Service) Login(w http.ResponseWriter, r *http.Request) {
-	s.log.Info("request on signup", log.F{"method", r.Method}, log.F{"path", r.URL.Path})
-	SetContentTypeJSON(w)
-
-	defer r.Body.Close()
-	params := usecase.NewCredentials()
-	err := json.NewDecoder(r.Body).Decode(&params)
-	if err != nil {
-		s.log.Info("failed to parse parameters", log.F{"error", err.Error()})
-		err = responseError(w, "parse_body", "the correct username and password are expected to be received in JSON format")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	if !isValidPassword(params.Password) || !isValidUsername(params.Username) {
-		s.log.Info("invalid credentials")
-		err = responseError(w, "invalid_credentials", "invalid user credentials")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	user, err := s.userCase.Authentication(r.Context(), params)
-	if err != nil {
-		s.log.Warn(err.Error())
-		err = responseError(w, "bad_credentials", "incorrect user credentials")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	session, err := s.sm.CreateNewSessionForUser(r.Context(), user.ID)
-	if err != nil {
-		s.log.Error(err.Error())
-		err = responseError(w, "session", "failed to create a session for the user")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	cookie := &http.Cookie{
-		Name:     "session_key",
-		Value:    session.Key,
-		HttpOnly: true,
-		Secure:   true,
-		Path:     "/",
-		Expires:  session.Expire,
-		SameSite: http.SameSiteStrictMode,
-	}
-	http.SetCookie(w, cookie)
-
-	err = responseOk(w, "a new session has been created for the user", nil)
-	if err != nil {
-		s.log.Error(err.Error())
-	}
-}
-
-// SignUp godoc
-//
-//	@Description	User registration
-//	@Tags			Auth
-//	@Accept			json
-//	@Produce		json
-//	@Param			username	body		string	true	"Username"	example(clicker123)
-//	@Param			email		body		string	true	"Email"		example(clickkk@gmail.com)
-//	@Param			password	body		string	true	"Password"	example(safe_pass)
-//	@Success		200			{object}	JsonResponse
-//	@Failure		400			{object}	JsonErrResponse
-//	@Failure		404			{object}	JsonErrResponse
-//	@Failure		500			{object}	JsonErrResponse
-//	@Router			/api/v1/auth/signup [post]
-func (s *Service) Signup(w http.ResponseWriter, r *http.Request) {
-	s.log.Info("request on signup", log.F{"method", r.Method}, log.F{"path", r.URL.Path})
-	SetContentTypeJSON(w)
-
-	defer r.Body.Close()
-	user := &user.User{}
-	err := json.NewDecoder(r.Body).Decode(user)
-	if err != nil {
-		s.log.Info("failed to parse parameters", log.F{"error", err.Error()})
-		err = responseError(w, "parse_body", "the correct username, email and password are expected to be received in JSON format")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	if err := IsValidUserForRegistration(user); err != nil {
-		s.log.Info("invalid user registration data")
-		err = responseError(w, "invalid_params", err.Error())
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	err = s.userCase.Register(r.Context(), user)
-	if err != nil {
-		s.log.Warn(err.Error())
-		err = responseError(w, "uniq_fields", "there is already an account with this username or password")
-	} else {
-		err = responseOk(w, "the user has been successfully registered", nil)
-	}
-	if err != nil {
-		s.log.Error(err.Error())
-	}
-}
-
-// Logout godoc
-//
-//	@Description	User logout, session deletion
-//	@Tags			Auth
-//	@Produce		json
-//	@Param			session_key	header		string	false	"Auth session id"	example(senjs7rvdnrgkjdr)
-//
-//	@Success		200			{object}	JsonResponse
-//	@Failure		400			{object}	JsonErrResponse
-//	@Failure		404			{object}	JsonErrResponse
-//	@Failure		500			{object}	JsonErrResponse
-//	@Header			200			{string}	Session-id	"Auth cookie with expired session id"
-//	@Router			/api/v1/auth/logout [delete]
-func (s *Service) Logout(w http.ResponseWriter, r *http.Request) {
-	s.log.Info("request on logout", log.F{"method", r.Method}, log.F{"path", r.URL.Path})
-	SetContentTypeJSON(w)
-
-	cookie, err := r.Cookie("session_key")
-	if err != nil {
-		s.log.Info("no cookie", log.F{"error", err.Error()})
-		err = responseError(w, "no_auth", "to log out, you must first log in")
-		if err != nil {
-			s.log.Error(err.Error())
-		}
-		return
-	}
-
-	cookie.Expires = time.Now().UTC().AddDate(0, -1, 0)
-	http.SetCookie(w, cookie)
-
-	err = s.sm.DeleteUserSession(r.Context(), cookie.Value)
-	if err != nil {
-		s.log.Error(err.Error())
-		err = responseError(w, "session", "the user logged out, but his session did not end")
-	} else {
-		err = responseOk(w, "the user has successfully logged out", nil)
-	}
-	if err != nil {
-		s.log.Error(err.Error())
-	}
-}
diff --git a/internal/pkg/service/auth_test.go b/internal/pkg/service/auth_test.go
deleted file mode 100644
index 384296e..0000000
--- a/internal/pkg/service/auth_test.go
+++ /dev/null
@@ -1,467 +0,0 @@
-package service
-
-import (
-	"encoding/json"
-	"io"
-	"math/rand"
-	"net/http"
-	"net/http/httptest"
-	"strconv"
-	"strings"
-	"testing"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/session"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/user"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/stretchr/testify/require"
-)
-
-func checkAuthCookie(cookies []*http.Cookie) bool {
-	if cookies == nil {
-		return false
-	}
-	for _, cookie := range cookies {
-		if cookie.Name == "session_key" {
-			return true
-		}
-	}
-	return false
-}
-
-func TestCheckLogin(t *testing.T) {
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	sm := session.New(log, ramrepo.NewRamSessionRepo(db))
-	userCase := user.New(log, ramrepo.NewRamUserRepo(db))
-	service := New(log, sm, userCase, nil)
-
-	url := "https://domain.test:8080/api/v1/login"
-	goodCases := []struct {
-		name    string
-		cookie  *http.Cookie
-		expResp JsonResponse
-	}{
-		{
-			"sending valid session_key",
-			&http.Cookie{
-				Name:  "session_key",
-				Value: "461afabf38b3147c",
-			},
-			JsonResponse{
-				Status:  "ok",
-				Message: "user found",
-				Body:    map[string]interface{}{"username": "dogsLover", "avatar": "https://pinspire.online:8081/upload/avatars/default-avatar.png"},
-			},
-		},
-	}
-
-	for _, tCase := range goodCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodGet, url, nil)
-			req.AddCookie(tCase.cookie)
-			w := httptest.NewRecorder()
-
-			service.CheckLogin(w, req)
-
-			var actualResp JsonResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			actualResp.Body = actualResp.Body.(map[string]interface{})
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-
-	badCases := []struct {
-		name    string
-		cookie  *http.Cookie
-		expResp JsonErrResponse
-	}{
-		{
-			"sending empty cookie",
-			&http.Cookie{
-				Name:  "",
-				Value: "",
-			},
-			JsonErrResponse{
-				Status:  "error",
-				Message: "the user is not logged in",
-				Code:    "no_auth",
-			},
-		},
-		{
-			"sending invalid cookie",
-			&http.Cookie{
-				Name:  "session_key",
-				Value: "doesn't exist",
-			},
-			JsonErrResponse{
-				Status:  "error",
-				Message: "no user session found",
-				Code:    "no_auth",
-			},
-		},
-		{
-			"sending cookie with invald user",
-			&http.Cookie{
-				Name:  "session_key",
-				Value: "f4280a941b664d02",
-			},
-			JsonErrResponse{
-				Status:  "error",
-				Message: "no user was found for this session",
-				Code:    "no_auth",
-			},
-		},
-	}
-
-	for _, tCase := range badCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodGet, url, nil)
-			req.AddCookie(tCase.cookie)
-			w := httptest.NewRecorder()
-
-			service.CheckLogin(w, req)
-
-			var actualResp JsonErrResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-
-}
-
-func TestLogin(t *testing.T) {
-	url := "https://domain.test:8080/api/v1/login"
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	sm := session.New(log, ramrepo.NewRamSessionRepo(db))
-	userCase := user.New(log, ramrepo.NewRamUserRepo(db))
-	service := New(log, sm, userCase, nil)
-
-	goodCases := []struct {
-		name    string
-		rawBody string
-		expResp JsonResponse
-	}{
-		{
-			"providing correct and valid user credentials",
-			`{"username":"dogsLover", "password":"big_string"}`,
-			JsonResponse{
-				Status:  "ok",
-				Message: "a new session has been created for the user",
-				Body:    nil,
-			},
-		},
-	}
-
-	for _, tCase := range goodCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodPost, url, io.NopCloser(strings.NewReader(tCase.rawBody)))
-			w := httptest.NewRecorder()
-
-			service.Login(w, req)
-
-			var actualResp JsonResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-			require.True(t, checkAuthCookie(w.Result().Cookies()))
-		})
-	}
-
-	badCases := []struct {
-		name    string
-		rawBody string
-		expResp JsonErrResponse
-	}{
-		{
-			"providing invalid credentials - broken body",
-			"{'username': 'dogsLover', 'password': 'big_string'",
-			JsonErrResponse{
-				Status:  "error",
-				Message: "the correct username and password are expected to be received in JSON format",
-				Code:    "parse_body",
-			},
-		},
-		{
-			"providing invalid credentials - no username",
-			`{"password":"big_string"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing invalid credentials - no password",
-			`{"username":"dogsLover"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing invalid credentials - short username",
-			`{"username":"do", "password":"big_string"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing invalid credentials - long username",
-			`{"username":"dojsbrjfbdrjhbhjldrbgbdrhjgbdjrbgjdhbgjhdbrghbdhj,gbdhjrbgjhdbvkvghkevfghjdvrfhvdhrvbjdfgdrgdr","password":"big_string"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing invalid credentials - short password",
-			`{"username":"dogsLover","password":"bi"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing invalid credentials - long password",
-			`{"username":"dogsLover","password":"biyugsgrusgubskhvfhkdgvfgvdvrjgbsjhgjkshzkljfskfwjkhkfjisuidgoquakflsjuzeofiow3i"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "invalid user credentials",
-				Code:    "invalid_credentials",
-			},
-		},
-		{
-			"providing incorrect credentials - no user with such credentials",
-			`{"username":"dogsLover", "password":"doesn't_exist"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "incorrect user credentials",
-				Code:    "bad_credentials",
-			},
-		},
-	}
-
-	for _, tCase := range badCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodPost, url, io.NopCloser(strings.NewReader(tCase.rawBody)))
-			w := httptest.NewRecorder()
-
-			service.Login(w, req)
-
-			var actualResp JsonErrResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-			require.False(t, checkAuthCookie(w.Result().Cookies()))
-		})
-	}
-}
-
-func TestSignUp(t *testing.T) {
-	url := "https://domain.test:8080/api/v1/signup"
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	sm := session.New(log, ramrepo.NewRamSessionRepo(db))
-	userCase := user.New(log, ramrepo.NewRamUserRepo(db))
-	service := New(log, sm, userCase, nil)
-
-	goodCases := []struct {
-		name    string
-		rawBody string
-		expResp JsonResponse
-	}{
-		{
-			"providing correct and valid data for signup",
-			`{"username":"newbie", "password":"getHigh123", "email":"world@uandex.ru"}`,
-			JsonResponse{
-				Status:  "ok",
-				Message: "the user has been successfully registered",
-				Body:    nil,
-			},
-		},
-	}
-
-	for _, tCase := range goodCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodPost, url, io.NopCloser(strings.NewReader(tCase.rawBody)))
-			w := httptest.NewRecorder()
-
-			service.Signup(w, req)
-
-			var actualResp JsonResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-
-	badCases := []struct {
-		name    string
-		rawBody string
-		expResp JsonErrResponse
-	}{
-		{
-			"user with such data already exists",
-			`{"username":"dogsLover", "password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "there is already an account with this username or password",
-				Code:    "uniq_fields",
-			},
-		},
-		{
-			"invalid data - broken body",
-			`{"username":"dogsLover", "password":"big_string", "email":"dogslove@gmail.com"`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "the correct username, email and password are expected to be received in JSON format",
-				Code:    "parse_body",
-			},
-		},
-		{
-			"invalid data - no username",
-			`{"password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "username",
-				Code:    "invalid_params",
-			},
-		},
-		{
-			"invalid data - no username, password",
-			`{"email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "password,username",
-				Code:    "invalid_params",
-			},
-		},
-		{
-			"invalid data - short username",
-			`{"username":"sh", "password":"big_string", "email":"dogslove@gmail.com"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "username",
-				Code:    "invalid_params",
-			},
-		},
-		{
-			"invalid data - incorrect email",
-			`{"username":"sh", "password":"big_string", "email":"dog"}`,
-			JsonErrResponse{
-				Status:  "error",
-				Message: "email,username",
-				Code:    "invalid_params",
-			},
-		},
-	}
-
-	for _, tCase := range badCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodPost, url, io.NopCloser(strings.NewReader(tCase.rawBody)))
-			w := httptest.NewRecorder()
-
-			service.Signup(w, req)
-
-			var actualResp JsonErrResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-}
-
-func TestLogout(t *testing.T) {
-	url := "https://domain.test:8080/api/v1/logout"
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	sm := session.New(log, ramrepo.NewRamSessionRepo(db))
-	userCase := user.New(log, ramrepo.NewRamUserRepo(db))
-	service := New(log, sm, userCase, nil)
-
-	goodCases := []struct {
-		name    string
-		cookie  *http.Cookie
-		expResp JsonResponse
-	}{
-		{
-			"user is logged in - providing valid cookie",
-			&http.Cookie{
-				Name:  "session_key",
-				Value: "461afabf38b3147c",
-			},
-			JsonResponse{
-				Status:  "ok",
-				Message: "the user has successfully logged out",
-				Body:    nil,
-			},
-		},
-	}
-
-	for _, tCase := range goodCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodGet, url, nil)
-			req.AddCookie(tCase.cookie)
-			w := httptest.NewRecorder()
-
-			service.Logout(w, req)
-
-			var actualResp JsonResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-
-	badCases := []struct {
-		name    string
-		cookie  *http.Cookie
-		expResp JsonErrResponse
-	}{
-		{
-			"user isn't logged in - providing invalid cookie",
-			&http.Cookie{
-				Name:  "not_auth_cookie",
-				Value: "blablalba",
-			},
-			JsonErrResponse{
-				Status:  "error",
-				Message: "to log out, you must first log in",
-				Code:    "no_auth",
-			},
-		},
-	}
-
-	for _, tCase := range badCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			req := httptest.NewRequest(http.MethodGet, url, nil)
-			req.AddCookie(tCase.cookie)
-			w := httptest.NewRecorder()
-
-			service.Logout(w, req)
-
-			var actualResp JsonErrResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-
-}
diff --git a/internal/pkg/service/pin.go b/internal/pkg/service/pin.go
deleted file mode 100644
index 41332f2..0000000
--- a/internal/pkg/service/pin.go
+++ /dev/null
@@ -1,49 +0,0 @@
-package service
-
-import (
-	"errors"
-	"net/http"
-
-	_ "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
-
-	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-var ErrCountParameterMissing = errors.New("the count parameter is missing")
-var ErrBadParams = errors.New("bad params")
-
-// GetPins godoc
-//
-//	@Description	Get pin collection
-//	@Tags			Pin
-//	@Accept			json
-//	@Produce		json
-//	@Param			lastID	path		string	false	"ID of the pin that will be just before the first pin in the requested collection, 0 by default"	example(2)
-//
-// @Param			count	path		string	true	"Pins quantity after last pin specified in lastID"													example(5)
-// @Success		200		{object}	JsonResponse{body=[]Pin}
-// @Failure		400		{object}	JsonErrResponse
-// @Failure		404		{object}	JsonErrResponse
-// @Failure		500		{object}	JsonErrResponse
-// @Router			/api/v1/pin [get]
-func (s *Service) GetPins(w http.ResponseWriter, r *http.Request) {
-	s.log.Info("request on get pins", log.F{"method", r.Method}, log.F{"path", r.URL.Path})
-	SetContentTypeJSON(w)
-
-	count, lastID, err := FetchValidParamForLoadTape(r.URL)
-	if err != nil {
-		s.log.Info("parse url query params", log.F{"error", err.Error()})
-		err = responseError(w, "bad_params",
-			"expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)")
-	} else {
-		s.log.Sugar().Infof("param: count=%d, lastID=%d", count, lastID)
-		pins, last := s.pinCase.SelectNewPins(r.Context(), count, lastID)
-		err = responseOk(w, "pins received are sorted by id", map[string]any{
-			"pins":   pins,
-			"lastID": last,
-		})
-	}
-	if err != nil {
-		s.log.Error(err.Error())
-	}
-}
diff --git a/internal/pkg/service/pin_test.go b/internal/pkg/service/pin_test.go
deleted file mode 100644
index 2dd7998..0000000
--- a/internal/pkg/service/pin_test.go
+++ /dev/null
@@ -1,158 +0,0 @@
-package service
-
-import (
-	"encoding/json"
-	"fmt"
-	"io"
-	"math/rand"
-	"net/http/httptest"
-	"strconv"
-	"testing"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
-	pinCase "github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/pin"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/stretchr/testify/require"
-)
-
-func TestGetPins(t *testing.T) {
-
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	pinCase := pinCase.New(log, ramrepo.NewRamPinRepo(db))
-	service := New(log, nil, nil, pinCase)
-
-	rawUrl := "https://domain.test:8080/api/v1/pin"
-	goodCases := []struct {
-		rawURL  string
-		expResp JsonResponse
-	}{
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 1, 2),
-			expResp: JsonResponse{
-				Status:  "ok",
-				Message: "pins received are sorted by id",
-				Body: map[string]interface{}{
-					"lastID": 3,
-					"pins": []interface{}{
-						map[string]interface{}{"id": 3},
-					},
-				},
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 2, 3),
-			expResp: JsonResponse{
-				Status:  "ok",
-				Message: "pins received are sorted by id",
-				Body: map[string]interface{}{
-					"lastID": 5,
-					"pins": []interface{}{
-						map[string]interface{}{"id": 4},
-						map[string]interface{}{"id": 5},
-					},
-				},
-			},
-		},
-	}
-
-	for _, tCase := range goodCases {
-		t.Run(fmt.Sprintf("TestGetPins good: %s", tCase.rawURL), func(t *testing.T) {
-			req := httptest.NewRequest("GET", tCase.rawURL, nil)
-			w := httptest.NewRecorder()
-			service.GetPins(w, req)
-
-			var actualResp JsonResponse
-			json.NewDecoder(w.Result().Body).Decode(&actualResp)
-
-			require.Equal(t, tCase.expResp.Status, actualResp.Status)
-			require.Equal(t, tCase.expResp.Message, actualResp.Message)
-			expLastID := tCase.expResp.Body.(map[string]interface{})["lastID"].(int)
-			actualLastID := actualResp.Body.(map[string]interface{})["lastID"].(float64)
-
-			expIDs, actualIDs := make([]int, 0), make([]int, 0)
-			for _, pin := range tCase.expResp.Body.(map[string]interface{})["pins"].([]interface{}) {
-				expIDs = append(expIDs, pin.(map[string]interface{})["id"].(int))
-			}
-			for _, pin := range actualResp.Body.(map[string]interface{})["pins"].([]interface{}) {
-				actualIDs = append(actualIDs, int(pin.(map[string]interface{})["id"].(float64)))
-			}
-
-			require.Equal(t, expLastID, int(actualLastID))
-			require.Equal(t, expIDs, actualIDs)
-		})
-	}
-
-	badCases := []struct {
-		rawURL  string
-		expResp JsonErrResponse
-	}{
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 0, 3),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, -2, 3),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 213123, 3),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?count=%d&lastID=%d", rawUrl, 0, -1),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?count=&lastID=%d", rawUrl, 3),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-		{
-			rawURL: fmt.Sprintf("%s?lastID=%d", rawUrl, 3),
-			expResp: JsonErrResponse{
-				Status:  "error",
-				Message: "expected parameters: count(positive integer: [1; 1000]), lastID(positive integer, the absence of this parameter is equal to the value 0)",
-				Code:    "bad_params",
-			},
-		},
-	}
-
-	for _, tCase := range badCases {
-		t.Run(fmt.Sprintf("TestGetPins bad: %s", tCase.rawURL), func(t *testing.T) {
-			req := httptest.NewRequest("GET", tCase.rawURL, nil)
-			w := httptest.NewRecorder()
-			service.GetPins(w, req)
-
-			resp := w.Result()
-			body, _ := io.ReadAll(resp.Body)
-			var actualResp JsonErrResponse
-
-			json.Unmarshal(body, &actualResp)
-			require.Equal(t, tCase.expResp, actualResp)
-		})
-	}
-}
diff --git a/internal/pkg/service/response.go b/internal/pkg/service/response.go
deleted file mode 100644
index df3121d..0000000
--- a/internal/pkg/service/response.go
+++ /dev/null
@@ -1,57 +0,0 @@
-package service
-
-import (
-	"encoding/json"
-	"fmt"
-	"net/http"
-)
-
-// type JsonResponseNoBody struct {
-// 	Status  string `json:"status" example:"ok"`
-// 	Message string `json:"message" example:"Response message"`
-// }
-
-type JsonResponse struct {
-	Status  string      `json:"status" example:"ok"`
-	Message string      `json:"message" example:"Response message"`
-	Body    interface{} `json:"body" extensions:"x-omitempty"`
-} // @name JsonResponse
-
-type JsonErrResponse struct {
-	Status  string `json:"status" example:"error"`
-	Message string `json:"message" example:"Error description"`
-	Code    string `json:"code"`
-} // @name JsonErrResponse
-
-func SetContentTypeJSON(w http.ResponseWriter) {
-	w.Header().Set("Content-Type", "application/json")
-}
-
-func responseOk(w http.ResponseWriter, message string, body any) error {
-	res := JsonResponse{
-		Status:  "ok",
-		Message: message,
-		Body:    body,
-	}
-	resBytes, err := json.Marshal(res)
-	if err != nil {
-		return fmt.Errorf("responseOk: %w", err)
-	}
-	w.WriteHeader(http.StatusOK)
-	_, err = w.Write(resBytes)
-	return err
-}
-
-func responseError(w http.ResponseWriter, code, message string) error {
-	res := JsonErrResponse{
-		Status:  "error",
-		Message: message,
-		Code:    code,
-	}
-	resBytes, err := json.Marshal(res)
-	if err != nil {
-		return fmt.Errorf("responseError: %w", err)
-	}
-	_, err = w.Write(resBytes)
-	return err
-}
diff --git a/internal/pkg/service/service.go b/internal/pkg/service/service.go
deleted file mode 100644
index 05bb916..0000000
--- a/internal/pkg/service/service.go
+++ /dev/null
@@ -1,24 +0,0 @@
-package service
-
-import (
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/pin"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/session"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/usecases/user"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-type Service struct {
-	log      *logger.Logger
-	userCase *user.Usecase
-	pinCase  *pin.Usecase
-	sm       *session.SessionManager
-}
-
-func New(log *logger.Logger, sm *session.SessionManager, user *user.Usecase, pin *pin.Usecase) *Service {
-	return &Service{
-		log:      log,
-		userCase: user,
-		pinCase:  pin,
-		sm:       sm,
-	}
-}
diff --git a/internal/pkg/service/validation.go b/internal/pkg/service/validation.go
deleted file mode 100644
index 9356faa..0000000
--- a/internal/pkg/service/validation.go
+++ /dev/null
@@ -1,96 +0,0 @@
-package service
-
-import (
-	"fmt"
-	"net/url"
-	"strconv"
-	"strings"
-	"unicode"
-
-	valid "github.com/asaskevich/govalidator"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
-)
-
-type errorFields []string
-
-func (b *errorFields) Error() string {
-	return strings.Join(*b, ",")
-}
-
-func (b *errorFields) addInvalidField(fieldName string) {
-	*b = append(*b, fieldName)
-}
-
-func (b *errorFields) Err() error {
-	if len(*b) == 0 {
-		return nil
-	}
-	return b
-}
-
-func FetchValidParamForLoadTape(u *url.URL) (count int, lastID int, err error) {
-	if param := u.Query().Get("count"); len(param) > 0 {
-		c, err := strconv.ParseInt(param, 10, 64)
-		if err != nil {
-			return 0, 0, fmt.Errorf("fetch count param for load tape: %w", err)
-		}
-		count = int(c)
-	} else {
-		return 0, 0, ErrCountParameterMissing
-	}
-	if param := u.Query().Get("lastID"); len(param) > 0 {
-		last, err := strconv.ParseInt(param, 10, 64)
-		if err != nil {
-			return 0, 0, fmt.Errorf("fetch lastID param for load tape: %w", err)
-		}
-		lastID = int(last)
-	}
-	if count <= 0 || count > 1000 || lastID < 0 {
-		return 0, 0, ErrBadParams
-	}
-	return
-}
-
-func IsValidUserForRegistration(user *user.User) error {
-	invalidFields := new(errorFields)
-
-	if !isValidPassword(user.Password) {
-		invalidFields.addInvalidField("password")
-	}
-	if !isValidEmail(user.Email) {
-		invalidFields.addInvalidField("email")
-	}
-	if !isValidUsername(user.Username) {
-		invalidFields.addInvalidField("username")
-	}
-
-	return invalidFields.Err()
-}
-
-func isValidUsername(username string) bool {
-	if len(username) < 4 || len(username) > 50 {
-		return false
-	}
-	for _, r := range username {
-		if !(unicode.IsNumber(r) || unicode.IsSymbol(r) || unicode.IsPunct(r) || unicode.IsLetter(r)) {
-			return false
-		}
-	}
-	return true
-}
-
-func isValidEmail(email string) bool {
-	return valid.IsEmail(email) && len(email) <= 50
-}
-
-func isValidPassword(password string) bool {
-	if len(password) < 8 || len(password) > 50 {
-		return false
-	}
-	for _, r := range password {
-		if !(unicode.IsNumber(r) || unicode.IsSymbol(r) || unicode.IsPunct(r) || unicode.IsLetter(r)) {
-			return false
-		}
-	}
-	return true
-}
diff --git a/internal/pkg/service/validation_test.go b/internal/pkg/service/validation_test.go
deleted file mode 100644
index f2b094c..0000000
--- a/internal/pkg/service/validation_test.go
+++ /dev/null
@@ -1,68 +0,0 @@
-package service
-
-import (
-	"net/url"
-	"testing"
-
-	"github.com/stretchr/testify/require"
-)
-
-func TestFetchValidParams(t *testing.T) {
-	rawUrl := "https://domain.test:8080/api/v1/pin"
-
-	tests := []struct {
-		name                  string
-		queryRow              string
-		wantCount, wantLastID int
-	}{
-		{"both parameters were passed correctly", "?count=6&lastID=12", 6, 12},
-		{"both parameters were passed correctly in a different order", "?lastID=1&count=3", 3, 1},
-		{"repeating parameters", "?count=14&lastID=1&count=3&lastID=55&lastID=65", 14, 1},
-		{"repeating parameters", "?count=14&lastID=1&count=3&lastID=55&lastID=65", 14, 1},
-		{"empty parameter lastID", "?count=7", 7, 0},
-		{"the parameter lastID is registered but not specified", "?lastID=&count=17", 17, 0},
-	}
-
-	for _, test := range tests {
-		t.Run(test.name, func(t *testing.T) {
-			URL, err := url.Parse(rawUrl + test.queryRow)
-			if err != nil {
-				t.Fatalf("error when parsing into the url.URL structure: %v", err)
-			}
-			actualCount, actualLastID, err := FetchValidParamForLoadTape(URL)
-			require.NoError(t, err)
-			require.Equal(t, test.wantCount, actualCount)
-			require.Equal(t, test.wantLastID, actualLastID)
-		})
-	}
-}
-
-func TestErrorFetchValidParams(t *testing.T) {
-	rawUrl := "https://domain.test:8080/api/v1/pin"
-
-	tests := []struct {
-		name     string
-		queryRow string
-		wantErr  error
-	}{
-		{"empty query row", "", ErrCountParameterMissing},
-		{"count equal zero", "?count=0", ErrBadParams},
-		{"negative count", "?count=-5&lastID=12", ErrBadParams},
-		{"negative lastID", "?count=5&lastID=-6", ErrBadParams},
-		{"requested count is more than a thousand", "?count=1001", ErrBadParams},
-		{"count param empty", "?count=&lastID=6", ErrCountParameterMissing},
-	}
-
-	for _, test := range tests {
-		t.Run(test.name, func(t *testing.T) {
-			URL, err := url.Parse(rawUrl + test.queryRow)
-			if err != nil {
-				t.Fatalf("error when parsing into the url.URL structure: %v", err)
-			}
-			actualCount, actualLastID, err := FetchValidParamForLoadTape(URL)
-			require.ErrorIs(t, err, test.wantErr)
-			require.Equal(t, 0, actualCount)
-			require.Equal(t, 0, actualLastID)
-		})
-	}
-}
diff --git a/internal/pkg/usecase/auth/mock/auth_mock.go b/internal/pkg/usecase/auth/mock/auth_mock.go
new file mode 100644
index 0000000..813ae3b
--- /dev/null
+++ b/internal/pkg/usecase/auth/mock/auth_mock.go
@@ -0,0 +1,95 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	session "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/session"
+	user "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// GetUserIDBySession mocks base method.
+func (m *MockUsecase) GetUserIDBySession(ctx context.Context, sess *session.Session) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserIDBySession", ctx, sess)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetUserIDBySession indicates an expected call of GetUserIDBySession.
+func (mr *MockUsecaseMockRecorder) GetUserIDBySession(ctx, sess interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserIDBySession", reflect.TypeOf((*MockUsecase)(nil).GetUserIDBySession), ctx, sess)
+}
+
+// Login mocks base method.
+func (m *MockUsecase) Login(ctx context.Context, username, password string) (*session.Session, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "Login", ctx, username, password)
+	ret0, _ := ret[0].(*session.Session)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// Login indicates an expected call of Login.
+func (mr *MockUsecaseMockRecorder) Login(ctx, username, password interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "Login", reflect.TypeOf((*MockUsecase)(nil).Login), ctx, username, password)
+}
+
+// Logout mocks base method.
+func (m *MockUsecase) Logout(ctx context.Context, sess *session.Session) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "Logout", ctx, sess)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// Logout indicates an expected call of Logout.
+func (mr *MockUsecaseMockRecorder) Logout(ctx, sess interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "Logout", reflect.TypeOf((*MockUsecase)(nil).Logout), ctx, sess)
+}
+
+// Register mocks base method.
+func (m *MockUsecase) Register(ctx context.Context, user *user.User) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "Register", ctx, user)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// Register indicates an expected call of Register.
+func (mr *MockUsecaseMockRecorder) Register(ctx, user interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "Register", reflect.TypeOf((*MockUsecase)(nil).Register), ctx, user)
+}
diff --git a/internal/pkg/usecase/auth/usecase.go b/internal/pkg/usecase/auth/usecase.go
new file mode 100644
index 0000000..49ee9bf
--- /dev/null
+++ b/internal/pkg/usecase/auth/usecase.go
@@ -0,0 +1,80 @@
+package auth
+
+import (
+	"context"
+	"fmt"
+
+	authProto "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/auth"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/session"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"google.golang.org/protobuf/types/known/timestamppb"
+)
+
+//go:generate mockgen -destination=./mock/auth_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	Register(ctx context.Context, user *entity.User) error
+	Login(ctx context.Context, username, password string) (*session.Session, error)
+	GetUserIDBySession(ctx context.Context, sess *session.Session) (int, error)
+	Logout(ctx context.Context, sess *session.Session) error
+}
+
+type authCase struct {
+	client authProto.AuthClient
+}
+
+func New(client authProto.AuthClient) *authCase {
+	return &authCase{client}
+}
+
+func (ac *authCase) Register(ctx context.Context, user *entity.User) error {
+	_, err := ac.client.Register(ctx, &authProto.RegisterData{
+		Cred: &authProto.Credentials{
+			Username: user.Username,
+			Password: user.Password,
+		},
+		Email: user.Email,
+	})
+	if err != nil {
+		return fmt.Errorf("register: %w", err)
+	}
+	return nil
+}
+
+func (ac *authCase) Logout(ctx context.Context, sess *session.Session) error {
+	_, err := ac.client.Logout(ctx, &authProto.Session{
+		Key:    sess.Key,
+		UserID: int64(sess.UserID),
+		Expire: timestamppb.New(sess.Expire),
+	})
+	if err != nil {
+		return fmt.Errorf("logout: %w", err)
+	}
+	return nil
+}
+
+func (ac *authCase) Login(ctx context.Context, username, password string) (*session.Session, error) {
+	sess, err := ac.client.Login(ctx, &authProto.Credentials{
+		Username: username,
+		Password: password,
+	})
+	if err != nil {
+		return nil, fmt.Errorf("login: %w", err)
+	}
+	return &session.Session{
+		Key:    sess.Key,
+		UserID: int(sess.UserID),
+		Expire: sess.Expire.AsTime(),
+	}, nil
+}
+
+func (ac *authCase) GetUserIDBySession(ctx context.Context, sess *session.Session) (int, error) {
+	userID, err := ac.client.GetUserID(ctx, &authProto.Session{
+		Key:    sess.Key,
+		UserID: int64(sess.UserID),
+		Expire: timestamppb.New(sess.Expire),
+	})
+	if err != nil {
+		return 0, fmt.Errorf("get user id by session: %w", err)
+	}
+	return int(userID.Id), nil
+}
diff --git a/internal/pkg/usecase/board/delete.go b/internal/pkg/usecase/board/delete.go
index da4fd8b..cab1a87 100644
--- a/internal/pkg/usecase/board/delete.go
+++ b/internal/pkg/usecase/board/delete.go
@@ -31,3 +31,31 @@ func (bCase *boardUsecase) DeleteCertainBoard(ctx context.Context, boardID int)
 
 	return nil
 }
+
+func (bCase *boardUsecase) DeletePinFromBoard(ctx context.Context, boardID, pinID int) error {
+	boardAuthorID, err := bCase.boardRepo.GetBoardAuthorByBoardID(ctx, boardID)
+	if err != nil {
+		switch err {
+		case repository.ErrNoData:
+			return ErrNoSuchBoard
+		default:
+			return fmt.Errorf("delete certain board: %w", err)
+		}
+	}
+
+	currUserID, loggedIn := ctx.Value(auth.KeyCurrentUserID).(int)
+	if !(loggedIn && currUserID == boardAuthorID) {
+		return ErrNoAccess
+	}
+
+	err = bCase.boardRepo.DeletePinFromBoard(ctx, boardID, pinID)
+	if err != nil {
+		switch err {
+		case repository.ErrNoDataAffected:
+			return ErrNoPinOnBoard
+		}
+		return fmt.Errorf("delete certain board: %w", err)
+	}
+
+	return nil
+}
diff --git a/internal/pkg/usecase/board/errors.go b/internal/pkg/usecase/board/errors.go
index b241f3c..da4ef61 100644
--- a/internal/pkg/usecase/board/errors.go
+++ b/internal/pkg/usecase/board/errors.go
@@ -5,6 +5,7 @@ import "errors"
 var (
 	ErrInvalidUsername = errors.New("username doesn't exist")
 	ErrNoSuchBoard     = errors.New("board is not accessable or doesn't exist")
+	ErrNoPinOnBoard    = errors.New("no such pin on board")
 	ErrInvalidUserID   = errors.New("invalid user id has been provided")
 	ErrNoAccess        = errors.New("no access for this action")
 )
diff --git a/internal/pkg/usecase/board/get.go b/internal/pkg/usecase/board/get.go
index 9e02946..a56467f 100644
--- a/internal/pkg/usecase/board/get.go
+++ b/internal/pkg/usecase/board/get.go
@@ -36,26 +36,23 @@ func (bCase *boardUsecase) GetBoardsByUsername(ctx context.Context, username str
 		return nil, fmt.Errorf("get boards by user id usecase: %w", err)
 	}
 
-	for _, board := range boards {
-		board.Sanitize(bCase.sanitizer)
-	}
 	return boards, nil
 }
 
-func (bCase *boardUsecase) GetCertainBoard(ctx context.Context, boardID int) (entity.BoardWithContent, error) {
+func (bCase *boardUsecase) GetCertainBoard(ctx context.Context, boardID int) (entity.BoardWithContent, string, error) {
 	boardAuthorID, err := bCase.boardRepo.GetBoardAuthorByBoardID(ctx, boardID)
 	if err != nil {
 		switch err {
 		case repository.ErrNoData:
-			return entity.BoardWithContent{}, ErrNoSuchBoard
+			return entity.BoardWithContent{}, "", ErrNoSuchBoard
 		default:
-			return entity.BoardWithContent{}, fmt.Errorf("get certain board: %w", err)
+			return entity.BoardWithContent{}, "", fmt.Errorf("get certain board: %w", err)
 		}
 	}
 
 	boardContributors, err := bCase.boardRepo.GetContributorsByBoardID(ctx, boardID)
 	if err != nil {
-		return entity.BoardWithContent{}, fmt.Errorf("get certain board: %w", err)
+		return entity.BoardWithContent{}, "", fmt.Errorf("get certain board: %w", err)
 	}
 
 	boardContributorsIDs := make([]int, 0, len(boardContributors))
@@ -70,18 +67,16 @@ func (bCase *boardUsecase) GetCertainBoard(ctx context.Context, boardID int) (en
 		hasAccess = true
 	}
 
-	board, err := bCase.boardRepo.GetBoardByID(ctx, boardID, hasAccess)
+	board, username, err := bCase.boardRepo.GetBoardByID(ctx, boardID, hasAccess)
 	if err != nil {
 		switch err {
 		case repository.ErrNoData:
-			return entity.BoardWithContent{}, ErrNoSuchBoard
+			return entity.BoardWithContent{}, "", ErrNoSuchBoard
 		default:
-			return entity.BoardWithContent{}, fmt.Errorf("get certain board: %w", err)
+			return entity.BoardWithContent{}, "", fmt.Errorf("get certain board: %w", err)
 		}
 	}
-
-	board.Sanitize(bCase.sanitizer)
-	return board, nil
+	return board, username, nil
 }
 
 func isContributor(contributorsIDs []int, userID int) bool {
diff --git a/internal/pkg/usecase/board/mock/board_mock.go b/internal/pkg/usecase/board/mock/board_mock.go
index 39845c3..1b14189 100644
--- a/internal/pkg/usecase/board/mock/board_mock.go
+++ b/internal/pkg/usecase/board/mock/board_mock.go
@@ -79,6 +79,20 @@ func (mr *MockUsecaseMockRecorder) DeleteCertainBoard(ctx, boardID interface{})
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteCertainBoard", reflect.TypeOf((*MockUsecase)(nil).DeleteCertainBoard), ctx, boardID)
 }
 
+// DeletePinFromBoard mocks base method.
+func (m *MockUsecase) DeletePinFromBoard(ctx context.Context, boardID, pinID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeletePinFromBoard", ctx, boardID, pinID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeletePinFromBoard indicates an expected call of DeletePinFromBoard.
+func (mr *MockUsecaseMockRecorder) DeletePinFromBoard(ctx, boardID, pinID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeletePinFromBoard", reflect.TypeOf((*MockUsecase)(nil).DeletePinFromBoard), ctx, boardID, pinID)
+}
+
 // FixPinsOnBoard mocks base method.
 func (m *MockUsecase) FixPinsOnBoard(ctx context.Context, boardID int, pinIds []int, userID int) error {
 	m.ctrl.T.Helper()
@@ -125,12 +139,13 @@ func (mr *MockUsecaseMockRecorder) GetBoardsByUsername(ctx, username interface{}
 }
 
 // GetCertainBoard mocks base method.
-func (m *MockUsecase) GetCertainBoard(ctx context.Context, boardID int) (board.BoardWithContent, error) {
+func (m *MockUsecase) GetCertainBoard(ctx context.Context, boardID int) (board.BoardWithContent, string, error) {
 	m.ctrl.T.Helper()
 	ret := m.ctrl.Call(m, "GetCertainBoard", ctx, boardID)
 	ret0, _ := ret[0].(board.BoardWithContent)
-	ret1, _ := ret[1].(error)
-	return ret0, ret1
+	ret1, _ := ret[1].(string)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
 }
 
 // GetCertainBoard indicates an expected call of GetCertainBoard.
diff --git a/internal/pkg/usecase/board/update.go b/internal/pkg/usecase/board/update.go
index c30180c..686f44e 100644
--- a/internal/pkg/usecase/board/update.go
+++ b/internal/pkg/usecase/board/update.go
@@ -49,10 +49,6 @@ func (bCase *boardUsecase) GetBoardInfoForUpdate(ctx context.Context, boardID in
 		}
 	}
 
-	board.Sanitize(bCase.sanitizer)
-	for id, title := range tagTitles {
-		tagTitles[id] = bCase.sanitizer.Sanitize(title)
-	}
 	return board, tagTitles, nil
 }
 
diff --git a/internal/pkg/usecase/board/usecase.go b/internal/pkg/usecase/board/usecase.go
index 641945c..730e042 100644
--- a/internal/pkg/usecase/board/usecase.go
+++ b/internal/pkg/usecase/board/usecase.go
@@ -8,18 +8,18 @@ import (
 	boardRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/board"
 	userRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/microcosm-cc/bluemonday"
 )
 
 //go:generate mockgen -destination=./mock/board_mock.go -package=mock -source=usecase.go Usecase
 type Usecase interface {
 	CreateNewBoard(ctx context.Context, newBoard entity.Board, tagTitles []string) (int, error)
 	GetBoardsByUsername(ctx context.Context, username string) ([]entity.BoardWithContent, error)
-	GetCertainBoard(ctx context.Context, boardID int) (entity.BoardWithContent, error)
+	GetCertainBoard(ctx context.Context, boardID int) (entity.BoardWithContent, string, error)
 	GetBoardInfoForUpdate(ctx context.Context, boardID int) (entity.Board, []string, error)
 	UpdateBoardInfo(ctx context.Context, updatedBoard entity.Board, tagTitles []string) error
 	DeleteCertainBoard(ctx context.Context, boardID int) error
 	FixPinsOnBoard(ctx context.Context, boardID int, pinIds []int, userID int) error
+	DeletePinFromBoard(ctx context.Context, boardID, pinID int) error
 	CheckAvailabilityFeedPinCfgOnBoard(ctx context.Context, cfg pin.FeedPinConfig, userID int, isAuth bool) error
 }
 
@@ -27,9 +27,8 @@ type boardUsecase struct {
 	log       *logger.Logger
 	boardRepo boardRepo.Repository
 	userRepo  userRepo.Repository
-	sanitizer *bluemonday.Policy
 }
 
-func New(logger *logger.Logger, boardRepo boardRepo.Repository, userRepo userRepo.Repository, sanitizer *bluemonday.Policy) *boardUsecase {
-	return &boardUsecase{log: logger, boardRepo: boardRepo, userRepo: userRepo, sanitizer: sanitizer}
+func New(logger *logger.Logger, boardRepo boardRepo.Repository, userRepo userRepo.Repository) *boardUsecase {
+	return &boardUsecase{log: logger, boardRepo: boardRepo, userRepo: userRepo}
 }
diff --git a/internal/pkg/usecase/board/usecase_test.go b/internal/pkg/usecase/board/usecase_test.go
index f3c20dd..251d70c 100644
--- a/internal/pkg/usecase/board/usecase_test.go
+++ b/internal/pkg/usecase/board/usecase_test.go
@@ -339,6 +339,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 		GetBoardByID             GetBoardByID
 		hasAccess                bool
 		expBoard                 entity.BoardWithContent
+		expUsername              string
 		wantErr                  bool
 		expErr                   error
 	}{
@@ -363,7 +364,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 					PinsNumber: 1,
 					Pins:       []string{"/pic1"},
 					TagTitles:  []string{"good", "bad"},
-				}, nil).Times(1)
+				}, "user", nil).Times(1)
 			},
 			hasAccess: true,
 			expBoard: entity.BoardWithContent{
@@ -377,6 +378,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 				Pins:       []string{"/pic1"},
 				TagTitles:  []string{"good", "bad"},
 			},
+			expUsername: "user",
 		},
 		{
 			name:    "private board, valid board id, request from contributor",
@@ -399,7 +401,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 					PinsNumber: 1,
 					Pins:       []string{"/pic1"},
 					TagTitles:  []string{"good", "bad"},
-				}, nil).Times(1)
+				}, "user", nil).Times(1)
 			},
 			hasAccess: true,
 			expBoard: entity.BoardWithContent{
@@ -413,6 +415,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 				Pins:       []string{"/pic1"},
 				TagTitles:  []string{"good", "bad"},
 			},
+			expUsername: "user",
 		},
 		{
 			name:    "private board, valid board id, request from not author, not contributor",
@@ -425,7 +428,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 				mockRepo.EXPECT().GetContributorsByBoardID(ctx, boardID).Return([]uEntity.User{{ID: 123}}, nil).Times(1)
 			},
 			GetBoardByID: func(mockRepo *mock_board.MockRepository, ctx context.Context, boardID int, hasAccess bool) {
-				mockRepo.EXPECT().GetBoardByID(ctx, boardID, hasAccess).Return(entity.BoardWithContent{}, repository.ErrNoData).Times(1)
+				mockRepo.EXPECT().GetBoardByID(ctx, boardID, hasAccess).Return(entity.BoardWithContent{}, "", repository.ErrNoData).Times(1)
 			},
 			hasAccess: false,
 			expBoard:  entity.BoardWithContent{},
@@ -443,7 +446,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 				mockRepo.EXPECT().GetContributorsByBoardID(ctx, boardID).Return([]uEntity.User{{ID: 123}}, nil).Times(1)
 			},
 			GetBoardByID: func(mockRepo *mock_board.MockRepository, ctx context.Context, boardID int, hasAccess bool) {
-				mockRepo.EXPECT().GetBoardByID(ctx, boardID, hasAccess).Return(entity.BoardWithContent{}, repository.ErrNoData).Times(1)
+				mockRepo.EXPECT().GetBoardByID(ctx, boardID, hasAccess).Return(entity.BoardWithContent{}, "", repository.ErrNoData).Times(1)
 			},
 			hasAccess: false,
 			expBoard:  entity.BoardWithContent{},
@@ -471,7 +474,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 					PinsNumber: 1,
 					Pins:       []string{"/pic1"},
 					TagTitles:  []string{"good", "bad"},
-				}, nil).Times(1)
+				}, "user", nil).Times(1)
 			},
 			hasAccess: false,
 			expBoard: entity.BoardWithContent{
@@ -485,6 +488,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 				Pins:       []string{"/pic1"},
 				TagTitles:  []string{"good", "bad"},
 			},
+			expUsername: "user",
 		},
 		{
 			name:    "invalid board id",
@@ -514,7 +518,7 @@ func TestBoardUsecase_GetCertainBoard(t *testing.T) {
 			test.GetBoardByID(mockBoardRepo, test.inCtx, test.boardID, test.hasAccess)
 
 			boardUsecase := New(log, mockBoardRepo, nil, sanitizer)
-			board, err := boardUsecase.GetCertainBoard(test.inCtx, test.boardID)
+			board, _, err := boardUsecase.GetCertainBoard(test.inCtx, test.boardID)
 
 			if test.wantErr {
 				require.EqualError(t, err, test.expErr.Error())
diff --git a/internal/pkg/usecase/comment/check.go b/internal/pkg/usecase/comment/check.go
new file mode 100644
index 0000000..a278b68
--- /dev/null
+++ b/internal/pkg/usecase/comment/check.go
@@ -0,0 +1,29 @@
+package comment
+
+import (
+	"context"
+	"errors"
+	"fmt"
+)
+
+var ErrNotAvailableAction = errors.New("action not available for user")
+
+func (c *commentCase) isAvailableCommentForDelete(ctx context.Context, userID, commentID int) error {
+	comment, err := c.repo.GetCommentByID(ctx, commentID)
+	if err != nil {
+		return fmt.Errorf("get comment for check available comment for delete: %w", err)
+	}
+
+	if comment.Author.ID == userID {
+		return nil
+	}
+
+	authorPinID, err := c.GetAuthorIdOfThePin(ctx, comment.PinID)
+	if err != nil {
+		return fmt.Errorf("get author pin for check availabel comment: %w", err)
+	}
+	if authorPinID != userID {
+		return ErrNotAvailableAction
+	}
+	return nil
+}
diff --git a/internal/pkg/usecase/comment/mock/comment_mock.go b/internal/pkg/usecase/comment/mock/comment_mock.go
new file mode 100644
index 0000000..92bec48
--- /dev/null
+++ b/internal/pkg/usecase/comment/mock/comment_mock.go
@@ -0,0 +1,133 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	comment "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// DeleteComment mocks base method.
+func (m *MockUsecase) DeleteComment(ctx context.Context, userID, commentID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeleteComment", ctx, userID, commentID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeleteComment indicates an expected call of DeleteComment.
+func (mr *MockUsecaseMockRecorder) DeleteComment(ctx, userID, commentID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteComment", reflect.TypeOf((*MockUsecase)(nil).DeleteComment), ctx, userID, commentID)
+}
+
+// GetFeedCommentOnPin mocks base method.
+func (m *MockUsecase) GetFeedCommentOnPin(ctx context.Context, userID, pinID, count, lastID int) ([]comment.Comment, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetFeedCommentOnPin", ctx, userID, pinID, count, lastID)
+	ret0, _ := ret[0].([]comment.Comment)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetFeedCommentOnPin indicates an expected call of GetFeedCommentOnPin.
+func (mr *MockUsecaseMockRecorder) GetFeedCommentOnPin(ctx, userID, pinID, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetFeedCommentOnPin", reflect.TypeOf((*MockUsecase)(nil).GetFeedCommentOnPin), ctx, userID, pinID, count, lastID)
+}
+
+// PutCommentOnPin mocks base method.
+func (m *MockUsecase) PutCommentOnPin(ctx context.Context, userID int, comment *comment.Comment) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "PutCommentOnPin", ctx, userID, comment)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// PutCommentOnPin indicates an expected call of PutCommentOnPin.
+func (mr *MockUsecaseMockRecorder) PutCommentOnPin(ctx, userID, comment interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "PutCommentOnPin", reflect.TypeOf((*MockUsecase)(nil).PutCommentOnPin), ctx, userID, comment)
+}
+
+// MockavailablePinChecker is a mock of availablePinChecker interface.
+type MockavailablePinChecker struct {
+	ctrl     *gomock.Controller
+	recorder *MockavailablePinCheckerMockRecorder
+}
+
+// MockavailablePinCheckerMockRecorder is the mock recorder for MockavailablePinChecker.
+type MockavailablePinCheckerMockRecorder struct {
+	mock *MockavailablePinChecker
+}
+
+// NewMockavailablePinChecker creates a new mock instance.
+func NewMockavailablePinChecker(ctrl *gomock.Controller) *MockavailablePinChecker {
+	mock := &MockavailablePinChecker{ctrl: ctrl}
+	mock.recorder = &MockavailablePinCheckerMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockavailablePinChecker) EXPECT() *MockavailablePinCheckerMockRecorder {
+	return m.recorder
+}
+
+// GetAuthorIdOfThePin mocks base method.
+func (m *MockavailablePinChecker) GetAuthorIdOfThePin(ctx context.Context, pinID int) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetAuthorIdOfThePin", ctx, pinID)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetAuthorIdOfThePin indicates an expected call of GetAuthorIdOfThePin.
+func (mr *MockavailablePinCheckerMockRecorder) GetAuthorIdOfThePin(ctx, pinID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetAuthorIdOfThePin", reflect.TypeOf((*MockavailablePinChecker)(nil).GetAuthorIdOfThePin), ctx, pinID)
+}
+
+// IsAvailablePinForViewingUser mocks base method.
+func (m *MockavailablePinChecker) IsAvailablePinForViewingUser(ctx context.Context, userID, pinID int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "IsAvailablePinForViewingUser", ctx, userID, pinID)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// IsAvailablePinForViewingUser indicates an expected call of IsAvailablePinForViewingUser.
+func (mr *MockavailablePinCheckerMockRecorder) IsAvailablePinForViewingUser(ctx, userID, pinID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "IsAvailablePinForViewingUser", reflect.TypeOf((*MockavailablePinChecker)(nil).IsAvailablePinForViewingUser), ctx, userID, pinID)
+}
diff --git a/internal/pkg/usecase/comment/usecase.go b/internal/pkg/usecase/comment/usecase.go
new file mode 100644
index 0000000..b7f4272
--- /dev/null
+++ b/internal/pkg/usecase/comment/usecase.go
@@ -0,0 +1,110 @@
+package comment
+
+import (
+	"context"
+	"fmt"
+	"time"
+
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	commentRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/comment"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime/notification"
+)
+
+//go:generate mockgen -destination=./mock/comment_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	PutCommentOnPin(ctx context.Context, userID int, comment *entity.Comment) (int, error)
+	GetFeedCommentOnPin(ctx context.Context, userID, pinID, count, lastID int) ([]entity.Comment, int, error)
+	DeleteComment(ctx context.Context, userID, commentID int) error
+	GetCommentWithAuthor(ctx context.Context, commentID int) (*entity.Comment, error)
+}
+
+type availablePinChecker interface {
+	IsAvailablePinForViewingUser(ctx context.Context, userID, pinID int) error
+	GetAuthorIdOfThePin(ctx context.Context, pinID int) (int, error)
+}
+
+const _timeoutNotification = 5 * time.Minute
+
+type commentCase struct {
+	availablePinChecker
+
+	notifyCase notification.Usecase
+	repo       commentRepo.Repository
+
+	notifyIsEnable bool
+}
+
+func New(repo commentRepo.Repository, checker availablePinChecker, notifyCase notification.Usecase) *commentCase {
+	comCase := &commentCase{
+		availablePinChecker: checker,
+		repo:                repo,
+		notifyCase:          notifyCase,
+	}
+
+	if notifyCase != nil {
+		comCase.notifyIsEnable = true
+	}
+	return comCase
+}
+
+func (c *commentCase) PutCommentOnPin(ctx context.Context, userID int, comment *entity.Comment) (int, error) {
+	err := c.IsAvailablePinForViewingUser(ctx, userID, comment.PinID)
+	if err != nil {
+		return 0, fmt.Errorf("put comment on not available pin: %w", err)
+	}
+
+	comment.Author = &user.User{ID: userID}
+
+	id, err := c.repo.AddComment(ctx, comment)
+	if err != nil {
+		return 0, fmt.Errorf("put comment on available pin: %w", err)
+	}
+
+	if c.notifyIsEnable {
+		ctx, _ = context.WithTimeout(context.Background(), _timeoutNotification)
+		go c.notifyCase.NotifyCommentLeftOnPin(ctx, id)
+	}
+
+	return id, nil
+}
+
+func (c *commentCase) GetFeedCommentOnPin(ctx context.Context, userID, pinID, count, lastID int) ([]entity.Comment, int, error) {
+	err := c.IsAvailablePinForViewingUser(ctx, userID, pinID)
+	if err != nil {
+		return nil, 0, fmt.Errorf("put comment on not available pin: %w", err)
+	}
+
+	feed, err := c.repo.GetCommensToPin(ctx, pinID, lastID, count)
+	if err != nil {
+		err = fmt.Errorf("get feed comment on pin: %w", err)
+	}
+
+	var newLastID int
+	if len(feed) > 0 {
+		newLastID = feed[len(feed)-1].ID
+	}
+	return feed, newLastID, err
+}
+
+func (c *commentCase) DeleteComment(ctx context.Context, userID, commentID int) error {
+	err := c.isAvailableCommentForDelete(ctx, userID, commentID)
+	if err != nil {
+		return fmt.Errorf("check available delete comment: %w", err)
+	}
+
+	err = c.repo.EditStatusCommentOnDeletedByID(ctx, commentID)
+	if err != nil {
+		return fmt.Errorf("delete comment: %w", err)
+	}
+	return nil
+}
+
+func (c *commentCase) GetCommentWithAuthor(ctx context.Context, commentID int) (*entity.Comment, error) {
+	comment, err := c.repo.GetCommentByID(ctx, commentID)
+	if err != nil {
+		return nil, fmt.Errorf("get comment with author: %w", err)
+	}
+
+	return comment, nil
+}
diff --git a/internal/pkg/usecase/image/filtration.go b/internal/pkg/usecase/image/filtration.go
new file mode 100644
index 0000000..457a1af
--- /dev/null
+++ b/internal/pkg/usecase/image/filtration.go
@@ -0,0 +1,101 @@
+package image
+
+import (
+	"context"
+	"errors"
+	"strings"
+
+	vision "cloud.google.com/go/vision/v2/apiv1"
+	pb "cloud.google.com/go/vision/v2/apiv1/visionpb"
+	validate "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/validation"
+)
+
+var (
+	maxAnnotationsNumber int32 = 15
+	explicitLabels             = []string{"goose", "duck"}
+	ErrExplicitImage           = errors.New("image content doesn't comply with service policy")
+)
+
+type ImageFilter interface {
+	Filter(ctx context.Context, imgBytes []byte, explicitLabels []string) error
+}
+
+type googleVision struct {
+	visionClient *vision.ImageAnnotatorClient
+	censor       validate.ProfanityCensor
+}
+
+func NewFilter(client *vision.ImageAnnotatorClient, censor validate.ProfanityCensor) *googleVision {
+	return &googleVision{client, censor}
+}
+
+func CheckAnnotations(annotation *pb.SafeSearchAnnotation) bool {
+	return annotation.GetAdult() >= pb.Likelihood_LIKELY ||
+		annotation.GetMedical() >= pb.Likelihood_LIKELY ||
+		annotation.GetRacy() >= pb.Likelihood_LIKELY ||
+		annotation.GetViolence() >= pb.Likelihood_LIKELY ||
+		annotation.GetSpoof() >= pb.Likelihood_LIKELY
+}
+
+func GetImageLabels(annotations []*pb.EntityAnnotation) []string {
+	imgLabels := make([]string, 0, len(annotations))
+	for _, label := range annotations {
+		imgLabels = append(imgLabels, label.GetDescription())
+	}
+	return imgLabels
+}
+
+func CheckCertainLabels(explicitLabels, imgLabels []string) bool {
+	for _, label := range explicitLabels {
+		if HasExplicitLabel(label, imgLabels) {
+			return true
+		}
+	}
+	return false
+}
+
+func HasExplicitLabel(explicitLabel string, imgLabels []string) bool {
+	for _, label := range imgLabels {
+		if strings.Contains(strings.ToLower(label), strings.ToLower(explicitLabel)) {
+			return true
+		}
+	}
+	return false
+}
+
+func getTextDescription(resp *pb.AnnotateImageResponse) string {
+	annotations := resp.GetTextAnnotations()
+	if len(annotations) == 0 {
+		return ""
+	}
+	return annotations[0].GetDescription()
+}
+
+func CheckExplicit(resp *pb.AnnotateImageResponse, explicitLabels []string, censor validate.ProfanityCensor) error {
+	if CheckCertainLabels(explicitLabels, GetImageLabels(resp.GetLabelAnnotations())) ||
+		CheckAnnotations(resp.GetSafeSearchAnnotation()) ||
+		censor.IsProfane(getTextDescription(resp)) {
+		return ErrExplicitImage
+	}
+	return nil
+}
+
+func (filter *googleVision) Filter(ctx context.Context, imgBytes []byte, explicitLabels []string) error {
+	req := &pb.BatchAnnotateImagesRequest{
+		Requests: []*pb.AnnotateImageRequest{
+			{
+				Image: &pb.Image{Content: imgBytes},
+				Features: []*pb.Feature{
+					{Type: pb.Feature_LABEL_DETECTION, MaxResults: maxAnnotationsNumber},
+					{Type: pb.Feature_SAFE_SEARCH_DETECTION, MaxResults: maxAnnotationsNumber},
+					{Type: pb.Feature_TEXT_DETECTION},
+				},
+			},
+		},
+	}
+	resp, err := filter.visionClient.BatchAnnotateImages(ctx, req)
+	if err != nil {
+		return err
+	}
+	return CheckExplicit(resp.GetResponses()[0], explicitLabels, filter.censor)
+}
diff --git a/internal/pkg/usecase/image/usecase.go b/internal/pkg/usecase/image/usecase.go
index 799ed62..8798040 100644
--- a/internal/pkg/usecase/image/usecase.go
+++ b/internal/pkg/usecase/image/usecase.go
@@ -2,6 +2,7 @@ package image
 
 import (
 	"bytes"
+	"context"
 	"errors"
 	"fmt"
 	"io"
@@ -12,35 +13,45 @@ import (
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/validator/image/check"
 )
 
-const PrefixURLImage = "https://pinspire.online:8081/"
+const PrefixURLImage = "https://pinspire.site/"
 
-var ErrInvalidImage = errors.New("invalid images")
-var ErrUploadFile = errors.New("file upload failed")
+var (
+	ErrInvalidImage = errors.New("invalid images")
+	ErrUploadFile   = errors.New("file upload failed")
+)
 
 //go:generate mockgen -destination=./mock/image_mock.go -package=mock -source=usecase.go Usecase
 type Usecase interface {
-	UploadImage(path string, mimeType string, size int64, image io.Reader, check check.CheckSize) (string, error)
+	UploadImage(ctx context.Context, path string, mimeType string, size int64, image io.Reader, check check.CheckSize) (string, error)
 }
 
 type imageCase struct {
-	log  *log.Logger
-	repo repo.Repository
+	log    *log.Logger
+	repo   repo.Repository
+	filter ImageFilter
 }
 
-func New(log *log.Logger, repo repo.Repository) *imageCase {
-	return &imageCase{log, repo}
+func New(log *log.Logger, repo repo.Repository, filter ImageFilter) *imageCase {
+	return &imageCase{log, repo, filter}
 }
 
-func (img *imageCase) UploadImage(path string, mimeType string, size int64, image io.Reader, check check.CheckSize) (string, error) {
+func (img *imageCase) UploadImage(ctx context.Context, path string, mimeType string, size int64, image io.Reader, check check.CheckSize) (string, error) {
 	buf := bytes.NewBuffer(nil)
 
 	extension, ok := valid.IsValidImage(io.TeeReader(image, buf), mimeType, check)
 	if !ok {
 		return "", ErrInvalidImage
 	}
-
 	io.Copy(buf, image)
 
+	err := img.filter.Filter(ctx, buf.Bytes(), explicitLabels)
+	if err != nil {
+		if err == ErrExplicitImage {
+			return "", err
+		}
+		return "", fmt.Errorf("upload image: %w", err)
+	}
+
 	filename, written, err := img.repo.SaveImage(path, extension, buf)
 	if err != nil {
 		return "", fmt.Errorf("upload image: %w", err)
diff --git a/internal/pkg/usecase/message/convert.go b/internal/pkg/usecase/message/convert.go
new file mode 100644
index 0000000..847065e
--- /dev/null
+++ b/internal/pkg/usecase/message/convert.go
@@ -0,0 +1,41 @@
+package message
+
+import (
+	"github.com/jackc/pgx/v5/pgtype"
+
+	mess "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+)
+
+func convertFeedMessage(feed *mess.FeedMessage) []entity.Message {
+	res := make([]entity.Message, len(feed.Messages))
+	for ind := range feed.Messages {
+		res[ind] = entity.Message{
+			ID:   int(feed.Messages[ind].GetId().Id),
+			From: int(feed.Messages[ind].UserFrom),
+			To:   int(feed.Messages[ind].UserTo),
+			Content: pgtype.Text{
+				String: feed.Messages[ind].GetContent(),
+				Valid:  true,
+			},
+		}
+	}
+	return res
+}
+
+func convertFeedChat(feed *mess.FeedChat) entity.FeedUserChats {
+	res := make(entity.FeedUserChats, len(feed.Chats))
+
+	for ind := range feed.Chats {
+		res[ind] = entity.ChatWithUser{
+			MessageLastID: int(feed.Chats[ind].GetLastMessageID()),
+			WichWhomChat: user.User{
+				ID:       int(feed.Chats[ind].GetChat().GetUserID()),
+				Username: feed.Chats[ind].GetChat().GetUsername(),
+				Avatar:   feed.Chats[ind].GetChat().GetAvatar(),
+			},
+		}
+	}
+	return res
+}
diff --git a/internal/pkg/usecase/message/mock/message_mock.go b/internal/pkg/usecase/message/mock/message_mock.go
new file mode 100644
index 0000000..3b6d816
--- /dev/null
+++ b/internal/pkg/usecase/message/mock/message_mock.go
@@ -0,0 +1,142 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	message "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	message0 "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/message"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// DeleteMessage mocks base method.
+func (m *MockUsecase) DeleteMessage(ctx context.Context, userID int, mes *message.Message) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "DeleteMessage", ctx, userID, mes)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// DeleteMessage indicates an expected call of DeleteMessage.
+func (mr *MockUsecaseMockRecorder) DeleteMessage(ctx, userID, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteMessage", reflect.TypeOf((*MockUsecase)(nil).DeleteMessage), ctx, userID, mes)
+}
+
+// GetMessage mocks base method.
+func (m *MockUsecase) GetMessage(ctx context.Context, userID, messageID int) (*message.Message, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessage", ctx, userID, messageID)
+	ret0, _ := ret[0].(*message.Message)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetMessage indicates an expected call of GetMessage.
+func (mr *MockUsecaseMockRecorder) GetMessage(ctx, userID, messageID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessage", reflect.TypeOf((*MockUsecase)(nil).GetMessage), ctx, userID, messageID)
+}
+
+// GetMessagesFromChat mocks base method.
+func (m *MockUsecase) GetMessagesFromChat(ctx context.Context, userID int, chat message.Chat, count, lastID int) ([]message.Message, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetMessagesFromChat", ctx, userID, chat, count, lastID)
+	ret0, _ := ret[0].([]message.Message)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetMessagesFromChat indicates an expected call of GetMessagesFromChat.
+func (mr *MockUsecaseMockRecorder) GetMessagesFromChat(ctx, userID, chat, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetMessagesFromChat", reflect.TypeOf((*MockUsecase)(nil).GetMessagesFromChat), ctx, userID, chat, count, lastID)
+}
+
+// GetUserChatsWithOtherUsers mocks base method.
+func (m *MockUsecase) GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (message.FeedUserChats, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserChatsWithOtherUsers", ctx, userID, count, lastID)
+	ret0, _ := ret[0].(message.FeedUserChats)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetUserChatsWithOtherUsers indicates an expected call of GetUserChatsWithOtherUsers.
+func (mr *MockUsecaseMockRecorder) GetUserChatsWithOtherUsers(ctx, userID, count, lastID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserChatsWithOtherUsers", reflect.TypeOf((*MockUsecase)(nil).GetUserChatsWithOtherUsers), ctx, userID, count, lastID)
+}
+
+// SendMessage mocks base method.
+func (m *MockUsecase) SendMessage(ctx context.Context, userID int, mes *message.Message) (int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "SendMessage", ctx, userID, mes)
+	ret0, _ := ret[0].(int)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// SendMessage indicates an expected call of SendMessage.
+func (mr *MockUsecaseMockRecorder) SendMessage(ctx, userID, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SendMessage", reflect.TypeOf((*MockUsecase)(nil).SendMessage), ctx, userID, mes)
+}
+
+// SubscribeUserToAllChats mocks base method.
+func (m *MockUsecase) SubscribeUserToAllChats(ctx context.Context, userID int) (<-chan message0.EventMessage, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "SubscribeUserToAllChats", ctx, userID)
+	ret0, _ := ret[0].(<-chan message0.EventMessage)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// SubscribeUserToAllChats indicates an expected call of SubscribeUserToAllChats.
+func (mr *MockUsecaseMockRecorder) SubscribeUserToAllChats(ctx, userID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SubscribeUserToAllChats", reflect.TypeOf((*MockUsecase)(nil).SubscribeUserToAllChats), ctx, userID)
+}
+
+// UpdateContentMessage mocks base method.
+func (m *MockUsecase) UpdateContentMessage(ctx context.Context, userID int, mes *message.Message) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "UpdateContentMessage", ctx, userID, mes)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// UpdateContentMessage indicates an expected call of UpdateContentMessage.
+func (mr *MockUsecaseMockRecorder) UpdateContentMessage(ctx, userID, mes interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateContentMessage", reflect.TypeOf((*MockUsecase)(nil).UpdateContentMessage), ctx, userID, mes)
+}
diff --git a/internal/pkg/usecase/message/usecase.go b/internal/pkg/usecase/message/usecase.go
new file mode 100644
index 0000000..a48369c
--- /dev/null
+++ b/internal/pkg/usecase/message/usecase.go
@@ -0,0 +1,207 @@
+package message
+
+import (
+	"context"
+	"errors"
+	"fmt"
+	"strconv"
+
+	"github.com/jackc/pgx/v5/pgtype"
+	"google.golang.org/grpc/metadata"
+
+	mess "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/messenger"
+	messMS "github.com/go-park-mail-ru/2023_2_OND_team/internal/microservices/messenger/delivery/grpc"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/message"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime/chat"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+var ErrNoAccess = errors.New("there is no access to perform this action")
+var ErrRealTimeDisable = errors.New("realtime disable")
+var ErrUnknowObj = errors.New("unknow object")
+
+//go:generate mockgen -destination=./mock/message_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, int, error)
+	SendMessage(ctx context.Context, userID int, mes *entity.Message) (int, error)
+	GetMessagesFromChat(ctx context.Context, userID int, chat entity.Chat, count, lastID int) (feed []entity.Message, newLastID int, err error)
+	UpdateContentMessage(ctx context.Context, userID int, mes *entity.Message) error
+	DeleteMessage(ctx context.Context, userID int, mes *entity.Message) error
+	GetMessage(ctx context.Context, userID int, messageID int) (*entity.Message, error)
+	SubscribeUserToAllChats(ctx context.Context, userID int) (<-chan EventMessage, error)
+}
+
+type EventMessage struct {
+	Type    string
+	Message *entity.Message
+	Err     error
+}
+
+func makeErrEventMessage(err error) EventMessage {
+	return EventMessage{Err: err}
+}
+
+type messageCase struct {
+	client           mess.MessengerClient
+	realtimeChatCase chat.Usecase
+	log              *logger.Logger
+	realtimeIsEnable bool
+}
+
+func New(log *logger.Logger, cl mess.MessengerClient, rtChatCase chat.Usecase) *messageCase {
+	m := &messageCase{
+		client: cl,
+		log:    log,
+	}
+
+	if rtChatCase != nil {
+		m.realtimeChatCase = rtChatCase
+		m.realtimeIsEnable = true
+	}
+
+	return m
+}
+
+func (m *messageCase) SendMessage(ctx context.Context, userID int, mes *entity.Message) (int, error) {
+	msgID, err := m.client.SendMessage(setAuthenticatedMetadataCtx(ctx, userID), &mess.Message{
+		UserFrom: int64(userID),
+		UserTo:   int64(mes.To),
+		Content:  mes.Content.String,
+	})
+	if err != nil {
+		return 0, fmt.Errorf("send message by grpc client")
+	}
+
+	if m.realtimeIsEnable {
+		go m.realtimeChatCase.PublishNewMessage(ctx, mes.To, int(msgID.GetId()))
+	}
+
+	return int(msgID.GetId()), nil
+}
+
+func (m *messageCase) GetMessagesFromChat(ctx context.Context, userID int, chat entity.Chat, count, lastID int) (feed []entity.Message, newLastID int, err error) {
+	feedMsg, err := m.client.MessageFromChat(setAuthenticatedMetadataCtx(ctx, userID), &mess.FeedMessageRequest{
+		Chat: &mess.Chat{
+			UserID1: int64(chat[0]),
+			UserID2: int64(chat[1]),
+		},
+		Count:  int64(count),
+		LastID: int64(lastID),
+	})
+	if err != nil {
+		err = fmt.Errorf("get message by : %w", err)
+	}
+	if feedMsg == nil {
+		return nil, 0, err
+	}
+
+	return convertFeedMessage(feedMsg), int(feedMsg.LastID), nil
+}
+
+func (m *messageCase) UpdateContentMessage(ctx context.Context, userID int, mes *entity.Message) error {
+	if _, err := m.client.UpdateMessage(setAuthenticatedMetadataCtx(ctx, userID), &mess.Message{
+		Id: &mess.MsgID{
+			Id: int64(mes.ID),
+		},
+		Content: mes.Content.String,
+	}); err != nil {
+		return fmt.Errorf("update messege by grpc client")
+	}
+
+	if m.realtimeIsEnable {
+		go m.realtimeChatCase.PublishUpdateMessage(ctx, mes.To, mes.ID)
+	}
+
+	return nil
+}
+
+func (m *messageCase) DeleteMessage(ctx context.Context, userID int, mes *entity.Message) error {
+	if _, err := m.client.DeleteMessage(setAuthenticatedMetadataCtx(ctx, userID), &mess.MsgID{Id: int64(mes.ID)}); err != nil {
+		return fmt.Errorf("delete messege by grpc client")
+	}
+
+	if m.realtimeIsEnable {
+		go m.realtimeChatCase.PublishDeleteMessage(ctx, mes.To, mes.ID)
+	}
+
+	return nil
+}
+
+func (m *messageCase) GetMessage(ctx context.Context, userID int, messageID int) (*entity.Message, error) {
+	mes, err := m.client.GetMessage(setAuthenticatedMetadataCtx(ctx, userID), &mess.MsgID{Id: int64(messageID)})
+	if err != nil {
+		return nil, fmt.Errorf("get message by grpc client")
+	}
+	return &entity.Message{
+		ID:   int(mes.GetId().Id),
+		From: int(mes.GetUserFrom()),
+		To:   int(mes.GetUserTo()),
+		Content: pgtype.Text{
+			String: mes.Content,
+			Valid:  true,
+		},
+	}, nil
+}
+
+func (m *messageCase) GetUserChatsWithOtherUsers(ctx context.Context, userID, count, lastID int) (entity.FeedUserChats, int, error) {
+	feed, err := m.client.UserChatsWithOtherUsers(setAuthenticatedMetadataCtx(ctx, userID), &mess.FeedChatRequest{
+		Count:  int64(count),
+		LastID: int64(lastID),
+	})
+	var errRes error
+	if err != nil {
+		errRes = fmt.Errorf("get user chats by grpc client: %w", err)
+	}
+	if feed == nil {
+		return nil, 0, errRes
+	}
+	return convertFeedChat(feed), int(feed.GetLastID()), errRes
+}
+
+func (m *messageCase) SubscribeUserToAllChats(ctx context.Context, userID int) (<-chan EventMessage, error) {
+	if !m.realtimeIsEnable {
+		return nil, ErrRealTimeDisable
+	}
+
+	subClient, err := m.realtimeChatCase.SubscribeUserToAllChats(ctx, userID)
+	if err != nil {
+		return nil, fmt.Errorf("subscribe: %w", err)
+	}
+
+	chanEvMsg := make(chan EventMessage)
+	go m.receiveFromSubClient(ctx, userID, subClient, chanEvMsg)
+	return chanEvMsg, nil
+}
+
+func (m *messageCase) receiveFromSubClient(ctx context.Context, userID int, subClient <-chan chat.EventMessageObjectID, chanEvMsg chan<- EventMessage) {
+	defer close(chanEvMsg)
+
+	var (
+		evMsg EventMessage
+		err   error
+	)
+	for msgObjID := range subClient {
+		if msgObjID.Err != nil {
+			chanEvMsg <- makeErrEventMessage(fmt.Errorf("receive from subcribtion client: %w", msgObjID.Err))
+			return
+		}
+
+		evMsg = EventMessage{
+			Type: msgObjID.Type,
+		}
+
+		evMsg.Message, err = m.GetMessage(ctx, userID, msgObjID.MessageID)
+		if err != nil {
+			m.log.Error(err.Error())
+			evMsg.Err = err
+		} else if evMsg.Type == "delete" {
+			evMsg.Message.Content.String = ""
+		}
+
+		chanEvMsg <- evMsg
+	}
+}
+
+func setAuthenticatedMetadataCtx(ctx context.Context, userID int) context.Context {
+	return metadata.AppendToOutgoingContext(ctx, messMS.AuthenticatedMetadataKey, strconv.FormatInt(int64(userID), 10))
+}
diff --git a/internal/pkg/usecase/pin/check.go b/internal/pkg/usecase/pin/check.go
index 396a45d..4d0a751 100644
--- a/internal/pkg/usecase/pin/check.go
+++ b/internal/pkg/usecase/pin/check.go
@@ -6,6 +6,7 @@ import (
 	"fmt"
 
 	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 )
 
 var (
@@ -18,8 +19,6 @@ var (
 
 const MaxSizeBatchPin = 100
 
-const UserUnknown = -1
-
 func (p *pinCase) IsAvailablePinForFixOnBoard(ctx context.Context, pinID, userID int) error {
 	pin, err := p.repo.GetPinByID(ctx, pinID, false)
 	if err != nil {
@@ -55,7 +54,7 @@ func (p *pinCase) isAvailablePinForViewingUser(ctx context.Context, pin *entity.
 	if pin.Public || pin.Author.ID == userID {
 		return nil
 	}
-	if userID == UserUnknown {
+	if userID == user.UserUnknown {
 		return ErrPinNotAccess
 	}
 
@@ -71,9 +70,13 @@ func (p *pinCase) isAvailablePinForViewingUser(ctx context.Context, pin *entity.
 }
 
 func (p *pinCase) isAvailablePinForSetLike(ctx context.Context, pinID, userID int) error {
+	return p.IsAvailablePinForViewingUser(ctx, userID, pinID)
+}
+
+func (p *pinCase) IsAvailablePinForViewingUser(ctx context.Context, userID, pinID int) error {
 	pin, err := p.repo.GetPinByID(ctx, pinID, false)
 	if err != nil {
-		return fmt.Errorf("get a pin to check for the availability of a like: %w", err)
+		return fmt.Errorf("get a pin to check for the availability: %w", err)
 	}
 
 	return p.isAvailablePinForViewingUser(ctx, pin, userID)
diff --git a/internal/pkg/usecase/pin/update.go b/internal/pkg/usecase/pin/update.go
index fc9281c..790e9e6 100644
--- a/internal/pkg/usecase/pin/update.go
+++ b/internal/pkg/usecase/pin/update.go
@@ -7,11 +7,14 @@ import (
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/pin"
 )
 
+//go:generate easyjson update.go
+
+//easyjson:json
 type PinUpdateData struct {
-	Title       *string
-	Description *string
-	Public      *bool
-	Tags        []string
+	Title       *string  `json:"title"`
+	Description *string  `json:"description"`
+	Public      *bool    `json:"public"`
+	Tags        []string `json:"tags"`
 }
 
 func (p *pinCase) EditPinByID(ctx context.Context, pinID, userID int, updateData *PinUpdateData) error {
diff --git a/internal/pkg/usecase/pin/update_easyjson.go b/internal/pkg/usecase/pin/update_easyjson.go
new file mode 100644
index 0000000..c3930bc
--- /dev/null
+++ b/internal/pkg/usecase/pin/update_easyjson.go
@@ -0,0 +1,174 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package pin
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson2d86586fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(in *jlexer.Lexer, out *PinUpdateData) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "title":
+			if in.IsNull() {
+				in.Skip()
+				out.Title = nil
+			} else {
+				if out.Title == nil {
+					out.Title = new(string)
+				}
+				*out.Title = string(in.String())
+			}
+		case "description":
+			if in.IsNull() {
+				in.Skip()
+				out.Description = nil
+			} else {
+				if out.Description == nil {
+					out.Description = new(string)
+				}
+				*out.Description = string(in.String())
+			}
+		case "public":
+			if in.IsNull() {
+				in.Skip()
+				out.Public = nil
+			} else {
+				if out.Public == nil {
+					out.Public = new(bool)
+				}
+				*out.Public = bool(in.Bool())
+			}
+		case "tags":
+			if in.IsNull() {
+				in.Skip()
+				out.Tags = nil
+			} else {
+				in.Delim('[')
+				if out.Tags == nil {
+					if !in.IsDelim(']') {
+						out.Tags = make([]string, 0, 4)
+					} else {
+						out.Tags = []string{}
+					}
+				} else {
+					out.Tags = (out.Tags)[:0]
+				}
+				for !in.IsDelim(']') {
+					var v1 string
+					v1 = string(in.String())
+					out.Tags = append(out.Tags, v1)
+					in.WantComma()
+				}
+				in.Delim(']')
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson2d86586fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(out *jwriter.Writer, in PinUpdateData) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"title\":"
+		out.RawString(prefix[1:])
+		if in.Title == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Title))
+		}
+	}
+	{
+		const prefix string = ",\"description\":"
+		out.RawString(prefix)
+		if in.Description == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Description))
+		}
+	}
+	{
+		const prefix string = ",\"public\":"
+		out.RawString(prefix)
+		if in.Public == nil {
+			out.RawString("null")
+		} else {
+			out.Bool(bool(*in.Public))
+		}
+	}
+	{
+		const prefix string = ",\"tags\":"
+		out.RawString(prefix)
+		if in.Tags == nil && (out.Flags&jwriter.NilSliceAsEmpty) == 0 {
+			out.RawString("null")
+		} else {
+			out.RawByte('[')
+			for v2, v3 := range in.Tags {
+				if v2 > 0 {
+					out.RawByte(',')
+				}
+				out.String(string(v3))
+			}
+			out.RawByte(']')
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v PinUpdateData) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson2d86586fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v PinUpdateData) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson2d86586fEncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *PinUpdateData) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson2d86586fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *PinUpdateData) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson2d86586fDecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecasePin(l, v)
+}
diff --git a/internal/pkg/usecase/pin/usecase.go b/internal/pkg/usecase/pin/usecase.go
index 6385475..f288769 100644
--- a/internal/pkg/usecase/pin/usecase.go
+++ b/internal/pkg/usecase/pin/usecase.go
@@ -8,6 +8,7 @@ import (
 
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
 	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
 	repo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/pin"
 	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/image"
 	log "github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
@@ -45,8 +46,11 @@ func New(log *log.Logger, imgCase image.Usecase, repo repo.Repository) *pinCase
 }
 
 func (p *pinCase) CreateNewPin(ctx context.Context, pin *entity.Pin, mimeTypePicture string, sizePicture int64, picture io.Reader) error {
-	picturePin, err := p.UploadImage("pins/", mimeTypePicture, sizePicture, picture, check.BothSidesFallIntoRange(100, 6000))
+	picturePin, err := p.UploadImage(ctx, "pins/", mimeTypePicture, sizePicture, picture, check.BothSidesFallIntoRange(100, 6000))
 	if err != nil {
+		if err == image.ErrExplicitImage {
+			return err
+		}
 		return fmt.Errorf("uploading an avatar when creating pin: %w", err)
 	}
 	pin.Picture = picturePin
@@ -97,9 +101,26 @@ func (p *pinCase) ViewFeedPin(ctx context.Context, userID int, cfg pin.FeedPinCo
 		return pin.FeedPin{}, ErrForbiddenAction
 	}
 
-	if !hasBoard && (userID == UserUnknown || !hasUser || userID != user) && cfg.Protection != pin.FeedProtectionPublic {
+	if !hasBoard && (userID == userEntity.UserUnknown || !hasUser || userID != user) && cfg.Protection != pin.FeedProtectionPublic {
 		return pin.FeedPin{}, ErrForbiddenAction
 	}
 
 	return p.repo.GetFeedPins(ctx, cfg)
 }
+
+func (p *pinCase) GetAuthorIdOfThePin(ctx context.Context, pinID int) (int, error) {
+	user, err := p.repo.GetAuthorPin(ctx, pinID)
+	if err != nil {
+		return 0, fmt.Errorf("get author id of the pin: %w", err)
+	}
+	return user.ID, nil
+}
+
+func (p *pinCase) GetPinWithAuthor(ctx context.Context, pinID int) (*pin.Pin, error) {
+	pin, err := p.repo.GetPinByID(ctx, pinID, true)
+	if err != nil {
+		return nil, fmt.Errorf("get a pin with author: %w", err)
+	}
+
+	return pin, nil
+}
diff --git a/internal/pkg/usecase/realtime/chat/chat.go b/internal/pkg/usecase/realtime/chat/chat.go
new file mode 100644
index 0000000..7514d2a
--- /dev/null
+++ b/internal/pkg/usecase/realtime/chat/chat.go
@@ -0,0 +1,114 @@
+package chat
+
+import (
+	"context"
+	"fmt"
+	"strconv"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+type EventMessageObjectID struct {
+	Type      string
+	MessageID int
+	Err       error
+}
+
+func makeErrEventMessageObjectID(err error) EventMessageObjectID {
+	return EventMessageObjectID{Err: err}
+}
+
+type Usecase interface {
+	PublishNewMessage(ctx context.Context, userToWhom, msgID int) error
+	PublishUpdateMessage(ctx context.Context, userToWhom, msgID int) error
+	PublishDeleteMessage(ctx context.Context, userToWhom, msgID int) error
+	SubscribeUserToAllChats(ctx context.Context, userID int) (<-chan EventMessageObjectID, error)
+}
+
+type realtimeCase struct {
+	client realtime.RealTimeClient
+	log    *logger.Logger
+}
+
+func New(client realtime.RealTimeClient, log *logger.Logger) *realtimeCase {
+	return &realtimeCase{client, log}
+}
+
+func (r *realtimeCase) PublishNewMessage(ctx context.Context, userToWhom, msgID int) error {
+	err := r.publishMessage(ctx, userToWhom, msgID, rt.EventType_EV_CREATE)
+	if err != nil {
+		r.log.Error(err.Error())
+		return fmt.Errorf("publish new message: %w", err)
+	}
+	return nil
+}
+
+func (r *realtimeCase) PublishUpdateMessage(ctx context.Context, userToWhom, msgID int) error {
+	err := r.publishMessage(ctx, userToWhom, msgID, rt.EventType_EV_UPDATE)
+	if err != nil {
+		r.log.Error(err.Error())
+		return fmt.Errorf("publish update message: %w", err)
+	}
+	return nil
+}
+
+func (r *realtimeCase) PublishDeleteMessage(ctx context.Context, userToWhom, msgID int) error {
+	err := r.publishMessage(ctx, userToWhom, msgID, rt.EventType_EV_DELETE)
+	if err != nil {
+		r.log.Error(err.Error())
+		return fmt.Errorf("publish delete message: %w", err)
+	}
+	return nil
+}
+
+func (r *realtimeCase) SubscribeUserToAllChats(ctx context.Context, userToWhom int) (<-chan EventMessageObjectID, error) {
+	chPack, err := r.client.Subscribe(ctx, []string{strconv.Itoa(userToWhom)})
+	if err != nil {
+		return nil, fmt.Errorf("subscribe user to all chats: %w", err)
+	}
+
+	chanEvMsg := make(chan EventMessageObjectID)
+	go r.receiveFromSubClient(ctx, chPack, chanEvMsg)
+
+	return chanEvMsg, nil
+}
+
+func (r *realtimeCase) receiveFromSubClient(ctx context.Context, subClient <-chan realtime.Pack, chanEvMsg chan<- EventMessageObjectID) {
+	defer close(chanEvMsg)
+
+	for pack := range subClient {
+		if pack.Err != nil {
+			chanEvMsg <- makeErrEventMessageObjectID(pack.Err)
+			return
+		}
+
+		msg, ok := pack.Body.(*rt.Message_Object)
+		if !ok {
+			chanEvMsg <- makeErrEventMessageObjectID(realtime.ErrUnknownTypeObject)
+			return
+		}
+
+		evMsgID := EventMessageObjectID{MessageID: int(msg.Object.GetId())}
+		switch msg.Object.GetType() {
+		case rt.EventType_EV_CREATE:
+			evMsgID.Type = "create"
+		case rt.EventType_EV_UPDATE:
+			evMsgID.Type = "update"
+		case rt.EventType_EV_DELETE:
+			evMsgID.Type = "delete"
+		}
+
+		chanEvMsg <- evMsgID
+	}
+}
+
+func (r *realtimeCase) publishMessage(ctx context.Context, userID, msgID int, t rt.EventType) error {
+	return r.client.Publish(ctx, strconv.Itoa(userID), &rt.Message_Object{
+		Object: &rt.EventObject{
+			Type: t,
+			Id:   int64(msgID),
+		},
+	})
+}
diff --git a/internal/pkg/usecase/realtime/notification/comment.go b/internal/pkg/usecase/realtime/notification/comment.go
new file mode 100644
index 0000000..0208aad
--- /dev/null
+++ b/internal/pkg/usecase/realtime/notification/comment.go
@@ -0,0 +1,36 @@
+package notification
+
+import (
+	"context"
+	"fmt"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+)
+
+func (n *notificationClient) NotifyCommentLeftOnPin(ctx context.Context, commentID int) error {
+	notifier, ok := n.notifiers[entity.NotifyComment]
+	if !ok {
+		n.log.Error(ErrNotifierNotRegistered.Error())
+		return ErrNotifierNotRegistered
+	}
+
+	chanName, data, err := notifier.ChannelNameForPublishWithData(ctx, commentID)
+	if err != nil {
+		n.log.Error(err.Error())
+		return fmt.Errorf("notify comment left on pin: %w", err)
+	}
+
+	err = n.client.Publish(ctx, chanName, &rt.Message_Content{
+		Content: &rt.EventMap{
+			Type: int64(entity.NotifyComment),
+			M:    data,
+		},
+	})
+	if err != nil {
+		n.log.Error(err.Error())
+		return fmt.Errorf("publish to client: %w", err)
+	}
+
+	return nil
+}
diff --git a/internal/pkg/usecase/realtime/notification/notification.go b/internal/pkg/usecase/realtime/notification/notification.go
new file mode 100644
index 0000000..57d5ae2
--- /dev/null
+++ b/internal/pkg/usecase/realtime/notification/notification.go
@@ -0,0 +1,101 @@
+package notification
+
+import (
+	"context"
+	"errors"
+	"fmt"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/notification"
+	notify "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/notification"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/usecase/realtime"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+var ErrNotifierNotRegistered = errors.New("notifier with this type not registered")
+
+type Usecase interface {
+	NotifyCommentLeftOnPin(ctx context.Context, commentID int) error
+}
+
+type notificationClient struct {
+	client    realtime.RealTimeClient
+	log       *logger.Logger
+	notifiers map[entity.NotifyType]notify.Notifier
+}
+
+func New(cl realtime.RealTimeClient, log *logger.Logger, opts ...Option) *notificationClient {
+	client := &notificationClient{
+		client:    cl,
+		log:       log,
+		notifiers: make(map[entity.NotifyType]notify.Notifier),
+	}
+
+	for _, opt := range opts {
+		opt.apply(client)
+	}
+
+	return client
+}
+
+func (n *notificationClient) SubscribeOnAllNotifications(ctx context.Context, userID int) (<-chan *entity.NotifyMessage, error) {
+	setChans := make(map[string]struct{})
+	for t, notifier := range n.notifiers {
+		nameChans, err := notifier.ChannelsNameForSubscribe(ctx, userID)
+		if err != nil {
+			return nil, fmt.Errorf("receiving name channels for subscribe on %s notifier: %w", entity.TypeString(t), err)
+		}
+
+		for _, name := range nameChans {
+			setChans[name] = struct{}{}
+		}
+	}
+
+	uniqChans := make([]string, 0, len(setChans))
+
+	for nameChan := range setChans {
+		uniqChans = append(uniqChans, nameChan)
+	}
+
+	chanPack, err := n.client.Subscribe(ctx, uniqChans)
+	if err != nil {
+		return nil, fmt.Errorf("subscribe on all notifications: %w", err)
+	}
+
+	chanNotifyMsg := make(chan *entity.NotifyMessage)
+
+	go n.pipelineNotify(chanPack, chanNotifyMsg)
+
+	return chanNotifyMsg, nil
+}
+
+func (n *notificationClient) pipelineNotify(chRecv <-chan realtime.Pack, chSend chan<- *entity.NotifyMessage) {
+	defer close(chSend)
+
+	for pack := range chRecv {
+		if pack.Err != nil {
+			chSend <- entity.NewNotifyMessageWithError(pack.Err)
+			return
+		}
+
+		notifyData, ok := pack.Body.(*rt.Message_Content)
+		if !ok {
+			chSend <- entity.NewNotifyMessageWithError(realtime.ErrUnknownTypeObject)
+			return
+		}
+
+		notifier, ok := n.notifiers[entity.NotifyType(notifyData.Content.GetType())]
+		if !ok {
+			chSend <- entity.NewNotifyMessageWithError(ErrNotifierNotRegistered)
+			return
+		}
+
+		msg, err := notifier.MessageNotify(notifyData.Content.GetM())
+		if err != nil {
+			chSend <- entity.NewNotifyMessageWithError(err)
+			return
+		}
+
+		chSend <- msg
+	}
+}
diff --git a/internal/pkg/usecase/realtime/notification/option.go b/internal/pkg/usecase/realtime/notification/option.go
new file mode 100644
index 0000000..0978634
--- /dev/null
+++ b/internal/pkg/usecase/realtime/notification/option.go
@@ -0,0 +1,19 @@
+package notification
+
+import notify "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/notification"
+
+type Option interface {
+	apply(*notificationClient)
+}
+
+type funcOption func(*notificationClient)
+
+func (f funcOption) apply(cl *notificationClient) {
+	f(cl)
+}
+
+func Register(notifier notify.Notifier) Option {
+	return funcOption(func(cl *notificationClient) {
+		cl.notifiers[notifier.Type()] = notifier
+	})
+}
diff --git a/internal/pkg/usecase/realtime/realtime.go b/internal/pkg/usecase/realtime/realtime.go
new file mode 100644
index 0000000..e5af26f
--- /dev/null
+++ b/internal/pkg/usecase/realtime/realtime.go
@@ -0,0 +1,109 @@
+package realtime
+
+import (
+	"context"
+	"errors"
+	"fmt"
+
+	rt "github.com/go-park-mail-ru/2023_2_OND_team/internal/api/realtime"
+)
+
+var ErrUnknownTypeObject = errors.New("unknown type")
+
+const (
+	_topicChat         = "chat"
+	_topicNotification = "notification"
+)
+
+type RealTimeClient interface {
+	Subscribe(ctx context.Context, nameChans []string) (<-chan Pack, error)
+	Publish(ctx context.Context, chanName string, object any) error
+}
+
+type Pack struct {
+	Body any
+	Err  error
+}
+
+type realtimeClient struct {
+	client rt.RealTimeClient
+	topic  string
+}
+
+func NewRealTimeChatClient(client rt.RealTimeClient) realtimeClient {
+	return realtimeClient{
+		client: client,
+		topic:  _topicChat,
+	}
+}
+
+func NewRealTimeNotificationClient(client rt.RealTimeClient) realtimeClient {
+	return realtimeClient{
+		client: client,
+		topic:  _topicNotification,
+	}
+}
+
+func (r realtimeClient) Publish(ctx context.Context, chanName string, object any) error {
+	pubMsg := &rt.PublishMessage{
+		Channel: &rt.Channel{
+			Topic: r.topic,
+			Name:  chanName,
+		},
+		Message: &rt.Message{},
+	}
+
+	switch body := object.(type) {
+	case *rt.Message_Object:
+		pubMsg.Message.Body = body
+	case *rt.Message_Content:
+		pubMsg.Message.Body = body
+	default:
+		return ErrUnknownTypeObject
+	}
+
+	_, err := r.client.Publish(ctx, pubMsg)
+	if err != nil {
+		return fmt.Errorf("publish as a realtime client: %w", err)
+	}
+	return nil
+}
+
+func (r realtimeClient) Subscribe(ctx context.Context, nameChans []string) (<-chan Pack, error) {
+	chans := &rt.Channels{
+		Chans: make([]*rt.Channel, len(nameChans)),
+	}
+
+	for _, name := range nameChans {
+		chans.Chans = append(chans.Chans, &rt.Channel{Topic: r.topic, Name: name})
+	}
+
+	subClient, err := r.client.Subscribe(ctx, chans)
+	if err != nil {
+		return nil, fmt.Errorf("subscribe as a realtime client: %w", err)
+	}
+
+	ch := make(chan Pack)
+	go runServeSubscribeClient(subClient, ch)
+
+	return ch, nil
+}
+
+func runServeSubscribeClient(client rt.RealTime_SubscribeClient, ch chan<- Pack) {
+	defer close(ch)
+
+	var (
+		mes *rt.Message
+		err error
+	)
+
+	for {
+		mes, err = client.Recv()
+		if err != nil {
+			ch <- Pack{Err: err}
+			return
+		}
+
+		ch <- Pack{Body: mes.GetBody()}
+	}
+}
diff --git a/internal/pkg/usecase/search/mock/search_mock.go b/internal/pkg/usecase/search/mock/search_mock.go
new file mode 100644
index 0000000..dd303a6
--- /dev/null
+++ b/internal/pkg/usecase/search/mock/search_mock.go
@@ -0,0 +1,81 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	search "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// GetBoards mocks base method.
+func (m *MockUsecase) GetBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetBoards", ctx, opts)
+	ret0, _ := ret[0].([]search.BoardForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetBoards indicates an expected call of GetBoards.
+func (mr *MockUsecaseMockRecorder) GetBoards(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetBoards", reflect.TypeOf((*MockUsecase)(nil).GetBoards), ctx, opts)
+}
+
+// GetPins mocks base method.
+func (m *MockUsecase) GetPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetPins", ctx, opts)
+	ret0, _ := ret[0].([]search.PinForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetPins indicates an expected call of GetPins.
+func (mr *MockUsecaseMockRecorder) GetPins(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetPins", reflect.TypeOf((*MockUsecase)(nil).GetPins), ctx, opts)
+}
+
+// GetUsers mocks base method.
+func (m *MockUsecase) GetUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUsers", ctx, opts)
+	ret0, _ := ret[0].([]search.UserForSearch)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetUsers indicates an expected call of GetUsers.
+func (mr *MockUsecaseMockRecorder) GetUsers(ctx, opts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUsers", reflect.TypeOf((*MockUsecase)(nil).GetUsers), ctx, opts)
+}
diff --git a/internal/pkg/usecase/search/usecase.go b/internal/pkg/usecase/search/usecase.go
new file mode 100644
index 0000000..4cfbea8
--- /dev/null
+++ b/internal/pkg/usecase/search/usecase.go
@@ -0,0 +1,49 @@
+package search
+
+import (
+	"context"
+
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/search"
+	sRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/search"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+//go:generate mockgen -destination=./mock/search_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	GetUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error)
+	GetBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error)
+	GetPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error)
+}
+
+type searchUsecase struct {
+	log        *logger.Logger
+	searchRepo sRepo.Repository
+}
+
+func New(log *logger.Logger, searchRepo sRepo.Repository) Usecase {
+	return &searchUsecase{log: log, searchRepo: searchRepo}
+}
+
+func (u *searchUsecase) GetUsers(ctx context.Context, opts *search.SearchOpts) ([]search.UserForSearch, error) {
+	users, err := u.searchRepo.GetFilteredUsers(ctx, opts)
+	if err != nil {
+		return nil, err
+	}
+	return users, nil
+}
+
+func (u *searchUsecase) GetBoards(ctx context.Context, opts *search.SearchOpts) ([]search.BoardForSearch, error) {
+	boards, err := u.searchRepo.GetFilteredBoards(ctx, opts)
+	if err != nil {
+		return nil, err
+	}
+	return boards, nil
+}
+
+func (u *searchUsecase) GetPins(ctx context.Context, opts *search.SearchOpts) ([]search.PinForSearch, error) {
+	pins, err := u.searchRepo.GetFilteredPins(ctx, opts)
+	if err != nil {
+		return nil, err
+	}
+	return pins, nil
+}
diff --git a/internal/pkg/usecase/subscription/create.go b/internal/pkg/usecase/subscription/create.go
new file mode 100644
index 0000000..dba99a0
--- /dev/null
+++ b/internal/pkg/usecase/subscription/create.go
@@ -0,0 +1,15 @@
+package subscription
+
+import "context"
+
+func (u *subscriptionUsecase) SubscribeToUser(ctx context.Context, from, to int) error {
+	if from == to {
+		return &ErrSelfSubscription{}
+	}
+
+	if err := u.userRepo.CheckUserExistence(ctx, to); err != nil {
+		return err
+	}
+
+	return u.subRepo.CreateSubscriptionUser(ctx, from, to)
+}
diff --git a/internal/pkg/usecase/subscription/delete.go b/internal/pkg/usecase/subscription/delete.go
new file mode 100644
index 0000000..c8c95f2
--- /dev/null
+++ b/internal/pkg/usecase/subscription/delete.go
@@ -0,0 +1,15 @@
+package subscription
+
+import "context"
+
+func (u *subscriptionUsecase) UnsubscribeFromUser(ctx context.Context, from, to int) error {
+	if from == to {
+		return &ErrSelfUnsubscription{}
+	}
+
+	if err := u.userRepo.CheckUserExistence(ctx, to); err != nil {
+		return err
+	}
+
+	return u.subRepo.DeleteSubscriptionUser(ctx, from, to)
+}
diff --git a/internal/pkg/usecase/subscription/errors.go b/internal/pkg/usecase/subscription/errors.go
new file mode 100644
index 0000000..4b2e376
--- /dev/null
+++ b/internal/pkg/usecase/subscription/errors.go
@@ -0,0 +1,39 @@
+package subscription
+
+import (
+	"fmt"
+
+	errPkg "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/errors"
+)
+
+type ErrSelfSubscription struct{}
+
+func (e *ErrSelfSubscription) Error() string {
+	return "can't subscribe on yourself"
+}
+
+func (e *ErrSelfSubscription) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrSelfUnsubscription struct{}
+
+func (e *ErrSelfUnsubscription) Error() string {
+	return "can't unsubscribe from yourself"
+}
+
+func (e *ErrSelfUnsubscription) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
+
+type ErrInvalidFilter struct {
+	filter string
+}
+
+func (e *ErrInvalidFilter) Error() string {
+	return fmt.Sprintf("invalid filter: %s", e.filter)
+}
+
+func (e *ErrInvalidFilter) Type() errPkg.Type {
+	return errPkg.ErrInvalidInput
+}
diff --git a/internal/pkg/usecase/subscription/get.go b/internal/pkg/usecase/subscription/get.go
new file mode 100644
index 0000000..2217318
--- /dev/null
+++ b/internal/pkg/usecase/subscription/get.go
@@ -0,0 +1,33 @@
+package subscription
+
+import (
+	"context"
+
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
+)
+
+func (u *subscriptionUsecase) GetSubscriptionInfoForUser(ctx context.Context, subOpts *userEntity.SubscriptionOpts) ([]userEntity.SubscriptionUser, error) {
+	if err := u.userRepo.CheckUserExistence(ctx, subOpts.UserID); err != nil {
+		return nil, err
+	}
+
+	currUserID, _ := ctx.Value(auth.KeyCurrentUserID).(int)
+	var (
+		users []userEntity.SubscriptionUser
+		err   error
+	)
+	switch subOpts.Filter {
+	case "subscriptions":
+		users, err = u.subRepo.GetUserSubscriptions(ctx, subOpts.UserID, subOpts.Count, subOpts.LastID, currUserID)
+	case "subscribers":
+		users, err = u.subRepo.GetUserSubscribers(ctx, subOpts.UserID, subOpts.Count, subOpts.LastID, currUserID)
+	default:
+		return nil, &ErrInvalidFilter{subOpts.Filter}
+	}
+	if err != nil {
+		return nil, err
+	}
+
+	return users, nil
+}
diff --git a/internal/pkg/usecase/subscription/mock/subscription_mock.go b/internal/pkg/usecase/subscription/mock/subscription_mock.go
new file mode 100644
index 0000000..6d3aab8
--- /dev/null
+++ b/internal/pkg/usecase/subscription/mock/subscription_mock.go
@@ -0,0 +1,79 @@
+// Code generated by MockGen. DO NOT EDIT.
+// Source: usecase.go
+
+// Package mock is a generated GoMock package.
+package mock
+
+import (
+	context "context"
+	reflect "reflect"
+
+	user "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	gomock "github.com/golang/mock/gomock"
+)
+
+// MockUsecase is a mock of Usecase interface.
+type MockUsecase struct {
+	ctrl     *gomock.Controller
+	recorder *MockUsecaseMockRecorder
+}
+
+// MockUsecaseMockRecorder is the mock recorder for MockUsecase.
+type MockUsecaseMockRecorder struct {
+	mock *MockUsecase
+}
+
+// NewMockUsecase creates a new mock instance.
+func NewMockUsecase(ctrl *gomock.Controller) *MockUsecase {
+	mock := &MockUsecase{ctrl: ctrl}
+	mock.recorder = &MockUsecaseMockRecorder{mock}
+	return mock
+}
+
+// EXPECT returns an object that allows the caller to indicate expected use.
+func (m *MockUsecase) EXPECT() *MockUsecaseMockRecorder {
+	return m.recorder
+}
+
+// GetSubscriptionInfoForUser mocks base method.
+func (m *MockUsecase) GetSubscriptionInfoForUser(ctx context.Context, subOpts *user.SubscriptionOpts) ([]user.SubscriptionUser, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetSubscriptionInfoForUser", ctx, subOpts)
+	ret0, _ := ret[0].([]user.SubscriptionUser)
+	ret1, _ := ret[1].(error)
+	return ret0, ret1
+}
+
+// GetSubscriptionInfoForUser indicates an expected call of GetSubscriptionInfoForUser.
+func (mr *MockUsecaseMockRecorder) GetSubscriptionInfoForUser(ctx, subOpts interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetSubscriptionInfoForUser", reflect.TypeOf((*MockUsecase)(nil).GetSubscriptionInfoForUser), ctx, subOpts)
+}
+
+// SubscribeToUser mocks base method.
+func (m *MockUsecase) SubscribeToUser(ctx context.Context, from, to int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "SubscribeToUser", ctx, from, to)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// SubscribeToUser indicates an expected call of SubscribeToUser.
+func (mr *MockUsecaseMockRecorder) SubscribeToUser(ctx, from, to interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "SubscribeToUser", reflect.TypeOf((*MockUsecase)(nil).SubscribeToUser), ctx, from, to)
+}
+
+// UnsubscribeFromUser mocks base method.
+func (m *MockUsecase) UnsubscribeFromUser(ctx context.Context, from, to int) error {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "UnsubscribeFromUser", ctx, from, to)
+	ret0, _ := ret[0].(error)
+	return ret0
+}
+
+// UnsubscribeFromUser indicates an expected call of UnsubscribeFromUser.
+func (mr *MockUsecaseMockRecorder) UnsubscribeFromUser(ctx, from, to interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UnsubscribeFromUser", reflect.TypeOf((*MockUsecase)(nil).UnsubscribeFromUser), ctx, from, to)
+}
diff --git a/internal/pkg/usecase/subscription/usecase.go b/internal/pkg/usecase/subscription/usecase.go
new file mode 100644
index 0000000..d44b5bb
--- /dev/null
+++ b/internal/pkg/usecase/subscription/usecase.go
@@ -0,0 +1,27 @@
+package subscription
+
+import (
+	"context"
+
+	userEntity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	subRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/subscription"
+	uRepo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
+)
+
+//go:generate mockgen -destination=./mock/subscription_mock.go -package=mock -source=usecase.go Usecase
+type Usecase interface {
+	SubscribeToUser(ctx context.Context, from, to int) error
+	UnsubscribeFromUser(ctx context.Context, from, to int) error
+	GetSubscriptionInfoForUser(ctx context.Context, subOpts *userEntity.SubscriptionOpts) ([]userEntity.SubscriptionUser, error)
+}
+
+type subscriptionUsecase struct {
+	subRepo  subRepo.Repository
+	userRepo uRepo.Repository
+	log      *logger.Logger
+}
+
+func New(log *logger.Logger, subRepo subRepo.Repository, uRepo uRepo.Repository) Usecase {
+	return &subscriptionUsecase{subRepo: subRepo, userRepo: uRepo, log: log}
+}
diff --git a/internal/pkg/usecase/user/credentials.go b/internal/pkg/usecase/user/credentials.go
index c8d95d6..9e3857c 100644
--- a/internal/pkg/usecase/user/credentials.go
+++ b/internal/pkg/usecase/user/credentials.go
@@ -1,6 +1,9 @@
 package user
 
+//go:generate easyjson credentials.go
+
+//easyjson:json
 type UserCredentials struct {
-	Username string
-	Password string
+	Username string `json:"username"`
+	Password string `json:"password"`
 }
diff --git a/internal/pkg/usecase/user/credentials_easyjson.go b/internal/pkg/usecase/user/credentials_easyjson.go
new file mode 100644
index 0000000..d303bee
--- /dev/null
+++ b/internal/pkg/usecase/user/credentials_easyjson.go
@@ -0,0 +1,92 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package user
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjson5b679028DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(in *jlexer.Lexer, out *UserCredentials) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "username":
+			out.Username = string(in.String())
+		case "password":
+			out.Password = string(in.String())
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjson5b679028EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(out *jwriter.Writer, in UserCredentials) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix[1:])
+		out.String(string(in.Username))
+	}
+	{
+		const prefix string = ",\"password\":"
+		out.RawString(prefix)
+		out.String(string(in.Password))
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v UserCredentials) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjson5b679028EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v UserCredentials) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjson5b679028EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *UserCredentials) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjson5b679028DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *UserCredentials) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjson5b679028DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(l, v)
+}
diff --git a/internal/pkg/usecase/user/info.go b/internal/pkg/usecase/user/info.go
index 1993261..b504f5f 100644
--- a/internal/pkg/usecase/user/info.go
+++ b/internal/pkg/usecase/user/info.go
@@ -1,10 +1,13 @@
 package user
 
+//go:generate easyjson info.go
+
+//easyjson:json
 type ProfileUpdateData struct {
-	Username *string
-	Email    *string
-	Name     *string
-	Surname  *string
+	Username *string `json:"username"`
+	Email    *string `json:"email"`
+	Name     *string `json:"name"`
+	Surname  *string `json:"surname"`
 	AboutMe  *string `json:"about_me"`
-	Password *string
+	Password *string `json:"password"`
 }
diff --git a/internal/pkg/usecase/user/info_easyjson.go b/internal/pkg/usecase/user/info_easyjson.go
new file mode 100644
index 0000000..af29bb5
--- /dev/null
+++ b/internal/pkg/usecase/user/info_easyjson.go
@@ -0,0 +1,192 @@
+// Code generated by easyjson for marshaling/unmarshaling. DO NOT EDIT.
+
+package user
+
+import (
+	json "encoding/json"
+	easyjson "github.com/mailru/easyjson"
+	jlexer "github.com/mailru/easyjson/jlexer"
+	jwriter "github.com/mailru/easyjson/jwriter"
+)
+
+// suppress unused package warning
+var (
+	_ *json.RawMessage
+	_ *jlexer.Lexer
+	_ *jwriter.Writer
+	_ easyjson.Marshaler
+)
+
+func easyjsonDdc53814DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(in *jlexer.Lexer, out *ProfileUpdateData) {
+	isTopLevel := in.IsStart()
+	if in.IsNull() {
+		if isTopLevel {
+			in.Consumed()
+		}
+		in.Skip()
+		return
+	}
+	in.Delim('{')
+	for !in.IsDelim('}') {
+		key := in.UnsafeFieldName(false)
+		in.WantColon()
+		if in.IsNull() {
+			in.Skip()
+			in.WantComma()
+			continue
+		}
+		switch key {
+		case "username":
+			if in.IsNull() {
+				in.Skip()
+				out.Username = nil
+			} else {
+				if out.Username == nil {
+					out.Username = new(string)
+				}
+				*out.Username = string(in.String())
+			}
+		case "email":
+			if in.IsNull() {
+				in.Skip()
+				out.Email = nil
+			} else {
+				if out.Email == nil {
+					out.Email = new(string)
+				}
+				*out.Email = string(in.String())
+			}
+		case "name":
+			if in.IsNull() {
+				in.Skip()
+				out.Name = nil
+			} else {
+				if out.Name == nil {
+					out.Name = new(string)
+				}
+				*out.Name = string(in.String())
+			}
+		case "surname":
+			if in.IsNull() {
+				in.Skip()
+				out.Surname = nil
+			} else {
+				if out.Surname == nil {
+					out.Surname = new(string)
+				}
+				*out.Surname = string(in.String())
+			}
+		case "about_me":
+			if in.IsNull() {
+				in.Skip()
+				out.AboutMe = nil
+			} else {
+				if out.AboutMe == nil {
+					out.AboutMe = new(string)
+				}
+				*out.AboutMe = string(in.String())
+			}
+		case "password":
+			if in.IsNull() {
+				in.Skip()
+				out.Password = nil
+			} else {
+				if out.Password == nil {
+					out.Password = new(string)
+				}
+				*out.Password = string(in.String())
+			}
+		default:
+			in.SkipRecursive()
+		}
+		in.WantComma()
+	}
+	in.Delim('}')
+	if isTopLevel {
+		in.Consumed()
+	}
+}
+func easyjsonDdc53814EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(out *jwriter.Writer, in ProfileUpdateData) {
+	out.RawByte('{')
+	first := true
+	_ = first
+	{
+		const prefix string = ",\"username\":"
+		out.RawString(prefix[1:])
+		if in.Username == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Username))
+		}
+	}
+	{
+		const prefix string = ",\"email\":"
+		out.RawString(prefix)
+		if in.Email == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Email))
+		}
+	}
+	{
+		const prefix string = ",\"name\":"
+		out.RawString(prefix)
+		if in.Name == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Name))
+		}
+	}
+	{
+		const prefix string = ",\"surname\":"
+		out.RawString(prefix)
+		if in.Surname == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Surname))
+		}
+	}
+	{
+		const prefix string = ",\"about_me\":"
+		out.RawString(prefix)
+		if in.AboutMe == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.AboutMe))
+		}
+	}
+	{
+		const prefix string = ",\"password\":"
+		out.RawString(prefix)
+		if in.Password == nil {
+			out.RawString("null")
+		} else {
+			out.String(string(*in.Password))
+		}
+	}
+	out.RawByte('}')
+}
+
+// MarshalJSON supports json.Marshaler interface
+func (v ProfileUpdateData) MarshalJSON() ([]byte, error) {
+	w := jwriter.Writer{}
+	easyjsonDdc53814EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(&w, v)
+	return w.Buffer.BuildBytes(), w.Error
+}
+
+// MarshalEasyJSON supports easyjson.Marshaler interface
+func (v ProfileUpdateData) MarshalEasyJSON(w *jwriter.Writer) {
+	easyjsonDdc53814EncodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(w, v)
+}
+
+// UnmarshalJSON supports json.Unmarshaler interface
+func (v *ProfileUpdateData) UnmarshalJSON(data []byte) error {
+	r := jlexer.Lexer{Data: data}
+	easyjsonDdc53814DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(&r, v)
+	return r.Error()
+}
+
+// UnmarshalEasyJSON supports easyjson.Unmarshaler interface
+func (v *ProfileUpdateData) UnmarshalEasyJSON(l *jlexer.Lexer) {
+	easyjsonDdc53814DecodeGithubComGoParkMailRu20232ONDTeamInternalPkgUsecaseUser(l, v)
+}
diff --git a/internal/pkg/usecase/user/mock/user_mock.go b/internal/pkg/usecase/user/mock/user_mock.go
index 167e063..745c994 100644
--- a/internal/pkg/usecase/user/mock/user_mock.go
+++ b/internal/pkg/usecase/user/mock/user_mock.go
@@ -97,6 +97,39 @@ func (mr *MockUsecaseMockRecorder) GetAllProfileInfo(ctx, userID interface{}) *g
 	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetAllProfileInfo", reflect.TypeOf((*MockUsecase)(nil).GetAllProfileInfo), ctx, userID)
 }
 
+// GetProfileInfo mocks base method.
+func (m *MockUsecase) GetProfileInfo(ctx context.Context) (*user.User, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetProfileInfo", ctx)
+	ret0, _ := ret[0].(*user.User)
+	ret1, _ := ret[1].(int)
+	ret2, _ := ret[2].(error)
+	return ret0, ret1, ret2
+}
+
+// GetProfileInfo indicates an expected call of GetProfileInfo.
+func (mr *MockUsecaseMockRecorder) GetProfileInfo(ctx interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetProfileInfo", reflect.TypeOf((*MockUsecase)(nil).GetProfileInfo), ctx)
+}
+
+// GetUserInfo mocks base method.
+func (m *MockUsecase) GetUserInfo(ctx context.Context, userID int) (*user.User, bool, int, error) {
+	m.ctrl.T.Helper()
+	ret := m.ctrl.Call(m, "GetUserInfo", ctx, userID)
+	ret0, _ := ret[0].(*user.User)
+	ret1, _ := ret[1].(bool)
+	ret2, _ := ret[2].(int)
+	ret3, _ := ret[3].(error)
+	return ret0, ret1, ret2, ret3
+}
+
+// GetUserInfo indicates an expected call of GetUserInfo.
+func (mr *MockUsecaseMockRecorder) GetUserInfo(ctx, userID interface{}) *gomock.Call {
+	mr.mock.ctrl.T.Helper()
+	return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetUserInfo", reflect.TypeOf((*MockUsecase)(nil).GetUserInfo), ctx, userID)
+}
+
 // Register mocks base method.
 func (m *MockUsecase) Register(ctx context.Context, user *user.User) error {
 	m.ctrl.T.Helper()
diff --git a/internal/pkg/usecase/user/profile.go b/internal/pkg/usecase/user/profile.go
index 5cb4f34..414c4a0 100644
--- a/internal/pkg/usecase/user/profile.go
+++ b/internal/pkg/usecase/user/profile.go
@@ -7,6 +7,7 @@ import (
 	"io"
 
 	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
+	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/middleware/auth"
 	repository "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/crypto"
 	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/validator/image/check"
@@ -15,7 +16,7 @@ import (
 var ErrBadBody = errors.New("bad body avatar")
 
 func (u *userCase) UpdateUserAvatar(ctx context.Context, userID int, mimeTypeAvatar string, sizeAvatar int64, avatar io.Reader) error {
-	avatarProfile, err := u.UploadImage("avatars/", mimeTypeAvatar, sizeAvatar, avatar, check.BothSidesFallIntoRange(200, 1800))
+	avatarProfile, err := u.UploadImage(ctx, "avatars/", mimeTypeAvatar, sizeAvatar, avatar, check.BothSidesFallIntoRange(200, 1800))
 	if err != nil {
 		return fmt.Errorf("uploading an avatar when updating avatar profile: %w", err)
 	}
@@ -27,6 +28,15 @@ func (u *userCase) UpdateUserAvatar(ctx context.Context, userID int, mimeTypeAva
 	return nil
 }
 
+func (u *userCase) GetUserInfo(ctx context.Context, userID int) (user *entity.User, isSubscribed bool, subsCount int, err error) {
+	currUserID, _ := ctx.Value(auth.KeyCurrentUserID).(int)
+	return u.repo.GetUserData(ctx, userID, currUserID)
+}
+
+func (u *userCase) GetProfileInfo(ctx context.Context) (user *entity.User, subsCount int, err error) {
+	return u.repo.GetProfileData(ctx, ctx.Value(auth.KeyCurrentUserID).(int))
+}
+
 func (u *userCase) GetAllProfileInfo(ctx context.Context, userID int) (*entity.User, error) {
 	return u.repo.GetAllUserData(ctx, userID)
 }
diff --git a/internal/pkg/usecase/user/usecase.go b/internal/pkg/usecase/user/usecase.go
index 167860c..c9a3eb9 100644
--- a/internal/pkg/usecase/user/usecase.go
+++ b/internal/pkg/usecase/user/usecase.go
@@ -25,6 +25,8 @@ type Usecase interface {
 	FindOutUsernameAndAvatar(ctx context.Context, userID int) (username string, avatar string, err error)
 	UpdateUserAvatar(ctx context.Context, userID int, mimeTypeAvatar string, sizeAvatar int64, avatar io.Reader) error
 	GetAllProfileInfo(ctx context.Context, userID int) (*entity.User, error)
+	GetUserInfo(ctx context.Context, userID int) (user *entity.User, isSubscribed bool, subsCount int, err error)
+	GetProfileInfo(ctx context.Context) (user *entity.User, subsCount int, err error)
 	EditProfileInfo(ctx context.Context, userID int, updateData *ProfileUpdateData) error
 }
 
diff --git a/internal/pkg/validation/censor.go b/internal/pkg/validation/censor.go
new file mode 100644
index 0000000..4180389
--- /dev/null
+++ b/internal/pkg/validation/censor.go
@@ -0,0 +1,107 @@
+package validation
+
+import (
+	"encoding/base64"
+	"log"
+	"strings"
+
+	goaway "github.com/TwiN/go-away"
+)
+
+var additionalProfanity = []string{
+	"0YXRgw==",
+	"0L/QuNC30LTQsA==",
+	"0YfQu9C10L0=",
+	"0LLQsNCz0LjQvQ==",
+	"0LPQvtCy0L3Qvg==",
+	"0L/QsNGA0LDRiNCw",
+	"0YHRg9C60LA=",
+	"0L/QuNGB0YzQug==",
+	"0YHQuNGB0YzQug==",
+	"0LLQu9Cw0LPQsNC70LjRiQ==",
+	"0L/QtdC90LjRgQ==",
+	"0LHQu9GP0LTRjA==",
+	"0YjQu9GO0YU=",
+	"0L/RgNC+0YHRgtC40YLRg9GC0Lo=",
+	"0L3QuNCz0LXRgA==",
+	"0L3QtdCz0YA=",
+	"0YPQt9C60L7Qs9C70LDQt9GL",
+	"0YXQtdGA",
+	"0LXQsdCw0YLRjA==",
+	"0YPQtdCx0LDQvQ==",
+	"0YPQtdCx0L7Qug==",
+	"0YLRgNCw0YXQsNGC0Yw=",
+	"0YLQstCw0YDRjA==",
+	"0L/QuNC00YA=",
+	"0YPRgNC+0LQ=",
+	"0L/QuNC30LTQtdGG",
+	"0YXRg9GP",
+	"0LfQsNC70YPQvw==",
+	"0L/QuNC00LDRgNCw0YE=",
+	"0LvQvtGF",
+	"0LPQsNC90LTQvtC9",
+	"0LTRgNC+0YfQuNGC0Yw=",
+	"0LDQvdCw0Ls=",
+	"0LbQvtC/0LA=",
+	"0LPQvdC40LTQsA==",
+	"0YPRiNC70LXQv9C+0Lo=",
+	"0YHRg9GH0LXQvdGL0Yg=",
+	"0YHQv9C10YDQvNCw",
+	"0LHQu9GP0YLRjA==",
+	"0L/QvtGA0L3Qvg==",
+	"0YHRgNCw0YLRjA==",
+	"0YfQvNC+",
+	"0LTQtdCx0LjQuw==",
+	"0LrRgNC10YLQuNC9",
+	"cGl6ZGE=",
+	"0LXQsdCw0Ls=",
+	"0LPQsNCy0L3Qvg==",
+	"0LPQvtC90LTQvtC9",
+	"0YXRg9C1",
+	"0LXQsdCw0L0=",
+	"0LXQsdC70LDQvQ==",
+	"0LXQsdGD0YfQuA==",
+	"0LXQsdC70LjQstGL",
+	"0L/QuNC00YDQuNC7",
+	"0L/QvtGA0L3Rg9GF0LA=",
+	"0LXQsdC70Y8=",
+	"0YPQtdCx0LjRidC90Ys=",
+}
+
+func GetLabels() []string {
+	decodedLabels := make([]string, 0, len(additionalProfanity))
+	for _, badEncoded := range additionalProfanity {
+		decoded, err := base64.StdEncoding.DecodeString(badEncoded)
+		if err != nil {
+			log.Println(err)
+		}
+		decodedLabels = append(decodedLabels, string(decoded))
+	}
+	return decodedLabels
+}
+
+type ProfanityCensor interface {
+	IsProfane(string) bool
+	Sanitize(string) string
+}
+
+type defaultCensor struct {
+	censor *goaway.ProfanityDetector
+}
+
+func (c *defaultCensor) IsProfane(s string) bool {
+	for _, word := range strings.Fields(s) {
+		if c.censor.IsProfane(strings.ToLower(word)) {
+			return true
+		}
+	}
+	return false
+}
+
+func (c *defaultCensor) Sanitize(s string) string {
+	return c.censor.Censor(s)
+}
+
+func NewCensor(censor *goaway.ProfanityDetector) ProfanityCensor {
+	return &defaultCensor{censor}
+}
diff --git a/internal/pkg/validation/xss.go b/internal/pkg/validation/xss.go
new file mode 100644
index 0000000..5ecce98
--- /dev/null
+++ b/internal/pkg/validation/xss.go
@@ -0,0 +1,19 @@
+package validation
+
+import "github.com/microcosm-cc/bluemonday"
+
+type SanitizerXSS interface {
+	Sanitize(string) string
+}
+
+type bluemondaySanitizer struct {
+	sanitizer *bluemonday.Policy
+}
+
+func (san *bluemondaySanitizer) Sanitize(s string) string {
+	return san.sanitizer.Sanitize(s)
+}
+
+func NewSanitizerXSS(sanitizer *bluemonday.Policy) SanitizerXSS {
+	return &bluemondaySanitizer{sanitizer}
+}
diff --git a/internal/usecases/pin/usecase.go b/internal/usecases/pin/usecase.go
deleted file mode 100644
index 2dbec72..0000000
--- a/internal/usecases/pin/usecase.go
+++ /dev/null
@@ -1,29 +0,0 @@
-package pin
-
-import (
-	"context"
-
-	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/pin"
-	repo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/pin"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-type Usecase struct {
-	log  *logger.Logger
-	repo repo.Repository
-}
-
-func New(log *logger.Logger, repo repo.Repository) *Usecase {
-	return &Usecase{log, repo}
-}
-
-func (u *Usecase) SelectNewPins(ctx context.Context, count, lastID int) ([]entity.Pin, int) {
-	pins, err := u.repo.GetSortedNPinsAfterID(ctx, count, lastID)
-	if err != nil {
-		u.log.Error(err.Error())
-	}
-	if len(pins) == 0 {
-		return []entity.Pin{}, lastID
-	}
-	return pins, pins[len(pins)-1].ID
-}
diff --git a/internal/usecases/pin/usecase_test.go b/internal/usecases/pin/usecase_test.go
deleted file mode 100644
index fa58f07..0000000
--- a/internal/usecases/pin/usecase_test.go
+++ /dev/null
@@ -1,48 +0,0 @@
-package pin
-
-import (
-	"context"
-	"math/rand"
-	"strconv"
-	"testing"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/stretchr/testify/require"
-)
-
-func TestSelectNewPins(t *testing.T) {
-	log, _ := logger.New(logger.RFC3339FormatTime())
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	pinCase := New(log, ramrepo.NewRamPinRepo(db))
-
-	testCases := []struct {
-		name          string
-		count, lastID int
-		expNewLastID  int
-	}{
-		{
-			name:         "provide correct count and lastID",
-			count:        2,
-			lastID:       1,
-			expNewLastID: 3,
-		},
-		{
-			name:         "provide incorrect count",
-			count:        -2,
-			lastID:       1,
-			expNewLastID: 1,
-		},
-	}
-
-	for _, tCase := range testCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			_, actualLastID := pinCase.SelectNewPins(context.Background(), tCase.count, tCase.lastID)
-			require.Equal(t, tCase.expNewLastID, actualLastID)
-		})
-	}
-}
diff --git a/internal/usecases/session/manager.go b/internal/usecases/session/manager.go
deleted file mode 100644
index a7a3b8e..0000000
--- a/internal/usecases/session/manager.go
+++ /dev/null
@@ -1,61 +0,0 @@
-package session
-
-import (
-	"context"
-	"errors"
-	"fmt"
-	"time"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/session"
-	repo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/session"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/crypto"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-const SessionLifeTime = 30 * 24 * time.Hour
-
-const lenSessionKey = 16
-
-var ErrExpiredSession = errors.New("session lifetime expired")
-
-type SessionManager struct {
-	log  *logger.Logger
-	repo repo.Repository
-}
-
-func New(log *logger.Logger, repo repo.Repository) *SessionManager {
-	return &SessionManager{log, repo}
-}
-
-func (sm *SessionManager) CreateNewSessionForUser(ctx context.Context, userID int) (*session.Session, error) {
-	sessionKey, err := crypto.NewRandomString(lenSessionKey)
-	if err != nil {
-		return nil, fmt.Errorf("session key generation for new session: %w", err)
-	}
-
-	session := &session.Session{
-		Key:    sessionKey,
-		UserID: userID,
-		Expire: time.Now().UTC().Add(SessionLifeTime),
-	}
-	err = sm.repo.AddSession(ctx, session)
-	if err != nil {
-		return nil, fmt.Errorf("creating a new session by the session manager: %w", err)
-	}
-	return session, nil
-}
-
-func (sm *SessionManager) GetUserIDBySessionKey(ctx context.Context, sessionKey string) (int, error) {
-	session, err := sm.repo.GetSessionByKey(ctx, sessionKey)
-	if err != nil {
-		return 0, fmt.Errorf("getting a session by a manager: %w", err)
-	}
-	if time.Now().UTC().After(session.Expire) {
-		return 0, ErrExpiredSession
-	}
-	return session.UserID, nil
-}
-
-func (sm *SessionManager) DeleteUserSession(ctx context.Context, key string) error {
-	return sm.repo.DeleteSessionByKey(ctx, key)
-}
diff --git a/internal/usecases/session/manager_test.go b/internal/usecases/session/manager_test.go
deleted file mode 100644
index 89a3633..0000000
--- a/internal/usecases/session/manager_test.go
+++ /dev/null
@@ -1,53 +0,0 @@
-package session
-
-import (
-	"context"
-	"fmt"
-	"math/rand"
-	"strconv"
-	"testing"
-
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/stretchr/testify/require"
-)
-
-func TestGetUserIDBySessionKey(t *testing.T) {
-	log, err := logger.New(logger.RFC3339FormatTime())
-	if err != nil {
-		fmt.Println(err)
-		return
-	}
-	defer log.Sync()
-
-	db, err := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	if err != nil {
-		log.Error(err.Error())
-		return
-	}
-	defer db.Close()
-
-	sm := New(log, ramrepo.NewRamSessionRepo(db))
-
-	testCases := []struct {
-		name        string
-		session_key string
-		expUserId   int
-		expErr      error
-	}{
-		{
-			"providing valid session key",
-			"461afabf38b3147c",
-			1,
-			nil,
-		},
-	}
-
-	for _, tCase := range testCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			id, err := sm.GetUserIDBySessionKey(context.Background(), tCase.session_key)
-			require.Equal(t, tCase.expErr, err)
-			require.Equal(t, tCase.expUserId, id)
-		})
-	}
-}
diff --git a/internal/usecases/user/credentials.go b/internal/usecases/user/credentials.go
deleted file mode 100644
index 9b5646b..0000000
--- a/internal/usecases/user/credentials.go
+++ /dev/null
@@ -1,10 +0,0 @@
-package user
-
-type userCredentials struct {
-	Username string
-	Password string
-}
-
-func NewCredentials() userCredentials {
-	return userCredentials{}
-}
diff --git a/internal/usecases/user/usecase.go b/internal/usecases/user/usecase.go
deleted file mode 100644
index b9cd907..0000000
--- a/internal/usecases/user/usecase.go
+++ /dev/null
@@ -1,59 +0,0 @@
-package user
-
-import (
-	"context"
-	"errors"
-	"fmt"
-
-	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
-	repo "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/user"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/crypto"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-)
-
-var ErrUserAuthentication = errors.New("user authentication")
-
-const (
-	lenSalt         = 16
-	lenPasswordHash = 64
-)
-
-type Usecase struct {
-	log  *logger.Logger
-	repo repo.Repository
-}
-
-func New(log *logger.Logger, repo repo.Repository) *Usecase {
-	return &Usecase{log, repo}
-}
-
-func (u *Usecase) Register(ctx context.Context, user *entity.User) error {
-	salt, err := crypto.NewRandomString(lenSalt)
-	if err != nil {
-		return fmt.Errorf("generating salt for registration: %w", err)
-	}
-
-	user.Password = salt + crypto.PasswordHash(user.Password, salt, lenPasswordHash)
-	err = u.repo.AddNewUser(ctx, user)
-	if err != nil {
-		return fmt.Errorf("user registration: %w", err)
-	}
-	return nil
-}
-
-func (u *Usecase) Authentication(ctx context.Context, credentials userCredentials) (*entity.User, error) {
-	user, err := u.repo.GetUserByUsername(ctx, credentials.Username)
-	if err != nil {
-		return nil, fmt.Errorf("user authentication: %w", err)
-	}
-	salt := user.Password[:lenSalt]
-	if crypto.PasswordHash(credentials.Password, salt, lenPasswordHash) != user.Password[lenSalt:] {
-		return nil, ErrUserAuthentication
-	}
-	user.Password = ""
-	return user, nil
-}
-
-func (u *Usecase) FindOutUsernameAndAvatar(ctx context.Context, userID int) (username string, avatar string, err error) {
-	return u.repo.GetUsernameAndAvatarByID(ctx, userID)
-}
diff --git a/internal/usecases/user/usecase_test.go b/internal/usecases/user/usecase_test.go
deleted file mode 100644
index 9fabfad..0000000
--- a/internal/usecases/user/usecase_test.go
+++ /dev/null
@@ -1,51 +0,0 @@
-package user
-
-import (
-	"context"
-	"fmt"
-	"math/rand"
-	"strconv"
-	"testing"
-
-	entity "github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/entity/user"
-	"github.com/go-park-mail-ru/2023_2_OND_team/internal/pkg/repository/ramrepo"
-	"github.com/go-park-mail-ru/2023_2_OND_team/pkg/logger"
-	"github.com/stretchr/testify/require"
-)
-
-func TestRegister(t *testing.T) {
-	log, err := logger.New(logger.RFC3339FormatTime())
-	if err != nil {
-		fmt.Println(err)
-		return
-	}
-	defer log.Sync()
-
-	db, _ := ramrepo.OpenDB(strconv.FormatInt(int64(rand.Int()), 10))
-	defer db.Close()
-
-	userCase := New(log, ramrepo.NewRamUserRepo(db))
-
-	testCases := []struct {
-		name   string
-		user   *entity.User
-		expErr error
-	}{
-		{
-			"providing valid user",
-			&entity.User{
-				Username: "valid_user",
-				Password: "helloworld",
-				Email:    "gggg@yandex.ru",
-			},
-			nil,
-		},
-	}
-
-	for _, tCase := range testCases {
-		t.Run(tCase.name, func(t *testing.T) {
-			err := userCase.Register(context.Background(), tCase.user)
-			require.Equal(t, tCase.expErr, err)
-		})
-	}
-}
diff --git a/pkg/levenstein/levenstein.go b/pkg/levenstein/levenstein.go
new file mode 100644
index 0000000..c03a020
--- /dev/null
+++ b/pkg/levenstein/levenstein.go
@@ -0,0 +1,37 @@
+package levenstein
+
+func Levenshtein(s1, s2 []rune) int {
+	col := make([]int, len(s1)+1)
+
+	for y := 1; y <= len(s1); y++ {
+		col[y] = y
+	}
+	for x := 1; x <= len(s2); x++ {
+		col[0] = x
+		lastkey := x - 1
+		for y := 1; y <= len(s1); y++ {
+			oldkey := col[y]
+			var incr int
+			if s1[y-1] != s2[x-1] {
+				incr = 1
+			}
+
+			col[y] = min(col[y]+1, col[y-1]+1, lastkey+incr)
+			lastkey = oldkey
+		}
+	}
+	return col[len(s1)]
+}
+
+func min(a, b, c int) int {
+	if a < b {
+		if a < c {
+			return a
+		}
+	} else {
+		if b < c {
+			return b
+		}
+	}
+	return c
+}
diff --git a/pkg/logger/logger.go b/pkg/logger/logger.go
index 1220cd9..a6d4f1a 100644
--- a/pkg/logger/logger.go
+++ b/pkg/logger/logger.go
@@ -1,6 +1,7 @@
 package logger
 
 import (
+	"context"
 	"fmt"
 
 	"go.uber.org/zap"
@@ -105,3 +106,10 @@ func (log *Logger) multiLevelSugarLog(logFn zapSugarLogFn, template string, args
 	}
 	logFn(log.Logger.Sugar().With(fieldsSugarLogger...), template, args...)
 }
+
+func GetLoggerFromCtx(ctx context.Context) *Logger {
+	if log, ok := ctx.Value(KeyLogger).(*Logger); ok {
+		return log
+	}
+	return &Logger{}
+}
diff --git a/pkg/logger/option.go b/pkg/logger/option.go
index 96db06c..9639478 100644
--- a/pkg/logger/option.go
+++ b/pkg/logger/option.go
@@ -18,3 +18,15 @@ func SetFormatTime(layout string) ConfigOption {
 func RFC3339FormatTime() ConfigOption {
 	return SetFormatTime(time.RFC3339)
 }
+
+func SetOutputPaths(files ...string) ConfigOption {
+	return func(cfg *zap.Config) {
+		cfg.OutputPaths = files
+	}
+}
+
+func SetErrorOutputPaths(files ...string) ConfigOption {
+	return func(cfg *zap.Config) {
+		cfg.ErrorOutputPaths = files
+	}
+}